diff options
| author | git perforce import user <a@b> | 2016-10-25 12:29:14 -0600 |
|---|---|---|
| committer | Sheikh Dawood Abdul Ajees <Sheikh Dawood Abdul Ajees> | 2016-10-25 18:56:37 -0500 |
| commit | 3dfe2108cfab31ba3ee5527e217d0d8e99a51162 (patch) | |
| tree | fa6485c169e50d7415a651bf838f5bcd0fd3bfbd /PhysX_3.4/Source/PhysXCooking | |
| download | physx-3.4-3dfe2108cfab31ba3ee5527e217d0d8e99a51162.tar.xz physx-3.4-3dfe2108cfab31ba3ee5527e217d0d8e99a51162.zip | |
Initial commit:
PhysX 3.4.0 Update @ 21294896
APEX 1.4.0 Update @ 21275617
[CL 21300167]
Diffstat (limited to 'PhysX_3.4/Source/PhysXCooking')
40 files changed, 16295 insertions, 0 deletions
diff --git a/PhysX_3.4/Source/PhysXCooking/src/Adjacencies.cpp b/PhysX_3.4/Source/PhysXCooking/src/Adjacencies.cpp new file mode 100644 index 00000000..63797c1a --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/Adjacencies.cpp @@ -0,0 +1,712 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + +#include "foundation/PxMemory.h" +#include "EdgeList.h" +#include "Adjacencies.h" +#include "CmRadixSortBuffered.h" +#include "GuSerialize.h" +#include "PsFoundation.h" + +using namespace physx; +using namespace Gu; + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +/** + * Flips the winding. + */ +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +void AdjTriangle::Flip() +{ +#ifdef MSH_ADJACENCIES_INCLUDE_TOPOLOGY + // Call the Triangle method + IndexedTriangle::Flip(); +#endif + + // Flip links. We flipped vertex references 1 & 2, i.e. links 0 & 1. + physx::shdfnd::swap(mATri[0], mATri[1]); +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +/** + * Computes the number of boundary edges in a triangle. + * \return the number of boundary edges. (0 => 3) + */ +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +PxU32 AdjTriangle::ComputeNbBoundaryEdges() const +{ + // Look for boundary edges + PxU32 Nb = 0; + if(IS_BOUNDARY(mATri[0])) Nb++; + if(IS_BOUNDARY(mATri[1])) Nb++; + if(IS_BOUNDARY(mATri[2])) Nb++; + return Nb; +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +/** + * Computes the number of valid neighbors. + * \return the number of neighbors. (0 => 3) + */ +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +PxU32 AdjTriangle::ComputeNbNeighbors() const +{ + PxU32 Nb = 0; + if(!IS_BOUNDARY(mATri[0])) Nb++; + if(!IS_BOUNDARY(mATri[1])) Nb++; + if(!IS_BOUNDARY(mATri[2])) Nb++; + return Nb; +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +/** + * Checks whether the triangle has a particular neighbor or not. + * \param tref [in] the triangle reference to look for + * \param index [out] the corresponding index in the triangle (NULL if not needed) + * \return true if the triangle has the given neighbor + */ +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +bool AdjTriangle::HasNeighbor(PxU32 tref, PxU32* index) const +{ + // ### could be optimized + if(!IS_BOUNDARY(mATri[0]) && MAKE_ADJ_TRI(mATri[0])==tref) { if(index) *index = 0; return true; } + if(!IS_BOUNDARY(mATri[1]) && MAKE_ADJ_TRI(mATri[1])==tref) { if(index) *index = 1; return true; } + if(!IS_BOUNDARY(mATri[2]) && MAKE_ADJ_TRI(mATri[2])==tref) { if(index) *index = 2; return true; } + return false; +} + + + + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +/** + * Constructor. + */ +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +Adjacencies::Adjacencies() : mNbFaces(0), mFaces(NULL) +{ +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +/** + * Destructor. + */ +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +Adjacencies::~Adjacencies() +{ + PX_DELETE_ARRAY(mFaces); +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +/** + * Computes the number of boundary edges. + * \return the number of boundary edges. + */ +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +PxU32 Adjacencies::ComputeNbBoundaryEdges() const +{ + // Checking + if(!mFaces) return 0; + + // Look for boundary edges + PxU32 Nb = 0; + for(PxU32 i=0;i<mNbFaces;i++) + { + AdjTriangle* CurTri = &mFaces[i]; + Nb+=CurTri->ComputeNbBoundaryEdges(); + } + return Nb; +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +/** + * Computes the boundary vertices. A boundary vertex is defined as a vertex shared by at least one boundary edge. + * \param nb_verts [in] the number of vertices + * \param bound_status [out] a user-provided array of bool + * \return true if success. The user-array is filled with true or false (boundary vertex / not boundary vertex) + */ +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +#ifdef MSH_ADJACENCIES_INCLUDE_TOPOLOGY +bool Adjacencies::GetBoundaryVertices(PxU32 nb_verts, bool* bound_status) const +#else +bool Adjacencies::GetBoundaryVertices(PxU32 nb_verts, bool* bound_status, const Gu::TriangleT<PxU32>* faces) const +#endif +{ + // We need the adjacencies + if(!mFaces || !bound_status || !nb_verts) + { + Ps::getFoundation().error(PxErrorCode::eINVALID_OPERATION, __FILE__, __LINE__, "Adjacencies::GetBoundaryVertices: NULL parameter!"); + return false; + } + +#ifndef MSH_ADJACENCIES_INCLUDE_TOPOLOGY + if(!faces) + { + Ps::getFoundation().error(PxErrorCode::eINVALID_OPERATION, __FILE__, __LINE__, "Adjacencies::GetBoundaryVertices: NULL parameter!"); + return false; + } +#endif + + // Init + PxMemZero(bound_status, nb_verts*sizeof(bool)); + + // Loop through faces + for(PxU32 i=0;i<mNbFaces;i++) + { + AdjTriangle* CurTri = &mFaces[i]; + if(IS_BOUNDARY(CurTri->mATri[0])) + { + // Two boundary vertices: 0 - 1 +#ifdef MSH_ADJACENCIES_INCLUDE_TOPOLOGY + PxU32 VRef0 = CurTri->v[0]; if(VRef0>=nb_verts) return false; bound_status[VRef0] = true; + PxU32 VRef1 = CurTri->v[1]; if(VRef1>=nb_verts) return false; bound_status[VRef1] = true; +#else + PxU32 VRef0 = faces[i].v[0]; if(VRef0>=nb_verts) return false; bound_status[VRef0] = true; + PxU32 VRef1 = faces[i].v[1]; if(VRef1>=nb_verts) return false; bound_status[VRef1] = true; +#endif + } + if(IS_BOUNDARY(CurTri->mATri[1])) + { + // Two boundary vertices: 0 - 2 +#ifdef MSH_ADJACENCIES_INCLUDE_TOPOLOGY + PxU32 VRef0 = CurTri->v[0]; if(VRef0>=nb_verts) return false; bound_status[VRef0] = true; + PxU32 VRef1 = CurTri->v[2]; if(VRef1>=nb_verts) return false; bound_status[VRef1] = true; +#else + PxU32 VRef0 = faces[i].v[0]; if(VRef0>=nb_verts) return false; bound_status[VRef0] = true; + PxU32 VRef1 = faces[i].v[2]; if(VRef1>=nb_verts) return false; bound_status[VRef1] = true; +#endif + } + if(IS_BOUNDARY(CurTri->mATri[2])) + { + // Two boundary vertices: 1 - 2 +#ifdef MSH_ADJACENCIES_INCLUDE_TOPOLOGY + PxU32 VRef0 = CurTri->v[1]; if(VRef0>=nb_verts) return false; bound_status[VRef0] = true; + PxU32 VRef1 = CurTri->v[2]; if(VRef1>=nb_verts) return false; bound_status[VRef1] = true; +#else + PxU32 VRef0 = faces[i].v[1]; if(VRef0>=nb_verts) return false; bound_status[VRef0] = true; + PxU32 VRef1 = faces[i].v[2]; if(VRef1>=nb_verts) return false; bound_status[VRef1] = true; +#endif + } + } + + return true; +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +/** + * Assigns a new edge code to the counterpart link of a given link. + * \param link [in] the link to modify - shouldn't be a boundary link + * \param edge_nb [in] the new edge number + */ +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +void Adjacencies::AssignNewEdgeCode(PxU32 link, PxU8 edge_nb) +{ + if(!IS_BOUNDARY(link)) + { + PxU32 Id = MAKE_ADJ_TRI(link); // Triangle ID + PxU32 Edge = GET_EDGE_NB(link); // Counterpart edge ID + AdjTriangle* Tri = &mFaces[Id]; // Adjacent triangle + + // Get link whose edge code is invalid + PxU32 AdjLink = Tri->mATri[Edge]; // Link to ourself (i.e. to 'link') + SET_EDGE_NB(AdjLink, edge_nb); // Assign new edge code + Tri->mATri[Edge] = AdjLink; // Put link back + } +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +/** + * Modifies the existing database so that reference 'vref' of triangle 'curtri' becomes the last one. + * Provided reference must already exist in provided triangle. + * \param cur_tri [in] the triangle + * \param vref [in] the reference + * \return true if success. + */ +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +#ifdef MSH_ADJACENCIES_INCLUDE_TOPOLOGY +bool Adjacencies::MakeLastRef(AdjTriangle& cur_tri, PxU32 vref) +#else +bool Adjacencies::MakeLastRef(AdjTriangle& cur_tri, PxU32 vref, Gu::TriangleT<PxU32>* cur_topo) +#endif +{ +#ifndef MSH_ADJACENCIES_INCLUDE_TOPOLOGY + // Checkings + if(!cur_topo) + { + Ps::getFoundation().error(PxErrorCode::eINVALID_OPERATION, __FILE__, __LINE__, "Adjacencies::MakeLastRef: NULL parameter!"); + return false; + } +#endif + // We want pattern (x y vref) + // Edge 0-1 is (x y) + // Edge 0-2 is (x vref) + // Edge 1-2 is (y vref) + + // First thing is to scroll the existing references in order for vref to become the last one. Scrolling assures winding order is conserved. + + // Edge code need fixing as well: + // The two MSB for each link encode the counterpart edge in adjacent triangle. We swap the link positions, but adjacent triangles remain the + // same. In other words, edge codes are still valid for current triangle since counterpart edges have not been swapped. *BUT* edge codes of + // the three possible adjacent triangles *are* now invalid. We need to fix edge codes, but for adjacent triangles... + +#ifdef MSH_ADJACENCIES_INCLUDE_TOPOLOGY + if(cur_tri.v[0]==vref) +#else + if(cur_topo->v[0]==vref) +#endif + { + // Pattern is (vref x y) + // Edge 0-1 is (vref x) + // Edge 0-2 is (vref y) + // Edge 1-2 is (x y) + + // Catch original data +#ifdef MSH_ADJACENCIES_INCLUDE_TOPOLOGY + PxU32 Ref0 = cur_tri.v[0]; PxU32 Link01 = cur_tri.mATri[0]; + PxU32 Ref1 = cur_tri.v[1]; PxU32 Link02 = cur_tri.mATri[1]; + PxU32 Ref2 = cur_tri.v[2]; PxU32 Link12 = cur_tri.mATri[2]; + + // Swap + cur_tri.v[0] = Ref1; + cur_tri.v[1] = Ref2; + cur_tri.v[2] = Ref0; +#else + PxU32 Ref0 = cur_topo->v[0]; PxU32 Link01 = cur_tri.mATri[0]; + PxU32 Ref1 = cur_topo->v[1]; PxU32 Link02 = cur_tri.mATri[1]; + PxU32 Ref2 = cur_topo->v[2]; PxU32 Link12 = cur_tri.mATri[2]; + + // Swap + cur_topo->v[0] = Ref1; + cur_topo->v[1] = Ref2; + cur_topo->v[2] = Ref0; +#endif + cur_tri.mATri[0] = Link12; // Edge 0-1 now encodes Ref1-Ref2, i.e. previous Link12 + cur_tri.mATri[1] = Link01; // Edge 0-2 now encodes Ref1-Ref0, i.e. previous Link01 + cur_tri.mATri[2] = Link02; // Edge 1-2 now encodes Ref2-Ref0, i.e. previous Link02 + + // Fix edge codes + AssignNewEdgeCode(Link01, 1); + AssignNewEdgeCode(Link02, 2); + AssignNewEdgeCode(Link12, 0); + + return true; + } +#ifdef MSH_ADJACENCIES_INCLUDE_TOPOLOGY + else if(cur_tri.v[1]==vref) +#else + else if(cur_topo->v[1]==vref) +#endif + { + // Pattern is (x vref y) + // Edge 0-1 is (x vref) + // Edge 0-2 is (x y) + // Edge 1-2 is (vref y) + + // Catch original data +#ifdef MSH_ADJACENCIES_INCLUDE_TOPOLOGY + PxU32 Ref0 = cur_tri.v[0]; PxU32 Link01 = cur_tri.mATri[0]; + PxU32 Ref1 = cur_tri.v[1]; PxU32 Link02 = cur_tri.mATri[1]; + PxU32 Ref2 = cur_tri.v[2]; PxU32 Link12 = cur_tri.mATri[2]; + + // Swap + cur_tri.v[0] = Ref2; + cur_tri.v[1] = Ref0; + cur_tri.v[2] = Ref1; +#else + PxU32 Ref0 = cur_topo->v[0]; PxU32 Link01 = cur_tri.mATri[0]; + PxU32 Ref1 = cur_topo->v[1]; PxU32 Link02 = cur_tri.mATri[1]; + PxU32 Ref2 = cur_topo->v[2]; PxU32 Link12 = cur_tri.mATri[2]; + + // Swap + cur_topo->v[0] = Ref2; + cur_topo->v[1] = Ref0; + cur_topo->v[2] = Ref1; +#endif + cur_tri.mATri[0] = Link02; // Edge 0-1 now encodes Ref2-Ref0, i.e. previous Link02 + cur_tri.mATri[1] = Link12; // Edge 0-2 now encodes Ref2-Ref1, i.e. previous Link12 + cur_tri.mATri[2] = Link01; // Edge 1-2 now encodes Ref0-Ref1, i.e. previous Link01 + + // Fix edge codes + AssignNewEdgeCode(Link01, 2); + AssignNewEdgeCode(Link02, 0); + AssignNewEdgeCode(Link12, 1); + + return true; + } +#ifdef MSH_ADJACENCIES_INCLUDE_TOPOLOGY + else if(cur_tri.v[2]==vref) +#else + else if(cur_topo->v[2]==vref) +#endif + { + // Nothing to do, provided reference already is the last one + return true; + } + + // Here the provided reference doesn't belong to the provided triangle. + return false; +} + +bool Adjacencies::Load(PxInputStream& stream) +{ + // Import header + PxU32 Version; + bool Mismatch; + if(!ReadHeader('A', 'D', 'J', 'A', Version, Mismatch, stream)) + return false; + + // Import adjacencies + mNbFaces = readDword(Mismatch, stream); + mFaces = PX_NEW(AdjTriangle)[mNbFaces]; + stream.read(mFaces, sizeof(AdjTriangle)*mNbFaces); + + return true; +} + +//#ifdef PX_COOKING + + //! An edge class used to compute the adjacency structures. + class AdjEdge : public Gu::EdgeData, public Ps::UserAllocated + { + public: + //! Constructor + PX_INLINE AdjEdge() {} + //! Destructor + PX_INLINE ~AdjEdge() {} + + PxU32 mFaceNb; //!< Owner face + }; + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + /** + * Adds a new edge to the database. + * \param ref0 [in] vertex reference for the new edge + * \param ref1 [in] vertex reference for the new edge + * \param face [in] owner face + */ + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + static void AddEdge(PxU32 ref0, PxU32 ref1, PxU32 face, PxU32& nb_edges, AdjEdge* edges) + { + // Store edge data + edges[nb_edges].Ref0 = ref0; + edges[nb_edges].Ref1 = ref1; + edges[nb_edges].mFaceNb = face; + nb_edges++; + } + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + /** + * Adds a new triangle to the database. + * \param ref0 [in] vertex reference for the new triangle + * \param ref1 [in] vertex reference for the new triangle + * \param ref2 [in] vertex reference for the new triangle + * \param id [in] triangle index + */ + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + static void AddTriangle(PxU32 ref0, PxU32 ref1, PxU32 ref2, PxU32 id, AdjTriangle* faces, PxU32& nb_edges, AdjEdge* edges) + { +#ifdef MSH_ADJACENCIES_INCLUDE_TOPOLOGY + // Store vertex-references + faces[id].v[0] = ref0; + faces[id].v[1] = ref1; + faces[id].v[2] = ref2; +#endif + // Reset links + faces[id].mATri[0] = PX_INVALID_U32; + faces[id].mATri[1] = PX_INVALID_U32; + faces[id].mATri[2] = PX_INVALID_U32; + + // Add edge 01 to database + if(ref0<ref1) AddEdge(ref0, ref1, id, nb_edges, edges); + else AddEdge(ref1, ref0, id, nb_edges, edges); + // Add edge 02 to database + if(ref0<ref2) AddEdge(ref0, ref2, id, nb_edges, edges); + else AddEdge(ref2, ref0, id, nb_edges, edges); + // Add edge 12 to database + if(ref1<ref2) AddEdge(ref1, ref2, id, nb_edges, edges); + else AddEdge(ref2, ref1, id, nb_edges, edges); + } + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + /** + * Updates the links in two adjacent triangles. + * \param first_tri [in] index of the first triangle + * \param second_tri [in] index of the second triangle + * \param ref0 [in] the common edge's first vertex reference + * \param ref1 [in] the common edge's second vertex reference + * \return true if success. + */ + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +#ifdef MSH_ADJACENCIES_INCLUDE_TOPOLOGY + static bool UpdateLink(PxU32 first_tri, PxU32 second_tri, PxU32 ref0, PxU32 ref1, AdjTriangle* faces) +#else + static bool UpdateLink(PxU32 first_tri, PxU32 second_tri, PxU32 ref0, PxU32 ref1, AdjTriangle* faces, const ADJACENCIESCREATE& create) +#endif + { +#ifdef MSH_ADJACENCIES_INCLUDE_TOPOLOGY + AdjTriangle& Tri0 = faces[first_tri]; // Catch the first triangle + AdjTriangle& Tri1 = faces[second_tri]; // Catch the second triangle + + // Get the edge IDs. 0xff means input references are wrong. + PxU8 EdgeNb0 = Tri0.FindEdge(ref0, ref1); if(EdgeNb0==0xff) return SetIceError("Adjacencies::UpdateLink: invalid edge reference in first triangle"); + PxU8 EdgeNb1 = Tri1.FindEdge(ref0, ref1); if(EdgeNb1==0xff) return SetIceError("Adjacencies::UpdateLink: invalid edge reference in second triangle"); + + // Update links. The two most significant bits contain the counterpart edge's ID. + Tri0.mATri[EdgeNb0] = second_tri |(PxU32(EdgeNb1)<<30); + Tri1.mATri[EdgeNb1] = first_tri |(PxU32(EdgeNb0)<<30); +#else + Gu::TriangleT<PxU32> FirstTri, SecondTri; + if(create.DFaces) + { + FirstTri.v[0] = create.DFaces[first_tri*3+0]; + FirstTri.v[1] = create.DFaces[first_tri*3+1]; + FirstTri.v[2] = create.DFaces[first_tri*3+2]; + SecondTri.v[0] = create.DFaces[second_tri*3+0]; + SecondTri.v[1] = create.DFaces[second_tri*3+1]; + SecondTri.v[2] = create.DFaces[second_tri*3+2]; + } + if(create.WFaces) + { + FirstTri.v[0] = create.WFaces[first_tri*3+0]; + FirstTri.v[1] = create.WFaces[first_tri*3+1]; + FirstTri.v[2] = create.WFaces[first_tri*3+2]; + SecondTri.v[0] = create.WFaces[second_tri*3+0]; + SecondTri.v[1] = create.WFaces[second_tri*3+1]; + SecondTri.v[2] = create.WFaces[second_tri*3+2]; + } + + // Get the edge IDs. 0xff means input references are wrong. + const PxU8 EdgeNb0 = FirstTri.findEdge(ref0, ref1); + const PxU8 EdgeNb1 = SecondTri.findEdge(ref0, ref1); + if(EdgeNb0==0xff || EdgeNb1==0xff) + { + Ps::getFoundation().error(PxErrorCode::eINVALID_OPERATION, __FILE__, __LINE__, "Adjacencies::UpdateLink: invalid edge reference"); + return false; + } + + // Update links. The two most significant bits contain the counterpart edge's ID. + faces[first_tri].mATri[EdgeNb0] = second_tri |(PxU32(EdgeNb1)<<30); + faces[second_tri].mATri[EdgeNb1] = first_tri |(PxU32(EdgeNb0)<<30); +#endif + return true; + } + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + /** + * Creates the adjacency structures. + * \return true if success. + */ + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +#ifdef MSH_ADJACENCIES_INCLUDE_TOPOLOGY + static bool CreateDatabase(AdjTriangle* faces, PxU32 nb_edges, const AdjEdge* edges) +#else + static bool CreateDatabase(AdjTriangle* faces, PxU32 nb_edges, const AdjEdge* edges, const ADJACENCIESCREATE& create) +#endif + { + Cm::RadixSortBuffered Core; + { + // Multiple sorts - this rewritten version uses less ram + // PT: TTP 2994: the mesh has 343000+ edges, so yeah, sure, allocating more than 1mb on the stack causes overflow... + PxU32* VRefs = PX_NEW_TEMP(PxU32)[nb_edges]; + + // Sort according to mRef0, then mRef1 + PxU32 i; + for(i=0;i<nb_edges;i++) + VRefs[i] = edges[i].Ref0; + Core.Sort(VRefs, nb_edges); + for(i=0;i<nb_edges;i++) + VRefs[i] = edges[i].Ref1; + Core.Sort(VRefs, nb_edges); + + PX_DELETE_POD(VRefs); + } + const PxU32* Sorted = Core.GetRanks(); + + // Read the list in sorted order, look for similar edges + PxU32 LastRef0 = edges[Sorted[0]].Ref0; + PxU32 LastRef1 = edges[Sorted[0]].Ref1; + PxU32 Count = 0; + PxU32 TmpBuffer[3]; + + while(nb_edges--) + { + PxU32 SortedIndex = *Sorted++; + PxU32 Face = edges[SortedIndex].mFaceNb; // Owner face + PxU32 Ref0 = edges[SortedIndex].Ref0; // Vertex ref #1 + PxU32 Ref1 = edges[SortedIndex].Ref1; // Vertex ref #2 + if(Ref0==LastRef0 && Ref1==LastRef1) + { + // Current edge is the same as last one + TmpBuffer[Count++] = Face; // Store face number + // Only works with manifold meshes (i.e. an edge is not shared by more than 2 triangles) + if(Count==3) + { + Ps::getFoundation().error(PxErrorCode::eINVALID_OPERATION, __FILE__, __LINE__, "Adjacencies::CreateDatabase: can't work on non-manifold meshes."); + return false; + } + } + else + { + // Here we have a new edge (LastRef0, LastRef1) shared by Count triangles stored in TmpBuffer + if(Count==2) + { + // if Count==1 => edge is a boundary edge: it belongs to a single triangle. + // Hence there's no need to update a link to an adjacent triangle. +#ifdef MSH_ADJACENCIES_INCLUDE_TOPOLOGY + if(!UpdateLink(TmpBuffer[0], TmpBuffer[1], LastRef0, LastRef1, faces)) return false; +#else + if(!UpdateLink(TmpBuffer[0], TmpBuffer[1], LastRef0, LastRef1, faces, create)) return false; +#endif + } + // Reset for next edge + Count = 0; + TmpBuffer[Count++] = Face; + LastRef0 = Ref0; + LastRef1 = Ref1; + } + } + bool Status = true; +#ifdef MSH_ADJACENCIES_INCLUDE_TOPOLOGY + if(Count==2) Status = UpdateLink(TmpBuffer[0], TmpBuffer[1], LastRef0, LastRef1, faces); +#else + if(Count==2) Status = UpdateLink(TmpBuffer[0], TmpBuffer[1], LastRef0, LastRef1, faces, create); +#endif + return Status; + } + +AdjacenciesBuilder::AdjacenciesBuilder() +{ +} + +AdjacenciesBuilder::~AdjacenciesBuilder() +{ +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +/** + * Initializes the component. + * \param create [in] the creation structure + * \return true if success. + */ +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +bool AdjacenciesBuilder::Init(const ADJACENCIESCREATE& create) +{ + // Checkings + if(!create.NbFaces) return false; + + // Get some bytes + mNbFaces = create.NbFaces; + mFaces = PX_NEW(AdjTriangle)[mNbFaces]; + + AdjEdge* Edges = PX_NEW_TEMP(AdjEdge)[mNbFaces*3]; + PxU32 NbEdges=0; + + // Feed me with triangles..... + for(PxU32 i=0;i<mNbFaces;i++) + { + // Get correct vertex references + const PxU32 Ref0 = create.DFaces ? create.DFaces[i*3+0] : create.WFaces ? create.WFaces[i*3+0] : 0; + const PxU32 Ref1 = create.DFaces ? create.DFaces[i*3+1] : create.WFaces ? create.WFaces[i*3+1] : 1; + const PxU32 Ref2 = create.DFaces ? create.DFaces[i*3+2] : create.WFaces ? create.WFaces[i*3+2] : 2; + + // Add a triangle to the database + AddTriangle(Ref0, Ref1, Ref2, i, mFaces, NbEdges, Edges); + } + + // At this point of the process we have mFaces & Edges filled with input data. That is: + // - a list of triangles with 3 NULL links (i.e. PX_INVALID_U32) + // - a list of mNbFaces*3 edges, each edge having 2 vertex references and an owner face. + + // Here NbEdges should be equal to mNbFaces*3. + PX_ASSERT(NbEdges==mNbFaces*3); + +#ifdef MSH_ADJACENCIES_INCLUDE_TOPOLOGY + bool Status = CreateDatabase(mFaces, NbEdges, Edges); +#else + bool Status = CreateDatabase(mFaces, NbEdges, Edges, create); +#endif + + // We don't need the edges anymore + PX_DELETE_ARRAY(Edges); + +#ifdef MSH_ADJACENCIES_INCLUDE_CONVEX_BITS + // Now create convex information. This creates coupling between adjacencies & edge-list but in this case it's actually the goal: + // mixing the two structures to save memory. + if(Status && create.Verts) + { + Gu::EDGELISTCREATE ELC; + ELC.NbFaces = create.NbFaces; + ELC.DFaces = create.DFaces; // That's where I like having a unified way to do things... We + ELC.WFaces = create.WFaces; // can just directly copy the same pointers. + ELC.FacesToEdges = true; + ELC.Verts = create.Verts; + ELC.Epsilon = create.Epsilon; + + Gu::EdgeListBuilder EL; + if(EL.init(ELC)) + { + for(PxU32 i=0;i<mNbFaces;i++) + { + const Gu::EdgeTriangleData& ET = EL.getEdgeTriangle(i); + if(Gu::EdgeTriangleAC::HasActiveEdge01(ET)) mFaces[i].mATri[EDGE01] |= 0x20000000; + else mFaces[i].mATri[EDGE01] &= ~0x20000000; + if(Gu::EdgeTriangleAC::HasActiveEdge20(ET)) mFaces[i].mATri[EDGE02] |= 0x20000000; + else mFaces[i].mATri[EDGE02] &= ~0x20000000; + if(Gu::EdgeTriangleAC::HasActiveEdge12(ET)) mFaces[i].mATri[EDGE12] |= 0x20000000; + else mFaces[i].mATri[EDGE12] &= ~0x20000000; + + PX_ASSERT((Gu::EdgeTriangleAC::HasActiveEdge01(ET) && mFaces[i].HasActiveEdge01()) || (!Gu::EdgeTriangleAC::HasActiveEdge01(ET) && !mFaces[i].HasActiveEdge01())); + PX_ASSERT((Gu::EdgeTriangleAC::HasActiveEdge20(ET) && mFaces[i].HasActiveEdge20()) || (!Gu::EdgeTriangleAC::HasActiveEdge20(ET) && !mFaces[i].HasActiveEdge20())); + PX_ASSERT((Gu::EdgeTriangleAC::HasActiveEdge12(ET) && mFaces[i].HasActiveEdge12()) || (!Gu::EdgeTriangleAC::HasActiveEdge12(ET) && !mFaces[i].HasActiveEdge12())); + } + } + } +#endif + + return Status; +} +/* +bool AdjacenciesBuilder::Save(Stream& stream) const +{ + bool PlatformMismatch = PxPlatformMismatch(); + + // Export header + if(!WriteHeader('A', 'D', 'J', 'A', gVersion, PlatformMismatch, stream)) + return false; + + // Export adjacencies +// stream.StoreDword(mNbFaces); + WriteDword(mNbFaces, PlatformMismatch, stream); + +// stream.StoreBuffer(mFaces, sizeof(AdjTriangle)*mNbFaces); + WriteDwordBuffer((const PxU32*)mFaces, mNbFaces*3, PlatformMismatch, stream); + + return true; +}*/ +//#endif diff --git a/PhysX_3.4/Source/PhysXCooking/src/Adjacencies.h b/PhysX_3.4/Source/PhysXCooking/src/Adjacencies.h new file mode 100644 index 00000000..5378c569 --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/Adjacencies.h @@ -0,0 +1,234 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + + +#ifndef PX_PHYSICS_GEOMUTILS_PX_ADJACENCIES +#define PX_PHYSICS_GEOMUTILS_PX_ADJACENCIES + +#define MSH_ADJACENCIES_INCLUDE_CONVEX_BITS +#include "foundation/Px.h" +#include "GuTriangle32.h" + +namespace physx +{ + +#ifdef MSH_ADJACENCIES_INCLUDE_CONVEX_BITS + #define ADJ_TRIREF_MASK 0x1fffffff //!< Masks 3 bits + #define IS_CONVEX_EDGE(x) (x & 0x20000000) //!< Returns true for convex edges +#else + #define ADJ_TRIREF_MASK 0x3fffffff //!< Masks 2 bits +#endif + + #define MAKE_ADJ_TRI(x) (x & ADJ_TRIREF_MASK) //!< Transforms a link into a triangle reference. + #define GET_EDGE_NB(x) (x>>30) //!< Transforms a link into a counterpart edge ID. +// #define IS_BOUNDARY(x) (x==PX_INVALID_U32) //!< Returns true for boundary edges. + #define IS_BOUNDARY(x) ((x & ADJ_TRIREF_MASK)==ADJ_TRIREF_MASK) //!< Returns true for boundary edges. + + // Forward declarations + class Adjacencies; + + enum SharedEdgeIndex + { + EDGE01 = 0, + EDGE02 = 1, + EDGE12 = 2 + }; + +/* PX_INLINE void GetEdgeIndices(SharedEdgeIndex edge_index, PxU32& id0, PxU32& id1) + { + if(edge_index==0) + { + id0 = 0; + id1 = 1; + } + else if(edge_index==1) + { + id0 = 0; + id1 = 2; + } + else if(edge_index==2) + { + id0 = 1; + id1 = 2; + } + }*/ + + //! Sets a new edge code + #define SET_EDGE_NB(link, code) \ + link&=ADJ_TRIREF_MASK; \ + link|=code<<30; \ + + //! A triangle class used to compute the adjacency structures. + class AdjTriangle +#ifdef MSH_ADJACENCIES_INCLUDE_TOPOLOGY + : public IndexedTriangle +#else + : public Ps::UserAllocated +#endif + { + public: + //! Constructor + PX_INLINE AdjTriangle() {} + //! Destructor + PX_INLINE ~AdjTriangle() {} + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + /** + * Computes the number of boundary edges in a triangle. + * \return the number of boundary edges. (0 => 3) + */ + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + PxU32 ComputeNbBoundaryEdges() const; + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + /** + * Computes the number of valid neighbors. + * \return the number of neighbors. (0 => 3) + */ + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + PxU32 ComputeNbNeighbors() const; + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + /** + * Checks whether the triangle has a particular neighbor or not. + * \param tref [in] the triangle reference to look for + * \param index [out] the corresponding index in the triangle (NULL if not needed) + * \return true if the triangle has the given neighbor + */ + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + bool HasNeighbor(PxU32 tref, PxU32* index=NULL) const; + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + /** + * Flips the winding. + */ + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + void Flip(); + + // Data access + PX_INLINE PxU32 GetLink(SharedEdgeIndex edge_index) const { return mATri[edge_index]; } + PX_INLINE PxU32 GetAdjTri(SharedEdgeIndex edge_index) const { return MAKE_ADJ_TRI(mATri[edge_index]); } + PX_INLINE PxU32 GetAdjEdge(SharedEdgeIndex edge_index) const { return GET_EDGE_NB(mATri[edge_index]); } + PX_INLINE Ps::IntBool IsBoundaryEdge(SharedEdgeIndex edge_index) const { return IS_BOUNDARY(mATri[edge_index]); } +#ifdef MSH_ADJACENCIES_INCLUDE_CONVEX_BITS + PX_INLINE Ps::IntBool HasActiveEdge01() const { return Ps::IntBool(IS_CONVEX_EDGE(mATri[EDGE01])); } + PX_INLINE Ps::IntBool HasActiveEdge20() const { return Ps::IntBool(IS_CONVEX_EDGE(mATri[EDGE02])); } + PX_INLINE Ps::IntBool HasActiveEdge12() const { return Ps::IntBool(IS_CONVEX_EDGE(mATri[EDGE12])); } + PX_INLINE Ps::IntBool HasActiveEdge(PxU32 i) const { return Ps::IntBool(IS_CONVEX_EDGE(mATri[i])); } +#endif +// private: + //! Links/References of adjacent triangles. The 2 most significant bits contains the counterpart edge in the adjacent triangle. + //! mATri[0] refers to edge 0-1 + //! mATri[1] refers to edge 0-2 + //! mATri[2] refers to edge 1-2 + PxU32 mATri[3]; + }; + + //! The adjacencies creation structure. + struct ADJACENCIESCREATE + { + //! Constructor + ADJACENCIESCREATE() : NbFaces(0), DFaces(NULL), WFaces(NULL) + { +#ifdef MSH_ADJACENCIES_INCLUDE_CONVEX_BITS + Verts = NULL; + Epsilon = 0.1f; +// Epsilon = 0.001f; +#endif + } + + PxU32 NbFaces; //!< Number of faces in source topo + const PxU32* DFaces; //!< List of faces (dwords) or NULL + const PxU16* WFaces; //!< List of faces (words) or NULL +#ifdef MSH_ADJACENCIES_INCLUDE_CONVEX_BITS + const PxVec3* Verts; + float Epsilon; +#endif + }; + + class Adjacencies : public Ps::UserAllocated + { + public: + Adjacencies(); + ~Adjacencies(); + + PxU32 mNbFaces; //!< Number of faces involved in the computation. + AdjTriangle* mFaces; //!< A list of AdjTriangles (one/face) + + bool Load(PxInputStream& stream); + // Basic mesh walking + PX_INLINE const AdjTriangle* GetAdjacentFace(const AdjTriangle& current_tri, SharedEdgeIndex edge_nb) const + { + // No checkings here, make sure mFaces has been created + + // Catch the link + PxU32 Link = current_tri.GetLink(edge_nb); + + // Returns NULL for boundary edges + if(IS_BOUNDARY(Link)) return NULL; + + // Else transform into face index + PxU32 Id = MAKE_ADJ_TRI(Link); + + // Possible counterpart edge is: + // PxU32 Edge = GET_EDGE_NB(Link); + + // And returns adjacent triangle + return &mFaces[Id]; + } + // Helpers + PxU32 ComputeNbBoundaryEdges() const; +#ifdef MSH_ADJACENCIES_INCLUDE_TOPOLOGY + bool GetBoundaryVertices(PxU32 nb_verts, bool* bound_status) const; +#else + bool GetBoundaryVertices(PxU32 nb_verts, bool* bound_status, const Gu::TriangleT<PxU32>* faces) const; +#endif + // +#ifdef MSH_ADJACENCIES_INCLUDE_TOPOLOGY + bool MakeLastRef(AdjTriangle& cur_tri, PxU32 vref); +#else + bool MakeLastRef(AdjTriangle& cur_tri, PxU32 vref, Gu::TriangleT<PxU32>* cur_topo); +#endif + private: + // New edge codes assignment + void AssignNewEdgeCode(PxU32 link, PxU8 edge_nb); + }; + +//#ifdef PX_COOKING + class AdjacenciesBuilder : public Adjacencies + { + public: + AdjacenciesBuilder(); + ~AdjacenciesBuilder(); + + bool Init(const ADJACENCIESCREATE& create); +// bool Save(Stream& stream) const; + }; +//#endif + +} + +#endif diff --git a/PhysX_3.4/Source/PhysXCooking/src/Cooking.cpp b/PhysX_3.4/Source/PhysXCooking/src/Cooking.cpp new file mode 100644 index 00000000..e793b48f --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/Cooking.cpp @@ -0,0 +1,493 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + + +#include "foundation/PxErrorCallback.h" +#include "PsFoundation.h" +#include "PsUtilities.h" +#include "PsFPU.h" +#include "CmPhysXCommon.h" +#include "PxPhysXConfig.h" +#include "PxSimpleTriangleMesh.h" +#include "PxTriangleMeshDesc.h" +#include "PxConvexMeshDesc.h" +#include "PxCooking.h" +#include "Cooking.h" +#include "mesh/TriangleMeshBuilder.h" +#include "GuConvexMesh.h" +#include "ConvexMeshBuilder.h" +#include "InflationConvexHullLib.h" +#include "QuickHullConvexHullLib.h" +#include "CmIO.h" +#include "PxHeightFieldDesc.h" +#include "GuHeightField.h" +#include "HeightFieldCooking.h" +#include "common/PxPhysicsInsertionCallback.h" +#include "CmUtils.h" + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + +using namespace physx; +using namespace Gu; + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + +void Cooking::setParams(const PxCookingParams& params) +{ + mParams = params; +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + +const PxCookingParams& Cooking::getParams() +{ + return mParams; +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + +bool Cooking::platformMismatch() +{ + // Get current endianness (the one for the platform where cooking is performed) + PxI8 currentEndian = Ps::littleEndian(); + + bool mismatch = true; + switch(mParams.targetPlatform) + { + case PxPlatform::ePC: + mismatch = currentEndian!=1; // The PC files must be little endian + break; + case PxPlatform::eARM: + mismatch = currentEndian!=1; + break; + } + return mismatch; +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + +void Cooking::release() +{ + delete this; + + Ps::Foundation::decRefCount(); +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +bool Cooking::validateTriangleMesh(const PxTriangleMeshDesc& desc) +{ + // cooking code does lots of float bitwise reinterpretation that generates exceptions + PX_FPU_GUARD; + + if(!desc.isValid()) + { + Ps::getFoundation().error(PxErrorCode::eINVALID_PARAMETER, __FILE__, __LINE__, "Cooking::validateTriangleMesh: user-provided triangle mesh descriptor is invalid!"); + return false; + } + + // PT: validation code doesn't look at midphase data, so ideally we wouldn't build the midphase structure at all here. + BV4TriangleMeshBuilder builder(mParams); + return builder.loadFromDesc(desc, NULL, true /*doValidate*/); +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + +bool Cooking::cookTriangleMesh(TriangleMeshBuilder& builder, const PxTriangleMeshDesc& desc, PxOutputStream& stream, PxTriangleMeshCookingResult::Enum* condition) +{ + // cooking code does lots of float bitwise reinterpretation that generates exceptions + PX_FPU_GUARD; + + if (condition) + *condition = PxTriangleMeshCookingResult::eSUCCESS; + if(!builder.loadFromDesc(desc, condition, false)) + { + if (condition) + *condition = PxTriangleMeshCookingResult::eFAILURE; + return false; + } + + builder.save(stream, platformMismatch(), mParams); + return true; +} + +bool Cooking::cookTriangleMesh(const PxTriangleMeshDesc& desc, PxOutputStream& stream, PxTriangleMeshCookingResult::Enum* condition) +{ + if((mParams.midphaseDesc.getType() == PxMeshMidPhase::eINVALID) || (mParams.midphaseDesc.getType() == PxMeshMidPhase::eBVH33)) + { + RTreeTriangleMeshBuilder builder(mParams); + return cookTriangleMesh(builder, desc, stream, condition); + } + else + { + BV4TriangleMeshBuilder builder(mParams); + return cookTriangleMesh(builder, desc, stream, condition); + } +} + +PxTriangleMesh* Cooking::createTriangleMesh(TriangleMeshBuilder& builder, const PxTriangleMeshDesc& desc, PxPhysicsInsertionCallback& insertionCallback) +{ + // cooking code does lots of float bitwise reinterpretation that generates exceptions + PX_FPU_GUARD; + + if(!builder.loadFromDesc(desc, NULL, false)) + return NULL; + + // check if the indices can be moved from 32bits to 16bits + if(!(mParams.meshPreprocessParams & PxMeshPreprocessingFlag::eFORCE_32BIT_INDICES)) + builder.checkMeshIndicesSize(); + + PxConcreteType::Enum type; + if(builder.getMidphaseID()==PxMeshMidPhase::eBVH33) + type = PxConcreteType::eTRIANGLE_MESH_BVH33; + else + type = PxConcreteType::eTRIANGLE_MESH_BVH34; + + return static_cast<PxTriangleMesh*>(insertionCallback.buildObjectFromData(type, &builder.getMeshData())); +} + +PxTriangleMesh* Cooking::createTriangleMesh(const PxTriangleMeshDesc& desc, PxPhysicsInsertionCallback& insertionCallback) +{ + if((mParams.midphaseDesc.getType() == PxMeshMidPhase::eINVALID) || (mParams.midphaseDesc.getType() == PxMeshMidPhase::eBVH33)) + { + RTreeTriangleMeshBuilder builder(mParams); + return createTriangleMesh(builder, desc, insertionCallback); + } + else + { + BV4TriangleMeshBuilder builder(mParams); + return createTriangleMesh(builder, desc, insertionCallback); + } +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +// cook convex mesh from given desc, internal function to be shared between create/cook convex mesh +bool Cooking::cookConvexMeshInternal(const PxConvexMeshDesc& desc_, ConvexMeshBuilder& meshBuilder, ConvexHullLib* hullLib, + PxConvexMeshCookingResult::Enum* condition) +{ + if (condition) + *condition = PxConvexMeshCookingResult::eFAILURE; + + if (!desc_.isValid()) + { + Ps::getFoundation().error(PxErrorCode::eINVALID_PARAMETER, __FILE__, __LINE__, "Cooking::cookConvexMesh: user-provided convex mesh descriptor is invalid!"); + return false; + } + + if (mParams.areaTestEpsilon <= 0.0f) + { + Ps::getFoundation().error(PxErrorCode::eINVALID_PARAMETER, __FILE__, __LINE__, "Cooking::cookConvexMesh: user-provided convex mesh areaTestEpsilon is invalid!"); + return false; + } + + PxConvexMeshDesc desc = desc_; + bool polygonsLimitReached = false; + + // the convex will be cooked from provided points + if (desc_.flags & PxConvexFlag::eCOMPUTE_CONVEX) + { + PX_ASSERT(hullLib); + + PxConvexMeshCookingResult::Enum res = hullLib->createConvexHull(); + if (res == PxConvexMeshCookingResult::eSUCCESS || res == PxConvexMeshCookingResult::ePOLYGONS_LIMIT_REACHED) + { + if (res == PxConvexMeshCookingResult::ePOLYGONS_LIMIT_REACHED) + polygonsLimitReached = true; + + hullLib->fillConvexMeshDesc(desc); + } + else + { + if (res == PxConvexMeshCookingResult::eZERO_AREA_TEST_FAILED) + { + *condition = PxConvexMeshCookingResult::eZERO_AREA_TEST_FAILED; + } + + return false; + } + } + + if (desc.points.count >= 256) + { + Ps::getFoundation().error(PxErrorCode::eINTERNAL_ERROR, __FILE__, __LINE__, "Cooking::cookConvexMesh: user-provided hull must have less than 256 vertices!"); + return false; + } + + if (!meshBuilder.build(desc, mParams.gaussMapLimit, false, hullLib ? false : true)) + { + return false; + } + + if (condition) + { + *condition = polygonsLimitReached ? PxConvexMeshCookingResult::ePOLYGONS_LIMIT_REACHED : PxConvexMeshCookingResult::eSUCCESS; + } + + return true; +} + +////////////////////////////////////////////////////////////////////////// +// cook convex mesh from given desc, save the results into stream +bool Cooking::cookConvexMesh(const PxConvexMeshDesc& desc_, PxOutputStream& stream, PxConvexMeshCookingResult::Enum* condition) +{ + PX_FPU_GUARD; + // choose cooking library if needed + ConvexHullLib* hullLib = NULL; + PxConvexMeshDesc desc = desc_; + + if(desc_.flags & PxConvexFlag::eCOMPUTE_CONVEX) + { + const PxU32 gpuMaxVertsLimit = 64; + + // GRB supports 64 verts max + if(desc_.flags & PxConvexFlag::eGPU_COMPATIBLE) + { + desc.vertexLimit = gpuMaxVertsLimit; + } + + if(mParams.convexMeshCookingType == PxConvexMeshCookingType::eINFLATION_INCREMENTAL_HULL) + { + hullLib = PX_NEW(InflationConvexHullLib) (desc, mParams); + } + else + { + hullLib = PX_NEW(QuickHullConvexHullLib) (desc, mParams); + } + } + + ConvexMeshBuilder meshBuilder(mParams.buildGPUData); + if(!cookConvexMeshInternal(desc,meshBuilder,hullLib , condition)) + { + if(hullLib) + PX_DELETE(hullLib); + return false; + } + + // save the cooked results into stream + if(!meshBuilder.save(stream, platformMismatch())) + { + if (condition) + { + *condition = PxConvexMeshCookingResult::eFAILURE; + } + if(hullLib) + PX_DELETE(hullLib); + return false; + } + + if(hullLib) + PX_DELETE(hullLib); + return true; +} + +////////////////////////////////////////////////////////////////////////// +// cook convex mesh from given desc, copy the results into internal convex mesh +// and insert the mesh into PxPhysics +PxConvexMesh* Cooking::createConvexMesh(const PxConvexMeshDesc& desc, PxPhysicsInsertionCallback& insertionCallback) +{ + PX_FPU_GUARD; + // choose cooking library if needed + ConvexHullLib* hullLib = NULL; + if(desc.flags & PxConvexFlag::eCOMPUTE_CONVEX) + { + if (mParams.convexMeshCookingType == PxConvexMeshCookingType::eINFLATION_INCREMENTAL_HULL) + { + hullLib = PX_NEW(InflationConvexHullLib) (desc, mParams); + } + else + { + hullLib = PX_NEW(QuickHullConvexHullLib) (desc, mParams); + } + } + + // cook the mesh + ConvexMeshBuilder meshBuilder(mParams.buildGPUData); + if (!cookConvexMeshInternal(desc, meshBuilder, hullLib, NULL)) + { + if(hullLib) + PX_DELETE(hullLib); + return NULL; + } + + // copy the constructed data into the new mesh + Gu::ConvexHullData meshData; + meshBuilder.copy(meshData); + + // insert into physics + Gu::ConvexMesh* convexMesh = static_cast<Gu::ConvexMesh*>(insertionCallback.buildObjectFromData(PxConcreteType::eCONVEX_MESH, &meshData)); + if (!convexMesh) + { + if (hullLib) + PX_DELETE(hullLib); + return NULL; + } + + convexMesh->setMass(meshBuilder.getMass()); + convexMesh->setInertia(meshBuilder.getInertia()); + if(meshBuilder.getBigConvexData()) + { + convexMesh->setBigConvexData(meshBuilder.getBigConvexData()); + meshBuilder.setBigConvexData(NULL); + } + + if(hullLib) + PX_DELETE(hullLib); + return convexMesh; +} + +////////////////////////////////////////////////////////////////////////// + +bool Cooking::validateConvexMesh(const PxConvexMeshDesc& desc) +{ + ConvexMeshBuilder mesh(mParams.buildGPUData); + return mesh.build(desc, mParams.gaussMapLimit, true); +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + +bool Cooking::computeHullPolygons(const PxSimpleTriangleMesh& mesh, PxAllocatorCallback& inCallback,PxU32& nbVerts, PxVec3*& vertices, + PxU32& nbIndices, PxU32*& indices, PxU32& nbPolygons, PxHullPolygon*& hullPolygons) +{ + PxVec3* geometry = reinterpret_cast<PxVec3*>(PxAlloca(sizeof(PxVec3)*mesh.points.count)); + Cooking::gatherStrided(mesh.points.data, geometry, mesh.points.count, sizeof(PxVec3), mesh.points.stride); + + PxU32* topology = reinterpret_cast<PxU32*>(PxAlloca(sizeof(PxU32)*3*mesh.triangles.count)); + if (mesh.flags & PxMeshFlag::e16_BIT_INDICES) + { + // conversion; 16 bit index -> 32 bit index & stride + PxU32* dest = topology; + const PxU32* pastLastDest = topology + 3*mesh.triangles.count; + const PxU8* source = reinterpret_cast<const PxU8*>(mesh.triangles.data); + while (dest < pastLastDest) + { + const PxU16 * trig16 = reinterpret_cast<const PxU16*>(source); + *dest++ = trig16[0]; + *dest++ = trig16[1]; + *dest++ = trig16[2]; + source += mesh.triangles.stride; + } + } + else + { + Cooking::gatherStrided(mesh.triangles.data, topology, mesh.triangles.count, sizeof(PxU32) * 3, mesh.triangles.stride); + } + + ConvexMeshBuilder meshBuilder(mParams.buildGPUData); + if(!meshBuilder.computeHullPolygons(mesh.points.count,geometry,mesh.triangles.count,topology,inCallback, nbVerts, vertices,nbIndices,indices,nbPolygons,hullPolygons)) + return false; + + return true; +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + +bool Cooking::cookHeightField(const PxHeightFieldDesc& desc, PxOutputStream& stream) +{ + PX_FPU_GUARD; + + if(!desc.isValid()) + { + #if PX_CHECKED + Ps::getFoundation().error(PxErrorCode::eINVALID_PARAMETER, __FILE__, __LINE__, "Cooking::createHeightField: user-provided heightfield descriptor is invalid!"); + #endif + return false; + } + + Gu::HeightField hf(NULL); + + if(!hf.loadFromDesc(desc)) + { + hf.releaseMemory(); + return false; + } + + if (!saveHeightField(hf, stream, platformMismatch())) + { + hf.releaseMemory(); + return false; + } + + hf.releaseMemory(); + + return true; +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + +PxHeightField* Cooking::createHeightField(const PxHeightFieldDesc& desc, PxPhysicsInsertionCallback& insertionCallback) +{ + PX_FPU_GUARD; + + if(!desc.isValid()) + { + #if PX_CHECKED + Ps::getFoundation().error(PxErrorCode::eINVALID_PARAMETER, __FILE__, __LINE__, "Cooking::createHeightField: user-provided heightfield descriptor is invalid!"); + #endif + return NULL; + } + + Gu::HeightField* hf; + PX_NEW_SERIALIZED(hf, Gu::HeightField)(NULL); + + if(!hf->loadFromDesc(desc)) + { + PX_DELETE(hf); + return NULL; + } + + // create heightfield and set the HF data + Gu::HeightField* heightField = static_cast<Gu::HeightField*>(insertionCallback.buildObjectFromData(PxConcreteType::eHEIGHTFIELD, &hf->mData)); + if(!heightField) + { + PX_DELETE(hf); + return NULL; + } + + // copy the Gu::HeightField variables + heightField->mSampleStride = hf->mSampleStride; + heightField->mNbSamples = hf->mNbSamples; + heightField->mMinHeight = hf->mMinHeight; + heightField->mMaxHeight = hf->mMaxHeight; + heightField->mModifyCount = hf->mModifyCount; + + PX_DELETE(hf); + return heightField; +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + +PxCooking* PxCreateCooking(PxU32 /*version*/, PxFoundation& foundation, const PxCookingParams& params) +{ + PX_ASSERT(static_cast<Ps::Foundation*>(&foundation) == &Ps::Foundation::getInstance()); + PX_UNUSED(foundation); + + Ps::Foundation::incRefCount(); + + return PX_NEW(Cooking)(params); +} + diff --git a/PhysX_3.4/Source/PhysXCooking/src/Cooking.h b/PhysX_3.4/Source/PhysXCooking/src/Cooking.h new file mode 100644 index 00000000..d54aea0f --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/Cooking.h @@ -0,0 +1,87 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + +#ifndef PX_PSCOOKING_H +#define PX_PSCOOKING_H + +#include "foundation/PxMemory.h" +#include "PxCooking.h" +#include "PsUserAllocated.h" + +namespace physx +{ +class TriangleMeshBuilder; +class ConvexMeshBuilder; +class ConvexHullLib; + +class Cooking: public PxCooking, public Ps::UserAllocated +{ +public: + Cooking(const PxCookingParams& params): mParams(params) {} + + virtual void release(); + virtual void setParams(const PxCookingParams& params); + virtual const PxCookingParams& getParams(); + virtual bool platformMismatch(); + virtual bool cookTriangleMesh(const PxTriangleMeshDesc& desc, PxOutputStream& stream, PxTriangleMeshCookingResult::Enum* condition = NULL); + virtual PxTriangleMesh* createTriangleMesh(const PxTriangleMeshDesc& desc, PxPhysicsInsertionCallback& insertionCallback); + virtual bool validateTriangleMesh(const PxTriangleMeshDesc& desc); + + virtual bool cookConvexMesh(const PxConvexMeshDesc& desc, PxOutputStream& stream, PxConvexMeshCookingResult::Enum* condition); + virtual PxConvexMesh* createConvexMesh(const PxConvexMeshDesc& desc, PxPhysicsInsertionCallback& insertionCallback); + virtual bool validateConvexMesh(const PxConvexMeshDesc& desc); + virtual bool computeHullPolygons(const PxSimpleTriangleMesh& mesh, PxAllocatorCallback& inCallback,PxU32& nbVerts, PxVec3*& vertices, + PxU32& nbIndices, PxU32*& indices, PxU32& nbPolygons, PxHullPolygon*& hullPolygons); + virtual bool cookHeightField(const PxHeightFieldDesc& desc, PxOutputStream& stream); + virtual PxHeightField* createHeightField(const PxHeightFieldDesc& desc, PxPhysicsInsertionCallback& insertionCallback); + + PX_FORCE_INLINE static void gatherStrided(const void* src, void* dst, PxU32 nbElem, PxU32 elemSize, PxU32 stride) + { + const PxU8* s = reinterpret_cast<const PxU8*>(src); + PxU8* d = reinterpret_cast<PxU8*>(dst); + while(nbElem--) + { + PxMemCopy(d, s, elemSize); + d += elemSize; + s += stride; + } + } + +private: + bool cookConvexMeshInternal(const PxConvexMeshDesc& desc, ConvexMeshBuilder& meshBuilder, ConvexHullLib* hullLib, PxConvexMeshCookingResult::Enum* condition); + +private: + PxCookingParams mParams; + + bool cookTriangleMesh(TriangleMeshBuilder& builder, const PxTriangleMeshDesc& desc, PxOutputStream& stream, PxTriangleMeshCookingResult::Enum* condition); + PxTriangleMesh* createTriangleMesh(TriangleMeshBuilder& builder, const PxTriangleMeshDesc& desc, PxPhysicsInsertionCallback& insertionCallback); +}; + +} +#endif //#define PX_PSCOOKING_H diff --git a/PhysX_3.4/Source/PhysXCooking/src/CookingUtils.cpp b/PhysX_3.4/Source/PhysXCooking/src/CookingUtils.cpp new file mode 100644 index 00000000..37aa7b12 --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/CookingUtils.cpp @@ -0,0 +1,120 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + +#include "foundation/PxMath.h" +#include "CookingUtils.h" +#include "CmRadixSortBuffered.h" +#include "PsAllocator.h" +#include "PsFPU.h" + +using namespace physx; +using namespace Cm; + +ReducedVertexCloud::ReducedVertexCloud(const PxVec3* verts, PxU32 nb_verts) : mNbRVerts(0), mRVerts(NULL), mXRef(NULL) +{ + mVerts = verts; + mNbVerts = nb_verts; +} + +ReducedVertexCloud::~ReducedVertexCloud() +{ + Clean(); +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +/** +* Frees used ram. +* \return Self-reference +*/ +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +ReducedVertexCloud& ReducedVertexCloud::Clean() +{ + PX_DELETE_POD(mXRef); + PX_FREE_AND_RESET(mRVerts); + return *this; +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +/** +* Reduction method. Use this to create a minimal vertex cloud. +* \param rc [out] result structure +* \return true if success +* \warning This is not about welding nearby vertices, here we look for real redundant ones. +*/ +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +bool ReducedVertexCloud::Reduce(REDUCEDCLOUD* rc) +{ + Clean(); + + mXRef = PX_NEW(PxU32)[mNbVerts]; + + float* f = PX_NEW_TEMP(float)[mNbVerts]; + + for(PxU32 i=0;i<mNbVerts;i++) + f[i] = mVerts[i].x; + + RadixSortBuffered Radix; + Radix.Sort(reinterpret_cast<const PxU32*>(f), mNbVerts, RADIX_UNSIGNED); + + for(PxU32 i=0;i<mNbVerts;i++) + f[i] = mVerts[i].y; + Radix.Sort(reinterpret_cast<const PxU32*>(f), mNbVerts, RADIX_UNSIGNED); + + for(PxU32 i=0;i<mNbVerts;i++) + f[i] = mVerts[i].z; + const PxU32* Sorted = Radix.Sort(reinterpret_cast<const PxU32*>(f), mNbVerts, RADIX_UNSIGNED).GetRanks(); + + PX_DELETE_POD(f); + + mNbRVerts = 0; + const PxU32 Junk[] = {PX_INVALID_U32, PX_INVALID_U32, PX_INVALID_U32}; + const PxU32* Previous = Junk; + mRVerts = reinterpret_cast<PxVec3*>(PX_ALLOC(sizeof(PxVec3) * mNbVerts, "PxVec3")); + PxU32 Nb = mNbVerts; + while(Nb--) + { + const PxU32 Vertex = *Sorted++; // Vertex number + + const PxU32* current = reinterpret_cast<const PxU32*>(&mVerts[Vertex]); + if(current[0]!=Previous[0] || current[1]!=Previous[1] || current[2]!=Previous[2]) + mRVerts[mNbRVerts++] = mVerts[Vertex]; + + Previous = current; + + mXRef[Vertex] = mNbRVerts-1; + } + + if(rc) + { + rc->CrossRef = mXRef; + rc->NbRVerts = mNbRVerts; + rc->RVerts = mRVerts; + } + return true; +} diff --git a/PhysX_3.4/Source/PhysXCooking/src/CookingUtils.h b/PhysX_3.4/Source/PhysXCooking/src/CookingUtils.h new file mode 100644 index 00000000..41de2360 --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/CookingUtils.h @@ -0,0 +1,79 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + + +#ifndef PX_COOKINGUTILS +#define PX_COOKINGUTILS + +#include "foundation/PxVec3.h" +#include "PxPhysXConfig.h" + +namespace physx +{ + //! Vertex cloud reduction result structure + struct REDUCEDCLOUD + { + // Out + PxVec3* RVerts; //!< Reduced list + PxU32 NbRVerts; //!< Reduced number of vertices + PxU32* CrossRef; //!< nb_verts remapped indices + }; + + class ReducedVertexCloud + { + public: + // Constructors/destructor + ReducedVertexCloud(const PxVec3* verts, PxU32 nb_verts); + ~ReducedVertexCloud(); + // Free used bytes + ReducedVertexCloud& Clean(); + // Cloud reduction + bool Reduce(REDUCEDCLOUD* rc=NULL); + // Data access + PX_INLINE PxU32 GetNbVerts() const { return mNbVerts; } + PX_INLINE PxU32 GetNbReducedVerts() const { return mNbRVerts; } + PX_INLINE const PxVec3* GetReducedVerts() const { return mRVerts; } + PX_INLINE const PxVec3& GetReducedVertex(PxU32 i) const { return mRVerts[i]; } + PX_INLINE const PxU32* GetCrossRefTable() const { return mXRef; } + + private: + // Original vertex cloud + PxU32 mNbVerts; //!< Number of vertices + const PxVec3* mVerts; //!< List of vertices (pointer copy) + + // Reduced vertex cloud + PxU32 mNbRVerts; //!< Reduced number of vertices + PxVec3* mRVerts; //!< Reduced list of vertices + PxU32* mXRef; //!< Cross-reference table (used to remap topologies) + }; + +} + +#endif + diff --git a/PhysX_3.4/Source/PhysXCooking/src/EdgeList.cpp b/PhysX_3.4/Source/PhysXCooking/src/EdgeList.cpp new file mode 100644 index 00000000..bd0b58f9 --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/EdgeList.cpp @@ -0,0 +1,753 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + + +#include "foundation/PxMemory.h" +#include "EdgeList.h" +#include "PxTriangle.h" +#include "PsMathUtils.h" +#include "CmRadixSortBuffered.h" +#include "GuSerialize.h" +#include "PsFoundation.h" + +using namespace physx; +using namespace Gu; + +Gu::EdgeList::EdgeList() +{ + mData.mNbEdges = 0; + mData.mEdgeFaces = NULL; + mData.mEdges = NULL; + mData.mEdgeToTriangles = NULL; + mData.mFacesByEdges = NULL; +} + +Gu::EdgeList::~EdgeList() +{ + PX_FREE_AND_RESET(mData.mFacesByEdges); + PX_FREE_AND_RESET(mData.mEdgeToTriangles); + PX_FREE_AND_RESET(mData.mEdges); + PX_DELETE_POD(mData.mEdgeFaces); +} + +bool Gu::EdgeList::load(PxInputStream& stream) +{ + // Import header + PxU32 Version; + bool Mismatch; + if(!ReadHeader('E', 'D', 'G', 'E', Version, Mismatch, stream)) + return false; + + // Import edges + mData.mNbEdges = readDword(Mismatch, stream); + //mEdges = ICE_NEW_MEM(Edge[mNbEdges],Edge); + mData.mEdges = reinterpret_cast<EdgeData*>(PX_ALLOC(sizeof(EdgeData)*mData.mNbEdges, "EdgeData")); + stream.read(mData.mEdges, sizeof(EdgeData)*mData.mNbEdges); + + mData.mNbFaces = readDword(Mismatch, stream); + //mEdgeFaces = ICE_NEW_MEM(EdgeTriangle[mNbFaces],EdgeTriangle); + mData.mEdgeFaces = reinterpret_cast<EdgeTriangleData*>(PX_ALLOC(sizeof(EdgeTriangleData)*mData.mNbFaces, "EdgeTriangleData")); + stream.read(mData.mEdgeFaces, sizeof(EdgeTriangleData)*mData.mNbFaces); + + //mEdgeToTriangles = ICE_NEW_MEM(EdgeDesc[mNbEdges],EdgeDesc); + mData.mEdgeToTriangles = reinterpret_cast<EdgeDescData*>(PX_ALLOC(sizeof(EdgeDescData)*mData.mNbEdges, "EdgeDescData")); + stream.read(mData.mEdgeToTriangles, sizeof(EdgeDescData)*mData.mNbEdges); + + + PxU32 LastOffset = mData.mEdgeToTriangles[mData.mNbEdges-1].Offset + mData.mEdgeToTriangles[mData.mNbEdges-1].Count; + mData.mFacesByEdges = reinterpret_cast<PxU32*>(PX_ALLOC(sizeof(PxU32)*LastOffset, "EdgeList FacesByEdges")); + stream.read(mData.mFacesByEdges, sizeof(PxU32)*LastOffset); + + return true; +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +/** + * Initializes the edge-list. + * \param create [in] edge-list creation structure + * \return true if success. + */ +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +bool Gu::EdgeListBuilder::init(const EDGELISTCREATE& create) +{ + bool FacesToEdges = create.Verts ? true : create.FacesToEdges; + bool EdgesToFaces = create.Verts ? true : create.EdgesToFaces; + + // "FacesToEdges" maps each face to three edges. + if(FacesToEdges && !createFacesToEdges(create.NbFaces, create.DFaces, create.WFaces)) + return false; + + // "EdgesToFaces" maps each edge to the set of faces sharing this edge + if(EdgesToFaces && !createEdgesToFaces(create.NbFaces, create.DFaces, create.WFaces)) + return false; + + // Create active edges + if(create.Verts && !computeActiveEdges(create.NbFaces, create.DFaces, create.WFaces, create.Verts, create.Epsilon)) + return false; + + // Get rid of useless data + if(!create.FacesToEdges) + { + PX_FREE_AND_RESET(mData.mEdgeFaces); + } + if(!create.EdgesToFaces) + { + PX_FREE_AND_RESET(mData.mEdgeToTriangles); + PX_FREE_AND_RESET(mData.mFacesByEdges); + } + + return true; +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +/** + * Computes FacesToEdges. + * After the call: + * - mNbEdges is updated with the number of non-redundant edges + * - mEdges is a list of mNbEdges edges (one edge is 2 vertex-references) + * - mEdgesRef is a list of nbfaces structures with 3 indexes in mEdges for each face + * + * \param nb_faces [in] a number of triangles + * \param dfaces [in] list of triangles with PxU32 vertex references (or NULL) + * \param wfaces [in] list of triangles with PxU16 vertex references (or NULL) + * \return true if success. + */ +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +bool Gu::EdgeListBuilder::createFacesToEdges(PxU32 nb_faces, const PxU32* dfaces, const PxU16* wfaces) +{ + // Checkings + if(!nb_faces || (!dfaces && !wfaces)) + { + Ps::getFoundation().error(PxErrorCode::eINVALID_OPERATION, __FILE__, __LINE__, "EdgeList::CreateFacesToEdges: NULL parameter!"); + return false; + } + + if(mData.mEdgeFaces) + return true; // Already computed! + + // 1) Get some bytes: I need one EdgesRefs for each face, and some temp buffers + mData.mEdgeFaces = PX_NEW(EdgeTriangleData)[nb_faces]; // Link faces to edges + PxU32* VRefs0 = PX_NEW_TEMP(PxU32)[nb_faces*3]; // Temp storage + PxU32* VRefs1 = PX_NEW_TEMP(PxU32)[nb_faces*3]; // Temp storage + EdgeData* Buffer = PX_NEW_TEMP(EdgeData)[nb_faces*3]; // Temp storage + + // 2) Create a full redundant list of 3 edges / face. + for(PxU32 i=0;i<nb_faces;i++) + { + // Get right vertex-references + const PxU32 Ref0 = dfaces ? dfaces[i*3+0] : wfaces ? wfaces[i*3+0] : 0; + const PxU32 Ref1 = dfaces ? dfaces[i*3+1] : wfaces ? wfaces[i*3+1] : 1; + const PxU32 Ref2 = dfaces ? dfaces[i*3+2] : wfaces ? wfaces[i*3+2] : 2; + + // Pre-Sort vertex-references and put them in the lists + if(Ref0<Ref1) { VRefs0[i*3+0] = Ref0; VRefs1[i*3+0] = Ref1; } // Edge 0-1 maps (i%3) + else { VRefs0[i*3+0] = Ref1; VRefs1[i*3+0] = Ref0; } // Edge 0-1 maps (i%3) + + if(Ref1<Ref2) { VRefs0[i*3+1] = Ref1; VRefs1[i*3+1] = Ref2; } // Edge 1-2 maps (i%3)+1 + else { VRefs0[i*3+1] = Ref2; VRefs1[i*3+1] = Ref1; } // Edge 1-2 maps (i%3)+1 + + if(Ref2<Ref0) { VRefs0[i*3+2] = Ref2; VRefs1[i*3+2] = Ref0; } // Edge 2-0 maps (i%3)+2 + else { VRefs0[i*3+2] = Ref0; VRefs1[i*3+2] = Ref2; } // Edge 2-0 maps (i%3)+2 + } + + // 3) Sort the list according to both keys (VRefs0 and VRefs1) + Cm::RadixSortBuffered Sorter; + const PxU32* Sorted = Sorter.Sort(VRefs1, nb_faces*3).Sort(VRefs0, nb_faces*3).GetRanks(); + + // 4) Loop through all possible edges + // - clean edges list by removing redundant edges + // - create EdgesRef list + mData.mNbEdges = 0; // #non-redundant edges + mData.mNbFaces = nb_faces; + PxU32 PreviousRef0 = PX_INVALID_U32; + PxU32 PreviousRef1 = PX_INVALID_U32; + for(PxU32 i=0;i<nb_faces*3;i++) + { + PxU32 Face = Sorted[i]; // Between 0 and nbfaces*3 + PxU32 ID = Face % 3; // Get edge ID back. + PxU32 SortedRef0 = VRefs0[Face]; // (SortedRef0, SortedRef1) is the sorted edge + PxU32 SortedRef1 = VRefs1[Face]; + + if(SortedRef0!=PreviousRef0 || SortedRef1!=PreviousRef1) + { + // New edge found! => stored in temp buffer + Buffer[mData.mNbEdges].Ref0 = SortedRef0; + Buffer[mData.mNbEdges].Ref1 = SortedRef1; + mData.mNbEdges++; + } + PreviousRef0 = SortedRef0; + PreviousRef1 = SortedRef1; + + // Create mEdgesRef on the fly + mData.mEdgeFaces[Face/3].mLink[ID] = mData.mNbEdges-1; + } + + // 5) Here, mNbEdges==#non redundant edges + mData.mEdges = reinterpret_cast<EdgeData*>(PX_ALLOC(sizeof(EdgeData)*mData.mNbEdges, "EdgeData")); + + // Create real edges-list. + PxMemCopy(mData.mEdges, Buffer, mData.mNbEdges*sizeof(EdgeData)); + + // 6) Free ram and exit + PX_DELETE_POD(Buffer); + PX_DELETE_POD(VRefs1); + PX_DELETE_POD(VRefs0); + + return true; +} + + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +/** + * Computes EdgesToFaces. + * After the call: + * - mEdgeToTriangles is created + * - mFacesByEdges is created + * + * \param nb_faces [in] a number of triangles + * \param dfaces [in] list of triangles with PxU32 vertex references (or NULL) + * \param wfaces [in] list of triangles with PxU16 vertex references (or NULL) + * \return true if success. + */ +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +bool Gu::EdgeListBuilder::createEdgesToFaces(PxU32 nb_faces, const PxU32* dfaces, const PxU16* wfaces) +{ + // 1) I need FacesToEdges ! + if(!createFacesToEdges(nb_faces, dfaces, wfaces)) + return false; + + // 2) Get some bytes: one Pair structure / edge + mData.mEdgeToTriangles = reinterpret_cast<EdgeDescData*>(PX_ALLOC(sizeof(EdgeDescData)*mData.mNbEdges, "EdgeDescData")); + PxMemZero(mData.mEdgeToTriangles, sizeof(EdgeDescData)*mData.mNbEdges); + + // 3) Create Counters, ie compute the #faces sharing each edge + for(PxU32 i=0;i<nb_faces;i++) + { + mData.mEdgeToTriangles[mData.mEdgeFaces[i].mLink[0]].Count++; + mData.mEdgeToTriangles[mData.mEdgeFaces[i].mLink[1]].Count++; + mData.mEdgeToTriangles[mData.mEdgeFaces[i].mLink[2]].Count++; + } + + // 3) Create Radix-like Offsets + mData.mEdgeToTriangles[0].Offset=0; + for(PxU32 i=1;i<mData.mNbEdges;i++) + mData.mEdgeToTriangles[i].Offset = mData.mEdgeToTriangles[i-1].Offset + mData.mEdgeToTriangles[i-1].Count; + + PxU32 LastOffset = mData.mEdgeToTriangles[mData.mNbEdges-1].Offset + mData.mEdgeToTriangles[mData.mNbEdges-1].Count; + + // 4) Get some bytes for mFacesByEdges. LastOffset is the number of indices needed. + mData.mFacesByEdges = reinterpret_cast<PxU32*>(PX_ALLOC(sizeof(PxU32)*LastOffset, "EdgeListBuilder FacesByEdges")); + + // 5) Create mFacesByEdges + for(PxU32 i=0;i<nb_faces;i++) + { + mData.mFacesByEdges[mData.mEdgeToTriangles[mData.mEdgeFaces[i].mLink[0]].Offset++] = i; + mData.mFacesByEdges[mData.mEdgeToTriangles[mData.mEdgeFaces[i].mLink[1]].Offset++] = i; + mData.mFacesByEdges[mData.mEdgeToTriangles[mData.mEdgeFaces[i].mLink[2]].Offset++] = i; + } + + // 6) Recompute offsets wasted by 5) + mData.mEdgeToTriangles[0].Offset=0; + for(PxU32 i=1;i<mData.mNbEdges;i++) + { + mData.mEdgeToTriangles[i].Offset = mData.mEdgeToTriangles[i-1].Offset + mData.mEdgeToTriangles[i-1].Count; + } + + return true; +} + +static PX_INLINE PxU32 OppositeVertex(PxU32 r0, PxU32 r1, PxU32 r2, PxU32 vref0, PxU32 vref1) +{ + if(vref0==r0) + { + if (vref1==r1) return r2; + else if(vref1==r2) return r1; + } + else if(vref0==r1) + { + if (vref1==r0) return r2; + else if(vref1==r2) return r0; + } + else if(vref0==r2) + { + if (vref1==r1) return r0; + else if(vref1==r0) return r1; + } + return PX_INVALID_U32; +} + +bool Gu::EdgeListBuilder::computeActiveEdges(PxU32 nb_faces, const PxU32* dfaces, const PxU16* wfaces, const PxVec3* verts, float epsilon) +{ + // Checkings + if(!verts || (!dfaces && !wfaces)) + { + Ps::getFoundation().error(PxErrorCode::eINVALID_OPERATION, __FILE__, __LINE__, "EdgeList::ComputeActiveEdges: NULL parameter!"); + return false; + } + + PxU32 NbEdges = getNbEdges(); + if(!NbEdges) + { + Ps::getFoundation().error(PxErrorCode::eINVALID_OPERATION, __FILE__, __LINE__, "ActiveEdges::ComputeConvexEdges: no edges in edge list!"); + return false; + } + + const EdgeData* Edges = getEdges(); + if(!Edges) + { + Ps::getFoundation().error(PxErrorCode::eINVALID_OPERATION, __FILE__, __LINE__, "ActiveEdges::ComputeConvexEdges: no edge data in edge list!"); + return false; + } + + const EdgeDescData* ED = getEdgeToTriangles(); + if(!ED) + { + Ps::getFoundation().error(PxErrorCode::eINVALID_OPERATION, __FILE__, __LINE__, "ActiveEdges::ComputeConvexEdges: no edge-to-triangle in edge list!"); + return false; + } + + const PxU32* FBE = getFacesByEdges(); + if(!FBE) + { + Ps::getFoundation().error(PxErrorCode::eINVALID_OPERATION, __FILE__, __LINE__, "ActiveEdges::ComputeConvexEdges: no faces-by-edges in edge list!"); + return false; + } + + // We first create active edges in a temporaray buffer. We have one bool / edge. + bool* ActiveEdges = reinterpret_cast<bool*>(PX_ALLOC_TEMP(sizeof(bool)*NbEdges, "bool")); + + // Loop through edges and look for convex ones + bool* CurrentMark = ActiveEdges; + + while(NbEdges--) + { + // Get number of triangles sharing current edge + PxU32 Count = ED->Count; + // Boundary edges are active => keep them (actually they're silhouette edges directly) + // Internal edges can be active => test them + // Singular edges ? => discard them + bool Active = false; + if(Count==1) + { + Active = true; + } + else if(Count==2) + { + PxU32 FaceIndex0 = FBE[ED->Offset+0]*3; + PxU32 FaceIndex1 = FBE[ED->Offset+1]*3; + + PxU32 VRef00, VRef01, VRef02; + PxU32 VRef10, VRef11, VRef12; + + if(dfaces) + { + VRef00 = dfaces[FaceIndex0+0]; + VRef01 = dfaces[FaceIndex0+1]; + VRef02 = dfaces[FaceIndex0+2]; + VRef10 = dfaces[FaceIndex1+0]; + VRef11 = dfaces[FaceIndex1+1]; + VRef12 = dfaces[FaceIndex1+2]; + } + else //if(wfaces) + { + PX_ASSERT(wfaces); + VRef00 = wfaces[FaceIndex0+0]; + VRef01 = wfaces[FaceIndex0+1]; + VRef02 = wfaces[FaceIndex0+2]; + VRef10 = wfaces[FaceIndex1+0]; + VRef11 = wfaces[FaceIndex1+1]; + VRef12 = wfaces[FaceIndex1+2]; + } + + { + // We first check the opposite vertex against the plane + + PxU32 Op = OppositeVertex(VRef00, VRef01, VRef02, Edges->Ref0, Edges->Ref1); + + PxPlane PL1(verts[VRef10], verts[VRef11], verts[VRef12]); + + if(PL1.distance(verts[Op])<0.0f) // If opposite vertex is below the plane, i.e. we discard concave edges + { + PxTriangle T0(verts[VRef00], verts[VRef01], verts[VRef02]); + PxTriangle T1(verts[VRef10], verts[VRef11], verts[VRef12]); + + PxVec3 N0, N1; + T0.normal(N0); + T1.normal(N1); + const float a = Ps::angle(N0, N1); + + if(fabsf(a)>epsilon) Active = true; + } + else + { + PxTriangle T0(verts[VRef00], verts[VRef01], verts[VRef02]); + PxTriangle T1(verts[VRef10], verts[VRef11], verts[VRef12]); + PxVec3 N0, N1; + T0.normal(N0); + T1.normal(N1); + + if(N0.dot(N1) < -0.999f) + { + Active = true; + } + + } + } + + } + else + { + //Connected to more than 2 + //We need to loop through the triangles and count the number of unique triangles (considering back-face triangles as non-unique). If we end up with more than 2 unique triangles, + //then by definition this is an inactive edge. However, if we end up with 2 unique triangles (say like a double-sided tesselated surface), then it depends on the same rules as above + + PxU32 FaceInd0 = FBE[ED->Offset]*3; + PxU32 VRef00, VRef01, VRef02; + PxU32 VRef10=0, VRef11=0, VRef12=0; + if(dfaces) + { + VRef00 = dfaces[FaceInd0+0]; + VRef01 = dfaces[FaceInd0+1]; + VRef02 = dfaces[FaceInd0+2]; + } + else //if(wfaces) + { + PX_ASSERT(wfaces); + VRef00 = wfaces[FaceInd0+0]; + VRef01 = wfaces[FaceInd0+1]; + VRef02 = wfaces[FaceInd0+2]; + } + + + PxU32 numUniqueTriangles = 1; + bool doubleSided0 = false; + bool doubleSided1 = 0; + + for(PxU32 a = 1; a < Count; ++a) + { + PxU32 FaceInd = FBE[ED->Offset+a]*3; + + PxU32 VRef0, VRef1, VRef2; + if(dfaces) + { + VRef0 = dfaces[FaceInd+0]; + VRef1 = dfaces[FaceInd+1]; + VRef2 = dfaces[FaceInd+2]; + } + else //if(wfaces) + { + PX_ASSERT(wfaces); + VRef0 = wfaces[FaceInd+0]; + VRef1 = wfaces[FaceInd+1]; + VRef2 = wfaces[FaceInd+2]; + } + + if(((VRef0 != VRef00) && (VRef0 != VRef01) && (VRef0 != VRef02)) || + ((VRef1 != VRef00) && (VRef1 != VRef01) && (VRef1 != VRef02)) || + ((VRef2 != VRef00) && (VRef2 != VRef01) && (VRef2 != VRef02))) + { + //Not the same as trig 0 + if(numUniqueTriangles == 2) + { + if(((VRef0 != VRef10) && (VRef0 != VRef11) && (VRef0 != VRef12)) || + ((VRef1 != VRef10) && (VRef1 != VRef11) && (VRef1 != VRef12)) || + ((VRef2 != VRef10) && (VRef2 != VRef11) && (VRef2 != VRef12))) + { + //Too many unique triangles - terminate and mark as inactive + numUniqueTriangles++; + break; + } + else + { + PxTriangle T0(verts[VRef10], verts[VRef11], verts[VRef12]); + PxTriangle T1(verts[VRef0], verts[VRef1], verts[VRef2]); + PxVec3 N0, N1; + T0.normal(N0); + T1.normal(N1); + + if(N0.dot(N1) < -0.999f) + doubleSided1 = true; + } + } + else + { + VRef10 = VRef0; + VRef11 = VRef1; + VRef12 = VRef2; + numUniqueTriangles++; + } + } + else + { + //Check for double sided... + PxTriangle T0(verts[VRef00], verts[VRef01], verts[VRef02]); + PxTriangle T1(verts[VRef0], verts[VRef1], verts[VRef2]); + PxVec3 N0, N1; + T0.normal(N0); + T1.normal(N1); + + if(N0.dot(N1) < -0.999f) + doubleSided0 = true; + } + } + + if(numUniqueTriangles == 1) + Active = true; + if(numUniqueTriangles == 2) + { + //Potentially active. Let's check the angles between the surfaces... + + if(doubleSided0 || doubleSided1) + { + + // Plane PL1 = faces[FBE[ED->Offset+1]].PlaneEquation(verts); + PxPlane PL1(verts[VRef10], verts[VRef11], verts[VRef12]); + + // if(PL1.Distance(verts[Op])<-epsilon) Active = true; + //if(PL1.distance(verts[Op])<0.0f) // If opposite vertex is below the plane, i.e. we discard concave edges + //KS - can't test signed distance for concave edges. This is a double-sided poly + { + PxTriangle T0(verts[VRef00], verts[VRef01], verts[VRef02]); + PxTriangle T1(verts[VRef10], verts[VRef11], verts[VRef12]); + + PxVec3 N0, N1; + T0.normal(N0); + T1.normal(N1); + const float a = Ps::angle(N0, N1); + + if(fabsf(a)>epsilon) + Active = true; + } + } + else + { + + //Not double sided...must have had a bunch of duplicate triangles!!!! + //Treat as normal + PxU32 Op = OppositeVertex(VRef00, VRef01, VRef02, Edges->Ref0, Edges->Ref1); + + // Plane PL1 = faces[FBE[ED->Offset+1]].PlaneEquation(verts); + PxPlane PL1(verts[VRef10], verts[VRef11], verts[VRef12]); + + // if(PL1.Distance(verts[Op])<-epsilon) Active = true; + if(PL1.distance(verts[Op])<0.0f) // If opposite vertex is below the plane, i.e. we discard concave edges + { + PxTriangle T0(verts[VRef00], verts[VRef01], verts[VRef02]); + PxTriangle T1(verts[VRef10], verts[VRef11], verts[VRef12]); + + PxVec3 N0, N1; + T0.normal(N0); + T1.normal(N1); + const float a = Ps::angle(N0, N1); + + if(fabsf(a)>epsilon) + Active = true; + } + } + } + else + { + //Lots of triangles all smooshed together. Just activate the edge in this case + Active = true; + } + + } + + *CurrentMark++ = Active; + ED++; + Edges++; + } + + + // Now copy bits back into already existing edge structures + // - first in edge triangles + for(PxU32 i=0;i<mData.mNbFaces;i++) + { + EdgeTriangleData& ET = mData.mEdgeFaces[i]; + for(PxU32 j=0;j<3;j++) + { + PxU32 Link = ET.mLink[j]; + if(!(Link & MSH_ACTIVE_EDGE_MASK)) // else already active + { + if(ActiveEdges[Link & MSH_EDGE_LINK_MASK]) ET.mLink[j] |= MSH_ACTIVE_EDGE_MASK; // Mark as active + } + } + } + + // - then in edge-to-faces + for(PxU32 i=0;i<mData.mNbEdges;i++) + { + if(ActiveEdges[i]) mData.mEdgeToTriangles[i].Flags |= PX_EDGE_ACTIVE; + } + + // Free & exit + PX_FREE_AND_RESET(ActiveEdges); + + { + //initially all vertices are flagged to ignore them. (we assume them to be flat) + //for all NONFLAT edges, incl boundary + //unflag 2 vertices in up to 2 trigs as perhaps interesting + //for all CONCAVE edges + //flag 2 vertices in up to 2 trigs to ignore them. + + // Handle active vertices + PxU32 MaxIndex = 0; + for(PxU32 i=0;i<nb_faces;i++) + { + PxU32 VRef0, VRef1, VRef2; + if(dfaces) + { + VRef0 = dfaces[i*3+0]; + VRef1 = dfaces[i*3+1]; + VRef2 = dfaces[i*3+2]; + } + else //if(wfaces) + { + PX_ASSERT(wfaces); + VRef0 = wfaces[i*3+0]; + VRef1 = wfaces[i*3+1]; + VRef2 = wfaces[i*3+2]; + } + if(VRef0>MaxIndex) MaxIndex = VRef0; + if(VRef1>MaxIndex) MaxIndex = VRef1; + if(VRef2>MaxIndex) MaxIndex = VRef2; + } + + MaxIndex++; + bool* ActiveVerts = reinterpret_cast<bool*>(PX_ALLOC_TEMP(sizeof(bool)*MaxIndex, "bool")); + PxMemZero(ActiveVerts, MaxIndex*sizeof(bool)); + + PX_ASSERT(dfaces || wfaces); + for(PxU32 i=0;i<mData.mNbFaces;i++) + { + PxU32 VRef[3]; + if(dfaces) + { + VRef[0] = dfaces[i*3+0]; + VRef[1] = dfaces[i*3+1]; + VRef[2] = dfaces[i*3+2]; + } + else if(wfaces) + { + VRef[0] = wfaces[i*3+0]; + VRef[1] = wfaces[i*3+1]; + VRef[2] = wfaces[i*3+2]; + } + + const EdgeTriangleData& ET = mData.mEdgeFaces[i]; + for(PxU32 j=0;j<3;j++) + { + PxU32 Link = ET.mLink[j]; + if(Link & MSH_ACTIVE_EDGE_MASK) + { + // Active edge => mark edge vertices as active + PxU32 r0, r1; + if(j==0) { r0=0; r1=1; } + else if(j==1) { r0=1; r1=2; } + else /*if(j==2)*/ { PX_ASSERT(j==2); r0=0; r1=2; } + ActiveVerts[VRef[r0]] = ActiveVerts[VRef[r1]] = true; + } + } + } + +/* for(PxU32 i=0;i<mNbFaces;i++) + { + PxU32 VRef[3]; + if(dfaces) + { + VRef[0] = dfaces[i*3+0]; + VRef[1] = dfaces[i*3+1]; + VRef[2] = dfaces[i*3+2]; + } + else if(wfaces) + { + VRef[0] = wfaces[i*3+0]; + VRef[1] = wfaces[i*3+1]; + VRef[2] = wfaces[i*3+2]; + } + + const EdgeTriangle& ET = mEdgeFaces[i]; + for(PxU32 j=0;j<3;j++) + { + PxU32 Link = ET.mLink[j]; + if(!(Link & MSH_ACTIVE_EDGE_MASK)) + { + // Inactive edge => mark edge vertices as inactive + PxU32 r0, r1; + if(j==0) { r0=0; r1=1; } + if(j==1) { r0=1; r1=2; } + if(j==2) { r0=0; r1=2; } + ActiveVerts[VRef[r0]] = ActiveVerts[VRef[r1]] = false; + } + } + }*/ + + // Now stuff this into the structure + for(PxU32 i=0;i<mData.mNbFaces;i++) + { + PxU32 VRef[3]; + if(dfaces) + { + VRef[0] = dfaces[i*3+0]; + VRef[1] = dfaces[i*3+1]; + VRef[2] = dfaces[i*3+2]; + } + else if(wfaces) + { + VRef[0] = wfaces[i*3+0]; + VRef[1] = wfaces[i*3+1]; + VRef[2] = wfaces[i*3+2]; + } + + EdgeTriangleData& ET = mData.mEdgeFaces[i]; + for(PxU32 j=0;j<3;j++) + { + PxU32 Link = ET.mLink[j]; + if(!(Link & MSH_ACTIVE_VERTEX_MASK)) // else already active + { + if(ActiveVerts[VRef[j]]) ET.mLink[j] |= MSH_ACTIVE_VERTEX_MASK; // Mark as active + } + } + } + + PX_FREE_AND_RESET(ActiveVerts); + } + + return true; +} + +Gu::EdgeListBuilder::EdgeListBuilder() +{ +} + +Gu::EdgeListBuilder::~EdgeListBuilder() +{ +} + + diff --git a/PhysX_3.4/Source/PhysXCooking/src/EdgeList.h b/PhysX_3.4/Source/PhysXCooking/src/EdgeList.h new file mode 100644 index 00000000..d4a47873 --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/EdgeList.h @@ -0,0 +1,110 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + + +#ifndef PX_EDGELIST +#define PX_EDGELIST + +// PT: this file should be moved to cooking lib + +#include "foundation/Px.h" +#include "PsUserAllocated.h" + +// Data/code shared with LL +#include "GuEdgeListData.h" + +namespace physx +{ +namespace Gu +{ + //! The edge-list creation structure. + struct EDGELISTCREATE + { + EDGELISTCREATE() : + NbFaces (0), + DFaces (NULL), + WFaces (NULL), + FacesToEdges (false), + EdgesToFaces (false), + Verts (NULL), + Epsilon (0.1f) + {} + + PxU32 NbFaces; //!< Number of faces in source topo + const PxU32* DFaces; //!< List of faces (dwords) or NULL + const PxU16* WFaces; //!< List of faces (words) or NULL + + bool FacesToEdges; + bool EdgesToFaces; + const PxVec3* Verts; + float Epsilon; + }; + + class EdgeList : public Ps::UserAllocated + { + public: + EdgeList(); + ~EdgeList(); + + bool load(PxInputStream& stream); + // Data access + PX_INLINE PxU32 getNbEdges() const { return mData.mNbEdges; } + PX_INLINE const Gu::EdgeData* getEdges() const { return mData.mEdges; } + PX_INLINE const Gu::EdgeData& getEdge(PxU32 edge_index) const { return mData.mEdges[edge_index]; } + // + PX_INLINE PxU32 getNbFaces() const { return mData.mNbFaces; } + PX_INLINE const Gu::EdgeTriangleData* getEdgeTriangles() const { return mData.mEdgeFaces; } + PX_INLINE const Gu::EdgeTriangleData& getEdgeTriangle(PxU32 face_index) const { return mData.mEdgeFaces[face_index]; } + // + PX_INLINE const Gu::EdgeDescData* getEdgeToTriangles() const { return mData.mEdgeToTriangles; } + PX_INLINE const Gu::EdgeDescData& getEdgeToTriangles(PxU32 edge_index) const { return mData.mEdgeToTriangles[edge_index]; } + PX_INLINE const PxU32* getFacesByEdges() const { return mData.mFacesByEdges; } + PX_INLINE PxU32 getFacesByEdges(PxU32 face_index) const { return mData.mFacesByEdges[face_index]; } + + protected: + Gu::EdgeListData mData; //!< Pointer to edgelist data + }; + + class EdgeListBuilder : public EdgeList + { + public: + EdgeListBuilder(); + ~EdgeListBuilder(); + + bool init(const EDGELISTCREATE& create); + private: + bool createFacesToEdges(PxU32 nb_faces, const PxU32* dfaces, const PxU16* wfaces); + bool createEdgesToFaces(PxU32 nb_faces, const PxU32* dfaces, const PxU16* wfaces); + bool computeActiveEdges(PxU32 nb_faces, const PxU32* dfaces, const PxU16* wfaces, const PxVec3* verts, float epsilon); + }; +} + +} + +#endif diff --git a/PhysX_3.4/Source/PhysXCooking/src/MeshCleaner.cpp b/PhysX_3.4/Source/PhysXCooking/src/MeshCleaner.cpp new file mode 100644 index 00000000..0f4b6f67 --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/MeshCleaner.cpp @@ -0,0 +1,233 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + +#include "foundation/PxVec3.h" +#include "MeshCleaner.h" +#include "PsAllocator.h" +#include "PsBitUtils.h" + +#ifndef PX_COOKING +#error Do not include anymore! +#endif + +using namespace physx; + +struct Indices +{ + PxU32 mRef[3]; + + PX_FORCE_INLINE bool operator!=(const Indices&v) const { return mRef[0] != v.mRef[0] || mRef[1] != v.mRef[1] || mRef[2] != v.mRef[2]; } +}; + +static PX_FORCE_INLINE PxU32 getHashValue(const PxVec3& v) +{ + const PxU32* h = reinterpret_cast<const PxU32*>(&v.x); + const PxU32 f = (h[0]+h[1]*11-(h[2]*17)) & 0x7fffffff; // avoid problems with +-0 + return (f>>22)^(f>>12)^(f); +} + +static PX_FORCE_INLINE PxU32 getHashValue(const Indices& v) +{ +// const PxU32* h = v.mRef; +// const PxU32 f = (h[0]+h[1]*11-(h[2]*17)) & 0x7fffffff; // avoid problems with +-0 +// return (f>>22)^(f>>12)^(f); + + PxU32 a = v.mRef[0]; + PxU32 b = v.mRef[1]; + PxU32 c = v.mRef[2]; + a=a-b; a=a-c; a=a^(c >> 13); + b=b-c; b=b-a; b=b^(a << 8); + c=c-a; c=c-b; c=c^(b >> 13); + a=a-b; a=a-c; a=a^(c >> 12); + b=b-c; b=b-a; b=b^(a << 16); + c=c-a; c=c-b; c=c^(b >> 5); + a=a-b; a=a-c; a=a^(c >> 3); + b=b-c; b=b-a; b=b^(a << 10); + c=c-a; c=c-b; c=c^(b >> 15); + return c; +} + +MeshCleaner::MeshCleaner(PxU32 nbVerts, const PxVec3* srcVerts, PxU32 nbTris, const PxU32* srcIndices, PxF32 meshWeldTolerance) +{ + PxVec3* cleanVerts = reinterpret_cast<PxVec3*>(PX_ALLOC(sizeof(PxVec3)*nbVerts, "MeshCleaner")); + PX_ASSERT(cleanVerts); + + PxU32* indices = reinterpret_cast<PxU32*>(PX_ALLOC(sizeof(PxU32)*nbTris*3, "MeshCleaner")); + + PxU32* remapTriangles = reinterpret_cast<PxU32*>(PX_ALLOC(sizeof(PxU32)*nbTris, "MeshCleaner")); + + PxU32* vertexIndices = NULL; + if(meshWeldTolerance!=0.0f) + { + vertexIndices = reinterpret_cast<PxU32*>(PX_ALLOC(sizeof(PxU32)*nbVerts, "MeshCleaner")); + const PxF32 weldTolerance = 1.0f / meshWeldTolerance; + // snap to grid + for(PxU32 i=0; i<nbVerts; i++) + { + vertexIndices[i] = i; + cleanVerts[i] = PxVec3( PxFloor(srcVerts[i].x*weldTolerance + 0.5f), + PxFloor(srcVerts[i].y*weldTolerance + 0.5f), + PxFloor(srcVerts[i].z*weldTolerance + 0.5f)); + } + } + else + { + memcpy(cleanVerts, srcVerts, nbVerts*sizeof(PxVec3)); + } + + const PxU32 maxNbElems = PxMax(nbTris, nbVerts); + const PxU32 hashSize = shdfnd::nextPowerOfTwo(maxNbElems); + const PxU32 hashMask = hashSize-1; + PxU32* hashTable = reinterpret_cast<PxU32*>(PX_ALLOC(sizeof(PxU32)*(hashSize + maxNbElems), "MeshCleaner")); + PX_ASSERT(hashTable); + memset(hashTable, 0xff, hashSize * sizeof(PxU32)); + PxU32* const next = hashTable + hashSize; + + PxU32* remapVerts = reinterpret_cast<PxU32*>(PX_ALLOC(sizeof(PxU32)*nbVerts, "MeshCleaner")); + memset(remapVerts, 0xff, nbVerts * sizeof(PxU32)); + + for(PxU32 i=0;i<nbTris*3;i++) + { + const PxU32 vref = srcIndices[i]; + if(vref<nbVerts) + remapVerts[vref] = 0; + } + + PxU32 nbCleanedVerts = 0; + for(PxU32 i=0;i<nbVerts;i++) + { + if(remapVerts[i]==0xffffffff) + continue; + + const PxVec3& v = cleanVerts[i]; + const PxU32 hashValue = getHashValue(v) & hashMask; + PxU32 offset = hashTable[hashValue]; + + while(offset!=0xffffffff && cleanVerts[offset]!=v) + offset = next[offset]; + + if(offset==0xffffffff) + { + remapVerts[i] = nbCleanedVerts; + cleanVerts[nbCleanedVerts] = v; + if(vertexIndices) + vertexIndices[nbCleanedVerts] = i; + next[nbCleanedVerts] = hashTable[hashValue]; + hashTable[hashValue] = nbCleanedVerts++; + } + else remapVerts[i] = offset; + } + + PxU32 nbCleanedTris = 0; + for(PxU32 i=0;i<nbTris;i++) + { + PxU32 vref0 = *srcIndices++; + PxU32 vref1 = *srcIndices++; + PxU32 vref2 = *srcIndices++; + if(vref0>=nbVerts || vref1>=nbVerts || vref2>=nbVerts) + continue; + + // PT: you can still get zero-area faces when the 3 vertices are perfectly aligned + const PxVec3& p0 = srcVerts[vref0]; + const PxVec3& p1 = srcVerts[vref1]; + const PxVec3& p2 = srcVerts[vref2]; + const float area2 = ((p0 - p1).cross(p0 - p2)).magnitudeSquared(); + if(area2==0.0f) + continue; + + vref0 = remapVerts[vref0]; + vref1 = remapVerts[vref1]; + vref2 = remapVerts[vref2]; + if(vref0==vref1 || vref1==vref2 || vref2==vref0) + continue; + + indices[nbCleanedTris*3+0] = vref0; + indices[nbCleanedTris*3+1] = vref1; + indices[nbCleanedTris*3+2] = vref2; + remapTriangles[nbCleanedTris] = i; + nbCleanedTris++; + } + PX_FREE(remapVerts); + + PxU32 nbToGo = nbCleanedTris; + nbCleanedTris = 0; + memset(hashTable, 0xff, hashSize * sizeof(PxU32)); + + Indices* const I = reinterpret_cast<Indices*>(indices); + bool idtRemap = true; + for(PxU32 i=0;i<nbToGo;i++) + { + const Indices& v = I[i]; + const PxU32 hashValue = getHashValue(v) & hashMask; + PxU32 offset = hashTable[hashValue]; + + while(offset!=0xffffffff && I[offset]!=v) + offset = next[offset]; + + if(offset==0xffffffff) + { + const PxU32 originalIndex = remapTriangles[i]; + PX_ASSERT(nbCleanedTris<=i); + remapTriangles[nbCleanedTris] = originalIndex; + if(originalIndex!=nbCleanedTris) + idtRemap = false; + I[nbCleanedTris] = v; + next[nbCleanedTris] = hashTable[hashValue]; + hashTable[hashValue] = nbCleanedTris++; + } + } + PX_FREE(hashTable); + + if(vertexIndices) + { + for(PxU32 i=0;i<nbCleanedVerts;i++) + cleanVerts[i] = srcVerts[vertexIndices[i]]; + PX_FREE(vertexIndices); + } + mNbVerts = nbCleanedVerts; + mNbTris = nbCleanedTris; + mVerts = cleanVerts; + mIndices = indices; + if(idtRemap) + { + PX_FREE(remapTriangles); + mRemap = NULL; + } + else + { + mRemap = remapTriangles; + } +} + +MeshCleaner::~MeshCleaner() +{ + PX_FREE_AND_RESET(mRemap); + PX_FREE_AND_RESET(mIndices); + PX_FREE_AND_RESET(mVerts); +} diff --git a/PhysX_3.4/Source/PhysXCooking/src/MeshCleaner.h b/PhysX_3.4/Source/PhysXCooking/src/MeshCleaner.h new file mode 100644 index 00000000..be3219ce --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/MeshCleaner.h @@ -0,0 +1,55 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + +#ifndef PX_MESH_CLEANER_H +#define PX_MESH_CLEANER_H + +#include "foundation/Px.h" + +#ifndef PX_COOKING +#error Do not include anymore! +#endif + +namespace physx +{ + class MeshCleaner + { + public: + MeshCleaner(PxU32 nbVerts, const PxVec3* verts, PxU32 nbTris, const PxU32* indices, PxF32 meshWeldTolerance); + ~MeshCleaner(); + + PxU32 mNbVerts; + PxU32 mNbTris; + PxVec3* mVerts; + PxU32* mIndices; + PxU32* mRemap; + }; +} + +#endif // PX_MESH_CLEANER_H diff --git a/PhysX_3.4/Source/PhysXCooking/src/Quantizer.cpp b/PhysX_3.4/Source/PhysXCooking/src/Quantizer.cpp new file mode 100644 index 00000000..6c68892a --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/Quantizer.cpp @@ -0,0 +1,338 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + +#include "Quantizer.h" + +#include "foundation/PxVec3.h" +#include "foundation/PxBounds3.h" + +#include "PsUserAllocated.h" +#include "PsAllocator.h" +#include "PsArray.h" + +#include "CmPhysXCommon.h" + +using namespace physx; + +PxU32 kmeans_cluster3d(const PxVec3 *input, // an array of input 3d data points. + PxU32 inputSize, // the number of input data points. + PxU32 clumpCount, // the number of clumps you wish to product. + PxVec3 *outputClusters, // The output array of clumps 3d vectors, should be at least 'clumpCount' in size. + PxU32 *outputIndices, // A set of indices which remaps the input vertices to clumps; should be at least 'inputSize' + float errorThreshold=0.01f, // The error threshold to converge towards before giving up. + float collapseDistance=0.01f); // distance so small it is not worth bothering to create a new clump. + +template <class Vec,class Type > +PxU32 kmeans_cluster(const Vec *input, + PxU32 inputCount, + PxU32 clumpCount, + Vec *clusters, + PxU32 *outputIndices, + Type threshold, // controls how long it works to converge towards a least errors solution. + Type collapseDistance) // distance between clumps to consider them to be essentially equal. +{ + PxU32 convergeCount = 64; // maximum number of iterations attempting to converge to a solution.. + PxU32* counts = reinterpret_cast<PxU32*> (PX_ALLOC_TEMP(sizeof(PxU32)*clumpCount, "PxU32")); + Type error=0; + if ( inputCount <= clumpCount ) // if the number of input points is less than our clumping size, just return the input points. + { + clumpCount = inputCount; + for (PxU32 i=0; i<inputCount; i++) + { + if ( outputIndices ) + { + outputIndices[i] = i; + } + clusters[i] = input[i]; + counts[i] = 1; + } + } + else + { + PxVec3* centroids = reinterpret_cast<PxVec3*> (PX_ALLOC_TEMP(sizeof(PxVec3)*clumpCount, "PxVec3")); + + // Take a sampling of the input points as initial centroid estimates. + for (PxU32 i=0; i<clumpCount; i++) + { + PxU32 index = (i*inputCount)/clumpCount; + PX_ASSERT( index < inputCount ); + clusters[i] = input[index]; + } + + // Here is the main convergence loop + Type old_error = FLT_MAX; // old and initial error estimates are max Type + error = FLT_MAX; + do + { + old_error = error; // preserve the old error + // reset the counts and centroids to current cluster location + for (PxU32 i=0; i<clumpCount; i++) + { + counts[i] = 0; + centroids[i] = PxVec3(PxZero); + } + error = 0; + // For each input data point, figure out which cluster it is closest too and add it to that cluster. + for (PxU32 i=0; i<inputCount; i++) + { + Type min_distance = FLT_MAX; + // find the nearest clump to this point. + for (PxU32 j=0; j<clumpCount; j++) + { + const Type distance = (input[i] - clusters[j]).magnitudeSquared(); + if ( distance < min_distance ) + { + min_distance = distance; + outputIndices[i] = j; // save which clump this point indexes + } + } + const PxU32 index = outputIndices[i]; // which clump was nearest to this point. + centroids[index]+=input[i]; + counts[index]++; // increment the counter indicating how many points are in this clump. + error+=min_distance; // save the error accumulation + } + // Now, for each clump, compute the mean and store the result. + for (PxU32 i=0; i<clumpCount; i++) + { + if ( counts[i] ) // if this clump got any points added to it... + { + const Type recip = 1.0f / Type(counts[i]); // compute the average (center of those points) + centroids[i]*=recip; // compute the average center of the points in this clump. + clusters[i] = centroids[i]; // store it as the new cluster. + } + } + // decrement the convergence counter and bail if it is taking too long to converge to a solution. + convergeCount--; + if (convergeCount == 0 ) + { + break; + } + if ( error < threshold ) // early exit if our first guess is already good enough (if all input points are the same) + break; + } while ( PxAbs(error - old_error) > threshold ); // keep going until the error is reduced by this threshold amount. + + PX_FREE(centroids); + } + + // ok..now we prune the clumps if necessary. + // The rules are; first, if a clump has no 'counts' then we prune it as it's unused. + // The second, is if the centroid of this clump is essentially the same (based on the distance tolerance) + // as an existing clump, then it is pruned and all indices which used to point to it, now point to the one + // it is closest too. + PxU32 outCount = 0; // number of clumps output after pruning performed. + Type d2 = collapseDistance*collapseDistance; // squared collapse distance. + for (PxU32 i=0; i<clumpCount; i++) + { + if ( counts[i] == 0 ) // if no points ended up in this clump, eliminate it. + continue; + // see if this clump is too close to any already accepted clump. + bool add = true; + PxU32 remapIndex = outCount; // by default this clump will be remapped to its current index. + for (PxU32 j=0; j<outCount; j++) + { + Type distance = (clusters[i] - clusters[j]).magnitudeSquared(); + if ( distance < d2 ) + { + remapIndex = j; + add = false; // we do not add this clump + break; + } + } + // If we have fewer output clumps than input clumps so far, then we need to remap the old indices to the new ones. + if ( outputIndices ) + { + if ( outCount != i || !add ) // we need to remap indices! everything that was index 'i' now needs to be remapped to 'outCount' + { + for (PxU32 j=0; j<inputCount; j++) + { + if ( outputIndices[j] == i ) + { + outputIndices[j] = remapIndex; // + } + } + } + } + if ( add ) + { + clusters[outCount] = clusters[i]; + outCount++; + } + } + PX_FREE(counts); + clumpCount = outCount; + return clumpCount; +} + +PxU32 kmeans_cluster3d(const PxVec3 *input, // an array of input 3d data points. + PxU32 inputSize, // the number of input data points. + PxU32 clumpCount, // the number of clumps you wish to produce + PxVec3 *outputClusters, // The output array of clumps 3d vectors, should be at least 'clumpCount' in size. + PxU32 *outputIndices, // A set of indices which remaps the input vertices to clumps; should be at least 'inputSize' + float errorThreshold, // The error threshold to converge towards before giving up. + float collapseDistance) // distance so small it is not worth bothering to create a new clump. +{ + return kmeans_cluster< PxVec3, float >(input, inputSize, clumpCount, outputClusters, outputIndices, errorThreshold, collapseDistance); +} + +class QuantizerImpl : public Quantizer, public Ps::UserAllocated +{ +public: + QuantizerImpl(void) + { + mScale = PxVec3(1.0f, 1.0f, 1.0f); + mCenter = PxVec3(0.0f, 0.0f, 0.0f); + } + + // Use the k-means quantizer, similar results, but much slower. + virtual const PxVec3 * kmeansQuantize3D(PxU32 vcount, + const PxVec3 *vertices, + PxU32 stride, + bool denormalizeResults, + PxU32 maxVertices, + PxU32 &outVertsCount) + { + const PxVec3 *ret = NULL; + outVertsCount = 0; + mNormalizedInput.clear(); + mQuantizedOutput.clear(); + + if ( vcount > 0 ) + { + normalizeInput(vcount,vertices, stride); + + PxVec3* quantizedOutput = reinterpret_cast<PxVec3*> (PX_ALLOC_TEMP(sizeof(PxVec3)*vcount, "PxVec3")); + PxU32* quantizedIndices = reinterpret_cast<PxU32*> (PX_ALLOC_TEMP(sizeof(PxU32)*vcount, "PxU32")); + outVertsCount = kmeans_cluster3d(&mNormalizedInput[0], vcount, maxVertices, quantizedOutput, quantizedIndices, 0.01f, 0.0001f ); + if ( outVertsCount > 0 ) + { + if ( denormalizeResults ) + { + for (PxU32 i=0; i<outVertsCount; i++) + { + PxVec3 v( quantizedOutput[i] ); + v = v.multiply(mScale) + mCenter; + mQuantizedOutput.pushBack(v); + } + } + else + { + for (PxU32 i=0; i<outVertsCount; i++) + { + const PxVec3& v( quantizedOutput[i] ); + mQuantizedOutput.pushBack(v); + } + } + ret = &mQuantizedOutput[0]; + } + PX_FREE(quantizedOutput); + PX_FREE(quantizedIndices); + } + return ret; + } + + virtual void release(void) + { + PX_DELETE(this); + } + + virtual const PxVec3& getDenormalizeScale(void) const + { + return mScale; + } + + virtual const PxVec3& getDenormalizeCenter(void) const + { + return mCenter; + } + + + +private: + + void normalizeInput(PxU32 vcount,const PxVec3 *vertices, PxU32 stride) + { + const char* vtx = reinterpret_cast<const char *> (vertices); + mNormalizedInput.clear(); + mQuantizedOutput.clear(); + PxBounds3 bounds; + bounds.setEmpty(); + for (PxU32 i=0; i<vcount; i++) + { + const PxVec3& v = *reinterpret_cast<const PxVec3 *> (vtx); + vtx += stride; + + bounds.include(v); + } + + mCenter = bounds.getCenter(); + + PxVec3 dim = bounds.getDimensions(); + dim *= 1.001f; + mScale = dim*0.5f; + + for (PxU32 i = 0; i < 3; i++) + { + if(dim[i] == 0) + mScale[i] = 1.0f; + } + + PxVec3 recip; + recip.x = 1.0f / mScale.x; + recip.y = 1.0f / mScale.y; + recip.z = 1.0f / mScale.z; + + vtx = reinterpret_cast<const char *> (vertices); + for (PxU32 i=0; i<vcount; i++) + { + PxVec3 v = *reinterpret_cast<const PxVec3 *> (vtx); + vtx += stride; + + v = (v - mCenter).multiply(recip); + + mNormalizedInput.pushBack(v); + } + } + + virtual ~QuantizerImpl(void) + { + + } + + private: + PxVec3 mScale; + PxVec3 mCenter; + Ps::Array<PxVec3> mNormalizedInput; + Ps::Array<PxVec3> mQuantizedOutput; +}; + +Quantizer * physx::createQuantizer(void) +{ + QuantizerImpl *m = PX_NEW(QuantizerImpl); + return static_cast< Quantizer *>(m); +} diff --git a/PhysX_3.4/Source/PhysXCooking/src/Quantizer.h b/PhysX_3.4/Source/PhysXCooking/src/Quantizer.h new file mode 100644 index 00000000..0b6e408e --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/Quantizer.h @@ -0,0 +1,76 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + + +#ifndef QUANTIZER_H +#define QUANTIZER_H + +#include "foundation/Px.h" + +namespace physx +{ + + ////////////////////////////////////////////////////////////////////////// + // K-means quantization class + // see http://en.wikipedia.org/wiki/K-means_clustering + // implementation from John Ratcliff http://codesuppository.blogspot.ch/2010/12/k-means-clustering-algorithm.html + class Quantizer + { + public: + // quantize the input vertices + virtual const PxVec3* kmeansQuantize3D(PxU32 vcount, + const PxVec3 *vertices, + PxU32 stride, + bool denormalizeResults, + PxU32 maxVertices, + PxU32 &outVertsCount) = 0; + + // returns the denormalized scale + virtual const PxVec3& getDenormalizeScale(void) const = 0; + + // returns the denormalized center + virtual const PxVec3& getDenormalizeCenter(void) const = 0; + + // release internal data + virtual void release(void) = 0; + + + protected: + virtual ~Quantizer(void) + { + + } + }; + + // creates the quantizer class + Quantizer * createQuantizer(void); + +} + +#endif diff --git a/PhysX_3.4/Source/PhysXCooking/src/convex/BigConvexDataBuilder.cpp b/PhysX_3.4/Source/PhysXCooking/src/convex/BigConvexDataBuilder.cpp new file mode 100644 index 00000000..5ab5965d --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/convex/BigConvexDataBuilder.cpp @@ -0,0 +1,353 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + + +#include "PsUserAllocated.h" +#include "PsUtilities.h" +#include "PsMathUtils.h" +#include "PsVecMath.h" + +#include "PxCooking.h" + +#include "GuConvexMeshData.h" +#include "GuBigConvexData2.h" +#include "GuIntersectionRayPlane.h" +#include "GuSerialize.h" + +#include "BigConvexDataBuilder.h" +#include "EdgeList.h" + +#include "ConvexHullBuilder.h" + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + +using namespace physx; +using namespace Gu; +using namespace Ps::aos; + +static const PxU32 gSupportVersion = 0; +static const PxU32 gVersion = 0; + +BigConvexDataBuilder::BigConvexDataBuilder(const Gu::ConvexHullData* hull, BigConvexData* gm, const PxVec3* hullVerts) : mHullVerts(hullVerts) +{ + mSVM = gm; + mHull = hull; +} + +BigConvexDataBuilder::~BigConvexDataBuilder() +{ +} + +bool BigConvexDataBuilder::initialize() +{ + mSVM->mData.mSamples = PX_NEW(PxU8)[mSVM->mData.mNbSamples*2u]; + +#if PX_DEBUG +// printf("SVM: %d bytes\n", mNbSamples*sizeof(PxU8)*2); +#endif + + return true; +} + +bool BigConvexDataBuilder::save(PxOutputStream& stream, bool platformMismatch) const +{ + // Export header + if(!WriteHeader('S', 'U', 'P', 'M', gSupportVersion, platformMismatch, stream)) + return false; + + // Save base gaussmap +// if(!GaussMapBuilder::Save(stream, platformMismatch)) return false; + // Export header + if(!WriteHeader('G', 'A', 'U', 'S', gVersion, platformMismatch, stream)) + return false; + + // Export basic info + // stream.StoreDword(mSubdiv); + writeDword(mSVM->mData.mSubdiv, platformMismatch, stream); // PT: could now write Word here + // stream.StoreDword(mNbSamples); + writeDword(mSVM->mData.mNbSamples, platformMismatch, stream); // PT: could now write Word here + + // Save map data + // It's an array of bytes so we don't care about 'PlatformMismatch' + stream.write(mSVM->mData.mSamples, sizeof(PxU8)*mSVM->mData.mNbSamples*2); + + if(!saveValencies(stream, platformMismatch)) + return false; + + return true; +} + +////////////////////////////////////////////////////////////////////////// +// compute valencies for each vertex +// we dont compute the edges again here, we have them temporary stored in mHullDataFacesByAllEdges8 structure +bool BigConvexDataBuilder::computeValencies(const ConvexHullBuilder& meshBuilder) +{ + PX_ASSERT(meshBuilder.mHullDataFacesByAllEdges8); + + // Create valencies + const PxU32 numVertices = meshBuilder.mHull->mNbHullVertices; + mSVM->mData.mNbVerts = numVertices; + + // Get ram for valencies + mSVM->mData.mValencies = PX_NEW(Gu::Valency)[mSVM->mData.mNbVerts]; + PxMemZero(mSVM->mData.mValencies, numVertices*sizeof(Gu::Valency)); + PxU8 vertexMarker[256]; + PxMemZero(vertexMarker,numVertices); + // Get ram for adjacent vertices references + mSVM->mData.mAdjacentVerts = PX_NEW(PxU8)[meshBuilder.mHull->mNbEdges*2u]; + + // Compute valencies + for (PxU32 i = 0; i < meshBuilder.mHull->mNbPolygons; i++) + { + PxU32 numVerts = meshBuilder.mHullDataPolygons[i].mNbVerts; + const PxU8* Data = meshBuilder.mHullDataVertexData8 + meshBuilder.mHullDataPolygons[i].mVRef8; + for (PxU32 j = 0; j < numVerts; j++) + { + mSVM->mData.mValencies[Data[j]].mCount++; + PX_ASSERT(mSVM->mData.mValencies[Data[j]].mCount != 0xffff); + } + } + + // Create offsets + mSVM->CreateOffsets(); + + // mNbAdjVerts = mOffsets[mNbVerts-1] + mValencies[mNbVerts-1]; + mSVM->mData.mNbAdjVerts = PxU32(mSVM->mData.mValencies[mSVM->mData.mNbVerts - 1].mOffset + mSVM->mData.mValencies[mSVM->mData.mNbVerts - 1].mCount); + PX_ASSERT(mSVM->mData.mNbAdjVerts == PxU32(meshBuilder.mHull->mNbEdges * 2)); + + // Create adjacent vertices + // parse the polygons and its vertices + for (PxU32 i = 0; i < meshBuilder.mHull->mNbPolygons; i++) + { + PxU32 numVerts = meshBuilder.mHullDataPolygons[i].mNbVerts; + const PxU8* Data = meshBuilder.mHullDataVertexData8 + meshBuilder.mHullDataPolygons[i].mVRef8; + for (PxU32 j = 0; j < numVerts; j++) + { + const PxU8 vertexIndex = Data[j]; + PxU8 numAdj = 0; + // if we did not parsed this vertex, traverse to the adjacent face and then + // again to next till we hit back the original polygon + if(vertexMarker[vertexIndex] == 0) + { + PxU8 prevIndex = Data[(j+1)%numVerts]; + mSVM->mData.mAdjacentVerts[mSVM->mData.mValencies[vertexIndex].mOffset++] = prevIndex; + numAdj++; + // now traverse the neighbors + PxU8 n0 = meshBuilder.mHullDataFacesByAllEdges8[(meshBuilder.mHullDataPolygons[i].mVRef8 + j)*2]; + PxU8 n1 = meshBuilder.mHullDataFacesByAllEdges8[(meshBuilder.mHullDataPolygons[i].mVRef8 + j)*2 + 1]; + PxU32 neighborPolygon = n0 == i ? n1 : n0; + while (neighborPolygon != i) + { + PxU32 numNeighborVerts = meshBuilder.mHullDataPolygons[neighborPolygon].mNbVerts; + const PxU8* neighborData = meshBuilder.mHullDataVertexData8 + meshBuilder.mHullDataPolygons[neighborPolygon].mVRef8; + PxU32 nextEdgeIndex = 0; + // search in the neighbor face for the tested vertex + for (PxU32 k = 0; k < numNeighborVerts; k++) + { + // search the vertexIndex + if(neighborData[k] == vertexIndex) + { + const PxU8 nextIndex = neighborData[(k+1)%numNeighborVerts]; + // next index already there, pick the previous + if(nextIndex == prevIndex) + { + prevIndex = k == 0 ? neighborData[numNeighborVerts - 1] : neighborData[k-1]; + nextEdgeIndex = k == 0 ? numNeighborVerts - 1 : k-1; + } + else + { + prevIndex = nextIndex; + nextEdgeIndex = k; + } + mSVM->mData.mAdjacentVerts[mSVM->mData.mValencies[vertexIndex].mOffset++] = prevIndex; + numAdj++; + break; + } + } + + // now move to next neighbor + n0 = meshBuilder.mHullDataFacesByAllEdges8[(meshBuilder.mHullDataPolygons[neighborPolygon].mVRef8 + nextEdgeIndex)*2]; + n1 = meshBuilder.mHullDataFacesByAllEdges8[(meshBuilder.mHullDataPolygons[neighborPolygon].mVRef8 + nextEdgeIndex)*2 + 1]; + neighborPolygon = n0 == neighborPolygon ? n1 : n0; + } + vertexMarker[vertexIndex] = numAdj; + } + } + } + + // Recreate offsets + mSVM->CreateOffsets(); + return true; +} + +////////////////////////////////////////////////////////////////////////// +// compute the min dot product from the verts for given dir +void BigConvexDataBuilder::precomputeSample(const PxVec3& dir, PxU8& startIndex_, float negativeDir) +{ + PxU8 startIndex = startIndex_; + + const PxVec3* verts = mHullVerts; + const Valency* valency = mSVM->mData.mValencies; + const PxU8* adjacentVerts = mSVM->mData.mAdjacentVerts; + + // we have only 256 verts + PxU32 smallBitMap[8] = {0,0,0,0,0,0,0,0}; + + float minimum = negativeDir * verts[startIndex].dot(dir); + PxU32 initialIndex = startIndex; + do + { + initialIndex = startIndex; + const PxU32 numNeighbours = valency[startIndex].mCount; + const PxU32 offset = valency[startIndex].mOffset; + + for (PxU32 a = 0; a < numNeighbours; ++a) + { + const PxU8 neighbourIndex = adjacentVerts[offset + a]; + const float dist = negativeDir * verts[neighbourIndex].dot(dir); + if (dist < minimum) + { + const PxU32 ind = PxU32(neighbourIndex >> 5); + const PxU32 mask = PxU32(1 << (neighbourIndex & 31)); + if ((smallBitMap[ind] & mask) == 0) + { + smallBitMap[ind] |= mask; + minimum = dist; + startIndex = neighbourIndex; + } + } + } + + } while (startIndex != initialIndex); + + startIndex_ = startIndex; +} + +////////////////////////////////////////////////////////////////////////// +// Precompute the min/max vertices for cube directions. +bool BigConvexDataBuilder::precompute(PxU32 subdiv) +{ + mSVM->mData.mSubdiv = Ps::to16(subdiv); + mSVM->mData.mNbSamples = Ps::to16(6 * subdiv*subdiv); + + if (!initialize()) + return false; + + PxU8 startIndex[12] = { 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 }; + PxU8 startIndex2[12] = { 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0 }; + + const float halfSubdiv = float(subdiv - 1) * 0.5f; + for (PxU32 j = 0; j < subdiv; j++) + { + for (PxU32 i = j; i < subdiv; i++) + { + const float iSubDiv = 1.0f - i / halfSubdiv; + const float jSubDiv = 1.0f - j / halfSubdiv; + + PxVec3 tempDir(1.0f, iSubDiv, jSubDiv); + // we need to normalize only once, then we permute the components + // as before for each i,j and j,i face direction + tempDir.normalize(); + + const PxVec3 dirs[12] = { + PxVec3(-tempDir.x, tempDir.y, tempDir.z), + PxVec3(tempDir.x, tempDir.y, tempDir.z), + + PxVec3(tempDir.z, -tempDir.x, tempDir.y), + PxVec3(tempDir.z, tempDir.x, tempDir.y), + + PxVec3(tempDir.y, tempDir.z, -tempDir.x), + PxVec3(tempDir.y, tempDir.z, tempDir.x), + + PxVec3(-tempDir.x, tempDir.z, tempDir.y), + PxVec3(tempDir.x, tempDir.z, tempDir.y), + + PxVec3(tempDir.y, -tempDir.x, tempDir.z), + PxVec3(tempDir.y, tempDir.x, tempDir.z), + + PxVec3(tempDir.z, tempDir.y, -tempDir.x), + PxVec3(tempDir.z, tempDir.y, tempDir.x) + }; + + // compute in each direction + negative/positive dot, we have + // then two start indexes, which are used then for hill climbing + for (PxU32 dStep = 0; dStep < 12; dStep++) + { + precomputeSample(dirs[dStep], startIndex[dStep], 1.0f); + precomputeSample(dirs[dStep], startIndex2[dStep], -1.0f); + } + + // decompose the vector results into face directions + for (PxU32 k = 0; k < 6; k++) + { + const PxU32 ksub = k*subdiv*subdiv; + const PxU32 offset = j + i*subdiv + ksub; + const PxU32 offset2 = i + j*subdiv + ksub; + PX_ASSERT(offset < mSVM->mData.mNbSamples); + PX_ASSERT(offset2 < mSVM->mData.mNbSamples); + + mSVM->mData.mSamples[offset] = startIndex[k]; + mSVM->mData.mSamples[offset + mSVM->mData.mNbSamples] = startIndex2[k]; + + mSVM->mData.mSamples[offset2] = startIndex[k + 6]; + mSVM->mData.mSamples[offset2 + mSVM->mData.mNbSamples] = startIndex2[k + 6]; + } + } + } + return true; +} + +static const PxU32 gValencyVersion = 2; + +////////////////////////////////////////////////////////////////////////// + +bool BigConvexDataBuilder::saveValencies(PxOutputStream& stream, bool platformMismatch) const +{ + // Export header + if(!WriteHeader('V', 'A', 'L', 'E', gValencyVersion, platformMismatch, stream)) + return false; + + writeDword(mSVM->mData.mNbVerts, platformMismatch, stream); + writeDword(mSVM->mData.mNbAdjVerts, platformMismatch, stream); + + { + PxU16* temp = PX_NEW_TEMP(PxU16)[mSVM->mData.mNbVerts]; + for(PxU32 i=0;i<mSVM->mData.mNbVerts;i++) + temp[i] = mSVM->mData.mValencies[i].mCount; + + const PxU32 maxIndex = computeMaxIndex(temp, mSVM->mData.mNbVerts); + writeDword(maxIndex, platformMismatch, stream); + StoreIndices(Ps::to16(maxIndex), mSVM->mData.mNbVerts, temp, stream, platformMismatch); + + PX_DELETE_POD(temp); + } + stream.write(mSVM->mData.mAdjacentVerts, mSVM->mData.mNbAdjVerts); + + return true; +} diff --git a/PhysX_3.4/Source/PhysXCooking/src/convex/BigConvexDataBuilder.h b/PhysX_3.4/Source/PhysXCooking/src/convex/BigConvexDataBuilder.h new file mode 100644 index 00000000..2abf5993 --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/convex/BigConvexDataBuilder.h @@ -0,0 +1,100 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + +#ifndef BIG_CONVEX_DATA_BUILDER_H +#define BIG_CONVEX_DATA_BUILDER_H + +#include "foundation/PxMemory.h" +#include "PsVecMath.h" + +namespace physx +{ + struct HullTriangleData; + class BigConvexData; + class ConvexHullBuilder; + + ////////////////////////////////////////////////////////////////////////// + //! Valencies creation structure + struct ValenciesCreate + { + //! Constructor + ValenciesCreate() { PxMemZero(this, sizeof(*this)); } + + PxU32 nbVerts; //!< Number of vertices + PxU32 nbFaces; //!< Number of faces + const PxU32* dFaces; //!< List of faces (triangle list) + const PxU16* wFaces; //!< List of faces (triangle list) + bool adjacentList; //!< Compute list of adjacent vertices or not + }; + + ////////////////////////////////////////////////////////////////////////// + + class BigConvexDataBuilder : public Ps::UserAllocated + { + public: + BigConvexDataBuilder(const Gu::ConvexHullData* hull, BigConvexData* gm, const PxVec3* hullVerts); + ~BigConvexDataBuilder(); + // Support vertex map + bool precompute(PxU32 subdiv); + + bool initialize(); + + bool save(PxOutputStream& stream, bool platformMismatch) const; + + bool computeValencies(const ConvexHullBuilder& meshBuilder); + //~Support vertex map + + // Valencies + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + /** + * Computes valencies and adjacent vertices. + * After the call, get results with the appropriate accessors. + * + * \param vc [in] creation structure + * \return true if success. + */ + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + bool compute(const ValenciesCreate& vc) const; + + bool saveValencies(PxOutputStream& stream, bool platformMismatch) const; + //~Valencies + protected: + PX_FORCE_INLINE void precomputeSample(const PxVec3& dir, PxU8& startIndex, float negativeDir); + + private: + const Gu::ConvexHullData* mHull; + BigConvexData* mSVM; + const PxVec3* mHullVerts; + + }; + +} + +#endif // BIG_CONVEX_DATA_BUILDER_H diff --git a/PhysX_3.4/Source/PhysXCooking/src/convex/ConvexHullBuilder.cpp b/PhysX_3.4/Source/PhysXCooking/src/convex/ConvexHullBuilder.cpp new file mode 100644 index 00000000..3b9c3ac6 --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/convex/ConvexHullBuilder.cpp @@ -0,0 +1,797 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + +#include "foundation/PxMemory.h" +#include "EdgeList.h" +#include "GuTriangle32.h" +#include "GuConvexMesh.h" +#include "PxCooking.h" +#include "CookingUtils.h" +#include "ConvexHullBuilder.h" +#include "CmRadixSortBuffered.h" +#include "MeshCleaner.h" +#include "PsArray.h" +#include "PsFoundation.h" +#include "PsVecMath.h" + + +// 7: added mHullDataFacesByVertices8 +// 8: added mEdges +static const physx::PxU32 gVersion = 8; + +using namespace physx; +using namespace Gu; +using namespace Ps::aos; + +#define USE_PRECOMPUTED_HULL_PROJECTION + +////////////////////////////////////////////////////////////////////////// +// default constructor +ConvexHullBuilder::ConvexHullBuilder(Gu::ConvexHullData* hull, const bool buildGRBData) : + mHullDataHullVertices (NULL), + mHullDataPolygons (NULL), + mHullDataVertexData8 (NULL), + mHullDataFacesByEdges8 (NULL), + mHullDataFacesByVertices8 (NULL), + mHullDataFacesByAllEdges8 (NULL), + mEdgeData16 (NULL), + mEdges (NULL), + mHull (hull), + mBuildGRBData (buildGRBData) +{ +} + +////////////////////////////////////////////////////////////////////////// +// default destructor +ConvexHullBuilder::~ConvexHullBuilder() +{ + PX_DELETE_POD(mEdgeData16); + PX_DELETE_POD(mEdges); + + PX_DELETE_POD(mHullDataHullVertices); + PX_DELETE_POD(mHullDataPolygons); + PX_DELETE_POD(mHullDataVertexData8); + PX_DELETE_POD(mHullDataFacesByEdges8); + PX_DELETE_POD(mHullDataFacesByVertices8); + PX_DELETE_POD(mHullDataFacesByAllEdges8); +} + +////////////////////////////////////////////////////////////////////////// +// initialize the convex hull +// \param nbVerts [in] number of vertices used +// \param verts [in] vertices array +// \param indices [in] indices array +// \param nbPolygons [in] number of polygons +// \param hullPolygons [in] polygons array +bool ConvexHullBuilder::init(PxU32 nbVerts, const PxVec3* verts, const PxU32* indices, const PxU32 nbIndices, + const PxU32 nbPolygons, const PxHullPolygon* hullPolygons, PxU32 gaussMapVertexLimit, bool doValidation, bool userPolygons) +{ + PX_ASSERT(indices); + PX_ASSERT(verts); + PX_ASSERT(hullPolygons); + PX_ASSERT(nbVerts); + PX_ASSERT(nbPolygons); + + mHullDataHullVertices = NULL; + mHullDataPolygons = NULL; + mHullDataVertexData8 = NULL; + mHullDataFacesByEdges8 = NULL; + mHullDataFacesByVertices8 = NULL; + mHullDataFacesByAllEdges8 = NULL; + + mEdges = NULL; + mEdgeData16 = NULL; + + mHull->mNbHullVertices = Ps::to8(nbVerts); + // allocate additional vec3 for V4 safe load in VolumeInteration + mHullDataHullVertices = reinterpret_cast<PxVec3*>(PX_ALLOC(sizeof(PxVec3) * mHull->mNbHullVertices + 1, "PxVec3")); + PxMemCopy(mHullDataHullVertices, verts, mHull->mNbHullVertices*sizeof(PxVec3)); + + // Cleanup + mHull->mNbPolygons = 0; + PX_DELETE_POD(mHullDataVertexData8); + PX_FREE_AND_RESET(mHullDataPolygons); + + if(nbPolygons>255) + { + Ps::getFoundation().error(PxErrorCode::eINTERNAL_ERROR, __FILE__, __LINE__, "ConvexHullBuilder::init: convex hull has more than 255 polygons!"); + return false; + } + + // Precompute hull polygon structures + mHull->mNbPolygons = Ps::to8(nbPolygons); + mHullDataPolygons = reinterpret_cast<Gu::HullPolygonData*>(PX_ALLOC(sizeof(Gu::HullPolygonData)*mHull->mNbPolygons, "Gu::HullPolygonData")); + + mHullDataVertexData8 = PX_NEW(PxU8)[nbIndices]; + PxU8* dest = mHullDataVertexData8; + for(PxU32 i=0;i<nbPolygons;i++) + { + const PxHullPolygon& inPolygon = hullPolygons[i]; + mHullDataPolygons[i].mVRef8 = PxU16(dest - mHullDataVertexData8); // Setup link for current polygon + + PxU32 numVerts = inPolygon.mNbVerts; + PX_ASSERT(numVerts>=3); // Else something very wrong happened... + mHullDataPolygons[i].mNbVerts = Ps::to8(numVerts); + + for (PxU32 j = 0; j < numVerts; j++) + { + dest[j] = Ps::to8(indices[inPolygon.mIndexBase + j]); + } + + mHullDataPolygons[i].mPlane = PxPlane(inPolygon.mPlane[0],inPolygon.mPlane[1],inPolygon.mPlane[2],inPolygon.mPlane[3]); + + // Next one + dest += numVerts; + } + + if(!calculateVertexMapTable(nbPolygons, userPolygons)) + return false; + + // moved create edge list here from save, copy. This is a part of the validation process and + // we need to create the edge list anyway + if (!createEdgeList(doValidation, nbIndices, mHull->mNbHullVertices > gaussMapVertexLimit ? true : false)) + return false; + +#ifdef USE_PRECOMPUTED_HULL_PROJECTION + // Loop through polygons + for (PxU32 j = 0; j < nbPolygons; j++) + { + // Precompute hull projection along local polygon normal + PxU32 NbVerts = mHull->mNbHullVertices; + const PxVec3* Verts = mHullDataHullVertices; + Gu::HullPolygonData& polygon = mHullDataPolygons[j]; + PxReal min = PX_MAX_F32; + PxU8 minIndex = 0xff; + for (PxU8 i = 0; i < NbVerts; i++) + { + float dp = (*Verts++).dot(polygon.mPlane.n); + if (dp < min) + { + min = dp; + minIndex = i; + } + } + polygon.mMinIndex = minIndex; + } +#endif + + if(doValidation) + return checkHullPolygons(); + else + return true; +} + +////////////////////////////////////////////////////////////////////////// +// hull polygons check +bool ConvexHullBuilder::checkHullPolygons() const +{ + const PxVec3* hullVerts = mHullDataHullVertices; + const PxU8* vertexData = mHullDataVertexData8; + Gu::HullPolygonData* hullPolygons = mHullDataPolygons; + + // Check hull validity + if(!hullVerts || !hullPolygons) + return false; + + if(mHull->mNbPolygons<4) + return false; + + PxVec3 max(-FLT_MAX,-FLT_MAX,-FLT_MAX); + + PxVec3 hullMax = hullVerts[0]; + PxVec3 hullMin = hullVerts[0]; + + for(PxU32 j=0;j<mHull->mNbHullVertices;j++) + { + const PxVec3& hullVert = hullVerts[j]; + if(fabsf(hullVert.x) > max.x) + max.x = fabsf(hullVert.x); + + if(fabsf(hullVert.y) > max.y) + max.y = fabsf(hullVert.y); + + if(fabsf(hullVert.z) > max.z) + max.z = fabsf(hullVert.z); + + if (hullVert.x > hullMax.x) + { + hullMax.x = hullVert.x; + } + else if (hullVert.x < hullMin.x) + { + hullMin.x = hullVert.x; + } + + if (hullVert.y > hullMax.y) + { + hullMax.y = hullVert.y; + } + else if (hullVert.y < hullMin.y) + { + hullMin.y = hullVert.y; + } + + if (hullVert.z > hullMax.z) + { + hullMax.z = hullVert.z; + } + else if (hullVert.z < hullMin.z) + { + hullMin.z = hullVert.z; + } + } + + max += PxVec3(0.02f,0.02f,0.02f); + + PxVec3 testVectors[8]; + bool foundPlane[8]; + for (PxU32 i = 0; i < 8; i++) + { + foundPlane[i] = false; + } + + testVectors[0] = PxVec3(max.x,max.y,max.z); + testVectors[1] = PxVec3(max.x,-max.y,-max.z); + testVectors[2] = PxVec3(max.x,max.y,-max.z); + testVectors[3] = PxVec3(max.x,-max.y,max.z); + testVectors[4] = PxVec3(-max.x,max.y,max.z); + testVectors[5] = PxVec3(-max.x,-max.y,max.z); + testVectors[6] = PxVec3(-max.x,max.y,-max.z); + testVectors[7] = PxVec3(-max.x,-max.y,-max.z); + + + // Extra convex hull validity check. This is less aggressive than previous convex decomposer! + // Loop through polygons + for(PxU32 i=0;i<mHull->mNbPolygons;i++) + { + const PxPlane& P = hullPolygons[i].mPlane; + + for (PxU32 k = 0; k < 8; k++) + { + if(!foundPlane[k]) + { + const float d = P.distance(testVectors[k]); + if(d >= 0) + { + foundPlane[k] = true; + } + } + } + + // Test hull vertices against polygon plane + // compute the test epsilon the same way we construct the hull, verts are considered coplanar within this epsilon + const float planeTolerance = 0.002f; + const float testEpsilon = PxMax(planeTolerance * (PxMax(PxAbs(hullMax.x), PxAbs(hullMin.x)) + + PxMax(PxAbs(hullMax.y), PxAbs(hullMin.y)) + + PxMax(PxAbs(hullMax.z), PxAbs(hullMin.z))), planeTolerance); + + for(PxU32 j=0;j<mHull->mNbHullVertices;j++) + { + // Don't test vertex if it belongs to plane (to prevent numerical issues) + PxU32 nb = hullPolygons[i].mNbVerts; + bool discard=false; + for(PxU32 k=0;k<nb;k++) + { + if(vertexData[hullPolygons[i].mVRef8+k]==PxU8(j)) + { + discard = true; + break; + } + } + + if(!discard) + { + const float d = P.distance(hullVerts[j]); +// if(d>0.0001f) + //if(d>0.02f) + if(d > testEpsilon) + { + Ps::getFoundation().error(PxErrorCode::eINTERNAL_ERROR, __FILE__, __LINE__, "Gu::ConvexMesh::checkHullPolygons: Some hull vertices seems to be too far from hull planes."); + return false; + } + } + } + } + + for (PxU32 i = 0; i < 8; i++) + { + if(!foundPlane[i]) + { + Ps::getFoundation().error(PxErrorCode::eINTERNAL_ERROR, __FILE__, __LINE__, "Gu::ConvexMesh::checkHullPolygons: Hull seems to have opened volume or do (some) faces have reversed winding?"); + return false; + } + } + + return true; +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +/** +* Computes the center of the hull. It should be inside it ! +* \param center [out] hull center +* \return true if success +*/ +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +bool ConvexHullBuilder::computeGeomCenter(PxVec3& center, PxU32 numFaces, HullTriangleData* faces) const +{ + // Checkings + const PxVec3* PX_RESTRICT hullVerts = mHullDataHullVertices; + if (!mHull->mNbHullVertices || !hullVerts) return false; + + // Use the topological method + float totalArea = 0.0f; + center = PxVec3(0); + for (PxU32 i = 0; i < numFaces; i++) + { + Gu::TriangleT<PxU32> curTri(faces[i].mRef[0], faces[i].mRef[1], faces[i].mRef[2]); + const float area = curTri.area(hullVerts); + PxVec3 curCenter; curTri.center(hullVerts, curCenter); + center += area * curCenter; + totalArea += area; + } + center /= totalArea; + + return true; +} + +////////////////////////////////////////////////////////////////////////// +// hull data store +PX_COMPILE_TIME_ASSERT(sizeof(Gu::EdgeDescData)==8); +PX_COMPILE_TIME_ASSERT(sizeof(Gu::EdgeData)==8); +bool ConvexHullBuilder::save(PxOutputStream& stream, bool platformMismatch) const +{ + // Export header + if(!WriteHeader('C', 'L', 'H', 'L', gVersion, platformMismatch, stream)) + return false; + + // Export header + if(!WriteHeader('C', 'V', 'H', 'L', gVersion, platformMismatch, stream)) + return false; + + // Export figures + + //embed grb flag into mNbEdges + PxU16 hasGRBData = PxU16(mBuildGRBData); + hasGRBData = PxU16(hasGRBData << 15); + PX_ASSERT(mHull->mNbEdges <( (1 << 15) - 1)); + const PxU16 nbEdges = PxU16(mHull->mNbEdges | hasGRBData); + writeDword(mHull->mNbHullVertices, platformMismatch, stream); + writeDword(nbEdges, platformMismatch, stream); + writeDword(computeNbPolygons(), platformMismatch, stream); // Use accessor to lazy-build + PxU32 nb=0; + for(PxU32 i=0;i<mHull->mNbPolygons;i++) + nb += mHullDataPolygons[i].mNbVerts; + writeDword(nb, platformMismatch, stream); + + // Export triangles + + writeFloatBuffer(&mHullDataHullVertices->x, PxU32(mHull->mNbHullVertices*3), platformMismatch, stream); + + // Export polygons + // TODO: allow lazy-evaluation + // We can't really store the buffer in one run anymore! + for(PxU32 i=0;i<mHull->mNbPolygons;i++) + { + Gu::HullPolygonData tmpCopy = mHullDataPolygons[i]; + if(platformMismatch) + flipData(tmpCopy); + + stream.write(&tmpCopy, sizeof(Gu::HullPolygonData)); + } + + // PT: why not storeBuffer here? + for(PxU32 i=0;i<nb;i++) + stream.write(&mHullDataVertexData8[i], sizeof(PxU8)); + + stream.write(mHullDataFacesByEdges8, PxU32(mHull->mNbEdges*2)); + stream.write(mHullDataFacesByVertices8, PxU32(mHull->mNbHullVertices*3)); + + if (mBuildGRBData) + writeWordBuffer(mEdges, PxU32(mHull->mNbEdges * 2), platformMismatch, stream); + + return true; +} + +////////////////////////////////////////////////////////////////////////// +bool ConvexHullBuilder::copy(ConvexHullData& hullData) +{ + // set the numbers + hullData.mNbHullVertices = mHull->mNbHullVertices; + hullData.mNbEdges = mHull->mNbEdges; + hullData.mNbPolygons = Ps::to8(computeNbPolygons()); + PxU32 nb = 0; + for (PxU32 i = 0; i < mHull->mNbPolygons; i++) + nb += mHullDataPolygons[i].mNbVerts; + + PxU32 bytesNeeded = Gu::computeBufferSize(hullData, nb); + + // allocate the memory first. + void* dataMemory = PX_ALLOC(bytesNeeded, "ConvexHullData data"); + + PxU8* address = reinterpret_cast<PxU8*>(dataMemory); + + // set data pointers + hullData.mPolygons = reinterpret_cast<Gu::HullPolygonData*>(address); address += sizeof(Gu::HullPolygonData) * hullData.mNbPolygons; + PxVec3* dataHullVertices = reinterpret_cast<PxVec3*>(address); address += sizeof(PxVec3) * hullData.mNbHullVertices; + PxU8* dataFacesByEdges8 = reinterpret_cast<PxU8*>(address); address += sizeof(PxU8) * hullData.mNbEdges * 2; + PxU8* dataFacesByVertices8 = reinterpret_cast<PxU8*>(address); address += sizeof(PxU8) * hullData.mNbHullVertices * 3; + PxU16* dataEdges = reinterpret_cast<PxU16*>(address); address += hullData.mNbEdges.isBitSet() ? sizeof(PxU16) *hullData.mNbEdges * 2 : 0; + PxU8* dataVertexData8 = reinterpret_cast<PxU8*>(address); address += sizeof(PxU8) * nb; // PT: leave that one last, so that we don't need to serialize "Nb" + + PX_ASSERT(!(size_t(dataHullVertices) % sizeof(PxReal))); + PX_ASSERT(!(size_t(hullData.mPolygons) % sizeof(PxReal))); + PX_ASSERT(size_t(address) <= size_t(dataMemory) + bytesNeeded); + + PX_ASSERT(mHullDataHullVertices); + PX_ASSERT(mHullDataPolygons); + PX_ASSERT(mHullDataVertexData8); + PX_ASSERT(mHullDataFacesByEdges8); + PX_ASSERT(mHullDataFacesByVertices8); + + // copy the data + PxMemCopy(dataHullVertices, &mHullDataHullVertices->x, PxU32(mHull->mNbHullVertices * 3)*sizeof(float)); + PxMemCopy(hullData.mPolygons, mHullDataPolygons , hullData.mNbPolygons*sizeof(Gu::HullPolygonData)); + PxMemCopy(dataVertexData8, mHullDataVertexData8, nb); + PxMemCopy(dataFacesByEdges8,mHullDataFacesByEdges8, PxU32(mHull->mNbEdges * 2)); + if (hullData.mNbEdges.isBitSet()) + PxMemCopy(dataEdges, mEdges, PxU32(mHull->mNbEdges * 2) * sizeof(PxU16)); + PxMemCopy(dataFacesByVertices8, mHullDataFacesByVertices8, PxU32(mHull->mNbHullVertices * 3)); + return true; +} + +////////////////////////////////////////////////////////////////////////// +// calculate vertex map table +bool ConvexHullBuilder::calculateVertexMapTable(PxU32 nbPolygons, bool userPolygons) +{ + mHullDataFacesByVertices8 = PX_NEW(PxU8)[mHull->mNbHullVertices*3u]; + PxU8 vertexMarker[256]; + PxMemSet(vertexMarker, 0, mHull->mNbHullVertices); + + for (PxU32 i = 0; i < nbPolygons; i++) + { + const Gu::HullPolygonData& polygon = mHullDataPolygons[i]; + for (PxU32 k = 0; k < polygon.mNbVerts; ++k) + { + const PxU8 index = mHullDataVertexData8[polygon.mVRef8 + k]; + if (vertexMarker[index] < 3) + { + //Found a polygon + mHullDataFacesByVertices8[index*3 + vertexMarker[index]++] = Ps::to8(i); + } + } + } + + bool noPlaneShift = false; + for (PxU32 i = 0; i < mHull->mNbHullVertices; ++i) + { + if(vertexMarker[i] != 3) + noPlaneShift = true; + } + + if (noPlaneShift) + { + //PCM will use the original shape, which means it will have a huge performance drop + if (!userPolygons) + Ps::getFoundation().error(PxErrorCode::eINTERNAL_ERROR, __FILE__, __LINE__, "ConvexHullBuilder: convex hull does not have vertex-to-face info! Try to use different convex mesh cooking settings."); + else + Ps::getFoundation().error(PxErrorCode::eINTERNAL_ERROR, __FILE__, __LINE__, "ConvexHullBuilder: convex hull does not have vertex-to-face info! Some of the vertices have less than 3 neighbor polygons. The vertex is most likely inside a polygon or on an edge between 2 polygons, please remove those vertices."); + for (PxU32 i = 0; i < mHull->mNbHullVertices; ++i) + { + mHullDataFacesByVertices8[i * 3 + 0] = 0xFF; + mHullDataFacesByVertices8[i * 3 + 1] = 0xFF; + mHullDataFacesByVertices8[i * 3 + 2] = 0xFF; + } + return false; + } + + return true; +} + + +////////////////////////////////////////////////////////////////////////// +// create edge list +bool ConvexHullBuilder::createEdgeList(bool doValidation, PxU32 nbEdges, bool prepareBigHullData) +{ + // Code below could be greatly simplified if we assume manifold meshes! + + //feodorb: ok, let's assume manifold meshes, since the code before this change + //would fail on non-maniflold meshes anyways + + // We need the adjacency graph for hull polygons, similar to what we have for triangles. + // - sort the polygon edges and walk them in order + // - each edge should appear exactly twice since a convex is a manifold mesh without boundary edges + // - the polygon index is implicit when we walk the sorted list => get the 2 polygons back and update adjacency graph + // + // Two possible structures: + // - polygon to edges: needed for local search (actually: polygon to polygons) + // - edge to polygons: needed to compute edge normals on-the-fly + + // Below is largely copied from the edge-list code + + // Polygon to edges: + // + // We're dealing with convex polygons made of N vertices, defining N edges. For each edge we want the edge in + // an edge array. + // + // Edges to polygon: + // + // For each edge in the array, we want two polygon indices - ie an edge. + + // 0) Compute the total size needed for "polygon to edges" + const PxU32 nbPolygons = mHull->mNbPolygons; + PxU32 nbEdgesUnshared = nbEdges; + + // in a manifold mesh, each edge is repeated exactly twice as it shares exactly 2 faces + if (nbEdgesUnshared % 2 != 0) + { + Ps::getFoundation().error(PxErrorCode::eINTERNAL_ERROR, __FILE__, __LINE__, "Cooking::cookConvexMesh: non-manifold mesh cannot be used, invalid mesh!"); + return false; + } + + if (prepareBigHullData) + { + mHullDataFacesByAllEdges8 = PX_NEW(PxU8)[nbEdges * 2]; + } + + // 1) Get some bytes: I need one EdgesRefs for each face, and some temp buffers + + // Face indices by edge indices. First face is the one where the edge is ordered from tail to head. + PX_DELETE_POD(mHullDataFacesByEdges8); + mHullDataFacesByEdges8 = PX_NEW(PxU8)[nbEdgesUnshared]; + + PxU32* tempBuffer = PX_NEW_TEMP(PxU32)[nbEdgesUnshared*8]; // Temp storage + PxU32* bufferAdd = tempBuffer; + PxU32* PX_RESTRICT vRefs0 = tempBuffer; tempBuffer += nbEdgesUnshared; + PxU32* PX_RESTRICT vRefs1 = tempBuffer; tempBuffer += nbEdgesUnshared; + PxU32* polyIndex = tempBuffer; tempBuffer += nbEdgesUnshared; + PxU32* vertexIndex = tempBuffer; tempBuffer += nbEdgesUnshared; + PxU32* polyIndex2 = tempBuffer; tempBuffer += nbEdgesUnshared; + PxU32* vertexIndex2 = tempBuffer; tempBuffer += nbEdgesUnshared; + PxU32* edgeIndex = tempBuffer; tempBuffer += nbEdgesUnshared; + PxU32* edgeData = tempBuffer; tempBuffer += nbEdgesUnshared; + + // TODO avoroshilov: use the same "tempBuffer" + bool* flippedVRefs = PX_NEW_TEMP(bool)[nbEdgesUnshared]; // Temp storage + + PxU32* run0 = vRefs0; + PxU32* run1 = vRefs1; + PxU32* run2 = polyIndex; + PxU32* run3 = vertexIndex; + bool* run4 = flippedVRefs; + + // 2) Create a full redundant list of edges + PxU32 edgeCounter = 0; + for(PxU32 i=0;i<nbPolygons;i++) + { + PxU32 nbVerts = mHullDataPolygons[i].mNbVerts; + const PxU8* PX_RESTRICT Data = mHullDataVertexData8 + mHullDataPolygons[i].mVRef8; + + // Loop through polygon vertices + for(PxU32 j=0;j<nbVerts;j++) + { + PxU32 vRef0 = Data[j]; + PxU32 vRef1 = Data[(j+1)%nbVerts]; + bool flipped = vRef0>vRef1; + + if (flipped) + physx::shdfnd::swap(vRef0, vRef1); + + *run0++ = vRef0; + *run1++ = vRef1; + *run2++ = i; + *run3++ = j; + *run4++ = flipped; + edgeData[edgeCounter] = edgeCounter; + edgeCounter++; + } + } + PX_ASSERT(PxU32(run0-vRefs0)==nbEdgesUnshared); + PX_ASSERT(PxU32(run1-vRefs1)==nbEdgesUnshared); + + // 3) Sort the list according to both keys (VRefs0 and VRefs1) + Cm::RadixSortBuffered sorter; + const PxU32* PX_RESTRICT sorted = sorter.Sort(vRefs1, nbEdgesUnshared,Cm::RADIX_UNSIGNED).Sort(vRefs0, nbEdgesUnshared,Cm::RADIX_UNSIGNED).GetRanks(); + + PX_DELETE_POD(mEdges); + // Edges by their tail and head VRefs. NbEdgesUnshared == nbEdges * 2 + // mEdges[edgeIdx*2 + 0] = tailVref, mEdges[edgeIdx*2 + 1] = headVref + // Tails and heads should be consistent with face refs, so that the edge is given in the order of + // his first face and opposite to the order of his second face + mEdges = PX_NEW(PxU16)[nbEdgesUnshared]; + + PX_DELETE_POD(mEdgeData16); + // Face to edge mapping + mEdgeData16 = PX_NEW(PxU16)[nbEdgesUnshared]; + + // TODO avoroshilov: remove this comment + //mHull->mNbEdges = Ps::to16(nbEdgesUnshared / 2); // #non-redundant edges + + mHull->mNbEdges = 0; // #non-redundant edges + + // A.B. Comment out the early exit temporary since we need to precompute the additonal edge data for GPU + //if (!doValidation) + //{ + // // TODO avoroshilov: this codepath is not supported + + // for (PxU32 i = 0; i < nbEdgesUnshared; i = i + 2) + // { + // const PxU32 sortedIndex = sorted[i]; // Between 0 and Nb + // const PxU32 nextSortedIndex = sorted[i + 1]; // Between 0 and Nb + // const PxU32 polyID = polyIndex[sortedIndex]; // Poly index + // const PxU32 nextPolyID = polyIndex[nextSortedIndex]; // Poly index + // + // mHullDataFacesByEdges8[(mHull->mNbEdges) * 2] = Ps::to8(polyID); + // mHullDataFacesByEdges8[(mHull->mNbEdges) * 2 + 1] = Ps::to8(nextPolyID); + + // // store the full edge data for later use in big convex hull valencies computation + // if(mHullDataFacesByAllEdges8) + // { + // mHullDataFacesByAllEdges8[edgeData[sortedIndex] * 2] = Ps::to8(polyID); + // mHullDataFacesByAllEdges8[edgeData[sortedIndex] * 2 + 1] = Ps::to8(nextPolyID); + + // mHullDataFacesByAllEdges8[edgeData[nextSortedIndex] * 2] = Ps::to8(polyID); + // mHullDataFacesByAllEdges8[edgeData[nextSortedIndex] * 2 + 1] = Ps::to8(nextPolyID); + // } + // mHull->mNbEdges++; + // } + + // PX_DELETE_POD(bufferAdd); + // return true; + //} + + // 4) Loop through all possible edges + // - clean edges list by removing redundant edges + // - create EdgesRef list + // mNbFaces = nbFaces; + + // TODO avoroshilov: + PxU32 numFacesPerEdgeVerificationCounter = 0; + + PxU16* edgeVertOutput = mEdges; + + PxU32 previousRef0 = PX_INVALID_U32; + PxU32 previousRef1 = PX_INVALID_U32; + PxU32 previousIndex = PX_INVALID_U32; + PxU32 previousPolyId = PX_INVALID_U32; + + PxU16 nbHullEdges = 0; + for (PxU32 i = 0; i < nbEdgesUnshared; i++) + { + const PxU32 sortedIndex = sorted[i]; // Between 0 and Nb + const PxU32 polyID = polyIndex[sortedIndex]; // Poly index + const PxU32 vertexID = vertexIndex[sortedIndex]; // Poly index + PxU32 sortedRef0 = vRefs0[sortedIndex]; // (SortedRef0, SortedRef1) is the sorted edge + PxU32 sortedRef1 = vRefs1[sortedIndex]; + bool flipped = flippedVRefs[sortedIndex]; + + if (sortedRef0 != previousRef0 || sortedRef1 != previousRef1) + { + // TODO avoroshilov: remove this? + if (i != 0 && numFacesPerEdgeVerificationCounter != 1) + { + Ps::getFoundation().error(PxErrorCode::eINTERNAL_ERROR, __FILE__, __LINE__, "Cooking::cookConvexMesh: non-manifold mesh cannot be used, invalid mesh!"); + return false; + } + numFacesPerEdgeVerificationCounter = 0; + + // ### TODO: change this in edge list as well + previousRef0 = sortedRef0; + previousRef1 = sortedRef1; + previousPolyId = polyID; + + //feodorb:restore the original order of VRefs (tail and head) + if (flipped) + physx::shdfnd::swap(sortedRef0, sortedRef1); + + *edgeVertOutput++ = Ps::to16(sortedRef0); + *edgeVertOutput++ = Ps::to16(sortedRef1); + + nbHullEdges++; + } + else + { + mHullDataFacesByEdges8[(nbHullEdges - 1) * 2] = Ps::to8(previousPolyId); + mHullDataFacesByEdges8[(nbHullEdges - 1) * 2 + 1] = Ps::to8(polyID); + + ++numFacesPerEdgeVerificationCounter; + } + + mEdgeData16[mHullDataPolygons[polyID].mVRef8 + vertexID] = Ps::to16(i / 2); + + if (mHullDataFacesByAllEdges8) + { + if (previousIndex != PX_INVALID_U32) + { + // store the full edge data for later use in big convex hull valencies computation + mHullDataFacesByAllEdges8[edgeData[sortedIndex] * 2] = Ps::to8(polyID); + mHullDataFacesByAllEdges8[edgeData[sortedIndex] * 2 + 1] = Ps::to8(polyIndex[previousIndex]); + + mHullDataFacesByAllEdges8[edgeData[previousIndex] * 2] = Ps::to8(polyID); + mHullDataFacesByAllEdges8[edgeData[previousIndex] * 2 + 1] = Ps::to8(polyIndex[previousIndex]); + previousIndex = PX_INVALID_U32; + } + else + { + previousIndex = sortedIndex; + } + } + // Create mEdgesRef on the fly + + polyIndex2[i] = polyID; + vertexIndex2[i] = vertexID; + edgeIndex[i] = PxU32(nbHullEdges - 1); + } + + mHull->mNbEdges = nbHullEdges; + + ////////////////////// + + // 2) Get some bytes: one Pair structure / edge + // create this structure only for validation purpose + // 3) Create Counters, ie compute the #faces sharing each edge + if(doValidation) + { + // + sorted = sorter.Sort(vertexIndex2, nbEdgesUnshared, Cm::RADIX_UNSIGNED).Sort(polyIndex2, nbEdgesUnshared, Cm::RADIX_UNSIGNED).GetRanks(); + + for (PxU32 i = 0; i < nbEdgesUnshared; i++) edgeData[i] = edgeIndex[sorted[i]]; + + Gu::EdgeDescData* edgeToTriangles = PX_NEW(Gu::EdgeDescData)[PxU16(mHull->mNbEdges)]; + PxMemZero(edgeToTriangles, sizeof(Gu::EdgeDescData)*mHull->mNbEdges); + + PxU32* data = edgeData; + for(PxU32 i=0;i<nbEdgesUnshared;i++) // <= maybe not the same Nb + { + edgeToTriangles[*data++].Count++; + } + + // if we don't have a manifold mesh, this can fail... but the runtime would assert in any case + for (PxU32 i = 0; i < mHull->mNbEdges; i++) + { + if (edgeToTriangles[i].Count != 2) + { + Ps::getFoundation().error(PxErrorCode::eINTERNAL_ERROR, __FILE__, __LINE__, "Cooking::cookConvexMesh: non-manifold mesh cannot be used, invalid mesh!"); + return false; + } + } + PX_DELETE_POD(edgeToTriangles); + } + + // ### free temp ram + PX_DELETE_POD(bufferAdd); + + // TODO avoroshilov: use the same "tempBuffer" + PX_DELETE_POD(flippedVRefs); + + return true; +} + diff --git a/PhysX_3.4/Source/PhysXCooking/src/convex/ConvexHullBuilder.h b/PhysX_3.4/Source/PhysXCooking/src/convex/ConvexHullBuilder.h new file mode 100644 index 00000000..a3d57202 --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/convex/ConvexHullBuilder.h @@ -0,0 +1,95 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + + +#ifndef PX_CONVEXHULLBUILDER_H +#define PX_CONVEXHULLBUILDER_H + +#include "GuConvexMeshData.h" +#include "PsUserAllocated.h" +#include "PxCooking.h" + +namespace physx +{ + struct PxHullPolygon; + + namespace Gu + { + struct EdgeDescData; + struct ConvexHullData; + } // namespace Gu + + struct HullTriangleData + { + PxU32 mRef[3]; + }; + + class ConvexHullBuilder : public Ps::UserAllocated + { + public: + ConvexHullBuilder(Gu::ConvexHullData* hull, const bool buildGRBData); + ~ConvexHullBuilder(); + + bool init(PxU32 nbVerts, const PxVec3* verts, const PxU32* indices, const PxU32 nbIndices, const PxU32 nbPolygons, + const PxHullPolygon* hullPolygons, PxU32 gaussMapVertexLimit, bool doValidation = true, bool userPolygons = false); + + bool save(PxOutputStream& stream, bool platformMismatch) const; + bool copy(Gu::ConvexHullData& hullData); + + bool createEdgeList(bool doValidation, PxU32 nbEdges, bool prepareBigHullData); + bool checkHullPolygons() const; + + bool calculateVertexMapTable(PxU32 nbPolygons, bool userPolygons = false); + + PX_INLINE PxU32 computeNbPolygons() const + { + PX_ASSERT(mHull->mNbPolygons); + return mHull->mNbPolygons; + } + + PxVec3* mHullDataHullVertices; + Gu::HullPolygonData* mHullDataPolygons; + PxU8* mHullDataVertexData8; + PxU8* mHullDataFacesByEdges8; + PxU8* mHullDataFacesByVertices8; + PxU8* mHullDataFacesByAllEdges8; // data used fom big hull valencies computation + + PxU16* mEdgeData16; //!< Edge indices indexed by hull polygons + PxU16* mEdges; //!< Edge to vertex mapping + + Gu::ConvexHullData* mHull; + bool mBuildGRBData; + + protected: + bool computeGeomCenter(PxVec3& , PxU32 numFaces, HullTriangleData* faces) const; + }; +} + +#endif // PX_CONVEXHULLBUILDER_H + diff --git a/PhysX_3.4/Source/PhysXCooking/src/convex/ConvexHullLib.cpp b/PhysX_3.4/Source/PhysXCooking/src/convex/ConvexHullLib.cpp new file mode 100644 index 00000000..92ffc888 --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/convex/ConvexHullLib.cpp @@ -0,0 +1,299 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + + +#include "ConvexHullLib.h" +#include "Quantizer.h" +#include "PsAllocator.h" +#include "foundation/PxBounds3.h" +#include "foundation/PxMemory.h" + +using namespace physx; + +namespace local +{ + ////////////////////////////////////////////////////////////////////////// + // constants + static const float DISTANCE_EPSILON = 0.000001f; // close enough to consider two floating point numbers to be 'the same'. + static const float NORMAL_DISTANCE_EPSILON = 0.001f; // close enough to consider two floating point numbers to be 'the same' in normalized points cloud. + static const float RESIZE_VALUE = 0.01f; // if the provided points AABB is very thin resize it to this size + + ////////////////////////////////////////////////////////////////////////// + // checks if points form a valid AABB cube, if not construct a default CUBE + static bool checkPointsAABBValidity(PxU32 numPoints, const PxVec3* points, PxU32 stride , float distanceEpsilon, + float resizeValue, PxVec3& center, PxVec3& scale, PxU32& vcount, PxVec3* vertices, bool fCheck = false) + { + const char* vtx = reinterpret_cast<const char *> (points); + PxBounds3 bounds; + bounds.setEmpty(); + + // get the bounding box + for (PxU32 i = 0; i < numPoints; i++) + { + const PxVec3& p = *reinterpret_cast<const PxVec3 *> (vtx); + vtx += stride; + + bounds.include(p); + } + + PxVec3 dim = bounds.getDimensions(); + center = bounds.getCenter(); + + // special case, the AABB is very thin or user provided us with only input 2 points + // we construct an AABB cube and return it + if ( dim.x < distanceEpsilon || dim.y < distanceEpsilon || dim.z < distanceEpsilon || numPoints < 3 ) + { + float len = FLT_MAX; + + // pick the shortest size bigger than the distance epsilon + if ( dim.x > distanceEpsilon && dim.x < len ) + len = dim.x; + if ( dim.y > distanceEpsilon && dim.y < len ) + len = dim.y; + if ( dim.z > distanceEpsilon && dim.z < len ) + len = dim.z; + + // if the AABB is small in all dimensions, resize it + if ( len == FLT_MAX ) + { + dim = PxVec3(resizeValue); + } + // if one edge is small, set to 1/5th the shortest non-zero edge. + else + { + if ( dim.x < distanceEpsilon ) + dim.x = len * 0.05f; + else + dim.x *= 0.5f; + if ( dim.y < distanceEpsilon ) + dim.y = len * 0.05f; + else + dim.y *= 0.5f; + if ( dim.z < distanceEpsilon ) + dim.z = len * 0.05f; + else + dim.z *= 0.5f; + } + + // construct the AABB + const PxVec3 extPos = center + dim; + const PxVec3 extNeg = center - dim; + + if(fCheck) + vcount = 0; + + vertices[vcount++] = extNeg; + vertices[vcount++] = PxVec3(extPos.x,extNeg.y,extNeg.z); + vertices[vcount++] = PxVec3(extPos.x,extPos.y,extNeg.z); + vertices[vcount++] = PxVec3(extNeg.x,extPos.y,extNeg.z); + vertices[vcount++] = PxVec3(extNeg.x,extNeg.y,extPos.z); + vertices[vcount++] = PxVec3(extPos.x,extNeg.y,extPos.z); + vertices[vcount++] = extPos; + vertices[vcount++] = PxVec3(extNeg.x,extPos.y,extPos.z); + return true; // return cube + } + else + { + scale = dim; + } + return false; + } + +} + +////////////////////////////////////////////////////////////////////////// +// normalize point cloud, remove duplicates! +bool ConvexHullLib::cleanupVertices(PxU32 svcount, const PxVec3* svertices, PxU32 stride, + PxU32& vcount, PxVec3* vertices, PxVec3& scale, PxVec3& center) +{ + if ( svcount == 0 ) + return false; + + const PxVec3* verticesToClean = svertices; + PxU32 numVerticesToClean = svcount; + Quantizer* quantizer = NULL; + + // if quantization is enabled, parse the input vertices and produce new qantized vertices, + // that will be then cleaned the same way + if (mConvexMeshDesc.flags & PxConvexFlag::eQUANTIZE_INPUT) + { + quantizer = createQuantizer(); + PxU32 vertsOutCount; + const PxVec3* vertsOut = quantizer->kmeansQuantize3D(svcount, svertices, stride,true, mConvexMeshDesc.quantizedCount, vertsOutCount); + + if (vertsOut) + { + numVerticesToClean = vertsOutCount; + verticesToClean = vertsOut; + } + } + + const float distanceEpsilon = local::DISTANCE_EPSILON * mCookingParams.scale.length; + const float resizeValue = local::RESIZE_VALUE * mCookingParams.scale.length; + const float normalEpsilon = local::NORMAL_DISTANCE_EPSILON; // used to determine if 2 points are the same + + vcount = 0; + PxVec3 recip; + + scale = PxVec3(1.0f); + + // check for the AABB from points, if its very tiny return a resized CUBE + if (local::checkPointsAABBValidity(numVerticesToClean, verticesToClean, stride, distanceEpsilon, resizeValue, center, scale, vcount, vertices, false)) + { + if (quantizer) + quantizer->release(); + return true; + } + + recip[0] = 1 / scale[0]; + recip[1] = 1 / scale[1]; + recip[2] = 1 / scale[2]; + + center = center.multiply(recip); + + // normalize the point cloud + const char * vtx = reinterpret_cast<const char *> (verticesToClean); + for (PxU32 i = 0; i<numVerticesToClean; i++) + { + const PxVec3& p = *reinterpret_cast<const PxVec3 *>(vtx); + vtx+=stride; + + PxVec3 normalizedP = p.multiply(recip); // normalize + + PxU32 j; + + // parse the already stored vertices and check the distance + for (j=0; j<vcount; j++) + { + PxVec3& v = vertices[j]; + + const float dx = fabsf(normalizedP[0] - v[0] ); + const float dy = fabsf(normalizedP[1] - v[1] ); + const float dz = fabsf(normalizedP[2] - v[2] ); + + if ( dx < normalEpsilon && dy < normalEpsilon && dz < normalEpsilon ) + { + // ok, it is close enough to the old one + // now let us see if it is further from the center of the point cloud than the one we already recorded. + // in which case we keep this one instead. + const float dist1 = (normalizedP - center).magnitudeSquared(); + const float dist2 = (v - center).magnitudeSquared(); + + if ( dist1 > dist2 ) + { + v = normalizedP; + } + break; + } + } + + // we dont have that vertex in the output, add it + if ( j == vcount ) + { + vertices[vcount] = normalizedP; + vcount++; + } + } + + // scale the verts back + for (PxU32 i = 0; i < vcount; i++) + { + vertices[i] = vertices[i].multiply(scale); + } + + // ok..now make sure we didn't prune so many vertices it is now invalid. + // note, that the output vertices are again scaled, we need to scale them back then + local::checkPointsAABBValidity(vcount, vertices, sizeof(PxVec3), distanceEpsilon, resizeValue, center, scale, vcount, vertices, true); + + if (quantizer) + quantizer->release(); + return true; +} + +void ConvexHullLib::swapLargestFace(PxConvexMeshDesc& desc) +{ + const PxHullPolygon* polygons = reinterpret_cast<const PxHullPolygon*>(desc.polygons.data); + PxHullPolygon* polygonsOut = const_cast<PxHullPolygon*>(polygons); + + PxU32 largestFace = 0; + for (PxU32 i = 1; i < desc.polygons.count; i++) + { + if(polygons[largestFace].mNbVerts < polygons[i].mNbVerts) + largestFace = i; + } + + // early exit if no swap needs to be done + if(largestFace == 0) + return; + + const PxU32* indices = reinterpret_cast<const PxU32*>(desc.indices.data); + mSwappedIndices = reinterpret_cast<PxU32*> (PX_ALLOC_TEMP(sizeof(PxU32)*desc.indices.count, "PxU32")); + + PxHullPolygon replacedPolygon = polygons[0]; + PxHullPolygon largestPolygon = polygons[largestFace]; + polygonsOut[0] = polygons[largestFace]; + polygonsOut[largestFace] = replacedPolygon; + + // relocate indices + PxU16 indexBase = 0; + for (PxU32 i = 0; i < desc.polygons.count; i++) + { + if(i == 0) + { + PxMemCopy(mSwappedIndices, &indices[largestPolygon.mIndexBase],sizeof(PxU32)*largestPolygon.mNbVerts); + polygonsOut[0].mIndexBase = indexBase; + indexBase += largestPolygon.mNbVerts; + } + else + { + if(i == largestFace) + { + PxMemCopy(&mSwappedIndices[indexBase], &indices[replacedPolygon.mIndexBase], sizeof(PxU32)*replacedPolygon.mNbVerts); + polygonsOut[i].mIndexBase = indexBase; + indexBase += replacedPolygon.mNbVerts; + } + else + { + PxMemCopy(&mSwappedIndices[indexBase], &indices[polygons[i].mIndexBase], sizeof(PxU32)*polygons[i].mNbVerts); + polygonsOut[i].mIndexBase = indexBase; + indexBase += polygons[i].mNbVerts; + } + } + } + + PX_ASSERT(indexBase == desc.indices.count); + + desc.indices.data = mSwappedIndices; +} + +ConvexHullLib::~ConvexHullLib() +{ + if (mSwappedIndices) + PX_FREE(mSwappedIndices); +} diff --git a/PhysX_3.4/Source/PhysXCooking/src/convex/ConvexHullLib.h b/PhysX_3.4/Source/PhysXCooking/src/convex/ConvexHullLib.h new file mode 100644 index 00000000..19ab68fe --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/convex/ConvexHullLib.h @@ -0,0 +1,82 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + + +#ifndef PX_CONVEXHULLLIB_H +#define PX_CONVEXHULLLIB_H + +#include "PxConvexMeshDesc.h" +#include "PxCooking.h" +#include "CmPhysXCommon.h" + +namespace physx +{ + ////////////////////////////////////////////////////////////////////////// + // base class for the convex hull libraries - inflation based and quickhull + class ConvexHullLib + { + PX_NOCOPY(ConvexHullLib) + public: + // functions + ConvexHullLib(const PxConvexMeshDesc& desc, const PxCookingParams& params) + : mConvexMeshDesc(desc), mCookingParams(params), mSwappedIndices(NULL) + { + } + + virtual ~ConvexHullLib(); + + // computes the convex hull from provided points + virtual PxConvexMeshCookingResult::Enum createConvexHull() = 0; + + // fills the PxConvexMeshDesc with computed hull data + virtual void fillConvexMeshDesc(PxConvexMeshDesc& desc) = 0; + + static const PxU32 gpuMaxVertsPerFace = 32; + + protected: + + // clean input vertices from duplicates, normalize etc. + bool cleanupVertices(PxU32 svcount, // input vertex count + const PxVec3* svertices, // vertices + PxU32 stride, // stride + PxU32& vcount, // output number of vertices + PxVec3* vertices, // location to store the results. + PxVec3& scale, // scale + PxVec3& center); // center + + void swapLargestFace(PxConvexMeshDesc& desc); + + protected: + const PxConvexMeshDesc& mConvexMeshDesc; + const PxCookingParams& mCookingParams; + PxU32* mSwappedIndices; + }; +} + +#endif diff --git a/PhysX_3.4/Source/PhysXCooking/src/convex/ConvexHullUtils.cpp b/PhysX_3.4/Source/PhysXCooking/src/convex/ConvexHullUtils.cpp new file mode 100644 index 00000000..cf921a16 --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/convex/ConvexHullUtils.cpp @@ -0,0 +1,925 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + + +#include "foundation/PxBounds3.h" +#include "foundation/PxMathUtils.h" + +#include "ConvexHullUtils.h" +#include "VolumeIntegration.h" +#include "PsUtilities.h" +#include "PsVecMath.h" +#include "GuBox.h" +#include "GuConvexMeshData.h" + +using namespace physx; +using namespace Ps::aos; + +namespace local +{ + static const float MIN_ADJACENT_ANGLE = 3.0f; // in degrees - result wont have two adjacent facets within this angle of each other. + static const float MAXDOT_MINANG = cosf(Ps::degToRad(MIN_ADJACENT_ANGLE)); // adjacent angle for dot product tests + + ////////////////////////////////////////////////////////////////////////// + // helper class for ConvexHullCrop + class VertFlag + { + public: + PxU8 planetest; + PxU8 undermap; + PxU8 overmap; + }; + + //////////////////////////////////////////////////////////////////////////| + // helper class for ConvexHullCrop + class EdgeFlag + { + public: + PxI16 undermap; + }; + + //////////////////////////////////////////////////////////////////////////| + // helper class for ConvexHullCrop + class Coplanar + { + public: + PxU16 ea; + PxU8 v0; + PxU8 v1; + }; + + ////////////////////////////////////////////////////////////////////////// + // plane test + enum PlaneTestResult + { + eCOPLANAR = 0, + eUNDER = 1 << 0, + eOVER = 1 << 1 + }; + + ////////////////////////////////////////////////////////////////////////// + // test where vertex lies in respect to the plane + static PlaneTestResult planeTest(const PxPlane& p, const PxVec3& v, float epsilon) + { + const float a = v.dot(p.n) + p.d; + PlaneTestResult flag = (a > epsilon) ? eOVER : ((a < -epsilon) ? eUNDER : eCOPLANAR); + return flag; + } + + // computes the OBB for this set of points relative to this transform matrix. SIMD version + void computeOBBSIMD(PxU32 vcount, const Vec4V* points, Vec4V& sides, const QuatV& rot, Vec4V& trans) + { + PX_ASSERT(vcount); + + Vec4V minV = V4Load(FLT_MAX); + Vec4V maxV = V4Load(FLT_MIN); + for (PxU32 i = 0; i < vcount; i++) + { + const Vec4V& vertexV = points[i]; + const Vec4V t = V4Sub(vertexV, trans); + const Vec4V v = Vec4V_From_Vec3V(QuatRotateInv(rot, Vec3V_From_Vec4V(t))); + + minV = V4Min(minV, v); + maxV = V4Max(maxV, v); + } + + sides = V4Sub(maxV, minV); + + Mat33V tmpMat; + QuatGetMat33V(rot, tmpMat.col0, tmpMat.col1, tmpMat.col2); + const FloatV coe = FLoad(0.5f); + + const Vec4V deltaVec = V4Sub(maxV, V4Scale(sides, coe)); + + const Vec4V t0 = V4Scale(Vec4V_From_Vec3V(tmpMat.col0), V4GetX(deltaVec)); + trans = V4Add(trans, t0); + + const Vec4V t1 = V4Scale(Vec4V_From_Vec3V(tmpMat.col1), V4GetY(deltaVec)); + trans = V4Add(trans, t1); + + const Vec4V t2 = V4Scale(Vec4V_From_Vec3V(tmpMat.col2), V4GetZ(deltaVec)); + trans = V4Add(trans, t2); + } +} + +////////////////////////////////////////////////////////////////////////// +// construct the base cube from given min/max +ConvexHull::ConvexHull(const PxVec3& bmin, const PxVec3& bmax, const Ps::Array<PxPlane>& inPlanes) +: mInputPlanes(inPlanes) +{ + // min max verts of the cube - 8 verts + mVertices.pushBack(PxVec3(bmin.x, bmin.y, bmin.z)); // --- + mVertices.pushBack(PxVec3(bmin.x, bmin.y, bmax.z)); // --+ + mVertices.pushBack(PxVec3(bmin.x, bmax.y, bmin.z)); // -+- + mVertices.pushBack(PxVec3(bmin.x, bmax.y, bmax.z)); // -++ + mVertices.pushBack(PxVec3(bmax.x, bmin.y, bmin.z)); // +-- + mVertices.pushBack(PxVec3(bmax.x, bmin.y, bmax.z)); // +-+ + mVertices.pushBack(PxVec3(bmax.x, bmax.y, bmin.z)); // ++- + mVertices.pushBack(PxVec3(bmax.x, bmax.y, bmax.z)); // +++ + + // cube planes - 6 planes + mFacets.pushBack(PxPlane(PxVec3(-1.f, 0, 0), bmin.x)); // 0,1,3,2 + mFacets.pushBack(PxPlane(PxVec3(1.f, 0, 0), -bmax.x)); // 6,7,5,4 + mFacets.pushBack(PxPlane(PxVec3(0, -1.f, 0), bmin.y)); // 0,4,5,1 + mFacets.pushBack(PxPlane(PxVec3(0, 1.f, 0), -bmax.y)); // 3,7,6,2 + mFacets.pushBack(PxPlane(PxVec3(0, 0, -1.f), bmin.z)); // 0,2,6,4 + mFacets.pushBack(PxPlane(PxVec3(0, 0, 1.f), -bmax.z)); // 1,5,7,3 + + // cube edges - 24 edges + mEdges.pushBack(HalfEdge(11, 0, 0)); + mEdges.pushBack(HalfEdge(23, 1, 0)); + mEdges.pushBack(HalfEdge(15, 3, 0)); + mEdges.pushBack(HalfEdge(16, 2, 0)); + + mEdges.pushBack(HalfEdge(13, 6, 1)); + mEdges.pushBack(HalfEdge(21, 7, 1)); + mEdges.pushBack(HalfEdge(9, 5, 1)); + mEdges.pushBack(HalfEdge(18, 4, 1)); + + mEdges.pushBack(HalfEdge(19, 0, 2)); + mEdges.pushBack(HalfEdge(6, 4, 2)); + mEdges.pushBack(HalfEdge(20, 5, 2)); + mEdges.pushBack(HalfEdge(0, 1, 2)); + + mEdges.pushBack(HalfEdge(22, 3, 3)); + mEdges.pushBack(HalfEdge(4, 7, 3)); + mEdges.pushBack(HalfEdge(17, 6, 3)); + mEdges.pushBack(HalfEdge(2, 2, 3)); + + mEdges.pushBack(HalfEdge(3, 0, 4)); + mEdges.pushBack(HalfEdge(14, 2, 4)); + mEdges.pushBack(HalfEdge(7, 6, 4)); + mEdges.pushBack(HalfEdge(8, 4, 4)); + + mEdges.pushBack(HalfEdge(10, 1, 5)); + mEdges.pushBack(HalfEdge(5, 5, 5)); + mEdges.pushBack(HalfEdge(12, 7, 5)); + mEdges.pushBack(HalfEdge(1, 3, 5)); +} + +////////////////////////////////////////////////////////////////////////// +// create the initial convex hull from given OBB +ConvexHull::ConvexHull(const PxVec3& extent, const PxTransform& transform, const Ps::Array<PxPlane>& inPlanes) + : mInputPlanes(inPlanes) +{ + // get the OBB corner points + PxVec3 extentPoints[8]; + PxMat33 rot(transform.q); + Gu::computeOBBPoints(extentPoints, transform.p, extent, rot.column0, rot.column1, rot.column2); + + mVertices.pushBack(PxVec3(extentPoints[0].x, extentPoints[0].y, extentPoints[0].z)); // --- + mVertices.pushBack(PxVec3(extentPoints[4].x, extentPoints[4].y, extentPoints[4].z)); // --+ + mVertices.pushBack(PxVec3(extentPoints[3].x, extentPoints[3].y, extentPoints[3].z)); // -+- + mVertices.pushBack(PxVec3(extentPoints[7].x, extentPoints[7].y, extentPoints[7].z)); // -++ + mVertices.pushBack(PxVec3(extentPoints[1].x, extentPoints[1].y, extentPoints[1].z)); // +-- + mVertices.pushBack(PxVec3(extentPoints[5].x, extentPoints[5].y, extentPoints[5].z)); // +-+ + mVertices.pushBack(PxVec3(extentPoints[2].x, extentPoints[2].y, extentPoints[2].z)); // ++- + mVertices.pushBack(PxVec3(extentPoints[6].x, extentPoints[6].y, extentPoints[6].z)); // +++ + + // cube planes - 6 planes + PxPlane plane0(extentPoints[0], extentPoints[4], extentPoints[7]); // 0,1,3,2 + mFacets.pushBack(PxPlane(plane0.n, plane0.d)); + + PxPlane plane1(extentPoints[2], extentPoints[6], extentPoints[5]); // 6,7,5,4 + mFacets.pushBack(PxPlane(plane1.n, plane1.d)); + + PxPlane plane2(extentPoints[0], extentPoints[1], extentPoints[5]); // 0,4,5,1 + mFacets.pushBack(PxPlane(plane2.n, plane2.d)); + + PxPlane plane3(extentPoints[7], extentPoints[6], extentPoints[2]); // 3,7,6,2 + mFacets.pushBack(PxPlane(plane3.n, plane3.d)); + + PxPlane plane4(extentPoints[0], extentPoints[3], extentPoints[2]); // 0,2,6,4 + mFacets.pushBack(PxPlane(plane4.n, plane4.d)); + + PxPlane plane5(extentPoints[4], extentPoints[5], extentPoints[6]); // 1,5,7,3 + mFacets.pushBack(PxPlane(plane5.n, plane5.d)); + + // cube edges - 24 edges + mEdges.pushBack(HalfEdge(11, 0, 0)); + mEdges.pushBack(HalfEdge(23, 1, 0)); + mEdges.pushBack(HalfEdge(15, 3, 0)); + mEdges.pushBack(HalfEdge(16, 2, 0)); + + mEdges.pushBack(HalfEdge(13, 6, 1)); + mEdges.pushBack(HalfEdge(21, 7, 1)); + mEdges.pushBack(HalfEdge(9, 5, 1)); + mEdges.pushBack(HalfEdge(18, 4, 1)); + + mEdges.pushBack(HalfEdge(19, 0, 2)); + mEdges.pushBack(HalfEdge(6, 4, 2)); + mEdges.pushBack(HalfEdge(20, 5, 2)); + mEdges.pushBack(HalfEdge(0, 1, 2)); + + mEdges.pushBack(HalfEdge(22, 3, 3)); + mEdges.pushBack(HalfEdge(4, 7, 3)); + mEdges.pushBack(HalfEdge(17, 6, 3)); + mEdges.pushBack(HalfEdge(2, 2, 3)); + + mEdges.pushBack(HalfEdge(3, 0, 4)); + mEdges.pushBack(HalfEdge(14, 2, 4)); + mEdges.pushBack(HalfEdge(7, 6, 4)); + mEdges.pushBack(HalfEdge(8, 4, 4)); + + mEdges.pushBack(HalfEdge(10, 1, 5)); + mEdges.pushBack(HalfEdge(5, 5, 5)); + mEdges.pushBack(HalfEdge(12, 7, 5)); + mEdges.pushBack(HalfEdge(1, 3, 5)); +} + +////////////////////////////////////////////////////////////////////////// +// finds the candidate plane, returns -1 otherwise +PxI32 ConvexHull::findCandidatePlane(float planeTestEpsilon, float epsilon) const +{ + PxI32 p = -1; + float md = 0.0f; + PxU32 i, j; + for (i = 0; i < mInputPlanes.size(); i++) + { + float d = 0.0f; + float dmax = 0.0f; + float dmin = 0.0f; + for (j = 0; j < mVertices.size(); j++) + { + dmax = PxMax(dmax, mVertices[j].dot(mInputPlanes[i].n) + mInputPlanes[i].d); + dmin = PxMin(dmin, mVertices[j].dot(mInputPlanes[i].n) + mInputPlanes[i].d); + } + + float dr = dmax - dmin; + if (dr < planeTestEpsilon) + dr = 1.0f; // shouldn't happen. + d = dmax / dr; + // we have a better candidate try another one + if (d <= md) + continue; + // check if we dont have already that plane or if the normals are nearly the same + for (j = 0; j<mFacets.size(); j++) + { + if (mInputPlanes[i] == mFacets[j]) + { + d = 0.0f; + continue; + } + if (mInputPlanes[i].n.dot(mFacets[j].n)> local::MAXDOT_MINANG) + { + for (PxU32 k = 0; k < mEdges.size(); k++) + { + if (mEdges[k].p != j) + continue; + if (mVertices[mEdges[k].v].dot(mInputPlanes[i].n) + mInputPlanes[i].d < 0) + { + d = 0; // so this plane wont get selected. + break; + } + } + } + } + if (d>md) + { + p = PxI32(i); + md = d; + } + } + return (md > epsilon) ? p : -1; +} + +////////////////////////////////////////////////////////////////////////// +// internal hull check +bool ConvexHull::assertIntact(float epsilon) const +{ + PxU32 i; + PxU32 estart = 0; + for (i = 0; i < mEdges.size(); i++) + { + if (mEdges[estart].p != mEdges[i].p) + { + estart = i; + } + PxU32 inext = i + 1; + if (inext >= mEdges.size() || mEdges[inext].p != mEdges[i].p) + { + inext = estart; + } + PX_ASSERT(mEdges[inext].p == mEdges[i].p); + PxI16 nb = mEdges[i].ea; + if (nb == 255 || nb == -1) + return false; + PX_ASSERT(nb != -1); + PX_ASSERT(i == PxU32(mEdges[PxU32(nb)].ea)); + // Check that the vertex of the next edge is the vertex of the adjacent half edge. + // Otherwise the two half edges are not really adjacent and we have a hole. + PX_ASSERT(mEdges[PxU32(nb)].v == mEdges[inext].v); + if (!(mEdges[PxU32(nb)].v == mEdges[inext].v)) + return false; + } + + for (i = 0; i < mEdges.size(); i++) + { + PX_ASSERT(local::eCOPLANAR == local::planeTest(mFacets[mEdges[i].p], mVertices[mEdges[i].v], epsilon)); + if (local::eCOPLANAR != local::planeTest(mFacets[mEdges[i].p], mVertices[mEdges[i].v], epsilon)) + return false; + if (mEdges[estart].p != mEdges[i].p) + { + estart = i; + } + PxU32 i1 = i + 1; + if (i1 >= mEdges.size() || mEdges[i1].p != mEdges[i].p) { + i1 = estart; + } + PxU32 i2 = i1 + 1; + if (i2 >= mEdges.size() || mEdges[i2].p != mEdges[i].p) { + i2 = estart; + } + if (i == i2) + continue; // i sliced tangent to an edge and created 2 meaningless edges + + // check the face normal against the triangle from edges + PxVec3 localNormal = (mVertices[mEdges[i1].v] - mVertices[mEdges[i].v]).cross(mVertices[mEdges[i2].v] - mVertices[mEdges[i1].v]); + const float m = localNormal.magnitude(); + if (m == 0.0f) + localNormal = PxVec3(1.f, 0.0f, 0.0f); + localNormal *= (1.0f / m); + if (localNormal.dot(mFacets[mEdges[i].p].n) <= 0.0f) + return false; + } + return true; +} + +// returns the maximum number of vertices on a face +PxU32 ConvexHull::maxNumVertsPerFace() const +{ + PxU32 maxVerts = 0; + PxU32 currentVerts = 0; + PxU32 estart = 0; + for (PxU32 i = 0; i < mEdges.size(); i++) + { + if (mEdges[estart].p != mEdges[i].p) + { + if(currentVerts > maxVerts) + { + maxVerts = currentVerts + 1; + } + currentVerts = 0; + estart = i; + } + else + { + currentVerts++; + } + } + return maxVerts; +} + +////////////////////////////////////////////////////////////////////////// +// slice the input convexHull with the slice plane +ConvexHull* physx::convexHullCrop(const ConvexHull& convex, const PxPlane& slice, float planeTestEpsilon) +{ + static const PxU8 invalidIndex = PxU8(-1); + PxU32 i; + PxU32 vertCountUnder = 0; // Running count of the vertices UNDER the slicing plane. + + PX_ASSERT(convex.getEdges().size() < 480); + + // Arrays of mapping information associated with features in the input convex. + // edgeflag[i].undermap - output index of input edge convex->edges[i] + // vertflag[i].undermap - output index of input vertex convex->vertices[i] + // vertflag[i].planetest - the side-of-plane classification of convex->vertices[i] + // (There are other members but they are unused.) + local::EdgeFlag edgeFlag[512]; + local::VertFlag vertFlag[256]; + + // Lists of output features. Populated during clipping. + // Coplanar edges have one sibling in tmpunderedges and one in coplanaredges. + // coplanaredges holds the sibling that belong to the new polygon created from slicing. + ConvexHull::HalfEdge tmpUnderEdges[512]; // The output edge list. + PxPlane tmpUnderPlanes[128]; // The output plane list. + local::Coplanar coplanarEdges[512]; // The coplanar edge list. + + PxU32 coplanarEdgesNum = 0; // Running count of coplanar edges. + + // Created vertices on the slicing plane (stored for output after clipping). + Ps::Array<PxVec3> createdVerts; + + // Logical OR of individual vertex flags. + PxU32 convexClipFlags = 0; + + // Classify each vertex against the slicing plane as OVER | COPLANAR | UNDER. + // OVER - Vertex is over (outside) the slicing plane. Will not be output. + // COPLANAR - Vertex is on the slicing plane. A copy will be output. + // UNDER - Vertex is under (inside) the slicing plane. Will be output. + // We keep an array of information structures for each vertex in the input convex. + // vertflag[i].undermap - The (computed) index of convex->vertices[i] in the output. + // invalidIndex for OVER vertices - they are not output. + // initially invalidIndex for COPLANAR vertices - set later. + // vertflag[i].overmap - Unused - we don't care about the over part. + // vertflag[i].planetest - The classification (clip flag) of convex->vertices[i]. + for (i = 0; i < convex.getVertices().size(); i++) + { + local::PlaneTestResult vertexClipFlag = local::planeTest(slice, convex.getVertices()[i], planeTestEpsilon); + switch (vertexClipFlag) + { + case local::eOVER: + case local::eCOPLANAR: + vertFlag[i].undermap = invalidIndex; // Initially invalid for COPLANAR + vertFlag[i].overmap = invalidIndex; + break; + case local::eUNDER: + vertFlag[i].undermap = Ps::to8(vertCountUnder++); + vertFlag[i].overmap = invalidIndex; + break; + } + vertFlag[i].planetest = PxU8(vertexClipFlag); + convexClipFlags |= vertexClipFlag; + } + + // Check special case: everything UNDER or COPLANAR. + // This way we know we wont end up with silly faces / edges later on. + if ((convexClipFlags & local::eOVER) == 0) + { + // Just return a copy of the same convex. + ConvexHull* dst = PX_NEW_TEMP(ConvexHull)(convex); + return dst; + } + + PxU16 underEdgeCount = 0; // Running count of output edges. + PxU16 underPlanesCount = 0; // Running count of output planes. + + // Clipping Loop + // ============= + // + // for each plane + // + // for each edge + // + // if first UNDER & second !UNDER + // output current edge -> tmpunderedges + // if we have done the sibling + // connect current edge to its sibling + // set vout = first vertex of sibling + // else if second is COPLANAR + // if we havent already copied it + // copy second -> createdverts + // set vout = index of created vertex + // else + // generate a new vertex -> createdverts + // set vout = index of created vertex + // if vin is already set and vin != vout (non-trivial edge) + // output coplanar edge -> tmpunderedges (one sibling) + // set coplanaredge to new edge index (for connecting the other sibling) + // + // else if first !UNDER & second UNDER + // if we have done the sibling + // connect current edge to its sibling + // set vin = second vertex of sibling (this is a bit of a pain) + // else if first is COPLANAR + // if we havent already copied it + // copy first -> createdverts + // set vin = index of created vertex + // else + // generate a new vertex -> createdverts + // set vin = index of created vertex + // if vout is already set and vin != vout (non-trivial edge) + // output coplanar edge -> tmpunderedges (one sibling) + // set coplanaredge to new edge index (for connecting the other sibling) + // output current edge -> tmpunderedges + // + // else if first UNDER & second UNDER + // output current edge -> tmpunderedges + // + // next edge + // + // if part of current plane was UNDER + // output current plane -> tmpunderplanes + // + // if coplanaredge is set + // output coplanar edge -> coplanaredges + // + // next plane + // + + // Indexing is a bit tricky here: + // + // e0 - index of the current edge + // e1 - index of the next edge + // estart - index of the first edge in the current plane + // currentplane - index of the current plane + // enextface - first edge of next plane + + PxU32 e0 = 0; + + for (PxU32 currentplane = 0; currentplane < convex.getFacets().size(); currentplane++) + { + + PxU32 eStart = e0; + PxU32 eNextFace = 0xffffffff; + PxU32 e1 = e0 + 1; + + PxU8 vout = invalidIndex; + PxU8 vin = invalidIndex; + + PxU32 coplanarEdge = invalidIndex; + + // Logical OR of individual vertex flags in the current plane. + PxU32 planeSide = 0; + + do{ + + // Next edge modulo logic + if (e1 >= convex.getEdges().size() || convex.getEdges()[e1].p != currentplane) + { + eNextFace = e1; + e1 = eStart; + } + + const ConvexHull::HalfEdge& edge0 = convex.getEdges()[e0]; + const ConvexHull::HalfEdge& edge1 = convex.getEdges()[e1]; + const ConvexHull::HalfEdge& edgea = convex.getEdges()[PxU32(edge0.ea)]; + + planeSide |= vertFlag[edge0.v].planetest; + + if (vertFlag[edge0.v].planetest == local::eUNDER && vertFlag[edge1.v].planetest != local::eUNDER) + { + // first is UNDER, second is COPLANAR or OVER + + // Output current edge. + edgeFlag[e0].undermap = short(underEdgeCount); + tmpUnderEdges[underEdgeCount].v = vertFlag[edge0.v].undermap; + tmpUnderEdges[underEdgeCount].p = PxU8(underPlanesCount); + PX_ASSERT(tmpUnderEdges[underEdgeCount].v != invalidIndex); + + if (PxU32(edge0.ea) < e0) + { + // We have already done the sibling. + // Connect current edge to its sibling. + PX_ASSERT(edgeFlag[edge0.ea].undermap != invalidIndex); + tmpUnderEdges[underEdgeCount].ea = edgeFlag[edge0.ea].undermap; + tmpUnderEdges[edgeFlag[edge0.ea].undermap].ea = short(underEdgeCount); + // Set vout = first vertex of (output, clipped) sibling. + vout = tmpUnderEdges[edgeFlag[edge0.ea].undermap].v; + } + else if (vertFlag[edge1.v].planetest == local::eCOPLANAR) + { + // Boundary case. + // We output coplanar vertices once. + if (vertFlag[edge1.v].undermap == invalidIndex) + { + createdVerts.pushBack(convex.getVertices()[edge1.v]); + // Remember the index so we don't output it again. + vertFlag[edge1.v].undermap = Ps::to8(vertCountUnder++); + } + vout = vertFlag[edge1.v].undermap; + } + else + { + // Add new vertex. + const PxPlane& p0 = convex.getFacets()[edge0.p]; + const PxPlane& pa = convex.getFacets()[edgea.p]; + createdVerts.pushBack(threePlaneIntersection(p0, pa, slice)); + vout = Ps::to8(vertCountUnder++); + } + + // We added an edge, increment the counter + underEdgeCount++; + + if (vin != invalidIndex && vin != vout) + { + // We already have vin and a non-trivial edge + // Output coplanar edge + PX_ASSERT(vout != invalidIndex); + coplanarEdge = underEdgeCount; + tmpUnderEdges[underEdgeCount].v = vout; + tmpUnderEdges[underEdgeCount].p = PxU8(underPlanesCount); + tmpUnderEdges[underEdgeCount].ea = invalidIndex; + underEdgeCount++; + } + } + else if (vertFlag[edge0.v].planetest != local::eUNDER && vertFlag[edge1.v].planetest == local::eUNDER) + { + // First is OVER or COPLANAR, second is UNDER. + + if (PxU32(edge0.ea) < e0) + { + // We have already done the sibling. + // We need the second vertex of the sibling. + // Which is the vertex of the next edge in the adjacent poly. + int nea = edgeFlag[edge0.ea].undermap + 1; + int p = tmpUnderEdges[edgeFlag[edge0.ea].undermap].p; + if (nea >= underEdgeCount || tmpUnderEdges[nea].p != p) + { + // End of polygon, next edge is first edge + nea -= 2; + while (nea > 0 && tmpUnderEdges[nea - 1].p == p) + nea--; + } + vin = tmpUnderEdges[nea].v; + PX_ASSERT(vin < vertCountUnder); + } + else if (vertFlag[edge0.v].planetest == local::eCOPLANAR) + { + // Boundary case. + // We output coplanar vertices once. + if (vertFlag[edge0.v].undermap == invalidIndex) + { + createdVerts.pushBack(convex.getVertices()[edge0.v]); + // Remember the index so we don't output it again. + vertFlag[edge0.v].undermap = Ps::to8(vertCountUnder++); + } + vin = vertFlag[edge0.v].undermap; + } + else + { + // Add new vertex. + const PxPlane& p0 = convex.getFacets()[edge0.p]; + const PxPlane& pa = convex.getFacets()[edgea.p]; + createdVerts.pushBack(threePlaneIntersection(p0, pa, slice)); + vin = Ps::to8(vertCountUnder++); + } + + if (vout != invalidIndex && vin != vout) + { + // We have been in and out, Add the coplanar edge + coplanarEdge = underEdgeCount; + tmpUnderEdges[underEdgeCount].v = vout; + tmpUnderEdges[underEdgeCount].p = Ps::to8(underPlanesCount); + tmpUnderEdges[underEdgeCount].ea = invalidIndex; + underEdgeCount++; + } + + // Output current edge. + tmpUnderEdges[underEdgeCount].v = vin; + tmpUnderEdges[underEdgeCount].p = Ps::to8(underPlanesCount); + edgeFlag[e0].undermap = short(underEdgeCount); + + if (PxU32(edge0.ea) < e0) + { + // We have already done the sibling. + // Connect current edge to its sibling. + PX_ASSERT(edgeFlag[edge0.ea].undermap != invalidIndex); + tmpUnderEdges[underEdgeCount].ea = edgeFlag[edge0.ea].undermap; + tmpUnderEdges[edgeFlag[edge0.ea].undermap].ea = short(underEdgeCount); + } + + PX_ASSERT(edgeFlag[e0].undermap == underEdgeCount); + underEdgeCount++; + } + else if (vertFlag[edge0.v].planetest == local::eUNDER && vertFlag[edge1.v].planetest == local::eUNDER) + { + // Both UNDER + + // Output current edge. + edgeFlag[e0].undermap = short(underEdgeCount); + tmpUnderEdges[underEdgeCount].v = vertFlag[edge0.v].undermap; + tmpUnderEdges[underEdgeCount].p = Ps::to8(underPlanesCount); + if (PxU32(edge0.ea) < e0) + { + // We have already done the sibling. + // Connect current edge to its sibling. + PX_ASSERT(edgeFlag[edge0.ea].undermap != invalidIndex); + tmpUnderEdges[underEdgeCount].ea = edgeFlag[edge0.ea].undermap; + tmpUnderEdges[edgeFlag[edge0.ea].undermap].ea = short(underEdgeCount); + } + underEdgeCount++; + } + + e0 = e1; + e1++; // do the modulo at the beginning of the loop + + } while (e0 != eStart); + + e0 = eNextFace; + + if (planeSide & local::eUNDER) + { + // At least part of current plane is UNDER. + // Output current plane. + tmpUnderPlanes[underPlanesCount] = convex.getFacets()[currentplane]; + underPlanesCount++; + } + + if (coplanarEdge != invalidIndex) + { + // We have a coplanar edge. + // Add to coplanaredges for later processing. + // (One sibling is in place but one is missing) + PX_ASSERT(vin != invalidIndex); + PX_ASSERT(vout != invalidIndex); + PX_ASSERT(coplanarEdge != 511); + coplanarEdges[coplanarEdgesNum].ea = PxU8(coplanarEdge); + coplanarEdges[coplanarEdgesNum].v0 = vin; + coplanarEdges[coplanarEdgesNum].v1 = vout; + coplanarEdgesNum++; + } + + // Reset coplanar edge infos for next poly + vin = invalidIndex; + vout = invalidIndex; + coplanarEdge = invalidIndex; + } + + // Add the new plane to the mix: + if (coplanarEdgesNum > 0) + { + tmpUnderPlanes[underPlanesCount++] = slice; + } + + // Sort the coplanar edges in winding order. + for (i = 0; i < coplanarEdgesNum - 1; i++) + { + if (coplanarEdges[i].v1 != coplanarEdges[i + 1].v0) + { + PxU32 j = 0; + for (j = i + 2; j < coplanarEdgesNum; j++) + { + if (coplanarEdges[i].v1 == coplanarEdges[j].v0) + { + local::Coplanar tmp = coplanarEdges[i + 1]; + coplanarEdges[i + 1] = coplanarEdges[j]; + coplanarEdges[j] = tmp; + break; + } + } + if (j >= coplanarEdgesNum) + { + // PX_ASSERT(j<coplanaredges_num); + return NULL; + } + } + } + + // PT: added this line to fix DE2904 + if (!vertCountUnder) + return NULL; + + // Create the output convex. + ConvexHull* punder = PX_NEW_TEMP(ConvexHull)(convex.getInputPlanes()); + ConvexHull& under = *punder; + + // Copy UNDER vertices + PxU32 k = 0; + for (i = 0; i < convex.getVertices().size(); i++) + { + if (vertFlag[i].planetest == local::eUNDER) + { + under.getVertices().pushBack(convex.getVertices()[i]); + k++; + } + } + + // Copy created vertices + i = 0; + while (k < vertCountUnder) + { + under.getVertices().pushBack(createdVerts[i++]); + k++; + } + + PX_ASSERT(i == createdVerts.size()); + + // Copy the output edges and output planes. + under.getEdges().resize(underEdgeCount + coplanarEdgesNum); + under.getFacets().resize(underPlanesCount); + + // Add the coplanar edge siblings that belong to the new polygon (coplanaredges). + for (i = 0; i < coplanarEdgesNum; i++) + { + under.getEdges()[underEdgeCount + i].p = PxU8(underPlanesCount - 1); + under.getEdges()[underEdgeCount + i].ea = short(coplanarEdges[i].ea); + tmpUnderEdges[coplanarEdges[i].ea].ea = PxI16(underEdgeCount + i); + under.getEdges()[underEdgeCount + i].v = coplanarEdges[i].v0; + } + + PxMemCopy(under.getEdges().begin(), tmpUnderEdges, sizeof(ConvexHull::HalfEdge)*underEdgeCount); + PxMemCopy(under.getFacets().begin(), tmpUnderPlanes, sizeof(PxPlane)*underPlanesCount); + return punder; +} + +bool physx::computeOBBFromConvex(const PxConvexMeshDesc& desc, PxVec3& sides, PxTransform& matrix) +{ + PxIntegrals integrals; + // using the centroid of the convex for the volume integration solved accuracy issues in cases where the inertia tensor + // ended up close to not being positive definite and after a few further transforms the diagonalized inertia tensor ended + // up with negative values. + + const PxVec3* verts = (reinterpret_cast<const PxVec3*>(desc.points.data)); + const PxU32* ind = (reinterpret_cast<const PxU32*>(desc.indices.data)); + const PxHullPolygon* polygons = (reinterpret_cast<const PxHullPolygon*>(desc.polygons.data)); + PxVec3 mean(0.0f); + for (PxU32 i = 0; i < desc.points.count; i++) + mean += verts[i]; + mean *= (1.0f / desc.points.count); + + PxU8* indices = reinterpret_cast<PxU8*> (PX_ALLOC_TEMP(sizeof(PxU8)*desc.indices.count, "PxU8")); + for (PxU32 i = 0; i < desc.indices.count; i++) + { + indices[i] = Ps::to8(ind[i]); + } + // we need to move the polygon data to internal format + Gu::HullPolygonData* polygonData = reinterpret_cast<Gu::HullPolygonData*> (PX_ALLOC_TEMP(sizeof(Gu::HullPolygonData)*desc.polygons.count, "Gu::HullPolygonData")); + for (PxU32 i = 0; i < desc.polygons.count; i++) + { + polygonData[i].mPlane = PxPlane(polygons[i].mPlane[0], polygons[i].mPlane[1], polygons[i].mPlane[2], polygons[i].mPlane[3]); + polygonData[i].mNbVerts = Ps::to8(polygons[i].mNbVerts); + polygonData[i].mVRef8 = polygons[i].mIndexBase; + } + + PxConvexMeshDesc inDesc; + inDesc.points.data = desc.points.data; + inDesc.points.count = desc.points.count; + + inDesc.polygons.data = polygonData; + inDesc.polygons.count = desc.polygons.count; + + inDesc.indices.data = indices; + inDesc.indices.count = desc.indices.count; + + // compute volume integrals to get basis axis + bool status = (desc.flags & PxConvexFlag::eFAST_INERTIA_COMPUTATION) ? + computeVolumeIntegralsEberlySIMD(inDesc, 1.0f, integrals, mean) : computeVolumeIntegralsEberly(inDesc, 1.0f, integrals, mean); + if (status) + { + Vec4V* pointsV = reinterpret_cast<Vec4V*> (PX_ALLOC_TEMP(sizeof(Vec4V)*desc.points.count, "Vec4V")); + for (PxU32 i = 0; i < desc.points.count; i++) + { + // safe to V4 load, same as volume integration - we allocate one more vector + pointsV[i] = V4LoadU(&verts[i].x); + } + + PxMat33 inertia; + integrals.getOriginInertia(inertia); + PxQuat inertiaQuat; + PxDiagonalize(inertia, inertiaQuat); + PxMat33 baseAxis(inertiaQuat); + Vec4V center = V4LoadU(&integrals.COM.x); + + const PxU32 numSteps = 20; + const float subStep = Ps::degToRad(float(360/numSteps)); + + float bestVolume = 1e9; + + for (PxU32 axis = 0; axis < 3; axis++) + { + for (PxU32 iStep = 0; iStep < numSteps; iStep++) + { + PxQuat quat(iStep*subStep, baseAxis[axis]); + + Vec4V transV = center; + Vec4V psidesV; + + const QuatV rotV = QuatVLoadU(&quat.x); + local::computeOBBSIMD(desc.points.count, pointsV, psidesV, rotV, transV); + + PxVec3 psides; + V3StoreU(Vec3V_From_Vec4V(psidesV), psides); + + const float volume = psides[0] * psides[1] * psides[2]; // the volume of the cube + + if (volume <= bestVolume) + { + bestVolume = volume; + sides = psides; + + V4StoreU(rotV, &matrix.q.x); + V3StoreU(Vec3V_From_Vec4V(transV), matrix.p); + } + } + } + + PX_FREE_AND_RESET(pointsV); + } + else + { + PX_FREE_AND_RESET(indices); + PX_FREE_AND_RESET(polygonData); + return false; + } + + PX_FREE_AND_RESET(indices); + PX_FREE_AND_RESET(polygonData); + return true; +} diff --git a/PhysX_3.4/Source/PhysXCooking/src/convex/ConvexHullUtils.h b/PhysX_3.4/Source/PhysXCooking/src/convex/ConvexHullUtils.h new file mode 100644 index 00000000..5178b043 --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/convex/ConvexHullUtils.h @@ -0,0 +1,177 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + + +#ifndef PX_CONVEXHULLUTILS_H +#define PX_CONVEXHULLUTILS_H + +#include "foundation/PxMemory.h" +#include "foundation/PxPlane.h" + +#include "CmPhysXCommon.h" + +#include "PsUserAllocated.h" +#include "PsArray.h" +#include "PsMathUtils.h" + +#include "PxConvexMeshDesc.h" + +namespace physx +{ + + ////////////////////////////////////////////////////////////////////////// + // helper class for hull construction, holds the vertices and planes together + // while cropping the hull with planes + class ConvexHull : public Ps::UserAllocated + { + public: + + // Helper class for halfedge representation + class HalfEdge + { + public: + PxI16 ea; // the other half of the edge (index into edges list) + PxU8 v; // the vertex at the start of this edge (index into vertices list) + PxU8 p; // the facet on which this edge lies (index into facets list) + HalfEdge(){} + HalfEdge(PxI16 _ea, PxU8 _v, PxU8 _p) :ea(_ea), v(_v), p(_p){} + }; + + ConvexHull& operator = (const ConvexHull&); + + // construct the base cube hull from given max/min AABB + ConvexHull(const PxVec3& bmin, const PxVec3& bmax, const Ps::Array<PxPlane>& inPlanes); + + // construct the base cube hull from given OBB + ConvexHull(const PxVec3& extent, const PxTransform& transform, const Ps::Array<PxPlane>& inPlanes); + + // copy constructor + ConvexHull(const ConvexHull& srcHull) + : mInputPlanes(srcHull.getInputPlanes()) + { + copyHull(srcHull); + } + + // construct plain hull + ConvexHull(const Ps::Array<PxPlane>& inPlanes) + : mInputPlanes(inPlanes) + { + } + + // finds the candidate plane, returns -1 otherwise + PxI32 findCandidatePlane(float planetestepsilon, float epsilon) const; + + // internal check of the hull integrity + bool assertIntact(float epsilon) const; + + // return vertices + const Ps::Array<PxVec3>& getVertices() const + { + return mVertices; + } + + // return edges + const Ps::Array<HalfEdge>& getEdges() const + { + return mEdges; + } + + // return faces + const Ps::Array<PxPlane>& getFacets() const + { + return mFacets; + } + + // return input planes + const Ps::Array<PxPlane>& getInputPlanes() const + { + return mInputPlanes; + } + + // return vertices + Ps::Array<PxVec3>& getVertices() + { + return mVertices; + } + + // return edges + Ps::Array<HalfEdge>& getEdges() + { + return mEdges; + } + + // return faces + Ps::Array<PxPlane>& getFacets() + { + return mFacets; + } + + // returns the maximum number of vertices on a face + PxU32 maxNumVertsPerFace() const; + + // copy the hull from source + void copyHull(const ConvexHull& src) + { + mVertices.resize(src.getVertices().size()); + mEdges.resize(src.getEdges().size()); + mFacets.resize(src.getFacets().size()); + + PxMemCopy(mVertices.begin(), src.getVertices().begin(), src.getVertices().size()*sizeof(PxVec3)); + PxMemCopy(mEdges.begin(), src.getEdges().begin(), src.getEdges().size()*sizeof(HalfEdge)); + PxMemCopy(mFacets.begin(), src.getFacets().begin(), src.getFacets().size()*sizeof(PxPlane)); + } + + private: + Ps::Array<PxVec3> mVertices; + Ps::Array<HalfEdge> mEdges; + Ps::Array<PxPlane> mFacets; + const Ps::Array<PxPlane>& mInputPlanes; + }; + + //////////////////////////////////////////////////////////////////////////| + // Crops the hull with a provided plane and with given epsilon + // returns new hull if succeeded + ConvexHull* convexHullCrop(const ConvexHull& convex, const PxPlane& slice, float planetestepsilon); + + //////////////////////////////////////////////////////////////////////////| + // three planes intersection + PX_FORCE_INLINE PxVec3 threePlaneIntersection(const PxPlane& p0, const PxPlane& p1, const PxPlane& p2) + { + PxMat33 mp = (PxMat33(p0.n, p1.n, p2.n)).getTranspose(); + PxMat33 mi = (mp).getInverse(); + PxVec3 b(p0.d, p1.d, p2.d); + return -mi.transform(b); + } + + ////////////////////////////////////////////////////////////////////////// + // Compute OBB around given convex hull + bool computeOBBFromConvex(const PxConvexMeshDesc& desc, PxVec3& sides, PxTransform& matrix); +} + +#endif diff --git a/PhysX_3.4/Source/PhysXCooking/src/convex/ConvexMeshBuilder.cpp b/PhysX_3.4/Source/PhysXCooking/src/convex/ConvexMeshBuilder.cpp new file mode 100644 index 00000000..5fb356c3 --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/convex/ConvexMeshBuilder.cpp @@ -0,0 +1,504 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + + +#include "GuConvexMesh.h" +#include "PsFoundation.h" +#include "PsMathUtils.h" +#include "Cooking.h" + +#include "GuHillClimbing.h" +#include "GuBigConvexData2.h" +#include "GuInternal.h" +#include "GuSerialize.h" +#include "VolumeIntegration.h" + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + +#include "VolumeIntegration.h" +#include "ConvexHullBuilder.h" +#include "ConvexMeshBuilder.h" +#include "BigConvexDataBuilder.h" + +#include "CmUtils.h" +#include "PsVecMath.h" + +using namespace physx; +using namespace Gu; +using namespace Ps::aos; + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + +ConvexMeshBuilder::ConvexMeshBuilder(const bool buildGRBData) : hullBuilder(&mHullData, buildGRBData), mBigConvexData(NULL), mMass(0.0f), mInertia(PxIdentity) +{ +} + +ConvexMeshBuilder::~ConvexMeshBuilder() +{ + PX_DELETE_AND_RESET(mBigConvexData); +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +// load the mesh data from given polygons +bool ConvexMeshBuilder::build(const PxConvexMeshDesc& desc, PxU32 gaussMapVertexLimit, bool validateOnly, bool userPolygons) +{ + if(!desc.isValid()) + { + Ps::getFoundation().error(PxErrorCode::eINVALID_PARAMETER, __FILE__, __LINE__, "Gu::ConvexMesh::loadFromDesc: desc.isValid() failed!"); + return false; + } + + if(!loadConvexHull(desc, gaussMapVertexLimit, userPolygons)) + return false; + + // Compute local bounds (*after* hull has been created) + PxBounds3 minMaxBounds; + computeBoundsAroundVertices(minMaxBounds, mHullData.mNbHullVertices, hullBuilder.mHullDataHullVertices); + mHullData.mAABB = CenterExtents(minMaxBounds); + + if(mHullData.mNbHullVertices > gaussMapVertexLimit) + { + if(!computeGaussMaps()) + { + return false; + } + } + + if(validateOnly) + return true; + +// TEST_INTERNAL_OBJECTS + computeInternalObjects(); +//~TEST_INTERNAL_OBJECTS + + return true; +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + +PX_COMPILE_TIME_ASSERT(sizeof(PxMaterialTableIndex)==sizeof(PxU16)); +bool ConvexMeshBuilder::save(PxOutputStream& stream, bool platformMismatch) const +{ + // Export header + if(!writeHeader('C', 'V', 'X', 'M', PX_CONVEX_VERSION, platformMismatch, stream)) + return false; + + // Export serialization flags + PxU32 serialFlags = 0; + + writeDword(serialFlags, platformMismatch, stream); + + if(!hullBuilder.save(stream, platformMismatch)) + return false; + + // Export local bounds +// writeFloat(geomEpsilon, platformMismatch, stream); + writeFloat(0.0f, platformMismatch, stream); + writeFloat(mHullData.mAABB.getMin(0), platformMismatch, stream); + writeFloat(mHullData.mAABB.getMin(1), platformMismatch, stream); + writeFloat(mHullData.mAABB.getMin(2), platformMismatch, stream); + writeFloat(mHullData.mAABB.getMax(0), platformMismatch, stream); + writeFloat(mHullData.mAABB.getMax(1), platformMismatch, stream); + writeFloat(mHullData.mAABB.getMax(2), platformMismatch, stream); + + // Export mass info + writeFloat(mMass, platformMismatch, stream); + writeFloatBuffer(reinterpret_cast<const PxF32*>(&mInertia), 9, platformMismatch, stream); + writeFloatBuffer(&mHullData.mCenterOfMass.x, 3, platformMismatch, stream); + + // Export gaussmaps + if(mBigConvexData) + { + writeFloat(1.0f, platformMismatch, stream); //gauss map flag true + BigConvexDataBuilder SVMB(&mHullData, mBigConvexData, hullBuilder.mHullDataHullVertices); + SVMB.save(stream, platformMismatch); + } + else + writeFloat(-1.0f, platformMismatch, stream); //gauss map flag false + +// TEST_INTERNAL_OBJECTS + writeFloat(mHullData.mInternal.mRadius, platformMismatch, stream); + writeFloat(mHullData.mInternal.mExtents[0], platformMismatch, stream); + writeFloat(mHullData.mInternal.mExtents[1], platformMismatch, stream); + writeFloat(mHullData.mInternal.mExtents[2], platformMismatch, stream); +//~TEST_INTERNAL_OBJECTS + return true; +} + +////////////////////////////////////////////////////////////////////////// +// instead of saving the data into stream, we copy the mesh data +// into internal Gu::ConvexMesh. +bool ConvexMeshBuilder::copy(Gu::ConvexHullData& hullData) +{ + // hull builder data copy + hullBuilder.copy(hullData); + + // mass props + hullData.mAABB = mHullData.mAABB; + hullData.mCenterOfMass = mHullData.mCenterOfMass; + + // big convex data + if(mBigConvexData) + { + hullData.mBigConvexRawData = &mBigConvexData->mData; + } + else + hullData.mBigConvexRawData = NULL; + + // internal data + hullData.mInternal.mRadius = mHullData.mInternal.mRadius; + hullData.mInternal.mExtents[0] = mHullData.mInternal.mExtents[0]; + hullData.mInternal.mExtents[1] = mHullData.mInternal.mExtents[1]; + hullData.mInternal.mExtents[2] = mHullData.mInternal.mExtents[2]; + + return true; +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +// compute mass and inertia of the convex mesh +void ConvexMeshBuilder::computeMassInfo(bool lowerPrecision) +{ + if(mMass <= 0.0f) //not yet computed. + { + PxIntegrals integrals; + PxConvexMeshDesc meshDesc; + meshDesc.points.count = mHullData.mNbHullVertices; + meshDesc.points.data = hullBuilder.mHullDataHullVertices; + meshDesc.points.stride = sizeof(PxVec3); + + meshDesc.polygons.data = hullBuilder.mHullDataPolygons; + meshDesc.polygons.stride = sizeof(Gu::HullPolygonData); + meshDesc.polygons.count = hullBuilder.mHull->mNbPolygons; + + meshDesc.indices.data = hullBuilder.mHullDataVertexData8; + + // using the centroid of the convex for the volume integration solved accuracy issues in cases where the inertia tensor + // ended up close to not being positive definite and after a few further transforms the diagonalized inertia tensor ended + // up with negative values. + PxVec3 mean(0.0f); + for(PxU32 i=0; i < mHullData.mNbHullVertices; i++) + mean += hullBuilder.mHullDataHullVertices[i]; + mean *= (1.0f / mHullData.mNbHullVertices); + + bool status = lowerPrecision ? + computeVolumeIntegralsEberlySIMD(meshDesc, 1.0f, integrals, mean) : computeVolumeIntegralsEberly(meshDesc, 1.0f, integrals, mean); + if(status) + { + + integrals.getOriginInertia(reinterpret_cast<PxMat33&>(mInertia)); + mHullData.mCenterOfMass = integrals.COM; + + //note: the mass will be negative for an inside-out mesh! + if(mInertia.column0.isFinite() && mInertia.column1.isFinite() && mInertia.column2.isFinite() + && mHullData.mCenterOfMass.isFinite() && PxIsFinite(PxReal(integrals.mass))) + { + if (integrals.mass < 0) + { + Ps::getFoundation().error(PX_WARN, "Gu::ConvexMesh: Mesh has a negative volume! Is it open or do (some) faces have reversed winding? (Taking absolute value.)"); + integrals.mass = -integrals.mass; + mInertia = -mInertia; + } + + mMass = PxReal(integrals.mass); //set mass to valid value. + return; + } + } + Ps::getFoundation().error(PxErrorCode::eINTERNAL_ERROR, __FILE__, __LINE__, "Gu::ConvexMesh: Error computing mesh mass properties!\n"); + } +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +#if PX_VC +#pragma warning(push) +#pragma warning(disable:4996) // permitting use of gatherStrided until we have a replacement. +#endif + +bool ConvexMeshBuilder::loadConvexHull(const PxConvexMeshDesc& desc, PxU32 gaussMapVertexLimit, bool userPolygons) +{ + // gather points + PxVec3* geometry = reinterpret_cast<PxVec3*>(PxAlloca(sizeof(PxVec3)*desc.points.count)); + Cooking::gatherStrided(desc.points.data, geometry, desc.points.count, sizeof(PxVec3), desc.points.stride); + + PxU32* topology = NULL; + + // gather indices + // store the indices into topology if we have the polygon data + if(desc.indices.data) + { + topology = reinterpret_cast<PxU32*>(PxAlloca(sizeof(PxU32)*desc.indices.count)); + if (desc.flags & PxConvexFlag::e16_BIT_INDICES) + { + // conversion; 16 bit index -> 32 bit index & stride + PxU32* dest = topology; + const PxU32* pastLastDest = topology + desc.indices.count; + const PxU8* source = reinterpret_cast<const PxU8*>(desc.indices.data); + while (dest < pastLastDest) + { + const PxU16 * trig16 = reinterpret_cast<const PxU16*>(source); + *dest++ = trig16[0]; + *dest++ = trig16[1]; + *dest++ = trig16[2]; + source += desc.indices.stride; + } + } + else + { + Cooking::gatherStrided(desc.indices.data, topology, desc.indices.count, sizeof(PxU32), desc.indices.stride); + } + } + + // gather polygons + PxHullPolygon* hullPolygons = NULL; + if(desc.polygons.data) + { + hullPolygons = reinterpret_cast<PxHullPolygon*>(PxAlloca(sizeof(PxHullPolygon)*desc.polygons.count)); + Cooking::gatherStrided(desc.polygons.data,hullPolygons,desc.polygons.count,sizeof(PxHullPolygon),desc.polygons.stride); + + // if user polygons, make sure the largest one is the first one + if (userPolygons) + { + PxU32 largestPolygon = 0; + for (PxU32 i = 1; i < desc.polygons.count; i++) + { + if(hullPolygons[i].mNbVerts > hullPolygons[largestPolygon].mNbVerts) + largestPolygon = i; + } + if(largestPolygon != 0) + { + PxHullPolygon movedPolygon = hullPolygons[0]; + hullPolygons[0] = hullPolygons[largestPolygon]; + hullPolygons[largestPolygon] = movedPolygon; + } + } + } + + const bool doValidation = desc.flags & PxConvexFlag::eDISABLE_MESH_VALIDATION ? false : true; + if(!hullBuilder.init(desc.points.count, geometry, topology, desc.indices.count, desc.polygons.count, hullPolygons, gaussMapVertexLimit, doValidation)) + { + Ps::getFoundation().error(PxErrorCode::eINTERNAL_ERROR, __FILE__, __LINE__, "Gu::ConvexMesh::loadConvexHull: convex hull init failed!"); + return false; + } + computeMassInfo(desc.flags & PxConvexFlag::eFAST_INERTIA_COMPUTATION); + + return true; +} + +#if PX_VC +#pragma warning(pop) +#endif + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +// compute polygons from given triangles. This is support function used in extensions. We do not accept triangles as an input for convex mesh desc. +bool ConvexMeshBuilder::computeHullPolygons(const PxU32& nbVerts,const PxVec3* verts, const PxU32& nbTriangles, const PxU32* triangles, PxAllocatorCallback& inAllocator, + PxU32& outNbVerts, PxVec3*& outVertices , PxU32& nbIndices, PxU32*& indices, PxU32& nbPolygons, PxHullPolygon*& polygons) +{ + if(!hullBuilder.computeHullPolygons(nbVerts,verts,nbTriangles,triangles)) + { + Ps::getFoundation().error(PxErrorCode::eINTERNAL_ERROR, __FILE__, __LINE__, "ConvexMeshBuilder::computeHullPolygons: compute convex hull polygons failed. Provided triangles dont form a convex hull."); + return false; + } + + outNbVerts = hullBuilder.mHull->mNbHullVertices; + nbPolygons = hullBuilder.mHull->mNbPolygons; + + outVertices = reinterpret_cast<PxVec3*>(inAllocator.allocate(outNbVerts*sizeof(PxVec3),"PxVec3",__FILE__,__LINE__)); + PxMemCopy(outVertices,hullBuilder.mHullDataHullVertices,outNbVerts*sizeof(PxVec3)); + + nbIndices = 0; + for (PxU32 i = 0; i < nbPolygons; i++) + { + nbIndices += hullBuilder.mHullDataPolygons[i].mNbVerts; + } + + indices = reinterpret_cast<PxU32*>(inAllocator.allocate(nbIndices*sizeof(PxU32),"PxU32",__FILE__,__LINE__)); + for (PxU32 i = 0; i < nbIndices; i++) + { + indices[i] = hullBuilder.mHullDataVertexData8[i]; + } + + polygons = reinterpret_cast<PxHullPolygon*>(inAllocator.allocate(nbPolygons*sizeof(PxHullPolygon),"PxHullPolygon",__FILE__,__LINE__)); + + for (PxU32 i = 0; i < nbPolygons; i++) + { + const Gu::HullPolygonData& polygonData = hullBuilder.mHullDataPolygons[i]; + PxHullPolygon& outPolygon = polygons[i]; + outPolygon.mPlane[0] = polygonData.mPlane.n.x; + outPolygon.mPlane[1] = polygonData.mPlane.n.y; + outPolygon.mPlane[2] = polygonData.mPlane.n.z; + outPolygon.mPlane[3] = polygonData.mPlane.d; + + outPolygon.mNbVerts = polygonData.mNbVerts; + outPolygon.mIndexBase = polygonData.mVRef8; + + for (PxU32 j = 0; j < polygonData.mNbVerts; j++) + { + PX_ASSERT(indices[outPolygon.mIndexBase + j] == hullBuilder.mHullDataVertexData8[polygonData.mVRef8+j]); + } + } + + return true; +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +// compute big convex data +bool ConvexMeshBuilder::computeGaussMaps() +{ + // The number of polygons is limited to 256 because the gaussmap encode 256 polys maximum + + PxU32 density = 16; + // density = 64; + // density = 8; + // density = 2; + + PX_DELETE(mBigConvexData); + PX_NEW_SERIALIZED(mBigConvexData,BigConvexData); + BigConvexDataBuilder SVMB(&mHullData, mBigConvexData, hullBuilder.mHullDataHullVertices); + // valencies we need to compute first, they are needed for min/max precompute + SVMB.computeValencies(hullBuilder); + SVMB.precompute(density); + + return true; +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +// TEST_INTERNAL_OBJECTS + +static void ComputeInternalExtent(Gu::ConvexHullData& data, const Gu::HullPolygonData* hullPolys) +{ + const PxVec3 e = data.mAABB.getMax() - data.mAABB.getMin(); + + // PT: For that formula, see \\sw\physx\PhysXSDK\3.4\trunk\InternalDocumentation\Cooking\InternalExtents.png + const float r = data.mInternal.mRadius / sqrtf(3.0f); + + const float epsilon = 1E-7f; + + const PxU32 largestExtent = Ps::largestAxis(e); + PxU32 e0 = Ps::getNextIndex3(largestExtent); + PxU32 e1 = Ps::getNextIndex3(e0); + if(e[e0] < e[e1]) + Ps::swap<PxU32>(e0,e1); + + data.mInternal.mExtents[0] = FLT_MAX; + data.mInternal.mExtents[1] = FLT_MAX; + data.mInternal.mExtents[2] = FLT_MAX; + + // PT: the following code does ray-vs-plane raycasts. + + // find the largest box along the largest extent, with given internal radius + for(PxU32 i = 0; i < data.mNbPolygons; i++) + { + // concurrent with search direction + const float d = hullPolys[i].mPlane.n[largestExtent]; + if((-epsilon < d && d < epsilon)) + continue; + + const float numBase = -hullPolys[i].mPlane.d - hullPolys[i].mPlane.n.dot(data.mCenterOfMass); + const float denBase = 1.0f/hullPolys[i].mPlane.n[largestExtent]; + const float numn0 = r * hullPolys[i].mPlane.n[e0]; + const float numn1 = r * hullPolys[i].mPlane.n[e1]; + + float num = numBase - numn0 - numn1; + float ext = PxMax(fabsf(num*denBase), r); + if(ext < data.mInternal.mExtents[largestExtent]) + data.mInternal.mExtents[largestExtent] = ext; + + num = numBase - numn0 + numn1; + ext = PxMax(fabsf(num *denBase), r); + if(ext < data.mInternal.mExtents[largestExtent]) + data.mInternal.mExtents[largestExtent] = ext; + + num = numBase + numn0 + numn1; + ext = PxMax(fabsf(num *denBase), r); + if(ext < data.mInternal.mExtents[largestExtent]) + data.mInternal.mExtents[largestExtent] = ext; + + num = numBase + numn0 - numn1; + ext = PxMax(fabsf(num *denBase), r); + if(ext < data.mInternal.mExtents[largestExtent]) + data.mInternal.mExtents[largestExtent] = ext; + } + + // Refine the box along e0,e1 + for(PxU32 i = 0; i < data.mNbPolygons; i++) + { + const float denumAdd = hullPolys[i].mPlane.n[e0] + hullPolys[i].mPlane.n[e1]; + const float denumSub = hullPolys[i].mPlane.n[e0] - hullPolys[i].mPlane.n[e1]; + + const float numBase = -hullPolys[i].mPlane.d - hullPolys[i].mPlane.n.dot(data.mCenterOfMass); + const float numn0 = data.mInternal.mExtents[largestExtent] * hullPolys[i].mPlane.n[largestExtent]; + + if(!(-epsilon < denumAdd && denumAdd < epsilon)) + { + float num = numBase - numn0; + float ext = PxMax(fabsf(num/ denumAdd), r); + if(ext < data.mInternal.mExtents[e0]) + data.mInternal.mExtents[e0] = ext; + + num = numBase + numn0; + ext = PxMax(fabsf(num / denumAdd), r); + if(ext < data.mInternal.mExtents[e0]) + data.mInternal.mExtents[e0] = ext; + } + + if(!(-epsilon < denumSub && denumSub < epsilon)) + { + float num = numBase - numn0; + float ext = PxMax(fabsf(num / denumSub), r); + if(ext < data.mInternal.mExtents[e0]) + data.mInternal.mExtents[e0] = ext; + + num = numBase + numn0; + ext = PxMax(fabsf(num / denumSub), r); + if(ext < data.mInternal.mExtents[e0]) + data.mInternal.mExtents[e0] = ext; + } + } + data.mInternal.mExtents[e1] = data.mInternal.mExtents[e0]; +} + +////////////////////////////////////////////////////////////////////////// +// compute internal objects, get the internal extent and radius +void ConvexMeshBuilder::computeInternalObjects() +{ + const Gu::HullPolygonData* hullPolys = hullBuilder.mHullDataPolygons; + Gu::ConvexHullData& data = mHullData; + + // compute the internal radius + data.mInternal.mRadius = FLT_MAX; + for(PxU32 i=0;i<data.mNbPolygons;i++) + { + const float dist = fabsf(hullPolys[i].mPlane.distance(data.mCenterOfMass)); + if(dist<data.mInternal.mRadius) + data.mInternal.mRadius = dist; + } + + ComputeInternalExtent(data, hullPolys); +} + +//~TEST_INTERNAL_OBJECTS diff --git a/PhysX_3.4/Source/PhysXCooking/src/convex/ConvexMeshBuilder.h b/PhysX_3.4/Source/PhysXCooking/src/convex/ConvexMeshBuilder.h new file mode 100644 index 00000000..57e0ca97 --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/convex/ConvexMeshBuilder.h @@ -0,0 +1,100 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + + +#ifndef PX_COLLISION_CONVEXMESHBUILDER +#define PX_COLLISION_CONVEXMESHBUILDER + +#include "GuConvexMeshData.h" +#include "PxCooking.h" +#include "ConvexPolygonsBuilder.h" + +namespace physx +{ + ////////////////////////////////////////////////////////////////////////// + // Convex mesh builder, creates the convex mesh from given polygons and creates internal data + class ConvexMeshBuilder + { + public: + ConvexMeshBuilder(const bool buildGRBData); + ~ConvexMeshBuilder(); + + // loads the computed or given convex hull from descriptor. + // the descriptor does contain polygons directly, triangles are not allowed + bool build(const PxConvexMeshDesc&, PxU32 gaussMapVertexLimit, bool validateOnly = false, bool userPolygons = false); + + // save the convex mesh into stream + bool save(PxOutputStream& stream, bool platformMismatch) const; + + // copy the convex mesh into internal convex mesh, which can be directly used then + bool copy(Gu::ConvexHullData& convexData); + + // loads the convex mesh from given polygons + bool loadConvexHull(const PxConvexMeshDesc&, PxU32 gaussMapVertexLimit, bool userPolygons); + + // computed hull polygons from given triangles + bool computeHullPolygons(const PxU32& nbVerts,const PxVec3* verts, const PxU32& nbTriangles, const PxU32* triangles, PxAllocatorCallback& inAllocator, + PxU32& outNbVerts, PxVec3*& outVertices, PxU32& nbIndices, PxU32*& indices, PxU32& nbPolygons, PxHullPolygon*& polygons); + + // compute big convex data + bool computeGaussMaps(); + + // compute mass, inertia tensor + void computeMassInfo(bool lowerPrecision); +// TEST_INTERNAL_OBJECTS + // internal objects + void computeInternalObjects(); +//~TEST_INTERNAL_OBJECTS + + // return computed mass + PxReal getMass() const { return mMass; } + + // return computed inertia tensor + const PxMat33& getInertia() const { return mInertia; } + + // return big convex data + BigConvexData* getBigConvexData() const { return mBigConvexData; } + + // set big convex data + void setBigConvexData(BigConvexData* data) { mBigConvexData = data; } + + mutable ConvexPolygonsBuilder hullBuilder; + + protected: + Gu::ConvexHullData mHullData; + + BigConvexData* mBigConvexData; //!< optional, only for large meshes! PT: redundant with ptr in chull data? Could also be end of other buffer + PxReal mMass; //this is mass assuming a unit density that can be scaled by instances! + PxMat33 mInertia; //in local space of mesh! + + }; + +} + +#endif diff --git a/PhysX_3.4/Source/PhysXCooking/src/convex/ConvexPolygonsBuilder.cpp b/PhysX_3.4/Source/PhysXCooking/src/convex/ConvexPolygonsBuilder.cpp new file mode 100644 index 00000000..44725819 --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/convex/ConvexPolygonsBuilder.cpp @@ -0,0 +1,1328 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + +#include "foundation/PxMemory.h" +#include "EdgeList.h" +#include "Adjacencies.h" +#include "MeshCleaner.h" +#include "CmRadixSortBuffered.h" +#include "CookingUtils.h" +#include "PsArray.h" +#include "PsFoundation.h" + +#include "ConvexPolygonsBuilder.h" + + +using namespace physx; + +#define USE_PRECOMPUTED_HULL_PROJECTION + +static PX_INLINE void Flip(HullTriangleData& data) +{ + PxU32 tmp = data.mRef[2]; + data.mRef[2] = data.mRef[1]; + data.mRef[1] = tmp; +} + +////////////////////////////////////////////////////////////////////////// +//! A generic couple structure +class Pair : public Ps::UserAllocated +{ +public: + PX_FORCE_INLINE Pair() {} + PX_FORCE_INLINE Pair(PxU32 i0, PxU32 i1) : id0(i0), id1(i1) {} + PX_FORCE_INLINE ~Pair() {} + + //! Operator for "if(Pair==Pair)" + PX_FORCE_INLINE bool operator==(const Pair& p) const { return (id0==p.id0) && (id1==p.id1); } + //! Operator for "if(Pair!=Pair)" + PX_FORCE_INLINE bool operator!=(const Pair& p) const { return (id0!=p.id0) || (id1!=p.id1); } + + PxU32 id0; //!< First index of the pair + PxU32 id1; //!< Second index of the pair +}; +PX_COMPILE_TIME_ASSERT(sizeof(Pair)==8); + +////////////////////////////////////////////////////////////////////////// +// construct a plane +template <class T> +PX_INLINE PxPlane PlaneEquation(const T& t, const PxVec3* verts) +{ + const PxVec3& p0 = verts[t.v[0]]; + const PxVec3& p1 = verts[t.v[1]]; + const PxVec3& p2 = verts[t.v[2]]; + return PxPlane(p0, p1, p2); +} + +////////////////////////////////////////////////////////////////////////// +// negate plane +static PX_FORCE_INLINE void negatePlane(Gu::HullPolygonData& data) +{ + data.mPlane.n = -data.mPlane.n; + data.mPlane.d = -data.mPlane.d; +} + +////////////////////////////////////////////////////////////////////////// +// Inverse a buffer in-place +static bool inverseBuffer(PxU32 nbEntries, PxU8* entries) +{ + if(!nbEntries || !entries) return false; + + for(PxU32 i=0; i < (nbEntries>>1); i++) + Ps::swap(entries[i], entries[nbEntries-1-i]); + + return true; +} + +////////////////////////////////////////////////////////////////////////// +// Extracts a line-strip from a list of non-sorted line-segments (slow) +static bool findLineStrip(Ps::Array<PxU32>& lineStrip, const Ps::Array<Pair>& lineSegments) +{ + // Ex: + // + // 4-2 + // 0-1 + // 2-3 + // 4-0 + // 7-3 + // 7-1 + // + // => 0-1-7-3-2-4-0 + + // 0-0-1-1-2-2-3-3-4-4-7-7 + + // 0-1 + // 0-4 + // 1-7 + // 2-3 + // 2-4 + // 3-7 + + // Naive implementation below + + Ps::Array<Pair> Copy(lineSegments); + +RunAgain: + { + PxU32 nbSegments = Copy.size(); + for(PxU32 j=0;j<nbSegments;j++) + { + PxU32 ID0 = Copy[j].id0; + PxU32 ID1 = Copy[j].id1; + + for(PxU32 i=j+1;i<nbSegments;i++) + { + if( + (Copy[i].id0==ID0 && Copy[i].id1==ID1) + || (Copy[i].id1==ID0 && Copy[i].id0==ID1) + ) + { + // Duplicate segment found => remove both + PX_ASSERT(Copy.size()>=2); + Copy.remove(i); + Copy.remove(j); + goto RunAgain; + } + } + } + // Goes through when everything's fine + } + + PxU32 ref0 = 0xffffffff; + PxU32 ref1 = 0xffffffff; + if(Copy.size()>=1) + { + Pair* Segments = Copy.begin(); + if(Segments) + { + ref0 = Segments->id0; + ref1 = Segments->id1; + lineStrip.pushBack(ref0); + lineStrip.pushBack(ref1); + PX_ASSERT(Copy.size()>=1); + Copy.remove(0); + } + } + +Wrap: + // Look for same vertex ref in remaining segments + PxU32 nb = Copy.size(); + if(!nb) + { + // ### check the line is actually closed? + return true; + } + + for(PxU32 i=0;i<nb;i++) + { + PxU32 newRef0 = Copy[i].id0; + PxU32 newRef1 = Copy[i].id1; + + // We look for Ref1 only + if(newRef0==ref1) + { + // r0 - r1 + // r1 - x + lineStrip.pushBack(newRef1); // Output the other reference + ref0 = newRef0; + ref1 = newRef1; + Copy.remove(i); + goto Wrap; + } + else if(newRef1==ref1) + { + // r0 - r1 + // x - r1 => r1 - x + lineStrip.pushBack(newRef0); // Output the other reference + ref0 = newRef1; + ref1 = newRef0; + Copy.remove(i); + goto Wrap; + } + } + return false; +} + +////////////////////////////////////////////////////////////////////////// +// Test for duplicate triangles +PX_COMPILE_TIME_ASSERT(sizeof(Gu::TriangleT<PxU32>)==sizeof(PxVec3)); // ... +static bool TestDuplicateTriangles(PxU32& nbFaces, Gu::TriangleT<PxU32>* faces, bool repair) +{ + if(!nbFaces || !faces) + return true; + + Gu::TriangleT<PxU32>* indices32 = reinterpret_cast<Gu::TriangleT<PxU32>*>(PxAlloca(nbFaces*sizeof(Gu::TriangleT<PxU32>))); + for(PxU32 i=0;i<nbFaces;i++) + { + indices32[i].v[0] = faces[i].v[0]; + indices32[i].v[1] = faces[i].v[1]; + indices32[i].v[2] = faces[i].v[2]; + } + + // Radix-sort power... + ReducedVertexCloud reducer(reinterpret_cast<PxVec3*>(indices32), nbFaces); + REDUCEDCLOUD rc; + reducer.Reduce(&rc); + if(rc.NbRVerts<nbFaces) + { + if(repair) + { + nbFaces = rc.NbRVerts; + for(PxU32 i=0;i<nbFaces;i++) + { + const Gu::TriangleT<PxU32>* curTri = reinterpret_cast<const Gu::TriangleT<PxU32>*>(&rc.RVerts[i]); + faces[i].v[0] = curTri->v[0]; + faces[i].v[1] = curTri->v[1]; + faces[i].v[2] = curTri->v[2]; + } + } + return false; // Test failed + } + return true; // Test succeeded +} + +////////////////////////////////////////////////////////////////////////// +// plane culling test +static PX_FORCE_INLINE bool testCulling(const Gu::TriangleT<PxU32>& triangle, const PxVec3* verts, const PxVec3& center) +{ + const PxPlane plane(verts[triangle.v[0]], verts[triangle.v[1]], verts[triangle.v[2]]); + return plane.distance(center)>0.0f; +} + +////////////////////////////////////////////////////////////////////////// +// face normals test +static bool TestUnifiedNormals(PxU32 nbVerts, const PxVec3* verts, PxU32 nbFaces, Gu::TriangleT<PxU32>* faces, bool repair) +{ + if(!nbVerts || !verts || !nbFaces || !faces) + return false; + + // Unify normals so that all hull faces are well oriented + + // Compute geometric center - we need a vertex inside the hull + const float coeff = 1.0f / float(nbVerts); + PxVec3 geomCenter(0.0f, 0.0f, 0.0f); + for(PxU32 i=0;i<nbVerts;i++) + { + geomCenter.x += verts[i].x * coeff; + geomCenter.y += verts[i].y * coeff; + geomCenter.z += verts[i].z * coeff; + } + + // We know the hull is (hopefully) convex so we can easily test whether a point is inside the hull or not. + // The previous geometric center must be invisible from any hull face: that's our test to decide whether a normal + // must be flipped or not. + bool status = true; + for(PxU32 i=0;i<nbFaces;i++) + { + // Test face visibility from the geometric center (supposed to be inside the hull). + // All faces must be invisible from this point to ensure a strict CCW order. + if(testCulling(faces[i], verts, geomCenter)) + { + if(repair) faces[i].flip(); + status = false; + } + } + + return status; +} + +////////////////////////////////////////////////////////////////////////// +// clean the mesh +static bool CleanFaces(PxU32& nbFaces, Gu::TriangleT<PxU32>* faces, PxU32& nbVerts, PxVec3* verts) +{ + // Brute force mesh cleaning. + // PT: I added this back on Feb-18-05 because it fixes bugs with hulls from QHull. + MeshCleaner cleaner(nbVerts, verts, nbFaces, faces->v, 0.0f); + if (!cleaner.mNbTris) + return false; + + nbVerts = cleaner.mNbVerts; + nbFaces = cleaner.mNbTris; + + PxMemCopy(verts, cleaner.mVerts, cleaner.mNbVerts*sizeof(PxVec3)); + + for (PxU32 i = 0; i < cleaner.mNbTris; i++) + { + faces[i].v[0] = cleaner.mIndices[i * 3 + 0]; + faces[i].v[1] = cleaner.mIndices[i * 3 + 1]; + faces[i].v[2] = cleaner.mIndices[i * 3 + 2]; + } + + // Get rid of duplicates + TestDuplicateTriangles(nbFaces, faces, true); + + // Unify normals + TestUnifiedNormals(nbVerts, verts, nbFaces, faces, true); + + // Remove zero-area triangles + // TestZeroAreaTriangles(nbFaces, faces, verts, true); + + // Unify normals again + TestUnifiedNormals(nbVerts, verts, nbFaces, faces, true); + + // Get rid of duplicates again + TestDuplicateTriangles(nbFaces, faces, true); + + return true; +} + +////////////////////////////////////////////////////////////////////////// +// check the newly constructed faces +static bool CheckFaces(PxU32 nbFaces, const Gu::TriangleT<PxU32>* faces, PxU32 nbVerts, const PxVec3* verts) +{ + // Remove const since we use functions that can do both testing & repairing. But we won't change the data. + Gu::TriangleT<PxU32>* f = const_cast<Gu::TriangleT<PxU32>*>(faces); + + // Test duplicate faces + if(!TestDuplicateTriangles(nbFaces, f, false)) + return false; + + // Test unified normals + if(!TestUnifiedNormals(nbVerts, verts, nbFaces, f, false)) + return false; + + return true; +} + +////////////////////////////////////////////////////////////////////////// +// compute the newell plane from the face verts +static bool computeNewellPlane(PxPlane& plane, PxU32 nbVerts, const PxU8* indices, const PxVec3* verts) +{ + if(!nbVerts || !indices || !verts) + return false; + + PxVec3 centroid(0,0,0), normal(0,0,0); + for(PxU32 i=nbVerts-1, j=0; j<nbVerts; i=j, j++) + { + normal.x += (verts[indices[i]].y - verts[indices[j]].y) * (verts[indices[i]].z + verts[indices[j]].z); + normal.y += (verts[indices[i]].z - verts[indices[j]].z) * (verts[indices[i]].x + verts[indices[j]].x); + normal.z += (verts[indices[i]].x - verts[indices[j]].x) * (verts[indices[i]].y + verts[indices[j]].y); + centroid += verts[indices[j]]; + } + plane.n = normal; + plane.n.normalize(); + plane.d = -(centroid.dot(plane.n))/float(nbVerts); + + return true; +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +/** +* Analyses a redundant vertices and splits the polygons if necessary. +* \relates ConvexHull +* \fn extractHullPolygons(Container& polygon_data, const ConvexHull& hull) +* \param nb_polygons [out] number of extracted polygons +* \param polygon_data [out] polygon data: (Nb indices, index 0, index 1... index N)(Nb indices, index 0, index 1... index N)(...) +* \param hull [in] convex hull +* \param redundantVertices [out] redundant vertices found inside the polygons - we want to remove them because of PCM +*/ +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +static void checkRedundantVertices(PxU32& nb_polygons, Ps::Array<PxU32>& polygon_data, const ConvexPolygonsBuilder& hull, Ps::Array<PxU32>& triangle_data, Ps::Array<PxU32>& redundantVertices) +{ + const PxU32* dFaces = reinterpret_cast<const PxU32*>(hull.getFaces()); + bool needToSplitPolygons = false; + + bool* polygonMarkers = reinterpret_cast<bool*>(PxAlloca(nb_polygons*sizeof(bool))); + PxMemZero(polygonMarkers, nb_polygons*sizeof(bool)); + + bool* redundancyMarkers = reinterpret_cast<bool*>(PxAlloca(redundantVertices.size()*sizeof(bool))); + PxMemZero(redundancyMarkers, redundantVertices.size()*sizeof(bool)); + + // parse through the redundant vertices and if we cannot remove them split just the actual polygon if possible + Ps::Array<PxU32> polygonsContainer; + PxU32 numEntries = 0; + for (PxU32 i = redundantVertices.size(); i--;) + { + numEntries = 0; + polygonsContainer.clear(); + // go through polygons, if polygons does have only 3 verts we cannot remove any vertex from it, try to decompose the second one + PxU32* Data = polygon_data.begin(); + for(PxU32 t=0;t<nb_polygons;t++) + { + PxU32 nbVerts = *Data++; + PX_ASSERT(nbVerts>=3); // Else something very wrong happened... + + for(PxU32 j=0;j<nbVerts;j++) + { + if(redundantVertices[i] == Data[j]) + { + polygonsContainer.pushBack(t); + polygonsContainer.pushBack(nbVerts); + numEntries++; + break; + } + } + Data += nbVerts; + } + + bool needToSplit = false; + for (PxU32 j = 0; j < numEntries; j++) + { + PxU32 numInternalVertices = polygonsContainer[j*2 + 1]; + if(numInternalVertices == 3) + { + needToSplit = true; + } + } + + // now lets mark the polygons for split + if(needToSplit) + { + // mark the redundant vertex, it is solved by spliting, dont report it + needToSplitPolygons = true; + redundancyMarkers[i] = true; + for (PxU32 j = 0; j < numEntries; j++) + { + PxU32 polygonNumber = polygonsContainer[j*2]; + PxU32 numInternalPolygons = polygonsContainer[j*2 + 1]; + if(numInternalPolygons != 3) + { + polygonMarkers[polygonNumber] = true; + } + } + } + } + + if(needToSplitPolygons) + { + // parse from the end so we can remove it and not change the order + for (PxU32 i = redundantVertices.size(); i--;) + { + // remove it + if(redundancyMarkers[i]) + { + redundantVertices.remove(i); + } + } + + Ps::Array<PxU32> newPolygon_data; + Ps::Array<PxU32> newTriangle_data; + PxU32 newNb_polygons = 0; + + PxU32* data = polygon_data.begin(); + PxU32* triData = triangle_data.begin(); + for(PxU32 i=0;i<nb_polygons;i++) + { + PxU32 nbVerts = *data++; + PxU32 nbTris = *triData++; + if(polygonMarkers[i]) + { + // split the polygon into triangles + for(PxU32 k=0;k< nbTris; k++) + { + newNb_polygons++; + const PxU32 faceIndex = triData[k]; + newPolygon_data.pushBack(PxU32(3)); + newPolygon_data.pushBack(dFaces[3*faceIndex]); + newPolygon_data.pushBack(dFaces[3*faceIndex + 1]); + newPolygon_data.pushBack(dFaces[3*faceIndex + 2]); + newTriangle_data.pushBack(PxU32(1)); + newTriangle_data.pushBack(faceIndex); + } + } + else + { + newNb_polygons++; + // copy the original polygon + newPolygon_data.pushBack(nbVerts); + for(PxU32 j=0;j<nbVerts;j++) + newPolygon_data.pushBack(data[j]); + + // copy the original polygon triangles + newTriangle_data.pushBack(nbTris); + for(PxU32 k=0;k< nbTris; k++) + { + newTriangle_data.pushBack(triData[k]); + } + } + data += nbVerts; + triData += nbTris; + } + + // now put the data to output + polygon_data.clear(); + triangle_data.clear(); + + // the copy does copy even the data + polygon_data = newPolygon_data; + triangle_data = newTriangle_data; + nb_polygons = newNb_polygons; + } +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +/** +* Analyses a convex hull made of triangles and extracts polygon data out of it. +* \relates ConvexHull +* \fn extractHullPolygons(Ps::Array<PxU32>& polygon_data, const ConvexHull& hull) +* \param nb_polygons [out] number of extracted polygons +* \param polygon_data [out] polygon data: (Nb indices, index 0, index 1... index N)(Nb indices, index 0, index 1... index N)(...) +* \param hull [in] convex hull +* \param triangle_data [out] triangle data +* \param rendundantVertices [out] redundant vertices found inside the polygons - we want to remove them because of PCM +* \return true if success +*/ +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +static bool extractHullPolygons(PxU32& nb_polygons, Ps::Array<PxU32>& polygon_data, const ConvexPolygonsBuilder& hull, Ps::Array<PxU32>* triangle_data, Ps::Array<PxU32>& rendundantVertices) +{ + PxU32 nbFaces = hull.getNbFaces(); + const PxVec3* hullVerts = hull.mHullDataHullVertices; + const PxU32 nbVertices = hull.mHull->mNbHullVertices; + + const PxU16* wFaces = NULL; + const PxU32* dFaces = reinterpret_cast<const PxU32*>(hull.getFaces()); + PX_ASSERT(wFaces || dFaces); + + ADJACENCIESCREATE create; + create.NbFaces = nbFaces; + create.DFaces = dFaces; + create.WFaces = wFaces; + create.Verts = hullVerts; + //Create.Epsilon = 0.01f; // PT: trying to fix Rob Elam bug. Also fixes TTP 2467 + // Create.Epsilon = 0.001f; // PT: for "Bruno's bug" + create.Epsilon = 0.005f; // PT: middle-ground seems to fix both. Expose this param? + + + AdjacenciesBuilder adj; + if(!adj.Init(create)) return false; + + PxU32 nbBoundaryEdges = adj.ComputeNbBoundaryEdges(); + if(nbBoundaryEdges) return false; // A valid hull shouldn't have open edges!! + + bool* markers = reinterpret_cast<bool*>(PxAlloca(nbFaces*sizeof(bool))); + PxMemZero(markers, nbFaces*sizeof(bool)); + + PxU8* vertexMarkers = reinterpret_cast<PxU8*>(PxAlloca(nbVertices*sizeof(PxU8))); + PxMemZero(vertexMarkers, nbVertices*sizeof(PxU8)); + + PxU32 currentFace = 0; // Start with first triangle + nb_polygons = 0; + do + { + currentFace = 0; + while(currentFace<nbFaces && markers[currentFace]) currentFace++; + + // Start from "closest" face and floodfill through inactive edges + struct Local + { + static void FloodFill(Ps::Array<PxU32>& indices, const AdjTriangle* faces, PxU32 current, bool* inMarkers) + { + if(inMarkers[current]) return; + inMarkers[current] = true; + + indices.pushBack(current); + const AdjTriangle& AT = faces[current]; + + // We can floodfill through inactive edges since the mesh is convex (inactive==planar) + if(!AT.HasActiveEdge01()) FloodFill(indices, faces, AT.GetAdjTri(EDGE01), inMarkers); + if(!AT.HasActiveEdge20()) FloodFill(indices, faces, AT.GetAdjTri(EDGE02), inMarkers); + if(!AT.HasActiveEdge12()) FloodFill(indices, faces, AT.GetAdjTri(EDGE12), inMarkers); + } + + static bool GetNeighborFace(PxU32 index,PxU32 triangleIndex,const AdjTriangle* faces, const PxU32* dfaces, PxU32& neighbor, PxU32& current) + { + PxU32 currentIndex = index; + PxU32 previousIndex = index; + bool firstFace = true; + bool next = true; + while (next) + { + const AdjTriangle& currentAT = faces[currentIndex]; + PxU32 refTr0 = dfaces[currentIndex*3 + 0]; + PxU32 refTr1 = dfaces[currentIndex*3 + 1]; + + PxU32 edge[2]; + edge[0] = 1; + edge[1] = 2; + if(triangleIndex == refTr0) + { + edge[0] = 0; + edge[1] = 1; + } + else + { + if(triangleIndex == refTr1) + { + edge[0] = 0; + edge[1] = 2; + } + } + + if(currentAT.HasActiveEdge(edge[0]) && currentAT.HasActiveEdge(edge[1])) + { + return false; + } + + if(!currentAT.HasActiveEdge(edge[0]) && !currentAT.HasActiveEdge(edge[1])) + { + // not interested in testing transition vertices + if(currentIndex == index) + { + return false; + } + + // transition one + for (PxU32 i = 0; i < 2; i++) + { + PxU32 testIndex = currentAT.GetAdjTri(SharedEdgeIndex(edge[i])); + + // exit if we circle around the vertex back to beginning + if(testIndex == index && previousIndex != index) + { + return false; + } + + if(testIndex != previousIndex) + { + // move to next + previousIndex = currentIndex; + currentIndex = testIndex; + break; + } + } + } + else + { + if(!currentAT.HasActiveEdge(edge[0])) + { + PxU32 t = edge[0]; + edge[0] = edge[1]; + edge[1] = t; + } + + if(currentAT.HasActiveEdge(edge[0])) + { + PxU32 testIndex = currentAT.GetAdjTri(SharedEdgeIndex(edge[0])); + if(firstFace) + { + firstFace = false; + } + else + { + neighbor = testIndex; + current = currentIndex; + return true; + } + } + + if(!currentAT.HasActiveEdge(edge[1])) + { + PxU32 testIndex = currentAT.GetAdjTri(SharedEdgeIndex(edge[1])); + if(testIndex != index) + { + previousIndex = currentIndex; + currentIndex = testIndex; + } + } + } + + } + + return false; + } + + static bool CheckFloodFillFace(PxU32 index,const AdjTriangle* faces, const PxU32* dfaces) + { + if(!dfaces) + return true; + + const AdjTriangle& checkedAT = faces[index]; + + PxU32 refTr0 = dfaces[index*3 + 0]; + PxU32 refTr1 = dfaces[index*3 + 1]; + PxU32 refTr2 = dfaces[index*3 + 2]; + + for (PxU32 i = 0; i < 3; i++) + { + if(!checkedAT.HasActiveEdge(i)) + { + PxU32 testTr0 = refTr1; + PxU32 testTr1 = refTr2; + PxU32 testIndex0 = 0; + PxU32 testIndex1 = 1; + if(i == 0) + { + testTr0 = refTr0; + testTr1 = refTr1; + testIndex0 = 1; + testIndex1 = 2; + } + else + { + if(i == 1) + { + testTr0 = refTr0; + testTr1 = refTr2; + testIndex0 = 0; + testIndex1 = 2; + } + } + + PxU32 adjFaceTested = checkedAT.GetAdjTri(SharedEdgeIndex(testIndex0)); + + PxU32 neighborIndex00; + PxU32 neighborIndex01; + bool found0 = GetNeighborFace(index,testTr0,faces,dfaces, neighborIndex00, neighborIndex01); + PxU32 neighborIndex10; + PxU32 neighborIndex11; + bool found1 = GetNeighborFace(adjFaceTested,testTr0,faces,dfaces, neighborIndex10, neighborIndex11); + + if(found0 && found1 && neighborIndex00 == neighborIndex11 && neighborIndex01 == neighborIndex10) + { + return false; + } + + adjFaceTested = checkedAT.GetAdjTri(SharedEdgeIndex(testIndex1)); + found0 = GetNeighborFace(index,testTr1,faces,dfaces,neighborIndex00,neighborIndex01); + found1 = GetNeighborFace(adjFaceTested,testTr1,faces,dfaces,neighborIndex10,neighborIndex11); + + if(found0 && found1 && neighborIndex00 == neighborIndex11 && neighborIndex01 == neighborIndex10) + { + return false; + } + + } + } + + return true; + } + + static bool CheckFloodFill(Ps::Array<PxU32>& indices,AdjTriangle* faces,bool* inMarkers, const PxU32* dfaces) + { + bool valid = true; + + for(PxU32 i=0;i<indices.size();i++) + { + //const AdjTriangle& AT = faces[indices.GetEntry(i)]; + + for(PxU32 j= i + 1;j<indices.size();j++) + { + const AdjTriangle& testAT = faces[indices[j]]; + + if(testAT.GetAdjTri(EDGE01) == indices[i]) + { + if(testAT.HasActiveEdge01()) + { + valid = false; + } + } + if(testAT.GetAdjTri(EDGE02) == indices[i]) + { + if(testAT.HasActiveEdge20()) + { + valid = false; + } + } + if(testAT.GetAdjTri(EDGE12) == indices[i]) + { + if(testAT.HasActiveEdge12()) + { + valid = false; + } + } + + if(!valid) + break; + } + + if(!CheckFloodFillFace(indices[i], faces, dfaces)) + { + valid = false; + } + + if(!valid) + break; + } + + if(!valid) + { + for(PxU32 i=0;i<indices.size();i++) + { + AdjTriangle& AT = faces[indices[i]]; + AT.mATri[0] |= 0x20000000; + AT.mATri[1] |= 0x20000000; + AT.mATri[2] |= 0x20000000; + + inMarkers[indices[i]] = false; + } + + indices.forceSize_Unsafe(0); + + return true; + } + + return false; + } + }; + + if(currentFace!=nbFaces) + { + Ps::Array<PxU32> indices; // Indices of triangles forming hull polygon + + bool doFill = true; + while (doFill) + { + Local::FloodFill(indices, adj.mFaces, currentFace, markers); + + doFill = Local::CheckFloodFill(indices,adj.mFaces,markers, dFaces); + } + + // Now it would be nice to recreate a closed linestrip, similar to silhouette extraction. The line is composed of active edges, this time. + + + Ps::Array<Pair> activeSegments; + //Container ActiveSegments; + // Loop through triangles composing the polygon + for(PxU32 i=0;i<indices.size();i++) + { + const PxU32 currentTriIndex = indices[i]; // Catch current triangle + const PxU32 vRef0 = dFaces ? dFaces[currentTriIndex*3+0] : wFaces[currentTriIndex*3+0]; + const PxU32 vRef1 = dFaces ? dFaces[currentTriIndex*3+1] : wFaces[currentTriIndex*3+1]; + const PxU32 vRef2 = dFaces ? dFaces[currentTriIndex*3+2] : wFaces[currentTriIndex*3+2]; + + // Keep active edges + if(adj.mFaces[currentTriIndex].HasActiveEdge01()) { activeSegments.pushBack(Pair(vRef0,vRef1)); } + if(adj.mFaces[currentTriIndex].HasActiveEdge20()) { activeSegments.pushBack(Pair(vRef0,vRef2)); } + if(adj.mFaces[currentTriIndex].HasActiveEdge12()) { activeSegments.pushBack(Pair(vRef1,vRef2)); } + } + + // We assume the polygon is convex. In that case it should always be possible to retriangulate it so that the triangles are + // implicit (in particular, it should always be possible to remove interior triangles) + + Ps::Array<PxU32> lineStrip; + if(findLineStrip(lineStrip, activeSegments)) + { + PxU32 nb = lineStrip.size(); + if(nb) + { + const PxU32* entries = lineStrip.begin(); + PX_ASSERT(entries[0] == entries[nb-1]); // findLineStrip() is designed that way. Might not be what we want! + + // We get rid of the last (duplicated) index + polygon_data.pushBack(nb-1); + for (PxU32 i = 0; i < nb-1; i++) + { + vertexMarkers[entries[i]]++; + polygon_data.pushBack(entries[i]); + } + nb_polygons++; + + // Loop through vertices composing the line strip polygon end mark the redundant vertices inside the polygon + for(PxU32 i=0;i<indices.size();i++) + { + const PxU32 CurrentTriIndex = indices[i]; // Catch current triangle + const PxU32 VRef0 = dFaces ? dFaces[CurrentTriIndex*3+0] : wFaces[CurrentTriIndex*3+0]; + const PxU32 VRef1 = dFaces ? dFaces[CurrentTriIndex*3+1] : wFaces[CurrentTriIndex*3+1]; + const PxU32 VRef2 = dFaces ? dFaces[CurrentTriIndex*3+2] : wFaces[CurrentTriIndex*3+2]; + + bool found0 = false; + bool found1 = false; + bool found2 = false; + + for (PxU32 j=0;j < nb - 1; j++) + { + if(VRef0 == entries[j]) + { + found0 = true; + } + + if(VRef1 == entries[j]) + { + found1 = true; + } + + if(VRef2 == entries[j]) + { + found2 = true; + } + + if(found0 && found1 && found2) + break; + } + + if(!found0) + { + if(rendundantVertices.find(VRef0) == rendundantVertices.end()) + rendundantVertices.pushBack(VRef0); + } + + if(!found1) + { + if(rendundantVertices.find(VRef1) == rendundantVertices.end()) + rendundantVertices.pushBack(VRef1); + + } + + if(!found2) + { + if(rendundantVertices.find(VRef2) == rendundantVertices.end()) + rendundantVertices.pushBack(VRef2); + } + } + + // If needed, output triangle indices used to build this polygon + if(triangle_data) + { + triangle_data->pushBack(indices.size()); + for (PxU32 j = 0; j < indices.size(); j++) + triangle_data->pushBack(indices[j]); + } + } + } + else + { + Ps::getFoundation().error(PxErrorCode::eINVALID_OPERATION, __FILE__, __LINE__, "Meshmerizer::extractHullPolygons: line strip extraction failed"); + return false; + } + } + } + while(currentFace!=nbFaces); + + for (PxU32 i = 0; i < nbVertices; i++) + { + if(vertexMarkers[i] < 3) + { + if(rendundantVertices.find(i) == rendundantVertices.end()) + rendundantVertices.pushBack(i); + } + } + + if(rendundantVertices.size() > 0 && triangle_data) + checkRedundantVertices(nb_polygons,polygon_data,hull,*triangle_data,rendundantVertices); + + return true; +} + +////////////////////////////////////////////////////////////////////////// + +ConvexPolygonsBuilder::ConvexPolygonsBuilder(Gu::ConvexHullData* hull, const bool buildGRBData) + : ConvexHullBuilder(hull, buildGRBData), mNbHullFaces(0), mFaces(NULL) +{ +} + +////////////////////////////////////////////////////////////////////////// + +ConvexPolygonsBuilder::~ConvexPolygonsBuilder() +{ + PX_DELETE_POD(mFaces); +} + +////////////////////////////////////////////////////////////////////////// +// compute hull polygons from given hull triangles +bool ConvexPolygonsBuilder::computeHullPolygons(const PxU32& nbVerts,const PxVec3* verts, const PxU32& nbTriangles, const PxU32* triangles) +{ + PX_ASSERT(triangles); + PX_ASSERT(verts); + + mHullDataHullVertices = NULL; + mHullDataPolygons = NULL; + mHullDataVertexData8 = NULL; + mHullDataFacesByEdges8 = NULL; + mHullDataFacesByVertices8 = NULL; + + mNbHullFaces = nbTriangles; + mHull->mNbHullVertices = Ps::to8(nbVerts); + // allocate additional vec3 for V4 safe load in VolumeInteration + mHullDataHullVertices = reinterpret_cast<PxVec3*>(PX_ALLOC(sizeof(PxVec3) * mHull->mNbHullVertices + 1, "PxVec3")); + PxMemCopy(mHullDataHullVertices, verts, mHull->mNbHullVertices*sizeof(PxVec3)); + + mFaces = PX_NEW(HullTriangleData)[mNbHullFaces]; + for(PxU32 i=0;i<mNbHullFaces;i++) + { + PX_ASSERT(triangles[i*3+0]<=0xffff); + PX_ASSERT(triangles[i*3+1]<=0xffff); + PX_ASSERT(triangles[i*3+2]<=0xffff); + mFaces[i].mRef[0] = triangles[i*3+0]; + mFaces[i].mRef[1] = triangles[i*3+1]; + mFaces[i].mRef[2] = triangles[i*3+2]; + } + + Gu::TriangleT<PxU32>* hullAsIndexedTriangle = reinterpret_cast<Gu::TriangleT<PxU32>*>(mFaces); + + // We don't trust the user at all... So, clean the hull. + PxU32 nbHullVerts = mHull->mNbHullVertices; + CleanFaces(mNbHullFaces, hullAsIndexedTriangle, nbHullVerts, mHullDataHullVertices); + PX_ASSERT(nbHullVerts<256); + mHull->mNbHullVertices = Ps::to8(nbHullVerts); + + // ...and then run the full tests again. + if(!CheckFaces(mNbHullFaces, hullAsIndexedTriangle, mHull->mNbHullVertices, mHullDataHullVertices)) + return false; + + // Transform triangles-to-polygons + if(!createPolygonData()) + return false; + + return checkHullPolygons(); +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +/** +* Computes polygon data. +* \return true if success +*/ +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// +bool ConvexPolygonsBuilder::createPolygonData() +{ + // Cleanup + mHull->mNbPolygons = 0; + PX_DELETE_POD(mHullDataVertexData8); + PX_DELETE_POD(mHullDataFacesByVertices8); + PX_FREE_AND_RESET(mHullDataPolygons); + + // Extract polygon data from triangle data + Ps::Array<PxU32> temp; + Ps::Array<PxU32> temp2; + Ps::Array<PxU32> rendundantVertices; + PxU32 nbPolygons; + if(!extractHullPolygons(nbPolygons, temp, *this, &temp2,rendundantVertices)) + return false; + + PxVec3* reducedHullDataHullVertices = mHullDataHullVertices; + PxU8 numReducedHullDataVertices = mHull->mNbHullVertices; + + if(rendundantVertices.size() > 0) + { + numReducedHullDataVertices = Ps::to8(mHull->mNbHullVertices - rendundantVertices.size()); + reducedHullDataHullVertices = static_cast<PxVec3*> (PX_ALLOC_TEMP(sizeof(PxVec3)*numReducedHullDataVertices,"Reduced vertices hull data")); + PxU8* remapTable = PX_NEW(PxU8)[mHull->mNbHullVertices]; + + PxU8 currentIndex = 0; + for (PxU8 i = 0; i < mHull->mNbHullVertices; i++) + { + if(rendundantVertices.find(i) == rendundantVertices.end()) + { + PX_ASSERT(currentIndex < numReducedHullDataVertices); + reducedHullDataHullVertices[currentIndex] = mHullDataHullVertices[i]; + remapTable[i] = currentIndex; + currentIndex++; + } + else + { + remapTable[i] = 0xFF; + } + } + + PxU32* data = temp.begin(); + for(PxU32 i=0;i<nbPolygons;i++) + { + PxU32 nbVerts = *data++; + PX_ASSERT(nbVerts>=3); // Else something very wrong happened... + + for(PxU32 j=0;j<nbVerts;j++) + { + PX_ASSERT(data[j] < mHull->mNbHullVertices); + data[j] = remapTable[data[j]]; + } + + data += nbVerts; + } + + PX_DELETE_POD(remapTable); + } + + if(nbPolygons>255) + { + Ps::getFoundation().error(PxErrorCode::eINTERNAL_ERROR, __FILE__, __LINE__, "ConvexHullBuilder: convex hull has more than 255 polygons!"); + return false; + } + + // Precompute hull polygon structures + mHull->mNbPolygons = Ps::to8(nbPolygons); + mHullDataPolygons = reinterpret_cast<Gu::HullPolygonData*>(PX_ALLOC(sizeof(Gu::HullPolygonData)*mHull->mNbPolygons, "Gu::HullPolygonData")); + PxMemZero(mHullDataPolygons, sizeof(Gu::HullPolygonData)*mHull->mNbPolygons); + + // The winding hasn't been preserved so we need to handle this. Basically we need to "unify normals" + // exactly as we did at hull creation time - except this time we work on polygons + PxVec3 geomCenter; + computeGeomCenter(geomCenter, mNbHullFaces, mFaces); + + // Loop through polygons + // We have N polygons => remove N entries for number of vertices + PxU32 tmp = temp.size() - nbPolygons; + mHullDataVertexData8 = PX_NEW(PxU8)[tmp]; + PxU8* dest = mHullDataVertexData8; + const PxU32* data = temp.begin(); + const PxU32* triData = temp2.begin(); + for(PxU32 i=0;i<nbPolygons;i++) + { + mHullDataPolygons[i].mVRef8 = PxU16(dest - mHullDataVertexData8); // Setup link for current polygon + PxU32 nbVerts = *data++; + PX_ASSERT(nbVerts>=3); // Else something very wrong happened... + mHullDataPolygons[i].mNbVerts = Ps::to8(nbVerts); + + PxU32 index = 0; + for(PxU32 j=0;j<nbVerts;j++) + { + if(data[j] != 0xFF) + { + dest[index] = Ps::to8(data[j]); + index++; + } + else + { + mHullDataPolygons[i].mNbVerts--; + } + } + + // Compute plane equation + { + computeNewellPlane(mHullDataPolygons[i].mPlane, mHullDataPolygons[i].mNbVerts, dest, reducedHullDataHullVertices); + + PxU32 nbTris = *triData++; // #tris in current poly + bool flip = false; + for(PxU32 k=0;k< nbTris; k++) + { + PxU32 triIndex = *triData++; // Index of one triangle composing polygon + PX_ASSERT(triIndex<mNbHullFaces); + const Gu::TriangleT<PxU32>& T = reinterpret_cast<const Gu::TriangleT<PxU32>&>(mFaces[triIndex]); + const PxPlane PL = PlaneEquation(T, mHullDataHullVertices); + if(k==0 && PL.n.dot(mHullDataPolygons[i].mPlane.n) < 0.0f) + { + flip = true; + } + } + if(flip) + { + negatePlane(mHullDataPolygons[i]); + inverseBuffer(mHullDataPolygons[i].mNbVerts, dest); + } + + for(PxU32 j=0;j<mHull->mNbHullVertices;j++) + { + float d = - (mHullDataPolygons[i].mPlane.n).dot(mHullDataHullVertices[j]); + if(d<mHullDataPolygons[i].mPlane.d) mHullDataPolygons[i].mPlane.d=d; + } + } + + // "Unify normal" + if(mHullDataPolygons[i].mPlane.distance(geomCenter)>0.0f) + { + inverseBuffer(mHullDataPolygons[i].mNbVerts, dest); + + negatePlane(mHullDataPolygons[i]); + PX_ASSERT(mHullDataPolygons[i].mPlane.distance(geomCenter)<=0.0f); + } + + // Next one + data += nbVerts; // Skip vertex indices + dest += mHullDataPolygons[i].mNbVerts; + } + + if(reducedHullDataHullVertices != mHullDataHullVertices) + { + PxMemCopy(mHullDataHullVertices,reducedHullDataHullVertices,sizeof(PxVec3)*numReducedHullDataVertices); + PX_FREE(reducedHullDataHullVertices); + + mHull->mNbHullVertices = numReducedHullDataVertices; + } + + //calculate the vertex map table + if(!calculateVertexMapTable(nbPolygons)) + return false; + +#ifdef USE_PRECOMPUTED_HULL_PROJECTION + // Loop through polygons + for(PxU32 j=0;j<nbPolygons;j++) + { + // Precompute hull projection along local polygon normal + PxU32 nbVerts = mHull->mNbHullVertices; + const PxVec3* verts = mHullDataHullVertices; + Gu::HullPolygonData& polygon = mHullDataPolygons[j]; + PxReal min = PX_MAX_F32; + PxU8 minIndex = 0xff; + for (PxU8 i = 0; i < nbVerts; i++) + { + float dp = (*verts++).dot(polygon.mPlane.n); + if(dp < min) + { + min = dp; + minIndex = i; + } + } + polygon.mMinIndex = minIndex; + } +#endif + + // Triangulate newly created polygons to recreate a clean vertex cloud. + return createTrianglesFromPolygons(); +} + +////////////////////////////////////////////////////////////////////////// +// create back triangles from polygons +bool ConvexPolygonsBuilder::createTrianglesFromPolygons() +{ + if (!mHull->mNbPolygons || !mHullDataPolygons) return false; + + PxU32 maxNbTriangles = 0; + for (PxU32 i = 0; i < mHull->mNbPolygons; i++) + { + if (mHullDataPolygons[i].mNbVerts < 3) + { + Ps::getFoundation().error(PxErrorCode::eINTERNAL_ERROR, __FILE__, __LINE__, "ConvexHullBuilder::CreateTrianglesFromPolygons: convex hull has a polygon with less than 3 vertices!"); + return false; + } + maxNbTriangles += mHullDataPolygons[i].mNbVerts - 2; + } + + HullTriangleData* tmpFaces = PX_NEW(HullTriangleData)[maxNbTriangles]; + + HullTriangleData* currFace = tmpFaces; + PxU32 nbTriangles = 0; + const PxU8* vertexData = mHullDataVertexData8; + const PxVec3* hullVerts = mHullDataHullVertices; + for (PxU32 i = 0; i < mHull->mNbPolygons; i++) + { + const PxU8* data = vertexData + mHullDataPolygons[i].mVRef8; + PxU32 nbVerts = mHullDataPolygons[i].mNbVerts; + + // Triangulate the polygon such that all all generated triangles have one and the same vertex + // in common. + // + // Make sure to avoid creating zero area triangles. Imagine the following polygon: + // + // 4 3 + // *------------------* + // | | + // *---*----*----*----* + // 5 6 0 1 2 + // + // Choosing vertex 0 as the shared vertex, the following zero area triangles will be created: + // [0 1 2], [0 5 6] + // + // Check for these triangles and discard them + // Note: Such polygons should only occur if the user defines the convex hull, i.e., the triangles + // of the convex shape, himself. If the convex hull is built from the vertices only, the + // hull algorithm removes the useless vertices. + // + for (PxU32 j = 0; j < nbVerts - 2; j++) + { + currFace->mRef[0] = data[0]; + currFace->mRef[1] = data[(j + 1) % nbVerts]; + currFace->mRef[2] = data[(j + 2) % nbVerts]; + + const PxVec3& p0 = hullVerts[currFace->mRef[0]]; + const PxVec3& p1 = hullVerts[currFace->mRef[1]]; + const PxVec3& p2 = hullVerts[currFace->mRef[2]]; + + const float area = ((p1 - p0).cross(p2 - p0)).magnitudeSquared(); + + if (area != 0.0f) // Else discard the triangle + { + nbTriangles++; + currFace++; + } + } + } + + PX_DELETE_POD(mFaces); + HullTriangleData* faces; + PX_ASSERT(nbTriangles <= maxNbTriangles); + if (maxNbTriangles == nbTriangles) + { + // No zero area triangles, hence the face buffer has correct size and can be used directly. + faces = tmpFaces; + } + else + { + // Resize face buffer because some triangles were discarded. + faces = PX_NEW(HullTriangleData)[nbTriangles]; + if (!faces) + { + PX_DELETE_POD(tmpFaces); + return false; + } + PxMemCopy(faces, tmpFaces, sizeof(HullTriangleData)*nbTriangles); + PX_DELETE_POD(tmpFaces); + } + mFaces = faces; + mNbHullFaces = nbTriangles; + // TODO: at this point useless vertices should be removed from the hull. The current fix is to initialize + // support vertices to known valid vertices, but it's not really convincing. + + // Re-unify normals + PxVec3 geomCenter; + computeGeomCenter(geomCenter, mNbHullFaces, mFaces); + + for (PxU32 i = 0; i < mNbHullFaces; i++) + { + const PxPlane P(hullVerts[mFaces[i].mRef[0]], + hullVerts[mFaces[i].mRef[1]], + hullVerts[mFaces[i].mRef[2]]); + if (P.distance(geomCenter) > 0.0f) + { + Flip(mFaces[i]); + } + } + return true; +} + diff --git a/PhysX_3.4/Source/PhysXCooking/src/convex/ConvexPolygonsBuilder.h b/PhysX_3.4/Source/PhysXCooking/src/convex/ConvexPolygonsBuilder.h new file mode 100644 index 00000000..52044eb0 --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/convex/ConvexPolygonsBuilder.h @@ -0,0 +1,64 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + + +#ifndef PX_CONVEXPOLYGONSBUILDER_H +#define PX_CONVEXPOLYGONSBUILDER_H + +#include "ConvexHullBuilder.h" + +namespace physx +{ + ////////////////////////////////////////////////////////////////////////// + // extended convex hull builder for a case where we build polygons from input triangles + class ConvexPolygonsBuilder : public ConvexHullBuilder + { + public: + ConvexPolygonsBuilder(Gu::ConvexHullData* hull, const bool buildGRBData); + ~ConvexPolygonsBuilder(); + + bool computeHullPolygons(const PxU32& nbVerts,const PxVec3* verts, const PxU32& nbTriangles, const PxU32* triangles); + + PX_INLINE PxU32 getNbFaces()const { return mNbHullFaces; } + PX_INLINE const HullTriangleData* getFaces() const { return mFaces; } + + + private: + bool createPolygonData(); + bool createTrianglesFromPolygons(); + + private: + PxU32 mNbHullFaces; //!< Number of faces in the convex hull + HullTriangleData* mFaces; //!< Triangles. + + }; +} + +#endif // PX_CONVEXHULLBUILDER_H + diff --git a/PhysX_3.4/Source/PhysXCooking/src/convex/InflationConvexHullLib.cpp b/PhysX_3.4/Source/PhysXCooking/src/convex/InflationConvexHullLib.cpp new file mode 100644 index 00000000..8f60275c --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/convex/InflationConvexHullLib.cpp @@ -0,0 +1,1481 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + +#include "PsAlloca.h" +#include "PsUserAllocated.h" +#include "PsMathUtils.h" +#include "PsUtilities.h" + +#include "foundation/PxMath.h" +#include "foundation/PxBounds3.h" +#include "foundation/PxPlane.h" +#include "foundation/PxMemory.h" + +#include "InflationConvexHullLib.h" +#include "ConvexHullUtils.h" + +using namespace physx; + +namespace local +{ + ////////////////////////////////////////////////////////////////////////// + // constants + static const float DIMENSION_EPSILON_MULTIPLY = 0.001f; // used to scale down bounds dimension and set as epsilon used in the hull generator + static const float DIR_ANGLE_MULTIPLY = 0.025f; // used in maxIndexInDirSterid for direction check modifier + static const float VOLUME_EPSILON = (1e-20f); // volume epsilon used for simplex valid + static const float MIN_ADJACENT_ANGLE = 3.0f; // in degrees - result wont have two adjacent facets within this angle of each other. !AB expose this parameter or use the one PxCookingParams + static const float PAPERWIDTH = 0.001f; // used in hull construction from planes, within paperwidth its considered coplanar + + ////////////////////////////////////////////////////////////////////////// + // gets the most distant index along the given dir filtering allowed indices + PxI32 maxIndexInDirFiltered(const PxVec3 *p,PxU32 count,const PxVec3 &dir, bool* tempNotAllowed) + { + PX_ASSERT(count); + PxI32 m=-1; + for(PxU32 i=0;i < count; i++) + { + if(!tempNotAllowed[i]) + { + if(m==-1 || p[i].dot(dir) > p[m].dot(dir)) + m= PxI32(i); + } + } + PX_ASSERT(m!=-1); + return m; + } + + ////////////////////////////////////////////////////////////////////////// + // gets orthogonal more significant vector + static PxVec3 orth(const PxVec3& v) + { + PxVec3 a= v.cross(PxVec3(0,0,1.f)); + PxVec3 b= v.cross(PxVec3(0,1.f,0)); + PxVec3 out = (a.magnitudeSquared() > b.magnitudeSquared())? a : b; + out.normalize(); + return out; + } + + ////////////////////////////////////////////////////////////////////////// + // find the most distant index in given direction dir + PxI32 maxIndexInDirSterid(const PxVec3* p,PxU32 count,const PxVec3& dir,Ps::Array<PxU8> &allow) + { + // if the found vertex does not get hit by a slightly rotated ray, it + // may not be the extreme we are looking for. Therefore it is marked + // as disabled for the direction search and different candidate is chosen. + PX_ALLOCA(tempNotAllowed,bool,count); + PxMemSet(tempNotAllowed,0,count*sizeof(bool)); + + PxI32 m=-1; + while(m==-1) + { + // get the furthest index along dir + m = maxIndexInDirFiltered(p,count,dir,tempNotAllowed); + PX_ASSERT(m >= 0); + + if(allow[PxU32(m)] == 3) + return m; + + // get orthogonal vectors to the dir + PxVec3 u = orth(dir); + PxVec3 v = u.cross(dir); + + PxI32 ma=-1; + // we shoot a ray close to the original dir and hope to get the same index + // if we not hit the same index we try it with bigger precision + // if we still fail to hit the same index we drop the index and iterate again + for(float x = 0.0f ; x <= 360.0f ; x+= 45.0f) + { + float s0 = PxSin(Ps::degToRad(x)); + float c0 = PxCos(Ps::degToRad(x)); + PxI32 mb = maxIndexInDirFiltered(p,count,dir+(u*s0+v*c0)*DIR_ANGLE_MULTIPLY,tempNotAllowed); + if(ma==m && mb==m) + { + allow[PxU32(m)]=3; + return m; + } + if(ma!=-1 && ma!=mb) + { + PxI32 mc = ma; + for(float xx = x-40.0f ; xx <= x ; xx+= 5.0f) + { + float s = PxSin(Ps::degToRad(xx)); + float c = PxCos(Ps::degToRad(xx)); + int md = maxIndexInDirFiltered(p,count,dir+(u*s+v*c)*DIR_ANGLE_MULTIPLY,tempNotAllowed); + if(mc==m && md==m) + { + allow[PxU32(m)]=3; + return m; + } + mc=md; + } + } + ma=mb; + } + tempNotAllowed[m]=true; + m=-1; + } + PX_ASSERT(0); + return m; + } + + ////////////////////////////////////////////////////////////////////////// + // Simplex helper class - just holds the 4 indices + class HullSimplex + { + public: + PxI32 x,y,z,w; + HullSimplex(){} + HullSimplex(PxI32 _x,PxI32 _y, PxI32 _z,PxI32 _w){x=_x;y=_y;z=_z;w=_w;} + const PxI32& operator[](PxI32 i) const + { + return reinterpret_cast<const PxI32*>(this)[i]; + } + PxI32& operator[](PxI32 i) + { + return reinterpret_cast<PxI32*>(this)[i]; + } + + ////////////////////////////////////////////////////////////////////////// + // checks the volume of given simplex + static bool hasVolume(const PxVec3* verts, PxU32 p0, PxU32 p1, PxU32 p2, PxU32 p3) + { + PxVec3 result3 = (verts[p1]-verts[p0]).cross(verts[p2]-verts[p0]); + if ((result3).magnitude() < VOLUME_EPSILON && (result3).magnitude() > -VOLUME_EPSILON) // Almost collinear or otherwise very close to each other + return false; + result3.normalize(); + const float result = result3.dot(verts[p3]-verts[p0]); + return (result > VOLUME_EPSILON || result < -VOLUME_EPSILON); // Returns true if volume is significantly non-zero + } + }; + + ////////////////////////////////////////////////////////////////////////// + // finds the hull simplex http://en.wikipedia.org/wiki/Simplex + // in - vertices, vertex count, dimensions + // out - indices forming the simplex + static HullSimplex findSimplex(const PxVec3* verts, PxU32 verts_count, Ps::Array<PxU8>& allow,const PxVec3& minMax) + { + // pick the basis vectors + PxVec3 basisVector[3]; + PxVec3 basis[3]; + basisVector[0] = PxVec3( 1.0f, 0.02f, 0.01f); + basisVector[1] = PxVec3(-0.02f, 1.0f, -0.01f); + basisVector[2] = PxVec3( 0.01f, 0.02f, 1.0f ); + + PxU32 index0 = 0; + PxU32 index1 = 1; + PxU32 index2 = 2; + + // make the order of the basis vector depending on the points bounds, first basis test will be done + // along the longest axis + if(minMax.z > minMax.x && minMax.z > minMax.y) + { + index0 = 2; + index1 = 0; + index2 = 1; + } + else + { + if(minMax.y > minMax.x && minMax.y > minMax.z) + { + index0 = 1; + index1 = 2; + index2 = 0; + } + } + + // pick the fist basis vector + basis[0] = basisVector[index0]; + // find the indices along the pos/neg direction + PxI32 p0 = maxIndexInDirSterid(verts,verts_count, basis[0],allow); + PxI32 p1 = maxIndexInDirSterid(verts,verts_count,-basis[0],allow); + + // set the first simplex axis + basis[0] = verts[p0]-verts[p1]; + // if the points are the same or the basis vector is zero, terminate we failed to find a simplex + if(p0==p1 || basis[0]==PxVec3(0.0f)) + return HullSimplex(-1,-1,-1,-1); + + // get the orthogonal vectors against the new basis[0] vector + basis[1] = basisVector[index1].cross(basis[0]); //cross(float3( 1, 0.02f, 0),basis[0]); + basis[2] = basisVector[index2].cross(basis[0]); //cross(float3(-0.02f, 1, 0),basis[0]); + // pick the longer basis vector + basis[1] = ((basis[1]).magnitudeSquared() > (basis[2]).magnitudeSquared()) ? basis[1] : basis[2]; + basis[1].normalize(); + + // get the index along the picked second axis + PxI32 p2 = maxIndexInDirSterid(verts,verts_count,basis[1],allow); + // if we got the same point, try the negative direction + if(p2 == p0 || p2 == p1) + { + p2 = maxIndexInDirSterid(verts,verts_count,-basis[1],allow); + } + // we failed to create the simplex the points are the same as the base line + if(p2 == p0 || p2 == p1) + return HullSimplex(-1,-1,-1,-1); + + // set the second simplex edge + basis[1] = verts[p2] - verts[p0]; + // get the last orthogonal direction + basis[2] = basis[1].cross(basis[0]); + basis[2].normalize(); + + // get the index along the last direction + PxI32 p3 = maxIndexInDirSterid(verts,verts_count,basis[2],allow); + if(p3==p0||p3==p1||p3==p2||!HullSimplex::hasVolume(verts, PxU32(p0), PxU32(p1), PxU32(p2), PxU32(p3))) + { + p3 = maxIndexInDirSterid(verts,verts_count,-basis[2],allow); + } + // if this index was already chosen terminate we dont have the simplex + if(p3==p0||p3==p1||p3==p2) + return HullSimplex(-1,-1,-1,-1); + + PX_ASSERT(!(p0==p1||p0==p2||p0==p3||p1==p2||p1==p3||p2==p3)); + + // check the axis order + if((verts[p3]-verts[p0]).dot((verts[p1]-verts[p0]).cross(verts[p2]-verts[p0])) < 0) + { + Ps::swap(p2,p3); + } + return HullSimplex(p0,p1,p2,p3); + } + + ////////////////////////////////////////////////////////////////////////// + // helper struct for hull expand + struct ExpandPlane + { + PxPlane mPlane; + int mAdjacency[3]; // 1 - 0, 2 - 0, 2 - 1 + int mExpandPoint; + float mExpandDistance; + int mIndices[3]; + int mTrisIndex; + + ExpandPlane() + { + for (int i = 0; i < 3; i++) + { + mAdjacency[i] = -1; + mIndices[i] = -1; + } + + mExpandDistance = -FLT_MAX; + mExpandPoint = -1; + mTrisIndex = -1; + } + }; + + + ////////////////////////////////////////////////////////////////////////// + // helper class for triangle representation + class int3 + { + public: + PxI32 x,y,z; + int3(){} + int3(PxI32 _x,PxI32 _y, PxI32 _z){x=_x;y=_y;z=_z;} + const PxI32& operator[](PxI32 i) const + { + return reinterpret_cast<const PxI32*>(this)[i]; + } + PxI32& operator[](PxI32 i) + { + return reinterpret_cast<PxI32*>(this)[i]; + } + }; + + ////////////////////////////////////////////////////////////////////////// + // helper class for triangle representation + class Tri : public int3, public Ps::UserAllocated + { + public: + int3 n; + PxI32 id; + PxI32 vmax; + float rise; + + // get the neighbor index for edge + PxI32& neib(PxI32 a, PxI32 b) + { + static PxI32 er=-1; + for(PxI32 i=0;i<3;i++) + { + PxI32 i1= (i+1)%3; + PxI32 i2= (i+2)%3; + if((*this)[i]==a && (*this)[i1]==b) return n[i2]; + if((*this)[i]==b && (*this)[i1]==a) return n[i2]; + } + PX_ASSERT(0); + return er; + } + + // get triangle normal + PxVec3 getNormal(const PxVec3* verts) const + { + // return the normal of the triangle + // inscribed by v0, v1, and v2 + const PxVec3& v0 = verts[(*this)[0]]; + const PxVec3& v1 = verts[(*this)[1]]; + const PxVec3& v2 = verts[(*this)[2]]; + PxVec3 cp= (v1-v0).cross(v2-v1); + float m= (cp).magnitude(); + if(m==0) + return PxVec3(1.f,0.0f,0.0f); + return cp*(1.0f/m); + } + + float getArea2(const PxVec3* verts) const + { + const PxVec3& v0 = verts[(*this)[0]]; + const PxVec3& v1 = verts[(*this)[1]]; + const PxVec3& v2 = verts[(*this)[2]]; + return ((v0-v1).cross(v2-v0)).magnitudeSquared(); + } + + friend class HullTriangles; + protected: + + Tri(PxI32 a, PxI32 b, PxI32 c) : int3(a, b, c), n(-1,-1,-1) + { + vmax=-1; + rise = 0.0f; + } + + ~Tri() + { + } + }; + + ////////////////////////////////////////////////////////////////////////// + // checks if for given triangle the point is above the triangle in the normal direction + // value is checked against an epsilon + static PxI32 above(const PxVec3* vertices, const Tri& t, const PxVec3& p, float epsilon) + { + PxVec3 n = t.getNormal(vertices); + return (n.dot(p-vertices[t[0]]) > epsilon); + } + + ////////////////////////////////////////////////////////////////////////// + // checks if given triangle does contain the vertex v + static int hasVert(const int3& t, int v) + { + return (t[0]==v || t[1]==v || t[2]==v) ; + } + + ////////////////////////////////////////////////////////////////////////// + // helper class for hull triangles management + class HullTriangles + { + public: + HullTriangles() + { + mTriangles.reserve(256); + } + + ~HullTriangles() + { + for (PxU32 i = 0; i < mTriangles.size(); i++) + { + if(mTriangles[i]) + delete mTriangles[i]; + } + mTriangles.clear(); + } + + const Tri* operator[](PxU32 i) const + { + return mTriangles[i]; + } + + Tri* operator[](PxU32 i) + { + return mTriangles[i]; + } + + + ////////////////////////////////////////////////////////////////////////// + + const Ps::Array<Tri*>& getTriangles() const + { + return mTriangles; + } + Ps::Array<Tri*>& getTriangles() + { + return mTriangles; + } + + ////////////////////////////////////////////////////////////////////////// + + PxU32 size() const + { + return mTriangles.size(); + } + + ////////////////////////////////////////////////////////////////////////// + // delete triangle from the array + Tri* createTri(PxI32 a, PxI32 b, PxI32 c) + { + Tri* tri = PX_NEW_TEMP(Tri)(a, b, c); + tri->id = PxI32(mTriangles.size()); + mTriangles.pushBack(tri); + return tri; + } + + ////////////////////////////////////////////////////////////////////////// + // delete triangle from the array + void deleteTri(Tri* tri) + { + PX_ASSERT((mTriangles)[PxU32(tri->id)]==tri); + (mTriangles)[PxU32(tri->id)] = NULL; + delete tri; + } + + ////////////////////////////////////////////////////////////////////////// + // check triangle + void checkit(Tri* t) const + { + PX_ASSERT((mTriangles)[PxU32(t->id)]==t); + for(int i=0;i<3;i++) + { + const int i1=(i+1)%3; + const int i2=(i+2)%3; + const int a = (*t)[i1]; + const int b = (*t)[i2]; + PX_ASSERT(a!=b); + PX_ASSERT( (mTriangles)[PxU32(t->n[i])]->neib(b,a) == t->id); + PX_UNUSED(a); + PX_UNUSED(b); + } + } + + ////////////////////////////////////////////////////////////////////////// + // find the triangle, which has the greatest rise (distance in the direction of normal) + // return such a triangle if it does exist and if the rise is bigger than given epsilon + Tri* findExtrudable(float epsilon) const + { + Tri* t = NULL; + for(PxU32 i=0; i < mTriangles.size(); i++) + { + if(!t || ((mTriangles)[i] && (t->rise < (mTriangles)[i]->rise))) + { + t = (mTriangles)[i]; + } + } + if(!t) + return NULL; + return (t->rise > epsilon) ? t : NULL; + } + + ////////////////////////////////////////////////////////////////////////// + // extrude the given triangle t0 with triangle v + void extrude(Tri* t0, PxI32 v) + { + int3 t= *t0; + PxI32 n = PxI32(mTriangles.size()); + // create the 3 extruded triangles + Tri* ta = createTri(v, t[1], t[2]); + ta->n = int3(t0->n[0],n+1,n+2); + (mTriangles)[PxU32(t0->n[0])]->neib(t[1],t[2]) = n+0; + Tri* tb = createTri(v, t[2], t[0]); + tb->n = int3(t0->n[1],n+2,n+0); + (mTriangles)[PxU32(t0->n[1])]->neib(t[2],t[0]) = n+1; + Tri* tc = createTri(v, t[0], t[1]); + tc->n = int3(t0->n[2],n+0,n+1); + (mTriangles)[PxU32(t0->n[2])]->neib(t[0],t[1]) = n+2; + checkit(ta); + checkit(tb); + checkit(tc); + + // check if the added triangle is not already inserted + // in that case we remove both and fix the neighbors + // for the remaining triangles + if(hasVert(*(mTriangles)[PxU32(ta->n[0])],v)) + removeb2b(ta,(mTriangles)[PxU32(ta->n[0])]); + if(hasVert(*(mTriangles)[PxU32(tb->n[0])],v)) + removeb2b(tb,(mTriangles)[PxU32(tb->n[0])]); + if(hasVert(*(mTriangles)[PxU32(tc->n[0])],v)) + removeb2b(tc,(mTriangles)[PxU32(tc->n[0])]); + deleteTri(t0); + } + + protected: + ////////////////////////////////////////////////////////////////////////// + // remove the 2 triangles which are the same and fix the neighbor triangles + void b2bfix(Tri* s, Tri* t) + { + for(int i=0;i<3;i++) + { + const int i1=(i+1)%3; + const int i2=(i+2)%3; + const int a = (*s)[i1]; + const int b = (*s)[i2]; + PX_ASSERT((mTriangles)[PxU32(s->neib(a,b))]->neib(b,a) == s->id); + PX_ASSERT((mTriangles)[PxU32(t->neib(a,b))]->neib(b,a) == t->id); + (mTriangles)[PxU32(s->neib(a,b))]->neib(b,a) = t->neib(b,a); + (mTriangles)[PxU32(t->neib(b,a))]->neib(a,b) = s->neib(a,b); + } + } + + ////////////////////////////////////////////////////////////////////////// + // remove the 2 triangles which are the same and fix the neighbor triangles + void removeb2b(Tri* s, Tri* t) + { + b2bfix(s,t); + deleteTri(s); + deleteTri(t); + } + + + private: + Ps::Array<Tri*> mTriangles; + }; + + } + + ////////////////////////////////////////////////////////////////////////// + +InflationConvexHullLib::InflationConvexHullLib(const PxConvexMeshDesc& desc, const PxCookingParams& params) + : ConvexHullLib(desc,params), mFinished(false) +{ +} + +////////////////////////////////////////////////////////////////////////// +// Main function to create the hull. +// Construct the hull with set input parameters - ConvexMeshDesc and CookingParams +PxConvexMeshCookingResult::Enum InflationConvexHullLib::createConvexHull() +{ + PxConvexMeshCookingResult::Enum res = PxConvexMeshCookingResult::eFAILURE; + + PxU32 vcount = mConvexMeshDesc.points.count; + if ( vcount < 8 ) + vcount = 8; + + // allocate additional vec3 for V4 safe load in VolumeInteration + PxVec3* vsource = reinterpret_cast<PxVec3*> (PX_ALLOC_TEMP( sizeof(PxVec3)*vcount + 1, "PxVec3")); + PxVec3 scale; + PxVec3 center; + PxU32 ovcount; + + // cleanup the vertices first + if(!cleanupVertices(mConvexMeshDesc.points.count, reinterpret_cast<const PxVec3*> (mConvexMeshDesc.points.data), mConvexMeshDesc.points.stride, + ovcount, vsource, scale, center )) + return res; + + // scale vertices back to their original size. + for (PxU32 i=0; i<ovcount; i++) + { + PxVec3& v = vsource[i]; + v.multiply(scale); + } + + // compute the actual hull + ConvexHullLibResult::ErrorCode hullResult = computeHull(ovcount,vsource); + if(hullResult == ConvexHullLibResult::eSUCCESS) + { + mFinished = true; + res = PxConvexMeshCookingResult::eSUCCESS; + } + else + { + if(hullResult == ConvexHullLibResult::eZERO_AREA_TEST_FAILED) + res = PxConvexMeshCookingResult::eZERO_AREA_TEST_FAILED; + } + + if(vsource) + { + PX_FREE(vsource); + } + + return res; +} + +////////////////////////////////////////////////////////////////////////// +// computes the hull and stores results into mHullResult +ConvexHullLibResult::ErrorCode InflationConvexHullLib::computeHull(PxU32 vertsCount, const PxVec3* verts) +{ + PX_ASSERT(verts); + PX_ASSERT(vertsCount > 0); + + ConvexHull* hullOut = NULL; + ConvexHullLibResult::ErrorCode res = calchull(verts, vertsCount, hullOut); + if ((res == ConvexHullLibResult::eFAILURE) || (res == ConvexHullLibResult::eZERO_AREA_TEST_FAILED)) + return res; + + PX_ASSERT(hullOut); + + // parse the hullOut and fill the result with vertices and polygons + mHullResult.mIndices = reinterpret_cast<PxU32*> (PX_ALLOC_TEMP(sizeof(PxU32)*(hullOut->getEdges().size()), "PxU32")); + mHullResult.mIndexCount=hullOut->getEdges().size(); + + mHullResult.mPolygonCount = hullOut->getFacets().size(); + mHullResult.mPolygons = reinterpret_cast<PxHullPolygon*> (PX_ALLOC_TEMP(sizeof(PxHullPolygon)*mHullResult.mPolygonCount, "PxHullPolygon")); + + // allocate additional vec3 for V4 safe load in VolumeInteration + mHullResult.mVertices = reinterpret_cast<PxVec3*> (PX_ALLOC_TEMP(sizeof(PxVec3)*hullOut->getVertices().size() + 1, "PxVec3")); + mHullResult.mVcount = hullOut->getVertices().size(); + PxMemCopy(mHullResult.mVertices,hullOut->getVertices().begin(),sizeof(PxVec3)*mHullResult.mVcount); + + PxU32 i=0; + PxU32 k=0; + PxU32 j = 1; + while(i<hullOut->getEdges().size()) + { + j=1; + PxHullPolygon& polygon = mHullResult.mPolygons[k]; + // get num indices per polygon + while(j+i < hullOut->getEdges().size() && hullOut->getEdges()[i].p == hullOut->getEdges()[i+j].p) + { + j++; + } + polygon.mNbVerts = Ps::to16(j); + polygon.mIndexBase = Ps::to16(i); + + // get the plane + polygon.mPlane[0] = hullOut->getFacets()[k].n[0]; + polygon.mPlane[1] = hullOut->getFacets()[k].n[1]; + polygon.mPlane[2] = hullOut->getFacets()[k].n[2]; + + polygon.mPlane[3] = hullOut->getFacets()[k].d; + + while(j--) + { + mHullResult.mIndices[i] = hullOut->getEdges()[i].v; + i++; + } + k++; + } + + PX_ASSERT(k==hullOut->getFacets().size()); + PX_DELETE(hullOut); + + return res; +} + +////////////////////////////////////////////////////////////////////////// +// internal function taking the cleaned vertices and constructing the +// new hull from them. +// 1. using the incremental algorithm create base hull from the input vertices +// 2. if we reached the vertex limit, we expand the hull +// 3. otherwise we compute the new planes and inflate them +// 4. we crop the AABB with the computed planes to construct the new hull +ConvexHullLibResult::ErrorCode InflationConvexHullLib::calchull(const PxVec3* verts, PxU32 verts_count, ConvexHull*& hullOut) +{ + // calculate the actual hull using the incremental algorithm + local::HullTriangles triangles; + ConvexHullLibResult::ErrorCode rc = calchullgen(verts,verts_count, triangles); + if ((rc == ConvexHullLibResult::eFAILURE) || (rc == ConvexHullLibResult::eZERO_AREA_TEST_FAILED)) + return rc; + + // if vertex limit reached construct the hullOut from the expanded planes + if(rc == ConvexHullLibResult::eVERTEX_LIMIT_REACHED) + { + if(mConvexMeshDesc.flags & PxConvexFlag::ePLANE_SHIFTING) + rc = expandHull(verts,verts_count,triangles,hullOut); + else + rc = expandHullOBB(verts,verts_count,triangles,hullOut); + if ((rc == ConvexHullLibResult::eFAILURE) || (rc == ConvexHullLibResult::eZERO_AREA_TEST_FAILED)) + return rc; + + return ConvexHullLibResult::eSUCCESS; + } + + Ps::Array<PxPlane> planes; + if(!calchullplanes(verts,triangles,planes)) + return ConvexHullLibResult::eFAILURE; + + if(!overhull(verts, verts_count, planes,hullOut)) + return ConvexHullLibResult::eFAILURE; + + return ConvexHullLibResult::eSUCCESS; +} + +////////////////////////////////////////////////////////////////////////// +// computes the actual hull using the incremental algorithm +// in - vertices, numVertices +// out - triangles +// 1. construct the initial simplex +// 2. each step take the most furthers vertex from the hull and add it +// 3. terminate if we reached the hull limit or all verts are used +ConvexHullLibResult::ErrorCode InflationConvexHullLib::calchullgen(const PxVec3* verts, PxU32 verts_count, local::HullTriangles& triangles) +{ + // at least 4 verts so we can construct a simplex + // limit is 256 for OBB slicing or fixed limit for plane shifting + PxU32 vlimit = (mConvexMeshDesc.flags & PxConvexFlag::ePLANE_SHIFTING) ? mConvexMeshDesc.vertexLimit : 256u; + PxU32 numHullVerts = 4; + if(verts_count < 4) + return ConvexHullLibResult::eFAILURE; + + PxU32 j; + PxBounds3 bounds; + bounds.setEmpty(); + + Ps::Array<PxU8> isextreme; + isextreme.reserve(verts_count); + + Ps::Array<PxU8> allow; + allow.reserve(verts_count); + + for(j=0; j < verts_count; j++) + { + allow.pushBack(1); + isextreme.pushBack(0); + bounds.include(verts[j]); + } + + const PxVec3 dimensions = bounds.getDimensions(); + const float epsilon = dimensions.magnitude() * local::DIMENSION_EPSILON_MULTIPLY; + mTolerance = 0.001f; + mPlaneTolerance = epsilon; + + const bool useAreaTest = mConvexMeshDesc.flags & PxConvexFlag::eCHECK_ZERO_AREA_TRIANGLES ? true : false; + const float areaEpsilon = useAreaTest ? mCookingParams.areaTestEpsilon * 2.0f : epsilon*epsilon*0.1f; + + // find the simplex + local::HullSimplex p = local::findSimplex(verts,verts_count,allow, dimensions); + if(p.x==-1) // simplex failed + return ConvexHullLibResult::eFAILURE; + + // a valid interior point + PxVec3 center = (verts[p[0]]+verts[p[1]]+verts[p[2]]+verts[p[3]]) /4.0f; + + // add the simplex triangles into the triangle array + local::Tri *t0 = triangles.createTri(p[2], p[3], p[1]); t0->n=local::int3(2,3,1); + local::Tri *t1 = triangles.createTri(p[3], p[2], p[0]); t1->n=local::int3(3,2,0); + local::Tri *t2 = triangles.createTri(p[0], p[1], p[3]); t2->n=local::int3(0,1,3); + local::Tri *t3 = triangles.createTri(p[1], p[0], p[2]); t3->n=local::int3(1,0,2); + // mark the simplex indices as extremes + isextreme[PxU32(p[0])]=isextreme[PxU32(p[1])]=isextreme[PxU32(p[2])]=isextreme[PxU32(p[3])]=1; + + // check if the added simplex triangles are valid + triangles.checkit(t0); + triangles.checkit(t1); + triangles.checkit(t2); + triangles.checkit(t3); + + // parse the initial triangles and set max vertex along the normal and its distance + for(j=0;j< triangles.size(); j++) + { + local::Tri *t=(triangles.getTriangles())[j]; + PX_ASSERT(t); + PX_ASSERT(t->vmax<0); + PxVec3 n= (*t).getNormal(verts); + t->vmax = local::maxIndexInDirSterid(verts,verts_count,n,allow); + t->rise = n.dot(verts[t->vmax]-verts[(*t)[0]]); + + // use the areaTest to drop small triangles, which can cause trouble to the simulation, + // if we drop triangles from the initial simplex, we let the user know that the provided points form + // a simplex which is too small for given area threshold + if(useAreaTest && ((verts[(*t)[1]]-verts[(*t)[0]]).cross(verts[(*t)[2]]-verts[(*t)[1]])).magnitude() < areaEpsilon) + { + triangles.deleteTri(t0); + triangles.deleteTri(t1); + triangles.deleteTri(t2); + triangles.deleteTri(t3); + return ConvexHullLibResult::eZERO_AREA_TEST_FAILED; + } + } + + local::Tri *te; + // lower the vertex limit, we did already set 4 verts + vlimit-=4; + // iterate over triangles till we reach the limit or we dont have triangles with + // significant rise or we cannot add any triangles at all + while(vlimit >0 && ((te = triangles.findExtrudable(epsilon)) != NULL)) + { + PxI32 v = te->vmax; + PX_ASSERT(!isextreme[PxU32(v)]); // wtf we've already done this vertex + // set as extreme point + isextreme[PxU32(v)]=1; + + j=triangles.size(); + // go through the triangles and extrude the extreme point if it is above it + while(j--) + { + if(!(triangles)[j]) + continue; + const local::Tri& t= *(triangles)[j]; + if(above(verts,t,verts[v],0.01f*epsilon)) + { + triangles.extrude((triangles)[j],v); + } + } + + // now check for those degenerate cases where we have a flipped triangle or a really skinny triangle + j=triangles.size(); + while(j--) + { + if(!(triangles)[j]) + continue; + if(!hasVert(*(triangles)[j],v)) + break; + local::int3 nt=*(triangles)[j]; + if(above(verts,*(triangles)[j],center,0.01f*epsilon) || ((verts[nt[1]]-verts[nt[0]]).cross(verts[nt[2]]-verts[nt[1]])).magnitude() < areaEpsilon) + { + local::Tri *nb = (triangles)[PxU32((triangles)[j]->n[0])]; + PX_ASSERT(nb); + PX_ASSERT(!hasVert(*nb,v)); + PX_ASSERT(PxU32(nb->id)<j); + triangles.extrude(nb,v); + j=triangles.size(); + } + } + + // get new rise and vmax for the new triangles + j=triangles.size(); + while(j--) + { + local::Tri *t=(triangles)[j]; + if(!t) + continue; + if(t->vmax >= 0) + break; + PxVec3 n= t->getNormal(verts); + t->vmax = local::maxIndexInDirSterid(verts,verts_count,n,allow); + if(isextreme[PxU32(t->vmax)]) + { + t->vmax=-1; // already done that vertex - algorithm needs to be able to terminate. + } + else + { + t->rise = n.dot(verts[t->vmax]-verts[(*t)[0]]); + } + } + // we added a vertex we lower the limit + vlimit --; + numHullVerts++; + } + + if((mConvexMeshDesc.flags & PxConvexFlag::ePLANE_SHIFTING) && vlimit == 0) + return ConvexHullLibResult::eVERTEX_LIMIT_REACHED; + if (!(mConvexMeshDesc.flags & PxConvexFlag::ePLANE_SHIFTING) && numHullVerts > mConvexMeshDesc.vertexLimit) + return ConvexHullLibResult::eVERTEX_LIMIT_REACHED; + + return ConvexHullLibResult::eSUCCESS; +} + +////////////////////////////////////////////////////////////////////////// +// expand the hull with the from the limited triangles set +// expand hull will do following steps: +// 1. get planes from triangles that form the best hull with given vertices +// 2. compute the adjacency information for the planes +// 3. expand the planes to have all vertices inside the planes volume +// 4. compute new points by 3 adjacency planes intersections +// 5. take those points and create the hull from them +ConvexHullLibResult::ErrorCode InflationConvexHullLib::expandHull(const PxVec3* verts, PxU32 vertsCount, const local::HullTriangles& triangles, ConvexHull*& hullOut) +{ +#if PX_DEBUG + struct LocalTests + { + static bool PlaneCheck(const PxVec3* verts_, PxU32 verts_count_, Ps::Array<local::ExpandPlane>& planes) + { + for(PxU32 i=0;i<planes.size();i++) + { + const local::ExpandPlane& expandPlane = planes[i]; + if(expandPlane.mTrisIndex != -1) + { + for(PxU32 j=0;j<verts_count_;j++) + { + const PxVec3& vertex = verts_[j]; + + PX_ASSERT(expandPlane.mPlane.distance(vertex) < 0.02f); + + if(expandPlane.mPlane.distance(vertex) > 0.02f) + { + return false; + } + } + } + } + return true; + } + }; +#endif + + + Ps::Array<local::ExpandPlane> planes; + + // need planes and the adjacency for the triangle + int numPoints = 0; + for(PxU32 i=0; i < triangles.size();i++) + { + local::ExpandPlane expandPlane; + if((triangles)[i]) + { + const local::Tri *t=(triangles)[i]; + PxPlane p; + p.n = t->getNormal(verts); + p.d = -p.n.dot(verts[(*t)[0]]); + expandPlane.mPlane = p; + + for (int l = 0; l < 3; l++) + { + if(t->n[l] > numPoints) + { + numPoints = t->n[l]; + } + } + + for(PxU32 j=0;j<triangles.size();j++) + { + if((triangles)[j] && i != j) + { + const local::Tri *testTris=(triangles)[j]; + + int numId0 = 0; + int numId1 = 0; + int numId2 = 0; + + for (int k = 0; k < 3; k++) + { + int testI = (*testTris)[k]; + if(testI == (*t)[0] || testI == (*t)[1]) + { + numId0++; + } + if(testI == (*t)[0] || testI == (*t)[2]) + { + numId1++; + } + if(testI == (*t)[2] || testI == (*t)[1]) + { + numId2++; + } + } + + if(numId0 == 2) + { + PX_ASSERT(expandPlane.mAdjacency[0] == -1); + expandPlane.mAdjacency[0] = int(j); + } + if(numId1 == 2) + { + PX_ASSERT(expandPlane.mAdjacency[1] == -1); + expandPlane.mAdjacency[1] = int(j); + } + if(numId2 == 2) + { + PX_ASSERT(expandPlane.mAdjacency[2] == -1); + expandPlane.mAdjacency[2] = int(j); + } + } + } + + expandPlane.mTrisIndex = int(i); + } + planes.pushBack(expandPlane); + } + numPoints++; + + // go over the planes now and expand them + for(PxU32 i=0;i< vertsCount;i++) + { + const PxVec3& vertex = verts[i]; + + for(PxU32 j=0;j< triangles.size();j++) + { + local::ExpandPlane& expandPlane = planes[j]; + if(expandPlane.mTrisIndex != -1) + { + float dist = expandPlane.mPlane.distance(vertex); + if(dist > 0 && dist > expandPlane.mExpandDistance) + { + expandPlane.mExpandDistance = dist; + expandPlane.mExpandPoint = int(i); + } + } + } + } + + // expand the planes + for(PxU32 i=0;i<planes.size();i++) + { + local::ExpandPlane& expandPlane = planes[i]; + if(expandPlane.mTrisIndex != -1) + { + if(expandPlane.mExpandPoint >= 0) + expandPlane.mPlane.d -= expandPlane.mExpandDistance; + } + } + + PX_ASSERT(LocalTests::PlaneCheck(verts,vertsCount,planes)); + + Ps::Array <int> translateTable; + Ps::Array <PxVec3> points; + numPoints = 0; + + // find new triangle points and store them + for(PxU32 i=0;i<planes.size();i++) + { + local::ExpandPlane& expandPlane = planes[i]; + if(expandPlane.mTrisIndex != -1) + { + const local::Tri *expandTri=(triangles)[PxU32(expandPlane.mTrisIndex)]; + + for (int j = 0; j < 3; j++) + { + local::ExpandPlane& plane1 = planes[PxU32(expandPlane.mAdjacency[j])]; + local::ExpandPlane& plane2 = planes[PxU32(expandPlane.mAdjacency[(j + 1)%3])]; + const local::Tri *tri1=(triangles)[PxU32(expandPlane.mAdjacency[j])]; + const local::Tri *tri2=(triangles)[PxU32(expandPlane.mAdjacency[(j + 1)%3])]; + + int indexE = -1; + int index1 = -1; + int index2 = -1; + for (int l = 0; l < 3; l++) + { + for (int k = 0; k < 3; k++) + { + for (int m = 0; m < 3; m++) + { + if((*expandTri)[l] == (*tri1)[k] && (*expandTri)[l] == (*tri2)[m]) + { + indexE = l; + index1 = k; + index2 = m; + } + } + } + } + + PX_ASSERT(indexE != -1); + + int foundIndex = -1; + for (PxU32 u = 0; u < translateTable.size(); u++) + { + if(translateTable[u] == ((*expandTri)[indexE])) + { + foundIndex = int(u); + break; + } + } + + PxVec3 point = threePlaneIntersection(expandPlane.mPlane, plane1.mPlane, plane2.mPlane); + + if(foundIndex == -1) + { + expandPlane.mIndices[indexE] = numPoints; + plane1.mIndices[index1] = numPoints; + plane2.mIndices[index2] = numPoints; + + points.pushBack(point); + translateTable.pushBack((*expandTri)[indexE]); + numPoints++; + } + else + { + if(expandPlane.mPlane.distance(points[PxU32(foundIndex)]) < -0.02f || plane1.mPlane.distance(points[PxU32(foundIndex)]) < -0.02f || plane2.mPlane.distance(points[PxU32(foundIndex)]) < -0.02f) + { + points[PxU32(foundIndex)] = point; + } + + expandPlane.mIndices[indexE] = foundIndex; + plane1.mIndices[index1] = foundIndex; + plane2.mIndices[index2] = foundIndex; + } + + } + } + } + + // construct again the hull from the new points + local::HullTriangles outTriangles; + ConvexHullLibResult::ErrorCode rc = calchullgen(points.begin(),PxU32(numPoints), outTriangles); + if ((rc == ConvexHullLibResult::eFAILURE) || (rc == ConvexHullLibResult::eZERO_AREA_TEST_FAILED)) + return rc; + + // cleanup the unused vertices + Ps::Array<PxVec3> usedVertices; + translateTable.clear(); + translateTable.resize(points.size()); + for (PxU32 i = 0; i < points.size(); i++) + { + for (PxU32 j = 0; j < outTriangles.size(); j++) + { + const local::Tri* tri = outTriangles[j]; + if(tri) + { + if((*tri)[0] == int(i) || (*tri)[1] == int(i) || (*tri)[2] == int(i)) + { + translateTable[i] = int(usedVertices.size()); + usedVertices.pushBack(points[i]); + break; + } + } + } + } + + // now construct the hullOut + Ps::Array<PxPlane> inputPlanes; // < just a blank input planes + ConvexHull* c = PX_NEW_TEMP(ConvexHull)(inputPlanes); + + // copy the vertices + for (PxU32 i = 0; i < usedVertices.size(); i++) + { + c->getVertices().pushBack(usedVertices[i]); + } + + // copy planes and create edges + PxU32 numFaces = 0; + for (PxU32 i = 0; i < outTriangles.size(); i++) + { + const local::Tri* tri = outTriangles[i]; + if(tri) + { + PxPlane triPlane; + triPlane.n = tri->getNormal(points.begin()); + triPlane.d = -triPlane.n.dot(points[PxU32((*tri)[0])]); + c->getFacets().pushBack(triPlane); + + for (int j = 0; j < 3; j++) + { + ConvexHull::HalfEdge edge; + edge.p = Ps::to8(numFaces); + edge.v = Ps::to8(translateTable[PxU32((*tri)[j])]); + c->getEdges().pushBack(edge); + } + numFaces++; + } + } + hullOut = c; + return ConvexHullLibResult::eSUCCESS; +} + +////////////////////////////////////////////////////////////////////////// +// expand the hull from the limited triangles set +// 1. collect all planes +// 2. create OBB from the input verts +// 3. slice the OBB with the planes +// 5. iterate till vlimit is reached +ConvexHullLibResult::ErrorCode InflationConvexHullLib::expandHullOBB(const PxVec3* verts, PxU32 vertsCount, const local::HullTriangles& triangles, ConvexHull*& hullOut) +{ + Ps::Array<PxPlane> expandPlanes; + expandPlanes.reserve(triangles.size()); + + PxU32* indices = PX_NEW_TEMP(PxU32)[triangles.size()*3]; + PxHullPolygon* polygons = PX_NEW_TEMP(PxHullPolygon)[triangles.size()]; + + PxU16 currentIndex = 0; + PxU32 currentFace = 0; + + // collect expand planes + for (PxU32 i = 0; i < triangles.size(); i++) + { + local::ExpandPlane expandPlane; + if ((triangles)[i]) + { + const local::Tri *t = (triangles)[i]; + PxPlane p; + p.n = t->getNormal(verts); + p.d = -p.n.dot(verts[(*t)[0]]); + + // store the polygon + PxHullPolygon& polygon = polygons[currentFace++]; + polygon.mIndexBase = currentIndex; + polygon.mNbVerts = 3; + polygon.mPlane[0] = p.n[0]; + polygon.mPlane[1] = p.n[1]; + polygon.mPlane[2] = p.n[2]; + polygon.mPlane[3] = p.d; + + // store the index list + indices[currentIndex++] = PxU32((*t)[0]); + indices[currentIndex++] = PxU32((*t)[1]); + indices[currentIndex++] = PxU32((*t)[2]); + + expandPlanes.pushBack(p); + } + } + + PxTransform obbTransform; + PxVec3 sides; + + // compute the OBB + PxConvexMeshDesc convexDesc; + convexDesc.points.count = vertsCount; + convexDesc.points.data = verts; + convexDesc.points.stride = sizeof(PxVec3); + + convexDesc.indices.count = currentIndex; + convexDesc.indices.stride = sizeof(PxU32); + convexDesc.indices.data = indices; + + convexDesc.polygons.count = currentFace; + convexDesc.polygons.data = polygons; + convexDesc.polygons.stride = sizeof(PxHullPolygon); + + convexDesc.flags = mConvexMeshDesc.flags; + + computeOBBFromConvex(convexDesc, sides, obbTransform); + + // free the memory used for the convex mesh desc + PX_FREE_AND_RESET(indices); + PX_FREE_AND_RESET(polygons); + + // crop the OBB + PxU32 maxplanes = PxMin(PxU32(256), expandPlanes.size()); + + ConvexHull* c = PX_NEW_TEMP(ConvexHull)(sides*0.5f, obbTransform, expandPlanes); + + const float planeTolerance = mPlaneTolerance; + const float epsilon = mTolerance; + + PxI32 k; + while (maxplanes-- && (k = c->findCandidatePlane(planeTolerance, epsilon)) >= 0) + { + ConvexHull* tmp = c; + c = convexHullCrop(*tmp, expandPlanes[PxU32(k)], planeTolerance); + if (c == NULL) + { + c = tmp; + break; + } // might want to debug this case better!!! + if (!c->assertIntact(planeTolerance)) + { + PX_DELETE(c); + c = tmp; + break; + } // might want to debug this case better too!!! + + // check for vertex limit + if (c->getVertices().size() > mConvexMeshDesc.vertexLimit) + { + PX_DELETE(c); + c = tmp; + maxplanes = 0; + break; + } + PX_DELETE(tmp); + } + + PX_ASSERT(c->assertIntact(planeTolerance)); + + hullOut = c; + + return ConvexHullLibResult::eSUCCESS; +} + +////////////////////////////////////////////////////////////////////////// +// calculate the planes from given triangles +// 1. merge triangles with similar normal +// 2. inflate the planes +// 3. store the new triangles +bool InflationConvexHullLib::calchullplanes(const PxVec3* verts, local::HullTriangles& triangles, Ps::Array<PxPlane>& planes) +{ + PxU32 i,j; + float maxdot_minang = cosf(Ps::degToRad(local::MIN_ADJACENT_ANGLE)); + + // parse the triangles and check the angle between them, if the angle is below MIN_ADJACENT_ANGLE + // merge the triangles into single plane + for(i=0;i<triangles.size();i++) + { + if(triangles[i]) + { + for(j=i+1;j<triangles.size();j++) + { + if(triangles[i] && triangles[j]) + { + local::Tri *ti = triangles[i]; + local::Tri *tj = triangles[j]; + PxVec3 ni = ti->getNormal(verts); + PxVec3 nj = tj->getNormal(verts); + if(ni.dot(nj) > maxdot_minang) + { + // somebody has to die, keep the biggest triangle + if( ti->getArea2(verts) < tj->getArea2(verts)) + { + triangles.deleteTri(triangles[i]); + } + else + { + triangles.deleteTri(triangles[j]); + } + } + } + } + } + } + + // now add for each triangle that left a plane + for(i=0;i<triangles.size();i++) + { + if(triangles[i]) + { + + local::Tri *t = triangles[i]; + PxVec3 n = t->getNormal(verts); + float d = -n.dot(verts[(*t)[0]]) - mCookingParams.skinWidth; + PxPlane p(n,d); + planes.pushBack(p); + } + } + + // delete the triangles we don't need them anymore + for(i=0;i< triangles.size(); i++) + { + if(triangles[i]) + { + triangles.deleteTri(triangles[i]); + } + } + triangles.getTriangles().clear(); + return true; +} + +////////////////////////////////////////////////////////////////////////// +// create new points from the given planes, which form the new hull +// 1. form an AABB from the input verts +// 2. slice the AABB with the planes +// 3. if sliced hull is still valid use it, otherwise step back, try different plane +// 4. exit if limit reached or all planes added +bool InflationConvexHullLib::overhull(const PxVec3* verts, PxU32 vertsCount,const Ps::Array<PxPlane>& planes, ConvexHull*& hullOut) +{ + PxU32 i,j; + if(vertsCount < 4) + return false; + + const PxU32 planesLimit = 256; + PxU32 maxplanes = PxMin(planesLimit,planes.size()); + + // get the bounds + PxBounds3 bounds; + bounds.setEmpty(); + for(i=0;i<vertsCount;i++) + { + bounds.include(verts[i]); + } + float diameter = bounds.getDimensions().magnitude(); + PxVec3 emin = bounds.minimum; + PxVec3 emax = bounds.maximum; + float epsilon = 0.01f; // size of object is taken into account within candidate plane function. Used to multiply here by magnitude(emax-emin) + float planetestepsilon = (emax-emin).magnitude() * local::PAPERWIDTH; + // todo: add bounding cube planes to force bevel. or try instead not adding the diameter expansion ??? must think. + // ConvexH *convex = ConvexHMakeCube(bmin - float3(diameter,diameter,diameter),bmax+float3(diameter,diameter,diameter)); + + // now expand the axis aligned planes by half diameter, !AB what is the point here? + float maxdot_minang = cosf(Ps::degToRad(local::MIN_ADJACENT_ANGLE)); + for(j=0;j<6;j++) + { + PxVec3 n(0,0,0); + n[j/2] = (j%2) ? 1.0f : -1.0f; + for(i=0; i < planes.size(); i++) + { + if(n.dot(planes[i].n) > maxdot_minang) + { + (*((j%2)?&emax:&emin)) += n * (diameter*0.5f); + break; + } + } + } + + ConvexHull* c = PX_NEW_TEMP(ConvexHull)(emin,emax, planes); + PxI32 k; + // find the candidate plane and crop the hull + while(maxplanes-- && (k= c->findCandidatePlane(planetestepsilon, epsilon))>=0) + { + ConvexHull* tmp = c; + c = convexHullCrop(*tmp,planes[PxU32(k)], planetestepsilon); + if(c==NULL) + { + c=tmp; + break; + } // might want to debug this case better!!! + if(!c->assertIntact(planetestepsilon)) + { + PX_DELETE(c); + c=tmp; + break; + } // might want to debug this case better too!!! + + // check for vertex limit + if(c->getVertices().size() > mConvexMeshDesc.vertexLimit) + { + PX_DELETE(c); + c=tmp; + maxplanes = 0; + break; + } + // check for vertex limit per face if necessary, GRB supports max 32 verts per face + if ((mConvexMeshDesc.flags & PxConvexFlag::eGPU_COMPATIBLE) && c->maxNumVertsPerFace() > gpuMaxVertsPerFace) + { + PX_DELETE(c); + c = tmp; + maxplanes = 0; + break; + } + PX_DELETE(tmp); + } + + PX_ASSERT(c->assertIntact(planetestepsilon)); + hullOut = c; + + return true; +} + + +////////////////////////////////////////////////////////////////////////// +// fill the data +void InflationConvexHullLib::fillConvexMeshDesc(PxConvexMeshDesc& outDesc) +{ + PX_ASSERT(mFinished); + + outDesc.indices.count = mHullResult.mIndexCount; + outDesc.indices.stride = sizeof(PxU32); + outDesc.indices.data = mHullResult.mIndices; + + outDesc.points.count = mHullResult.mVcount; + outDesc.points.stride = sizeof(PxVec3); + outDesc.points.data = mHullResult.mVertices; + + outDesc.polygons.count = mHullResult.mPolygonCount; + outDesc.polygons.stride = sizeof(PxHullPolygon); + outDesc.polygons.data = mHullResult.mPolygons; + + swapLargestFace(outDesc); +} + +////////////////////////////////////////////////////////////////////////// + +InflationConvexHullLib::~InflationConvexHullLib() +{ + if(mHullResult.mIndices) + { + PX_FREE(mHullResult.mIndices); + } + + if(mHullResult.mPolygons) + { + PX_FREE(mHullResult.mPolygons); + } + + if(mHullResult.mVertices) + { + PX_FREE(mHullResult.mVertices); + } +} + +////////////////////////////////////////////////////////////////////////// diff --git a/PhysX_3.4/Source/PhysXCooking/src/convex/InflationConvexHullLib.h b/PhysX_3.4/Source/PhysXCooking/src/convex/InflationConvexHullLib.h new file mode 100644 index 00000000..8369691f --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/convex/InflationConvexHullLib.h @@ -0,0 +1,133 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + +#ifndef PX_INFLATION_CONVEXHULLLIB_H +#define PX_INFLATION_CONVEXHULLLIB_H + +#include "ConvexHullLib.h" +#include "Ps.h" +#include "PsArray.h" +#include "PsUserAllocated.h" + +namespace local +{ + class HullTriangles; +} + +namespace physx +{ + class ConvexHull; + + ////////////////////////////////////////////////////////////////////////// + // internal hull lib results + struct ConvexHullLibResult + { + // return code + enum ErrorCode + { + eSUCCESS = 0, // success! + eFAILURE, // failed. + eVERTEX_LIMIT_REACHED, // vertex limit reached fallback. + eZERO_AREA_TEST_FAILED// area test failed - failed to create simplex + }; + + PxU32 mVcount; + PxU32 mIndexCount; + PxU32 mPolygonCount; + PxVec3* mVertices; + PxU32* mIndices; + PxHullPolygon* mPolygons; + + + ConvexHullLibResult() + : mVcount(0), mIndexCount(0), mPolygonCount(0), + mVertices(NULL), mIndices(NULL), mPolygons(NULL) + { + } + }; + + ////////////////////////////////////////////////////////////////////////// + // inflation based hull library. Using the legacy Stan hull lib with inflation + // We construct the hull using incremental method and then inflate the resulting planes + // by specified skinWidth. We take the planes and crop AABB with them to construct + // the final hull. This method may reduce the number of polygons significantly + // in case of lot of vertices are used. On the other hand, we produce new vertices + // and enlarge the original hull constructed from the given input points. + // Generally speaking, the increase of vertices is usually too big, so it is not worthy + // to use this algorithm to reduce the number of polygons. This method is also very unprecise + // and may produce invalid hulls. It is recommended to use the new quickhull library. + class InflationConvexHullLib: public ConvexHullLib, public Ps::UserAllocated + { + PX_NOCOPY(InflationConvexHullLib) + public: + + // functions + InflationConvexHullLib(const PxConvexMeshDesc& desc, const PxCookingParams& params); + + ~InflationConvexHullLib(); + + // computes the convex hull from provided points + virtual PxConvexMeshCookingResult::Enum createConvexHull(); + + // fills the convexmeshdesc with computed hull data + virtual void fillConvexMeshDesc(PxConvexMeshDesc& desc); + + protected: + // internal + + // compute the hull + ConvexHullLibResult::ErrorCode computeHull(PxU32 vertsCount, const PxVec3* verts); + + // computes the hull + ConvexHullLibResult::ErrorCode calchull(const PxVec3* verts, PxU32 verts_count, ConvexHull*& hullOut); + + // computes the actual hull using the incremental algorithm + ConvexHullLibResult::ErrorCode calchullgen(const PxVec3* verts, PxU32 verts_count, local::HullTriangles& triangles); + + // calculates the hull planes from the triangles + bool calchullplanes(const PxVec3* verts, local::HullTriangles& triangles, Ps::Array<PxPlane>& planes); + + // construct the hull from given planes - create new verts + bool overhull(const PxVec3* verts, PxU32 vertsCount,const Ps::Array<PxPlane>& planes, ConvexHull*& hullOut); + + // expand the hull with the limited triangles set + ConvexHullLibResult::ErrorCode expandHull(const PxVec3* verts, PxU32 vertsCount, const local::HullTriangles& triangles, ConvexHull*& hullOut); + + // expand the hull with the limited triangles set + ConvexHullLibResult::ErrorCode expandHullOBB(const PxVec3* verts, PxU32 vertsCount, const local::HullTriangles& triangles, ConvexHull*& hullOut); + + private: + bool mFinished; + ConvexHullLibResult mHullResult; + float mTolerance; + float mPlaneTolerance; + }; +} + +#endif diff --git a/PhysX_3.4/Source/PhysXCooking/src/convex/QuickHullConvexHullLib.cpp b/PhysX_3.4/Source/PhysXCooking/src/convex/QuickHullConvexHullLib.cpp new file mode 100644 index 00000000..13b88364 --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/convex/QuickHullConvexHullLib.cpp @@ -0,0 +1,2383 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + +#include "QuickHullConvexHullLib.h" +#include "ConvexHullUtils.h" + +#include "PsAllocator.h" +#include "PsUserAllocated.h" +#include "PsSort.h" +#include "PsMathUtils.h" +#include "PsFoundation.h" +#include "PsUtilities.h" +#include "PsBitUtils.h" + +#include "foundation/PxMath.h" +#include "foundation/PxPlane.h" +#include "foundation/PxBounds3.h" +#include "foundation/PxMemory.h" + +using namespace physx; + +namespace local +{ + ////////////////////////////////////////////////////////////////////////// + static const float MIN_ADJACENT_ANGLE = 3.0f; // in degrees - result wont have two adjacent facets within this angle of each other. + static const float PLANE_THICKNES = 3.0f * PX_EPS_F32; // points within this distance are considered on a plane + static const float ACCEPTANCE_EPSILON_MULTIPLY = 2000.0f; // used to scale up plane tolerance to accept new points into convex, plane thickness tolerance is too high for point acceptance + static const float PLANE_TOLERANCE = 0.001f; // points within this distance are considered on a plane for post adjacent merging and eye vertex acceptance + static const float MAXDOT_MINANG = cosf(Ps::degToRad(MIN_ADJACENT_ANGLE)); // adjacent angle for dot product tests + + ////////////////////////////////////////////////////////////////////////// + + struct QuickHullFace; + class ConvexHull; + class HullPlanes; + + ////////////////////////////////////////////////////////////////////////// + template<typename T, bool useIndexing> + class MemBlock + { + public: + MemBlock(PxU32 preallocateSize) + : mPreallocateSize(preallocateSize), mCurrentBlock(0), mCurrentIndex(0) + { + PX_ASSERT(preallocateSize); + T* block = reinterpret_cast<T*>(PX_ALLOC_TEMP(sizeof(T)*preallocateSize, "Quickhull MemBlock")); + mBlocks.pushBack(block); + } + + MemBlock() + : mPreallocateSize(0), mCurrentBlock(0), mCurrentIndex(0) + { + } + + void init(PxU32 preallocateSize) + { + PX_ASSERT(preallocateSize); + PX_ASSERT(mPreallocateSize == 0); + mPreallocateSize = preallocateSize; + T* block = reinterpret_cast<T*>(PX_ALLOC_TEMP(sizeof(T)*preallocateSize, "Quickhull MemBlock")); + if(useIndexing) + { + for (PxU32 i = 0; i < mPreallocateSize; i++) + { + // placement new to index data + PX_PLACEMENT_NEW(&block[i], T)(i); + } + } + mBlocks.pushBack(block); + } + + ~MemBlock() + { + for (PxU32 i = 0; i < mBlocks.size(); i++) + { + PX_FREE(mBlocks[i]); + } + mBlocks.clear(); + } + + T* getItem(PxU32 index) + { + const PxU32 block = index/mPreallocateSize; + const PxU32 itemIndex = index % mPreallocateSize; + PX_ASSERT(block <= mCurrentBlock); + PX_ASSERT(itemIndex < mPreallocateSize); + return &(mBlocks[block])[itemIndex]; + } + + T* getFreeItem() + { + PX_ASSERT(mPreallocateSize); + // check if we have enough space in block, otherwise allocate new block + if(mCurrentIndex < mPreallocateSize) + { + return &(mBlocks[mCurrentBlock])[mCurrentIndex++]; + } + else + { + T* block = reinterpret_cast<T*>(PX_ALLOC_TEMP(sizeof(T)*mPreallocateSize, "Quickhull MemBlock")); + mCurrentBlock++; + if (useIndexing) + { + for (PxU32 i = 0; i < mPreallocateSize; i++) + { + // placement new to index data + PX_PLACEMENT_NEW(&block[i], T)(mCurrentBlock*mPreallocateSize + i); + } + } + mBlocks.pushBack(block); + mCurrentIndex = 0; + return &(mBlocks[mCurrentBlock])[mCurrentIndex++]; + } + } + + private: + PxU32 mPreallocateSize; + PxU32 mCurrentBlock; + PxU32 mCurrentIndex; + Ps::Array<T*> mBlocks; + }; + + ////////////////////////////////////////////////////////////////////////// + // representation of quick hull vertex + struct QuickHullVertex + { + PxVec3 point; // point vector + PxU32 index; // point index for compare + float dist; // distance from plane if necessary + + QuickHullVertex* next; // link to next vertex, linked list used for conflict list + + PX_FORCE_INLINE bool operator==(const QuickHullVertex& vertex) const + { + return index == vertex.index ? true : false; + } + + PX_FORCE_INLINE bool operator <(const QuickHullVertex& vertex) const + { + return dist < vertex.dist ? true : false; + } + }; + + ////////////////////////////////////////////////////////////////////////// + // representation of quick hull half edge + struct QuickHullHalfEdge + { + QuickHullHalfEdge() : prev(NULL), next(NULL), twin(NULL), face(NULL) + { + } + + QuickHullHalfEdge(PxU32 ) + : prev(NULL), next(NULL), twin(NULL), face(NULL) + { + } + + QuickHullVertex tail; // tail vertex, head vertex is the tail of the twin + + QuickHullHalfEdge* prev; // previous edge + QuickHullHalfEdge* next; // next edge + QuickHullHalfEdge* twin; // twin/opposite edge + + QuickHullFace* face; // face where the edge belong + + PX_FORCE_INLINE const QuickHullVertex& getTail() const + { + return tail; + } + + PX_FORCE_INLINE const QuickHullVertex& getHead() const + { + PX_ASSERT(twin); + return twin->tail; + } + + PX_FORCE_INLINE void setTwin(QuickHullHalfEdge* edge) + { + twin = edge; + edge->twin = this; + } + + PX_FORCE_INLINE QuickHullFace* getOppositeFace() const + { + return twin->face; + } + + float getOppositeFaceDistance() const; + }; + + ////////////////////////////////////////////////////////////////////////// + + typedef Ps::Array<QuickHullVertex*> QuickHullVertexArray; + typedef Ps::Array<QuickHullHalfEdge*> QuickHullHalfEdgeArray; + typedef Ps::Array<QuickHullFace*> QuickHullFaceArray; + + ////////////////////////////////////////////////////////////////////////// + // representation of quick hull face + struct QuickHullFace + { + enum FaceState + { + eVISIBLE, + eDELETED, + eNON_CONVEX + }; + + QuickHullHalfEdge* edge; // starting edge + PxU16 numEdges; // num edges on the face + QuickHullVertex* conflictList; // conflict list, used to determine unclaimed vertices + + PxVec3 normal; // Newell plane normal + float area; // face area + PxVec3 centroid; // face centroid + + float planeOffset; // Newell plane offset + float expandOffset; // used for plane expansion if vertex limit reached + + FaceState state; // face validity state + + QuickHullFace* nextFace; // used to indicate next free face in faceList + PxU32 index; // face index for compare identification + + public: + QuickHullFace() + : edge(NULL), numEdges(0), conflictList(NULL), area(0.0f), planeOffset(0.0f), expandOffset(-FLT_MAX), + state(eVISIBLE), nextFace(NULL) + { + } + + QuickHullFace(PxU32 ind) + : edge(NULL), numEdges(0), conflictList(NULL), area(0.0f), planeOffset(0.0f), expandOffset(-FLT_MAX), + state(eVISIBLE), nextFace(NULL), index(ind) + { + } + + ~QuickHullFace() + { + } + + // get edge on index + PX_FORCE_INLINE QuickHullHalfEdge* getEdge(PxU32 i) const + { + QuickHullHalfEdge* he = edge; + while (i > 0) + { + he = he->next; + i--; + } + return he; + } + + // distance from a plane to provided point + PX_FORCE_INLINE float distanceToPlane(const PxVec3 p) const + { + return normal.dot(p) - planeOffset; + } + + // compute face normal and centroid + PX_FORCE_INLINE void computeNormalAndCentroid() + { + PX_ASSERT(edge); + normal = PxVec3(PxZero); + numEdges = 1; + + QuickHullHalfEdge* testEdge = edge; + QuickHullHalfEdge* startEdge = NULL; + float minDist = FLT_MAX; + for (PxU32 i = 0; i < 3; i++) + { + const float d = (testEdge->tail.point - testEdge->next->tail.point).magnitudeSquared(); + if (d < minDist) + { + minDist = d; + startEdge = testEdge; + } + testEdge = testEdge->next; + } + PX_ASSERT(startEdge); + + QuickHullHalfEdge* he = startEdge->next; + const PxVec3& p0 = startEdge->tail.point; + const PxVec3 d = he->tail.point - p0; + centroid = startEdge->tail.point; + + do + { + numEdges++; + centroid += he->tail.point; + + normal += d.cross(he->next->tail.point - p0); + + he = he->next; + } while (he != startEdge); + + area = normal.normalize(); + centroid *= (1.0f / float(numEdges)); + + planeOffset = normal.dot(centroid); + } + + // merge adjacent face + void mergeAdjacentFace(QuickHullHalfEdge* halfEdge, QuickHullFaceArray& discardedFaces); + + // check face consistency + bool checkFaceConsistency(); + + private: + // connect halfedges + QuickHullFace* connectHalfEdges(QuickHullHalfEdge* hedgePrev, QuickHullHalfEdge* hedge); + + // check if the face does have only 3 vertices + PX_FORCE_INLINE bool isTriangle() const + { + return numEdges == 3 ? true : false; + } + + }; + + ////////////////////////////////////////////////////////////////////////// + struct QuickHullResult + { + enum Enum + { + eSUCCESS, // ok + eZERO_AREA_TEST_FAILED, // area test failed for simplex + eVERTEX_LIMIT_REACHED, // vertex limit reached need to expand hull + ePOLYGONS_LIMIT_REACHED, // polygons hard limit reached + eFAILURE // general failure + }; + }; + + ////////////////////////////////////////////////////////////////////////// + // Quickhull base class holding the hull during construction + class QuickHull : public Ps::UserAllocated + { + PX_NOCOPY(QuickHull) + public: + + QuickHull(const PxCookingParams& params, const PxConvexMeshDesc& desc); + + ~QuickHull(); + + // preallocate the edges, faces, vertices + void preallocate(PxU32 numVertices); + + // parse the input verts, store them into internal format + void parseInputVertices(const PxVec3* verts, PxU32 numVerts); + + // release the hull and data + void releaseHull(); + + // sets the precomputed min/max data + void setPrecomputedMinMax(const QuickHullVertex* minVertex,const QuickHullVertex* maxVertex, const float tolerance,const float planeTolerance); + + // main entry function to build the hull from provided points + QuickHullResult::Enum buildHull(); + + PxU32 maxNumVertsPerFace() const; + + protected: + // compute min max verts + void computeMinMaxVerts(); + + // find the initial simplex + bool findSimplex(); + + // add the initial simplex + void addSimplex(QuickHullVertex* simplex, bool flipTriangle); + + // finds next point to add + QuickHullVertex* nextPointToAdd(QuickHullFace*& eyeFace); + + // adds point to the hull + bool addPointToHull(const QuickHullVertex* vertex, QuickHullFace& face); + + // creates new face from given triangles + QuickHullFace* createTriangle(const QuickHullVertex& v0, const QuickHullVertex& v1, const QuickHullVertex& v2); + + // adds point to the face conflict list + void addPointToFace(QuickHullFace& face, QuickHullVertex* vertex, float dist); + + // removes eye point from the face conflict list + void removeEyePointFromFace(QuickHullFace& face, const QuickHullVertex* vertex); + + // calculate the horizon fro the eyePoint against a given face + void calculateHorizon(const PxVec3& eyePoint, QuickHullHalfEdge* edge, QuickHullFace& face, QuickHullHalfEdgeArray& horizon, QuickHullFaceArray& removedFaces); + + // adds new faces from given horizon and eyePoint + void addNewFacesFromHorizon(const QuickHullVertex* eyePoint, const QuickHullHalfEdgeArray& horizon, QuickHullFaceArray& newFaces); + + // merge adjacent face + bool doAdjacentMerge(QuickHullFace& face, bool mergeWrtLargeFace); + + // merge adjacent face doing normal test + bool doPostAdjacentMerge(QuickHullFace& face, const float minAngle); + + // delete face points + void deleteFacePoints(QuickHullFace& faceToDelete, QuickHullFace* absorbingFace); + + // resolve unclaimed points + void resolveUnclaimedPoints(const QuickHullFaceArray& newFaces); + + // merges polygons with similar normals + void postMergeHull(); + + // check if 2 faces can be merged + bool canMergeFaces(const QuickHullHalfEdge& he, float planeTolerance); + + // get next free face + PX_FORCE_INLINE QuickHullFace* getFreeHullFace() + { + return mFreeFaces.getFreeItem(); + } + + // get next free half edge + PX_FORCE_INLINE QuickHullHalfEdge* getFreeHullHalfEdge() + { + return mFreeHalfEdges.getFreeItem(); + } + + protected: + friend class physx::QuickHullConvexHullLib; + + const PxCookingParams& mCookingParams; // cooking params + const PxConvexMeshDesc& mConvexDesc; // convex desc + + PxVec3 mInteriorPoint; // interior point for int/ext tests + + PxU32 mMaxVertices; // maximum number of vertices (can be different as we may add vertices during the cleanup + PxU32 mNumVertices; // actual number of vertices + + QuickHullVertex* mVerticesList; // vertices list preallocated + MemBlock<QuickHullHalfEdge, false> mFreeHalfEdges; // free half edges + MemBlock<QuickHullFace, true> mFreeFaces; // free faces + + QuickHullFaceArray mHullFaces; // actual hull faces, contains also invalid and not used faces + PxU32 mNumHullFaces; // actual number of hull faces + + bool mPrecomputedMinMax; // if we got the precomputed min/max values + QuickHullVertex mMinVertex[3]; // min vertex + QuickHullVertex mMaxVertex[3]; // max vertex + float mTolerance; // hull tolerance, used for plane thickness and merge strategy + float mPlaneTolerance; // used for post merge stage + + QuickHullVertexArray mUnclaimedPoints; // holds temp unclaimed points + + QuickHullHalfEdgeArray mHorizon; // array for horizon computation + QuickHullFaceArray mNewFaces; // new faces created during horizon computation + QuickHullFaceArray mRemovedFaces; // removd faces during horizon computation + QuickHullFaceArray mDiscardedFaces; // discarded faces during face merging + }; + + ////////////////////////////////////////////////////////////////////////// + // return the distance from opposite face + float QuickHullHalfEdge::getOppositeFaceDistance() const + { + PX_ASSERT(face); + PX_ASSERT(twin); + return face->distanceToPlane(twin->face->centroid); + } + + ////////////////////////////////////////////////////////////////////////// + // merge adjacent face from provided half edge. + // 1. set new half edges + // 2. connect the new half edges - check we did not produced redundant triangles, discard them + // 3. recompute the plane and check consistency + void QuickHullFace::mergeAdjacentFace(QuickHullHalfEdge* hedgeAdj, QuickHullFaceArray& discardedFaces) + { + QuickHullFace* oppFace = hedgeAdj->getOppositeFace(); + + discardedFaces.pushBack(oppFace); + oppFace->state = QuickHullFace::eDELETED; + + QuickHullHalfEdge* hedgeOpp = hedgeAdj->twin; + + QuickHullHalfEdge* hedgeAdjPrev = hedgeAdj->prev; + QuickHullHalfEdge* hedgeAdjNext = hedgeAdj->next; + QuickHullHalfEdge* hedgeOppPrev = hedgeOpp->prev; + QuickHullHalfEdge* hedgeOppNext = hedgeOpp->next; + + // check if we are lining up with the face in adjPrev dir + while (hedgeAdjPrev->getOppositeFace() == oppFace) + { + hedgeAdjPrev = hedgeAdjPrev->prev; + hedgeOppNext = hedgeOppNext->next; + } + + // check if we are lining up with the face in adjNext dir + while (hedgeAdjNext->getOppositeFace() == oppFace) + { + hedgeOppPrev = hedgeOppPrev->prev; + hedgeAdjNext = hedgeAdjNext->next; + } + + QuickHullHalfEdge* hedge; + + // set new face owner for the line up edges + for (hedge = hedgeOppNext; hedge != hedgeOppPrev->next; hedge = hedge->next) + { + hedge->face = this; + } + + // if we are about to delete the shared edge, check if its not the starting edge of the face + if (hedgeAdj == edge) + { + edge = hedgeAdjNext; + } + + // handle the half edges at the head + QuickHullFace* discardedFace; + discardedFace = connectHalfEdges(hedgeOppPrev, hedgeAdjNext); + if (discardedFace != NULL) + { + discardedFaces.pushBack(discardedFace); + } + + // handle the half edges at the tail + discardedFace = connectHalfEdges(hedgeAdjPrev, hedgeOppNext); + if (discardedFace != NULL) + { + discardedFaces.pushBack(discardedFace); + } + + computeNormalAndCentroid(); + PX_ASSERT(checkFaceConsistency()); + } + + ////////////////////////////////////////////////////////////////////////// + // connect half edges of 2 adjacent faces + // if we find redundancy - edges are in a line, we drop the addional face if it is just a skinny triangle + QuickHullFace* QuickHullFace::connectHalfEdges(QuickHullHalfEdge* hedgePrev, QuickHullHalfEdge* hedge) + { + QuickHullFace* discardedFace = NULL; + + // redundant edge - can be in a line + if (hedgePrev->getOppositeFace() == hedge->getOppositeFace()) + { + // then there is a redundant edge that we can get rid off + QuickHullFace* oppFace = hedge->getOppositeFace(); + QuickHullHalfEdge* hedgeOpp; + + if (hedgePrev == edge) + { + edge = hedge; + } + + // check if its not a skinny face with just 3 vertices - 3 edges + if (oppFace->isTriangle()) + { + // then we can get rid of the opposite face altogether + hedgeOpp = hedge->twin->prev->twin; + + oppFace->state = QuickHullFace::eDELETED; + discardedFace = oppFace; + } + else + { + // if not triangle, merge the 2 opposite halfedges into one + hedgeOpp = hedge->twin->next; + + if (oppFace->edge == hedgeOpp->prev) + { + oppFace->edge = hedgeOpp; + } + hedgeOpp->prev = hedgeOpp->prev->prev; + hedgeOpp->prev->next = hedgeOpp; + } + + hedge->prev = hedgePrev->prev; + hedge->prev->next = hedge; + + hedge->twin = hedgeOpp; + hedgeOpp->twin = hedge; + + // oppFace was modified, so need to recompute + oppFace->computeNormalAndCentroid(); + } + else + { + // just merge the halfedges + hedgePrev->next = hedge; + hedge->prev = hedgePrev; + } + return discardedFace; + } + + ////////////////////////////////////////////////////////////////////////// + // check face consistency + bool QuickHullFace::checkFaceConsistency() + { + // do a sanity check on the face + QuickHullHalfEdge* hedge = edge; + PxU32 numv = 0; + + // check degenerate face + do + { + numv++; + hedge = hedge->next; + } while (hedge != edge); + + // degenerate face found + PX_ASSERT(numv > 2); + + numv = 0; + hedge = edge; + do + { + QuickHullHalfEdge* hedgeOpp = hedge->twin; + + // check if we have twin set + PX_ASSERT(hedgeOpp != NULL); + + // twin for the twin must be the original edge + PX_ASSERT(hedgeOpp->twin == hedge); + + QuickHullFace* oppFace = hedgeOpp->face; + + PX_UNUSED(oppFace); + + // opposite edge face must be set and valid + PX_ASSERT(oppFace != NULL); + PX_ASSERT(oppFace->state != QuickHullFace::eDELETED); + + // edges face must be this one + PX_ASSERT(hedge->face == this); + + hedge = hedge->next; + } while (hedge != edge); + + return true; + } + + ////////////////////////////////////////////////////////////////////////// + + QuickHull::QuickHull(const PxCookingParams& params, const PxConvexMeshDesc& desc) + : mCookingParams(params), mConvexDesc(desc), mVerticesList(NULL), mNumHullFaces(0), mPrecomputedMinMax(false), + mTolerance(-1.0f), mPlaneTolerance(-1.0f) + { + } + + ////////////////////////////////////////////////////////////////////////// + + QuickHull::~QuickHull() + { + } + + ////////////////////////////////////////////////////////////////////////// + // sets the precomputed min/max values + void QuickHull::setPrecomputedMinMax(const QuickHullVertex* minVertex,const QuickHullVertex* maxVertex, const float tolerance,const float planeTolerance) + { + for (PxU32 i = 0; i < 3; i++) + { + mMinVertex[i] = minVertex[i]; + mMaxVertex[i] = maxVertex[i]; + } + + mTolerance = tolerance; + mPlaneTolerance = planeTolerance; + + mPrecomputedMinMax = true; + } + + ////////////////////////////////////////////////////////////////////////// + // preallocate internal buffers + void QuickHull::preallocate(PxU32 numVertices) + { + PX_ASSERT(numVertices > 0); + + // max num vertices = numVertices + mMaxVertices = PxMax(PxU32(8), numVertices); // 8 is min, since we can expand to AABB during the clean vertices phase + mVerticesList = reinterpret_cast<QuickHullVertex*> (PX_ALLOC_TEMP(sizeof(QuickHullVertex)*mMaxVertices, "QuickHullVertex")); + + // estimate the max half edges + PxU32 maxHalfEdges = (3 * mMaxVertices - 6) * 3; + mFreeHalfEdges.init(maxHalfEdges); + + // estimate the max faces + PxU32 maxFaces = (2 * mMaxVertices - 4); + mFreeFaces.init(maxFaces*2); + + mHullFaces.reserve(maxFaces); + mUnclaimedPoints.reserve(numVertices); + + mNewFaces.reserve(32); + mRemovedFaces.reserve(32); + mDiscardedFaces.reserve(32); + mHorizon.reserve(PxMin(numVertices,PxU32(128))); + } + + ////////////////////////////////////////////////////////////////////////// + // release internal buffers + void QuickHull::releaseHull() + { + if (mVerticesList) + { + PX_FREE_AND_RESET(mVerticesList); + } + mHullFaces.clear(); + } + + ////////////////////////////////////////////////////////////////////////// + // returns the maximum number of vertices on a face + PxU32 QuickHull::maxNumVertsPerFace() const + { + PxU32 numFaces = mHullFaces.size(); + PxU32 maxVerts = 0; + for (PxU32 i = 0; i < numFaces; i++) + { + const local::QuickHullFace& face = *mHullFaces[i]; + if (face.state == local::QuickHullFace::eVISIBLE) + { + if (face.numEdges > maxVerts) + maxVerts = face.numEdges; + } + } + return maxVerts; + } + + ////////////////////////////////////////////////////////////////////////// + // parse the input vertices and store them in the hull + void QuickHull::parseInputVertices(const PxVec3* verts, PxU32 numVerts) + { + PX_ASSERT(verts); + PX_ASSERT(numVerts <= mMaxVertices); + + mNumVertices = numVerts; + for (PxU32 i = 0; i < numVerts; i++) + { + mVerticesList[i].point = verts[i]; + mVerticesList[i].index = i; + } + } + + ////////////////////////////////////////////////////////////////////////// + // compute min max verts + void QuickHull::computeMinMaxVerts() + { + for (PxU32 i = 0; i < 3; i++) + { + mMinVertex[i] = mVerticesList[0]; + mMaxVertex[i] = mVerticesList[0]; + } + + PxVec3 max = mVerticesList[0].point; + PxVec3 min = mVerticesList[0].point; + + // get the max min vertices along the x,y,z + for (PxU32 i = 1; i < mNumVertices; i++) + { + const QuickHullVertex& testVertex = mVerticesList[i]; + const PxVec3& testPoint = testVertex.point; + if (testPoint.x > max.x) + { + max.x = testPoint.x; + mMaxVertex[0] = testVertex; + } + else if (testPoint.x < min.x) + { + min.x = testPoint.x; + mMinVertex[0] = testVertex; + } + + if (testPoint.y > max.y) + { + max.y = testPoint.y; + mMaxVertex[1] = testVertex; + } + else if (testPoint.y < min.y) + { + min.y = testPoint.y; + mMinVertex[1] = testVertex; + } + + if (testPoint.z > max.z) + { + max.z = testPoint.z; + mMaxVertex[2] = testVertex; + } + else if (testPoint.z < min.z) + { + min.z = testPoint.z; + mMinVertex[2] = testVertex; + } + } + + mTolerance = PxMax(local::PLANE_THICKNES * (PxMax(PxAbs(max.x), PxAbs(min.x)) + + PxMax(PxAbs(max.y), PxAbs(min.y)) + + PxMax(PxAbs(max.z), PxAbs(min.z))), local::PLANE_THICKNES); + mPlaneTolerance = local::PLANE_TOLERANCE; + } + + ////////////////////////////////////////////////////////////////////////// + // find the initial simplex + // 1. search in max axis from compute min,max + // 2. 3rd point is the furthest vertex from the initial line + // 3. 4th vertex is along the line, 3rd vertex normal + bool QuickHull::findSimplex() + { + float max = 0; + PxU32 imax = 0; + + for (PxU32 i = 0; i < 3; i++) + { + float diff = mMaxVertex[i].point[i] - mMinVertex[i].point[i]; + if (diff > max) + { + max = diff; + imax = i; + } + } + + if (max <= mTolerance) + { + // should not happen as we clear the vertices before and expand them if they are really close to each other + Ps::getFoundation().error(PxErrorCode::eINTERNAL_ERROR, __FILE__, __LINE__, "QuickHullConvexHullLib::findSimplex: Simplex input points appers to be almost at the same place"); + return false; + } + + QuickHullVertex simplex[4]; + + // set first two vertices to be those with the greatest + // one dimensional separation + simplex[0] = mMaxVertex[imax]; + simplex[1] = mMinVertex[imax]; + + // set third vertex to be the vertex farthest from + // the line between simplex[0] and simplex[1] + PxVec3 normal; + float maxDist = 0; + PxVec3 u01 = (simplex[1].point - simplex[0].point); + u01.normalize(); + + for (PxU32 i = 0; i < mNumVertices; i++) + { + const QuickHullVertex& testVert = mVerticesList[i]; + const PxVec3& testPoint = testVert.point; + const PxVec3 diff = testPoint - simplex[0].point; + const PxVec3 xprod = u01.cross(diff); + const float lenSqr = xprod.magnitudeSquared(); + if (lenSqr > maxDist && testVert.index != simplex[0].index && testVert.index != simplex[1].index) + { + maxDist = lenSqr; + simplex[2] = testVert; + normal = xprod; + } + } + + if (PxSqrt(maxDist) <= 100 * mTolerance) + { + Ps::getFoundation().error(PxErrorCode::eINTERNAL_ERROR, __FILE__, __LINE__, "QuickHullConvexHullLib::findSimplex: Simplex input points appers to be colinear."); + return false; + } + normal.normalize(); + + // set the forth vertex in the normal direction + const float d0 = simplex[2].point.dot(normal); + maxDist = 0.0f; + for (PxU32 i = 0; i < mNumVertices; i++) + { + const QuickHullVertex& testVert = mVerticesList[i]; + const PxVec3& testPoint = testVert.point; + const float dist = PxAbs(testPoint.dot(normal) - d0); + if (dist > maxDist && testVert.index != simplex[0].index && + testVert.index != simplex[1].index && testVert.index != simplex[2].index) + { + maxDist = dist; + simplex[3] = testVert; + } + } + + if (PxAbs(maxDist) <= 100 * mTolerance) + { + Ps::getFoundation().error(PxErrorCode::eINTERNAL_ERROR, __FILE__, __LINE__, "QuickHullConvexHullLib::findSimplex: Simplex input points appers to be coplanar."); + return false; + } + + // now create faces from those triangles + addSimplex(&simplex[0], simplex[3].point.dot(normal) - d0 < 0); + + return true; + } + + ////////////////////////////////////////////////////////////////////////// + // create triangle from given vertices, produce new face and connect the half edges + QuickHullFace* QuickHull::createTriangle(const QuickHullVertex& v0, const QuickHullVertex& v1, const QuickHullVertex& v2) + { + QuickHullFace* face = getFreeHullFace(); + + QuickHullHalfEdge* he0 = getFreeHullHalfEdge(); + he0->face = face; + he0->tail = v0; + + QuickHullHalfEdge* he1 = getFreeHullHalfEdge(); + he1->face = face; + he1->tail = v1; + + QuickHullHalfEdge* he2 = getFreeHullHalfEdge(); + he2->face = face; + he2->tail = v2; + + he0->prev = he2; + he0->next = he1; + he1->prev = he0; + he1->next = he2; + he2->prev = he1; + he2->next = he0; + + face->edge = he0; + face->nextFace = NULL; + + // compute the normal and offset + face->computeNormalAndCentroid(); + return face; + } + + + ////////////////////////////////////////////////////////////////////////// + // add initial simplex to the quickhull + // construct triangles from the simplex points and connect them with half edges + void QuickHull::addSimplex(QuickHullVertex* simplex, bool flipTriangle) + { + PX_ASSERT(simplex); + + // get interior point + PxVec3 vectorSum = simplex[0].point; + for (PxU32 i = 1; i < 4; i++) + { + vectorSum += simplex[i].point; + } + mInteriorPoint = vectorSum / 4.0f; + + QuickHullFace* tris[4]; + // create the triangles from the initial simplex + if (flipTriangle) + { + tris[0] = createTriangle(simplex[0], simplex[1], simplex[2]); + tris[1] = createTriangle(simplex[3], simplex[1], simplex[0]); + tris[2] = createTriangle(simplex[3], simplex[2], simplex[1]); + tris[3] = createTriangle(simplex[3], simplex[0], simplex[2]); + + for (PxU32 i = 0; i < 3; i++) + { + PxU32 k = (i + 1) % 3; + tris[i + 1]->getEdge(1)->setTwin(tris[k + 1]->getEdge(0)); + tris[i + 1]->getEdge(2)->setTwin(tris[0]->getEdge(k)); + } + } + else + { + tris[0] = createTriangle(simplex[0], simplex[2], simplex[1]); + tris[1] = createTriangle(simplex[3], simplex[0], simplex[1]); + tris[2] = createTriangle(simplex[3], simplex[1], simplex[2]); + tris[3] = createTriangle(simplex[3], simplex[2], simplex[0]); + + for (PxU32 i = 0; i < 3; i++) + { + PxU32 k = (i + 1) % 3; + tris[i + 1]->getEdge(0)->setTwin(tris[k + 1]->getEdge(1)); + tris[i + 1]->getEdge(2)->setTwin(tris[0]->getEdge((3 - i) % 3)); + } + } + + // push back the first 4 faces created from the simplex + for (PxU32 i = 0; i < 4; i++) + { + mHullFaces.pushBack(tris[i]); + } + mNumHullFaces = 4; + + // go through points and add point to faces if they are on the plane + for (PxU32 i = 0; i < mNumVertices; i++) + { + const QuickHullVertex& v = mVerticesList[i]; + + if (v == simplex[0] || v == simplex[1] || v == simplex[2] || v == simplex[3]) + { + continue; + } + + float maxDist = mTolerance; + QuickHullFace* maxFace = NULL; + for (PxU32 k = 0; k < 4; k++) + { + const float dist = tris[k]->distanceToPlane(v.point); + if (dist > maxDist) + { + maxFace = tris[k]; + maxDist = dist; + } + } + + if (maxFace != NULL) + { + addPointToFace(*maxFace, &mVerticesList[i], maxDist); + } + } + } + + ////////////////////////////////////////////////////////////////////////// + // adds a point to the conflict list + // the trick here is to store the most furthest point as the last, thats the only one we care about + // the rest is not important, we just need to store them and claim to new faces later, if the + // faces most furthest point is the current global maximum + void QuickHull::addPointToFace(QuickHullFace& face, QuickHullVertex* vertex, float dist) + { + // if we dont have a conflict list, store the vertex as the first one in the conflict list + vertex->dist = dist; + if(!face.conflictList) + { + face.conflictList = vertex; + vertex->dist = dist; + vertex->next = NULL; + return; + } + + PX_ASSERT(face.conflictList); + + // this is not the furthest vertex, store it as next in the linked list + if (face.conflictList->dist > dist) + { + vertex->next = face.conflictList->next; + face.conflictList->next = vertex; + } + else + { + // this is the furthest vertex, store it as first in the linked list + vertex->next = face.conflictList; + face.conflictList = vertex; + } + } + + ////////////////////////////////////////////////////////////////////////// + // removes eye point from a conflict list + // we know that the vertex must the last, as we store it at the back, so just popback() + void QuickHull::removeEyePointFromFace(QuickHullFace& face, const QuickHullVertex* vertex) + { + PX_UNUSED(vertex); + // the picked vertex should always be the first in the linked list + PX_ASSERT(face.conflictList == vertex); + + face.conflictList = face.conflictList->next; + } + + ////////////////////////////////////////////////////////////////////////// + // merge polygons with similar normals + void QuickHull::postMergeHull() + { + // merge faces with similar normals + for (PxU32 i = 0; i < mHullFaces.size(); i++) + { + QuickHullFace& face = *mHullFaces[i]; + + if (face.state == QuickHullFace::eVISIBLE) + { + PX_ASSERT(face.checkFaceConsistency()); + while (doPostAdjacentMerge(face, local::MAXDOT_MINANG)); + } + } + } + + ////////////////////////////////////////////////////////////////////////// + // builds the hull + // 1. find the initial simplex + // 2. check if simplex has a valid area + // 3. add vertices to the hull. We add vertex most furthest from the hull + // 4. terminate if hull limit reached or we have added all vertices + QuickHullResult::Enum QuickHull::buildHull() + { + QuickHullVertex* eyeVtx = NULL; + QuickHullFace* eyeFace; + + // compute the vertex min max along x,y,z + if(!mPrecomputedMinMax) + computeMinMaxVerts(); + + // find the initial simplex of the hull + if (!findSimplex()) + { + return QuickHullResult::eFAILURE; + } + + // simplex area test + const bool useAreaTest = mConvexDesc.flags & PxConvexFlag::eCHECK_ZERO_AREA_TRIANGLES ? true : false; + const float areaEpsilon = mCookingParams.areaTestEpsilon * 2.0f; + if (useAreaTest) + { + for (PxU32 i = 0; i < mHullFaces.size(); i++) + { + if (mHullFaces[i]->area < areaEpsilon) + { + return QuickHullResult::eZERO_AREA_TEST_FAILED; + } + } + } + + // add points to the hull + PxU32 numVerts = 4; // initial vertex count - simplex vertices + while ((eyeVtx = nextPointToAdd(eyeFace)) != NULL) + { + // if plane shifting vertex limit, we need the reduced hull + if((mConvexDesc.flags & PxConvexFlag::ePLANE_SHIFTING) && (numVerts >= mConvexDesc.vertexLimit)) + break; + + PX_ASSERT(eyeFace); + if (!addPointToHull(eyeVtx, *eyeFace)) + { + // we hit the polygons hard limit + return QuickHullResult::ePOLYGONS_LIMIT_REACHED; + } + numVerts++; + } + + // vertex limit has been reached. We did not stopped the iteration, since we + // will use the produced hull to compute OBB from it and use the planes + // to slice the initial OBB + if (numVerts >= mConvexDesc.vertexLimit) + { + return QuickHullResult::eVERTEX_LIMIT_REACHED; + } + + return QuickHullResult::eSUCCESS; + } + + ////////////////////////////////////////////////////////////////////////// + // finds the best point to add to the hull + // go through the faces conflict list and pick the global maximum + QuickHullVertex* QuickHull::nextPointToAdd(QuickHullFace*& eyeFace) + { + QuickHullVertex* eyeVtx = NULL; + QuickHullFace* eyeF = NULL; + float maxDist = PxMax(mTolerance*ACCEPTANCE_EPSILON_MULTIPLY, mPlaneTolerance); + for (PxU32 i = 0; i < mHullFaces.size(); i++) + { + if (mHullFaces[i]->state == QuickHullFace::eVISIBLE && mHullFaces[i]->conflictList) + { + const float dist = mHullFaces[i]->conflictList->dist; + if (maxDist < dist) + { + maxDist = dist; + eyeVtx = mHullFaces[i]->conflictList; + eyeF = mHullFaces[i]; + } + } + } + + eyeFace = eyeF; + return eyeVtx; + } + + ////////////////////////////////////////////////////////////////////////// + // adds vertex to the hull + // returns false if the new faces count would hit the hull face hard limit (255) + bool QuickHull::addPointToHull(const QuickHullVertex* eyeVtx, QuickHullFace& eyeFace) + { + // removes the eyePoint from the conflict list + removeEyePointFromFace(eyeFace, eyeVtx); + + // calculates the horizon from the eyePoint + calculateHorizon(eyeVtx->point, NULL, eyeFace, mHorizon, mRemovedFaces); + + // check if we dont hit the polygons hard limit + if (mNumHullFaces + mHorizon.size() > 255) + { + // make the faces visible again and quit + for (PxU32 i = 0; i < mRemovedFaces.size(); i++) + { + mRemovedFaces[i]->state = QuickHullFace::eVISIBLE; + } + mNumHullFaces += mRemovedFaces.size(); + return false; + } + + // adds new faces from given horizon and eyePoint + addNewFacesFromHorizon(eyeVtx, mHorizon, mNewFaces); + + // first merge pass ... merge faces which are non-convex + // as determined by the larger face + for (PxU32 i = 0; i < mNewFaces.size(); i++) + { + QuickHullFace& face = *mNewFaces[i]; + + if (face.state == QuickHullFace::eVISIBLE) + { + PX_ASSERT(face.checkFaceConsistency()); + while (doAdjacentMerge(face, true)); + } + } + + // second merge pass ... merge faces which are non-convex + // wrt either face + for (PxU32 i = 0; i < mNewFaces.size(); i++) + { + QuickHullFace& face = *mNewFaces[i]; + if (face.state == QuickHullFace::eNON_CONVEX) + { + face.state = QuickHullFace::eVISIBLE; + while (doAdjacentMerge(face, false)); + } + } + + resolveUnclaimedPoints(mNewFaces); + + mHorizon.clear(); + mNewFaces.clear(); + mRemovedFaces.clear(); + + return true; + } + + ////////////////////////////////////////////////////////////////////////// + // merge adjacent faces + // We merge 2 adjacent faces if they lie on the same thick plane defined by the mTolerance + // we do this in 2 steps to ensure we dont leave non-convex faces + bool QuickHull::doAdjacentMerge(QuickHullFace& face, bool mergeWrtLargeFace) + { + QuickHullHalfEdge* hedge = face.edge; + + bool convex = true; + do + { + const QuickHullFace& oppFace = *hedge->getOppositeFace(); + bool merge = false; + + if (mergeWrtLargeFace) + { + // merge faces if they are parallel or non-convex + // wrt to the larger face; otherwise, just mark + // the face non-convex for the second pass. + if (face.area > oppFace.area) + { + if (hedge->getOppositeFaceDistance() > -mTolerance) + { + merge = true; + } + else if (hedge->twin->getOppositeFaceDistance() > -mTolerance) + { + convex = false; + } + } + else + { + if (hedge->twin->getOppositeFaceDistance() > -mTolerance) + { + merge = true; + } + else if (hedge->getOppositeFaceDistance() > -mTolerance) + { + convex = false; + } + } + } + else + { + // then merge faces if they are definitively non-convex + if (hedge->getOppositeFaceDistance() > -mTolerance || + hedge->twin->getOppositeFaceDistance() > -mTolerance) + { + merge = true; + } + } + + if (merge) + { + mDiscardedFaces.clear(); + face.mergeAdjacentFace(hedge, mDiscardedFaces); + mNumHullFaces -= mDiscardedFaces.size(); + for (PxU32 i = 0; i < mDiscardedFaces.size(); i++) + { + deleteFacePoints(*mDiscardedFaces[i], &face); + } + PX_ASSERT(face.checkFaceConsistency()); + return true; + } + hedge = hedge->next; + } while (hedge != face.edge); + + if (!convex) + { + face.state = QuickHullFace::eNON_CONVEX; + } + return false; + } + + ////////////////////////////////////////////////////////////////////////// + // merge adjacent faces doing normal test + // we try to merge more aggressively 2 faces with the same normal. + // We use bigger tolerance for the plane thickness in the end - mPlaneTolerance. + bool QuickHull::doPostAdjacentMerge(QuickHullFace& face, const float maxdot_minang) + { + QuickHullHalfEdge* hedge = face.edge; + + do + { + const QuickHullFace& oppFace = *hedge->getOppositeFace(); + bool merge = false; + const PxVec3& ni = face.normal; + const PxVec3& nj = oppFace.normal; + const float dotP = ni.dot(nj); + + if (dotP > maxdot_minang) + { + if (face.area > oppFace.area) + { + // check if we can merge the 2 faces + merge = canMergeFaces(*hedge, mPlaneTolerance); + } + } + + if (merge) + { + QuickHullFaceArray discardedFaces; + face.mergeAdjacentFace(hedge, discardedFaces); + mNumHullFaces -= discardedFaces.size(); + for (PxU32 i = 0; i < discardedFaces.size(); i++) + { + deleteFacePoints(*discardedFaces[i], &face); + } + PX_ASSERT(face.checkFaceConsistency()); + return true; + } + hedge = hedge->next; + } while (hedge != face.edge); + + return false; + } + + ////////////////////////////////////////////////////////////////////////// + // checks if 2 adjacent faces can be merged + // 1. creates a face with merged vertices + // 2. computes new normal and centroid + // 3. checks that all verts are not too far away from the plane + // 4. checks that the new polygon is still convex + // 5. checks if we are about to merge only 2 neighbor faces, we dont + // want to merge additional faces, that might corrupt the convexity + bool QuickHull::canMergeFaces(const QuickHullHalfEdge& he, float planeTolerance) + { + const QuickHullFace& face1 = *he.face; + const QuickHullFace& face2 = *he.twin->face; + + // construct the merged face + PX_ALLOCA(edges, QuickHullHalfEdge, (face1.numEdges + face2.numEdges)); + PxMemSet(edges, 0, (face1.numEdges + face2.numEdges)*sizeof(QuickHullHalfEdge)); + QuickHullFace mergedFace; + mergedFace.edge = &edges[0]; + + // copy the first face edges + PxU32 currentEdge = 0; + QuickHullHalfEdge* copyHe = he.next; + while (copyHe != &he) + { + edges[currentEdge].face = &mergedFace; + edges[currentEdge].tail = copyHe->tail; + edges[currentEdge].next = &edges.mPointer[currentEdge + 1]; + + currentEdge++; + copyHe = copyHe->next; + } + + // copy the second face edges + copyHe = he.twin->next; + while (copyHe != he.twin) + { + edges[currentEdge].face = &mergedFace; + edges[currentEdge].tail = copyHe->tail; + edges[currentEdge].next = &edges.mPointer[currentEdge + 1]; + + currentEdge++; + copyHe = copyHe->next; + } + edges[--currentEdge].next = &edges.mPointer[0]; + + // compute normal and centroid + mergedFace.computeNormalAndCentroid(); + + // test the vertex distance + QuickHullHalfEdge* qhe = mergedFace.edge; + do + { + const QuickHullVertex& vertex = qhe->tail; + const float dist = mergedFace.distanceToPlane(vertex.point); + if (dist > planeTolerance) + { + return false; + } + qhe = qhe->next; + } while (qhe != mergedFace.edge); + + // check the convexity + qhe = mergedFace.edge; + do + { + const QuickHullVertex& vertex = qhe->tail; + const QuickHullVertex& nextVertex = qhe->next->tail; + + PxVec3 edgeVector = nextVertex.point - vertex.point; + edgeVector.normalize(); + const PxVec3 outVector = -mergedFace.normal.cross(edgeVector); + + QuickHullHalfEdge* testHe = qhe->next; + do + { + const QuickHullVertex& testVertex = testHe->tail; + const float dist = (testVertex.point - vertex.point).dot(outVector); + + if (dist > mTolerance) + return false; + + testHe = testHe->next; + } while (testHe != qhe->next); + + qhe = qhe->next; + } while (qhe != mergedFace.edge); + + + const QuickHullFace* oppFace = he.getOppositeFace(); + + QuickHullHalfEdge* hedgeOpp = he.twin; + + QuickHullHalfEdge* hedgeAdjPrev = he.prev; + QuickHullHalfEdge* hedgeAdjNext = he.next; + QuickHullHalfEdge* hedgeOppPrev = hedgeOpp->prev; + QuickHullHalfEdge* hedgeOppNext = hedgeOpp->next; + + // check if we are lining up with the face in adjPrev dir + while (hedgeAdjPrev->getOppositeFace() == oppFace) + { + hedgeAdjPrev = hedgeAdjPrev->prev; + hedgeOppNext = hedgeOppNext->next; + } + + // check if we are lining up with the face in adjNext dir + while (hedgeAdjNext->getOppositeFace() == oppFace) + { + hedgeOppPrev = hedgeOppPrev->prev; + hedgeAdjNext = hedgeAdjNext->next; + } + + // no redundant merges, just clean merge of 2 neighbour faces + if (hedgeOppPrev->getOppositeFace() == hedgeAdjNext->getOppositeFace()) + { + return false; + } + + if (hedgeAdjPrev->getOppositeFace() == hedgeOppNext->getOppositeFace()) + { + return false; + } + + return true; + } + + ////////////////////////////////////////////////////////////////////////// + // delete face points and store them as unclaimed, so we can add them back to new faces later + void QuickHull::deleteFacePoints(QuickHullFace& face, QuickHullFace* absorbingFace) + { + // no conflict list for this face + if(!face.conflictList) + return; + + QuickHullVertex* unclaimedVertex = face.conflictList; + QuickHullVertex* vertexToClaim = NULL; + while (unclaimedVertex) + { + vertexToClaim = unclaimedVertex; + unclaimedVertex = unclaimedVertex->next; + vertexToClaim->next = NULL; + if (!absorbingFace) + { + mUnclaimedPoints.pushBack(vertexToClaim); + } + else + { + const float dist = absorbingFace->distanceToPlane(vertexToClaim->point); + if (dist > mTolerance) + { + addPointToFace(*absorbingFace, vertexToClaim, dist); + } + else + { + mUnclaimedPoints.pushBack(vertexToClaim); + } + } + } + + face.conflictList = NULL; + } + + ////////////////////////////////////////////////////////////////////////// + // calculate the horizon from the eyePoint against a given face + void QuickHull::calculateHorizon(const PxVec3& eyePoint, QuickHullHalfEdge* edge0, QuickHullFace& face, QuickHullHalfEdgeArray& horizon, QuickHullFaceArray& removedFaces) + { + deleteFacePoints(face, NULL); + face.state = QuickHullFace::eDELETED; + removedFaces.pushBack(&face); + mNumHullFaces--; + QuickHullHalfEdge* edge; + if (edge0 == NULL) + { + edge0 = face.getEdge(0); + edge = edge0; + } + else + { + edge = edge0->next; + } + + do + { + QuickHullFace* oppFace = edge->getOppositeFace(); + if (oppFace->state == QuickHullFace::eVISIBLE) + { + const float dist = oppFace->distanceToPlane(eyePoint); + if (dist > mTolerance) + { + calculateHorizon(eyePoint, edge->twin, *oppFace, horizon, removedFaces); + } + else + { + horizon.pushBack(edge); + } + } + edge = edge->next; + } while (edge != edge0); + } + + ////////////////////////////////////////////////////////////////////////// + // adds new faces from given horizon and eyePoint + void QuickHull::addNewFacesFromHorizon(const QuickHullVertex* eyePoint, const QuickHullHalfEdgeArray& horizon, QuickHullFaceArray& newFaces) + { + QuickHullHalfEdge* hedgeSidePrev = NULL; + QuickHullHalfEdge* hedgeSideBegin = NULL; + + for (PxU32 i = 0; i < horizon.size(); i++) + { + const QuickHullHalfEdge& horizonHe = *horizon[i]; + + QuickHullFace* face = createTriangle(*eyePoint, horizonHe.getHead(), horizonHe.getTail()); + mHullFaces.pushBack(face); + mNumHullFaces++; + face->getEdge(2)->setTwin(horizonHe.twin); + + QuickHullHalfEdge* hedgeSide = face->edge; + if (hedgeSidePrev != NULL) + { + hedgeSide->next->setTwin(hedgeSidePrev); + } + else + { + hedgeSideBegin = hedgeSide; + } + newFaces.pushBack(face); + hedgeSidePrev = hedgeSide; + } + hedgeSideBegin->next->setTwin(hedgeSidePrev); + } + + ////////////////////////////////////////////////////////////////////////// + // resolve unclaimed points + void QuickHull::resolveUnclaimedPoints(const QuickHullFaceArray& newFaces) + { + for (PxU32 i = 0; i < mUnclaimedPoints.size(); i++) + { + QuickHullVertex* vtx = mUnclaimedPoints[i]; + + float maxDist = mTolerance; + QuickHullFace* maxFace = NULL; + for (PxU32 j = 0; j < newFaces.size(); j++) + { + const QuickHullFace& newFace = *newFaces[j]; + if (newFace.state == QuickHullFace::eVISIBLE) + { + const float dist = newFace.distanceToPlane(vtx->point); + if (dist > maxDist) + { + maxDist = dist; + maxFace = newFaces[j]; + } + } + } + if (maxFace != NULL) + { + addPointToFace(*maxFace, vtx, maxDist); + } + } + + mUnclaimedPoints.clear(); + } + + ////////////////////////////////////////////////////////////////////////// + // helper struct for hull expand point + struct ExpandPoint + { + PxPlane plane[3]; // the 3 planes that will give us the point + PxU32 planeIndex[3]; // index of the planes for identification + + bool operator==(const ExpandPoint& expPoint) const + { + if (expPoint.planeIndex[0] == planeIndex[0] && expPoint.planeIndex[1] == planeIndex[1] && + expPoint.planeIndex[2] == planeIndex[2]) + return true; + else + return false; +} + }; + +////////////////////////////////////////////////////////////////////////// + // gets the half edge neighbors and form the expand point + void getExpandPoint(const QuickHullHalfEdge& he, ExpandPoint& expandPoint, const Ps::Array<PxU32>* translationTable = NULL) + { + // set the first 2 - the edge face and the twin face + expandPoint.planeIndex[0] = (translationTable) ? ((*translationTable)[he.face->index]) : (he.face->index); + + PxU32 index = translationTable ? ((*translationTable)[he.twin->face->index]) : he.twin->face->index; + if (index < expandPoint.planeIndex[0]) + { + expandPoint.planeIndex[1] = expandPoint.planeIndex[0]; + expandPoint.planeIndex[0] = index; + } + else + { + expandPoint.planeIndex[1] = index; + } + + // now the 3rd one is the next he twin index + index = translationTable ? (*translationTable)[he.next->twin->face->index] : he.next->twin->face->index; + if (index < expandPoint.planeIndex[0]) + { + expandPoint.planeIndex[2] = expandPoint.planeIndex[1]; + expandPoint.planeIndex[1] = expandPoint.planeIndex[0]; + expandPoint.planeIndex[0] = index; + } + else + { + if (index < expandPoint.planeIndex[1]) + { + expandPoint.planeIndex[2] = expandPoint.planeIndex[1]; + expandPoint.planeIndex[1] = index; + } + else + { + expandPoint.planeIndex[2] = index; + } + } + } + + ////////////////////////////////////////////////////////////////////////// + // adds the expand point, don't add similar point + void addExpandPoint(const ExpandPoint& expandPoint, Ps::Array<ExpandPoint>& expandPoints) + { + for (PxU32 i = expandPoints.size(); i--;) + { + if (expandPoint == expandPoints[i]) + { + return; + } + } + + expandPoints.pushBack(expandPoint); + } + + ////////////////////////////////////////////////////////////////////////// + // helper for 3 planes intersection + static PxVec3 threePlaneIntersection(const PxPlane &p0, const PxPlane &p1, const PxPlane &p2) + { + PxMat33 mp = (PxMat33(p0.n, p1.n, p2.n)).getTranspose(); + PxMat33 mi = (mp).getInverse(); + PxVec3 b(p0.d, p1.d, p2.d); + return -mi.transform(b); + } +} + +////////////////////////////////////////////////////////////////////////// + +QuickHullConvexHullLib::QuickHullConvexHullLib(const PxConvexMeshDesc& desc, const PxCookingParams& params) + : ConvexHullLib(desc, params),mQuickHull(NULL), mCropedConvexHull(NULL), mVertsOut(NULL), mIndicesOut(NULL), mPolygonsOut(NULL) +{ + mQuickHull = PX_NEW_TEMP(local::QuickHull)(params, desc); + mQuickHull->preallocate(desc.points.count); +} + +////////////////////////////////////////////////////////////////////////// + +QuickHullConvexHullLib::~QuickHullConvexHullLib() +{ + mQuickHull->releaseHull(); + PX_DELETE(mQuickHull); + + if(mCropedConvexHull) + { + PX_DELETE(mCropedConvexHull); + } + + PX_FREE(mVertsOut); + PX_FREE(mPolygonsOut); + PX_FREE(mIndicesOut); +} + +////////////////////////////////////////////////////////////////////////// +// create the hull +// 1. clean the input vertices +// 2. check we can construct the simplex, if not expand the input verts +// 3. prepare the quickhull - preallocate, parse input verts +// 4. construct the hull +// 5. post merge faces if limit not reached +// 6. if limit reached, expand the hull +PxConvexMeshCookingResult::Enum QuickHullConvexHullLib::createConvexHull() +{ + PxConvexMeshCookingResult::Enum res = PxConvexMeshCookingResult::eFAILURE; + + PxU32 vcount = mConvexMeshDesc.points.count; + if ( vcount < 8 ) + vcount = 8; + + PxVec3* outvsource = reinterpret_cast<PxVec3*> (PX_ALLOC_TEMP( sizeof(PxVec3)*vcount, "PxVec3")); + PxVec3 scale; + PxVec3 center; + PxU32 outvcount; + + // cleanup the vertices first + if(!cleanupVertices(mConvexMeshDesc.points.count, reinterpret_cast<const PxVec3*> (mConvexMeshDesc.points.data), mConvexMeshDesc.points.stride, + outvcount, outvsource, scale, center )) + { + PX_FREE(outvsource); + return res; + } + + // scale vertices back to their original size. + // move the vertices to the origin + for (PxU32 i=0; i< outvcount; i++) + { + PxVec3& v = outvsource[i]; + v.multiply(scale); + } + + local::QuickHullVertex minimumVertex[3]; + local::QuickHullVertex maximumVertex[3]; + float tolerance; + float planeTolerance; + bool canReuse = cleanupForSimplex(outvsource, outvcount, &minimumVertex[0], &maximumVertex[0], tolerance, planeTolerance); + + mQuickHull->parseInputVertices(outvsource,outvcount); + + if(canReuse) + { + mQuickHull->setPrecomputedMinMax(minimumVertex, maximumVertex, tolerance, planeTolerance); + } + + local::QuickHullResult::Enum qhRes = mQuickHull->buildHull(); + + switch(qhRes) + { + case local::QuickHullResult::eZERO_AREA_TEST_FAILED: + res = PxConvexMeshCookingResult::eZERO_AREA_TEST_FAILED; + break; + case local::QuickHullResult::eSUCCESS: + mQuickHull->postMergeHull(); + res = PxConvexMeshCookingResult::eSUCCESS; + break; + case local::QuickHullResult::ePOLYGONS_LIMIT_REACHED: + res = PxConvexMeshCookingResult::ePOLYGONS_LIMIT_REACHED; + break; + case local::QuickHullResult::eVERTEX_LIMIT_REACHED: + { + // expand the hull + if(mConvexMeshDesc.flags & PxConvexFlag::ePLANE_SHIFTING) + res = expandHull(); + else + res = expandHullOBB(); + } + break; + case local::QuickHullResult::eFAILURE: + break; + }; + + // check if we need to build GRB compatible mesh + // if hull was cropped we already have a compatible mesh, if not check + // the max verts per face + if((mConvexMeshDesc.flags & PxConvexFlag::eGPU_COMPATIBLE) && !mCropedConvexHull && + res == PxConvexMeshCookingResult::eSUCCESS) + { + PX_ASSERT(mQuickHull); + // if we hit the vertex per face limit, expand the hull by cropping OBB + if(mQuickHull->maxNumVertsPerFace() > gpuMaxVertsPerFace) + { + res = expandHullOBB(); + } + } + + PX_FREE(outvsource); + return res; +} + +////////////////////////////////////////////////////////////////////////// +// fixup the input vertices to be not colinear or coplanar for the initial simplex find +bool QuickHullConvexHullLib::cleanupForSimplex(PxVec3* vertices, PxU32 vertexCount, local::QuickHullVertex* minimumVertex, + local::QuickHullVertex* maximumVertex, float& tolerance, float& planeTolerance) +{ + bool retVal = true; + + for (PxU32 i = 0; i < 3; i++) + { + minimumVertex[i].point = vertices[0]; + minimumVertex[i].index = 0; + maximumVertex[i].point = vertices[0]; + maximumVertex[i].index = 0; + + } + + PxVec3 max = vertices[0]; + PxVec3 min = vertices[0]; + + // get the max min vertices along the x,y,z + for (PxU32 i = 1; i < vertexCount; i++) + { + const PxVec3& testPoint = vertices[i]; + if (testPoint.x > max.x) + { + max.x = testPoint.x; + maximumVertex[0].point = testPoint; + maximumVertex[0].index = i; + } + else if (testPoint.x < min.x) + { + min.x = testPoint.x; + minimumVertex[0].point = testPoint; + minimumVertex[0].index = i; + } + + if (testPoint.y > max.y) + { + max.y = testPoint.y; + maximumVertex[1].point = testPoint; + maximumVertex[1].index = i; + } + else if (testPoint.y < min.y) + { + min.y = testPoint.y; + minimumVertex[1].point = testPoint; + minimumVertex[1].index = i; + } + + if (testPoint.z > max.z) + { + max.z = testPoint.z; + maximumVertex[2].point = testPoint; + maximumVertex[2].index = i; + } + else if (testPoint.z < min.z) + { + min.z = testPoint.z; + minimumVertex[2].point = testPoint; + minimumVertex[2].index = i; + } + } + + tolerance = PxMax(local::PLANE_THICKNES * (PxMax(PxAbs(max.x), PxAbs(min.x)) + + PxMax(PxAbs(max.y), PxAbs(min.y)) + + PxMax(PxAbs(max.z), PxAbs(min.z))), local::PLANE_THICKNES); + + planeTolerance = local::PLANE_TOLERANCE; + + float fmax = 0; + PxU32 imax = 0; + + for (PxU32 i = 0; i < 3; i++) + { + float diff = (maximumVertex[i].point)[i] - (minimumVertex[i].point)[i]; + if (diff > fmax) + { + fmax = diff; + imax = i; + } + } + + PxVec3 simplex[4]; + + // set first two vertices to be those with the greatest + // one dimensional separation + simplex[0] = maximumVertex[imax].point; + simplex[1] = minimumVertex[imax].point; + + // set third vertex to be the vertex farthest from + // the line between simplex[0] and simplex[1] + PxVec3 normal; + float maxDist = 0; + imax = 0; + PxVec3 u01 = (simplex[1] - simplex[0]); + u01.normalize(); + + for (PxU32 i = 0; i < vertexCount; i++) + { + const PxVec3& testPoint = vertices[i]; + const PxVec3 diff = testPoint - simplex[0]; + const PxVec3 xprod = u01.cross(diff); + const float lenSqr = xprod.magnitudeSquared(); + if (lenSqr > maxDist) + { + maxDist = lenSqr; + simplex[2] = testPoint; + normal = xprod; + imax = i; + } + } + + if (PxSqrt(maxDist) <= 100 * tolerance) + { + // points are collinear, we have to move the point further + PxVec3 u02 = simplex[2] - simplex[0]; + float fT = u02.dot(u01); + const float sqrLen = u01.magnitudeSquared(); + fT /= sqrLen; + PxVec3 n = u02 - fT*u01; + n.normalize(); + const PxVec3 mP = simplex[2] + n * 100.0f * tolerance; + simplex[2] = mP; + vertices[imax] = mP; + retVal = false; + } + normal.normalize(); + + // set the forth vertex in the normal direction + float d0 = simplex[2].dot(normal); + maxDist = 0.0f; + imax = 0; + for (PxU32 i = 0; i < vertexCount; i++) + { + const PxVec3& testPoint = vertices[i]; + float dist = PxAbs(testPoint.dot(normal) - d0); + if (dist > maxDist) + { + maxDist = dist; + simplex[3] = testPoint; + imax = i; + } + } + + if (PxAbs(maxDist) <= 100.0f * tolerance) + { + float dist = (vertices[imax].dot(normal) - d0); + if (dist > 0) + vertices[imax] = vertices[imax] + normal * 100.0f * tolerance; + else + vertices[imax] = vertices[imax] - normal * 100.0f * tolerance; + retVal = false; + } + + return retVal; +} + +////////////////////////////////////////////////////////////////////////// +// expand the hull with the from the limited triangles set +// expand hull will do following steps: +// 1. get expand points from hull that form the best hull with given vertices +// 2. expand the planes to have all vertices inside the planes volume +// 3. compute new points by 3 adjacency planes intersections +// 4. take those points and create the hull from them +PxConvexMeshCookingResult::Enum QuickHullConvexHullLib::expandHull() +{ + Ps::Array<local::ExpandPoint> expandPoints; + expandPoints.reserve(mQuickHull->mNumVertices); + + // go over faces and gather expand points + for (PxU32 i = 0; i < mQuickHull->mHullFaces.size(); i++) + { + const local::QuickHullFace& face = *mQuickHull->mHullFaces[i]; + if(face.state == local::QuickHullFace::eVISIBLE) + { + local::ExpandPoint expandPoint; + local::QuickHullHalfEdge* he = face.edge; + local::getExpandPoint(*he, expandPoint); + local::addExpandPoint(expandPoint, expandPoints); + he = he->next; + while (he != face.edge) + { + local::getExpandPoint(*he, expandPoint); + local::addExpandPoint(expandPoint, expandPoints); + he = he->next; + } + } + } + + + // go over the planes now and expand them + for(PxU32 iVerts=0;iVerts< mQuickHull->mNumVertices;iVerts++) + { + const local::QuickHullVertex& vertex = mQuickHull->mVerticesList[iVerts]; + + for (PxU32 i = 0; i < mQuickHull->mHullFaces.size(); i++) + { + local::QuickHullFace& face = *mQuickHull->mHullFaces[i]; + if(face.state == local::QuickHullFace::eVISIBLE) + { + const float dist = face.distanceToPlane(vertex.point); + if(dist > 0 && dist > face.expandOffset) + { + face.expandOffset = dist; + } + } + } + } + + // fill the expand points planes + for(PxU32 i=0;i<expandPoints.size();i++) + { + local::ExpandPoint& expandPoint = expandPoints[i]; + for (PxU32 k = 0; k < 3; k++) + { + const local::QuickHullFace& face = *mQuickHull->mFreeFaces.getItem(expandPoint.planeIndex[k]); + PX_ASSERT(face.index == expandPoint.planeIndex[k]); + PxPlane plane; + plane.n = face.normal; + plane.d = -face.planeOffset; + if(face.expandOffset > 0.0f) + plane.d -= face.expandOffset; + expandPoint.plane[k] = plane; + } + } + + // now find the plane intersection + PX_ALLOCA(vertices,PxVec3,expandPoints.size()); + for(PxU32 i=0;i<expandPoints.size();i++) + { + local::ExpandPoint& expandPoint = expandPoints[i]; + vertices[i] = local::threePlaneIntersection(expandPoint.plane[0],expandPoint.plane[1],expandPoint.plane[2]); + } + + // construct again the hull from the new points + local::QuickHull* newHull = PX_NEW_TEMP(local::QuickHull)(mQuickHull->mCookingParams, mQuickHull->mConvexDesc); + newHull->preallocate(expandPoints.size()); + newHull->parseInputVertices(vertices,expandPoints.size()); + + local::QuickHullResult::Enum qhRes = newHull->buildHull(); + switch(qhRes) + { + case local::QuickHullResult::eZERO_AREA_TEST_FAILED: + { + newHull->releaseHull(); + PX_DELETE(newHull); + return PxConvexMeshCookingResult::eZERO_AREA_TEST_FAILED; + } + case local::QuickHullResult::eSUCCESS: + case local::QuickHullResult::eVERTEX_LIMIT_REACHED: + case local::QuickHullResult::ePOLYGONS_LIMIT_REACHED: + { + mQuickHull->releaseHull(); + PX_DELETE(mQuickHull); + mQuickHull = newHull; + } + break; + case local::QuickHullResult::eFAILURE: + { + newHull->releaseHull(); + PX_DELETE(newHull); + return PxConvexMeshCookingResult::eFAILURE; + } + }; + + return PxConvexMeshCookingResult::eSUCCESS; +} + +////////////////////////////////////////////////////////////////////////// +// expand the hull from the limited triangles set +// 1. collect all planes +// 2. create OBB from the input verts +// 3. slice the OBB with the planes +// 5. iterate till vlimit is reached +PxConvexMeshCookingResult::Enum QuickHullConvexHullLib::expandHullOBB() +{ + Ps::Array<PxPlane> expandPlanes; + expandPlanes.reserve(mQuickHull->mHullFaces.size()); + + // collect expand planes + for (PxU32 i = 0; i < mQuickHull->mHullFaces.size(); i++) + { + local::QuickHullFace& face = *mQuickHull->mHullFaces[i]; + if (face.state == local::QuickHullFace::eVISIBLE) + { + PxPlane plane; + plane.n = face.normal; + plane.d = -face.planeOffset; + if (face.expandOffset > 0.0f) + plane.d -= face.expandOffset; + + expandPlanes.pushBack(plane); + } + } + + + PxTransform obbTransform; + PxVec3 sides; + + // compute the OBB + PxConvexMeshDesc convexDesc; + fillConvexMeshDescFromQuickHull(convexDesc); + convexDesc.flags = mConvexMeshDesc.flags; + computeOBBFromConvex(convexDesc, sides, obbTransform); + + // free the memory used for the convex mesh desc + PX_FREE_AND_RESET(mVertsOut); + PX_FREE_AND_RESET(mPolygonsOut); + PX_FREE_AND_RESET(mIndicesOut); + + // crop the OBB + PxU32 maxplanes = PxMin(PxU32(256), expandPlanes.size()); + + ConvexHull* c = PX_NEW_TEMP(ConvexHull)(sides*0.5f,obbTransform, expandPlanes); + + const float planeTolerance = mQuickHull->mPlaneTolerance; + const float epsilon = mQuickHull->mTolerance; + + PxI32 k; + while (maxplanes-- && (k = c->findCandidatePlane(planeTolerance, epsilon)) >= 0) + { + ConvexHull* tmp = c; + c = convexHullCrop(*tmp, expandPlanes[PxU32(k)], planeTolerance); + if (c == NULL) + { + c = tmp; + break; + } // might want to debug this case better!!! + if (!c->assertIntact(planeTolerance)) + { + PX_DELETE(c); + c = tmp; + break; + } // might want to debug this case better too!!! + + // check for vertex limit + if (c->getVertices().size() > mConvexMeshDesc.vertexLimit) + { + PX_DELETE(c); + c = tmp; + maxplanes = 0; + break; + } + // check for vertex limit per face if necessary, GRB supports max 32 verts per face + if ((mConvexMeshDesc.flags & PxConvexFlag::eGPU_COMPATIBLE) && c->maxNumVertsPerFace() > gpuMaxVertsPerFace) + { + PX_DELETE(c); + c = tmp; + maxplanes = 0; + break; + } + PX_DELETE(tmp); + } + + PX_ASSERT(c->assertIntact(planeTolerance)); + + mCropedConvexHull = c; + + return PxConvexMeshCookingResult::eSUCCESS; +} + + + + +////////////////////////////////////////////////////////////////////////// +// fill the descriptor with computed verts, indices and polygons +void QuickHullConvexHullLib::fillConvexMeshDesc(PxConvexMeshDesc& desc) +{ + if (mCropedConvexHull) + fillConvexMeshDescFromCroppedHull(desc); + else + fillConvexMeshDescFromQuickHull(desc); +} + +////////////////////////////////////////////////////////////////////////// +// fill the descriptor with computed verts, indices and polygons from quickhull convex +void QuickHullConvexHullLib::fillConvexMeshDescFromQuickHull(PxConvexMeshDesc& desc) +{ + // get the number of indices needed + PxU32 numIndices = 0; + PxU32 numFaces = mQuickHull->mHullFaces.size(); + PxU32 numFacesOut = 0; + PxU32 largestFace = 0; // remember the largest face, we store it as the first face, required for GRB test (max 32 vers per face supported) + for (PxU32 i = 0; i < numFaces; i++) + { + const local::QuickHullFace& face = *mQuickHull->mHullFaces[i]; + if(face.state == local::QuickHullFace::eVISIBLE) + { + numFacesOut++; + numIndices += face.numEdges; + if(face.numEdges > mQuickHull->mHullFaces[largestFace]->numEdges) + largestFace = i; + } + } + + // allocate out buffers + PxU32* indices = reinterpret_cast<PxU32*> (PX_ALLOC_TEMP(sizeof(PxU32)*numIndices, "PxU32")); + PxI32* translateTable = reinterpret_cast<PxI32*> (PX_ALLOC_TEMP(sizeof(PxU32)*mQuickHull->mNumVertices, "PxU32")); + PxMemSet(translateTable,-1,mQuickHull->mNumVertices*sizeof(PxU32)); + // allocate additional vec3 for V4 safe load in VolumeInteration + PxVec3* vertices = reinterpret_cast<PxVec3*> (PX_ALLOC_TEMP(sizeof(PxVec3)*mQuickHull->mNumVertices + 1, "PxVec3")); + PxHullPolygon* polygons = reinterpret_cast<PxHullPolygon*> (PX_ALLOC_TEMP(sizeof(PxHullPolygon)*numFacesOut, "PxHullPolygon")); + + // go over the hullPolygons and mark valid vertices, create translateTable + PxU32 numVertices = 0; + for (PxU32 i = 0; i < numFaces; i++) + { + const local::QuickHullFace& face = *mQuickHull->mHullFaces[i]; + if(face.state == local::QuickHullFace::eVISIBLE) + { + local::QuickHullHalfEdge* he = face.edge; + if(translateTable[he->tail.index] == -1) + { + vertices[numVertices] = he->tail.point; + translateTable[he->tail.index] = PxI32(numVertices); + numVertices++; + } + he = he->next; + while (he != face.edge) + { + if(translateTable[he->tail.index] == -1) + { + vertices[numVertices] = he->tail.point; + translateTable[he->tail.index] = PxI32(numVertices); + numVertices++; + } + he = he->next; + } + } + } + + + desc.points.count = numVertices; + desc.points.data = vertices; + desc.points.stride = sizeof(PxVec3); + + desc.indices.count = numIndices; + desc.indices.data = indices; + desc.indices.stride = sizeof(PxU32); + + desc.polygons.count = numFacesOut; + desc.polygons.data = polygons; + desc.polygons.stride = sizeof(PxHullPolygon); + + PxU16 indexOffset = 0; + numFacesOut = 0; + for (PxU32 i = 0; i < numFaces; i++) + { + // faceIndex - store the largest face first then the rest + PxU32 faceIndex; + if(i == 0) + { + faceIndex = largestFace; + } + else + { + faceIndex = (i == largestFace) ? 0 : i; + } + + const local::QuickHullFace& face = *mQuickHull->mHullFaces[faceIndex]; + if(face.state == local::QuickHullFace::eVISIBLE) + { + //create index data + local::QuickHullHalfEdge* he = face.edge; + PxU32 index = 0; + indices[index + indexOffset] = PxU32(translateTable[he->tail.index]); + index++; + he = he->next; + while (he != face.edge) + { + indices[index + indexOffset] = PxU32(translateTable[he->tail.index]); + index++; + he = he->next; + } + + // create polygon + PxHullPolygon polygon; + polygon.mPlane[0] = face.normal[0]; + polygon.mPlane[1] = face.normal[1]; + polygon.mPlane[2] = face.normal[2]; + polygon.mPlane[3] = -face.normal.dot(face.centroid); + + polygon.mIndexBase = indexOffset; + polygon.mNbVerts = face.numEdges; + indexOffset += face.numEdges; + polygons[numFacesOut] = polygon; + numFacesOut++; + } + } + + PX_ASSERT(mQuickHull->mNumHullFaces == numFacesOut); + + mVertsOut = vertices; + mIndicesOut = indices; + mPolygonsOut = polygons; + + PX_FREE(translateTable); +} + +////////////////////////////////////////////////////////////////////////// +// fill the desc from cropped hull data +void QuickHullConvexHullLib::fillConvexMeshDescFromCroppedHull(PxConvexMeshDesc& outDesc) +{ + PX_ASSERT(mCropedConvexHull); + + // parse the hullOut and fill the result with vertices and polygons + mIndicesOut = reinterpret_cast<PxU32*> (PX_ALLOC_TEMP(sizeof(PxU32)*(mCropedConvexHull->getEdges().size()), "PxU32")); + PxU32 numIndices = mCropedConvexHull->getEdges().size(); + + PxU32 numPolygons = mCropedConvexHull->getFacets().size(); + mPolygonsOut = reinterpret_cast<PxHullPolygon*> (PX_ALLOC_TEMP(sizeof(PxHullPolygon)*numPolygons, "PxHullPolygon")); + + // allocate additional vec3 for V4 safe load in VolumeInteration + mVertsOut = reinterpret_cast<PxVec3*> (PX_ALLOC_TEMP(sizeof(PxVec3)*mCropedConvexHull->getVertices().size() + 1, "PxVec3")); + PxU32 numVertices = mCropedConvexHull->getVertices().size(); + PxMemCopy(mVertsOut, mCropedConvexHull->getVertices().begin(), sizeof(PxVec3)*numVertices); + + PxU32 i = 0; + PxU32 k = 0; + PxU32 j = 1; + while (i < mCropedConvexHull->getEdges().size()) + { + j = 1; + PxHullPolygon& polygon = mPolygonsOut[k]; + // get num indices per polygon + while (j + i < mCropedConvexHull->getEdges().size() && mCropedConvexHull->getEdges()[i].p == mCropedConvexHull->getEdges()[i + j].p) + { + j++; + } + polygon.mNbVerts = Ps::to16(j); + polygon.mIndexBase = Ps::to16(i); + + // get the plane + polygon.mPlane[0] = mCropedConvexHull->getFacets()[k].n[0]; + polygon.mPlane[1] = mCropedConvexHull->getFacets()[k].n[1]; + polygon.mPlane[2] = mCropedConvexHull->getFacets()[k].n[2]; + + polygon.mPlane[3] = mCropedConvexHull->getFacets()[k].d; + + while (j--) + { + mIndicesOut[i] = mCropedConvexHull->getEdges()[i].v; + i++; + } + k++; + } + + PX_ASSERT(k == mCropedConvexHull->getFacets().size()); + + outDesc.indices.count = numIndices; + outDesc.indices.stride = sizeof(PxU32); + outDesc.indices.data = mIndicesOut; + + outDesc.points.count = numVertices; + outDesc.points.stride = sizeof(PxVec3); + outDesc.points.data = mVertsOut; + + outDesc.polygons.count = numPolygons; + outDesc.polygons.stride = sizeof(PxHullPolygon); + outDesc.polygons.data = mPolygonsOut; + + swapLargestFace(outDesc); +} + diff --git a/PhysX_3.4/Source/PhysXCooking/src/convex/QuickHullConvexHullLib.h b/PhysX_3.4/Source/PhysXCooking/src/convex/QuickHullConvexHullLib.h new file mode 100644 index 00000000..ad077654 --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/convex/QuickHullConvexHullLib.h @@ -0,0 +1,97 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + +#ifndef PX_QUICKHULL_CONVEXHULLLIB_H +#define PX_QUICKHULL_CONVEXHULLLIB_H + +#include "ConvexHullLib.h" +#include "Ps.h" +#include "PsArray.h" +#include "PsUserAllocated.h" + +namespace local +{ + class QuickHull; + struct QuickHullVertex; +} + +namespace physx +{ + class ConvexHull; + + ////////////////////////////////////////////////////////////////////////// + // Quickhull lib constructs the hull from given input points. The resulting hull + // will only contain a subset of the input points. The algorithm does incrementally + // adds most furthest vertices to the starting simplex. The produced hulls are build with high precision + // and produce more stable and correct results, than the legacy algorithm. + class QuickHullConvexHullLib: public ConvexHullLib, public Ps::UserAllocated + { + PX_NOCOPY(QuickHullConvexHullLib) + public: + + // functions + QuickHullConvexHullLib(const PxConvexMeshDesc& desc, const PxCookingParams& params); + + ~QuickHullConvexHullLib(); + + // computes the convex hull from provided points + virtual PxConvexMeshCookingResult::Enum createConvexHull(); + + // fills the convexmeshdesc with computed hull data + virtual void fillConvexMeshDesc(PxConvexMeshDesc& desc); + + protected: + // if vertex limit reached we need to expand the hull using the OBB slicing + PxConvexMeshCookingResult::Enum expandHullOBB(); + + // if vertex limit reached we need to expand the hull using the plane shifting + PxConvexMeshCookingResult::Enum expandHull(); + + // checks for collinearity and co planarity + // returns true if the simplex was ok, we can reuse the computed tolerances and min/max values + bool cleanupForSimplex(PxVec3* vertices, PxU32 vertexCount, local::QuickHullVertex* minimumVertex, + local::QuickHullVertex* maximumVertex, float& tolerance, float& planeTolerance); + + // fill the result desc from quick hull convex + void fillConvexMeshDescFromQuickHull(PxConvexMeshDesc& desc); + + // fill the result desc from cropped hull convex + void fillConvexMeshDescFromCroppedHull(PxConvexMeshDesc& desc); + + private: + local::QuickHull* mQuickHull; // the internal quick hull representation + ConvexHull* mCropedConvexHull; //the hull cropped from OBB, used for vertex limit path + + PxVec3* mVertsOut; // vertices for output + PxU32* mIndicesOut; // inidices for output + PxHullPolygon* mPolygonsOut; // polygons for output + }; +} + +#endif diff --git a/PhysX_3.4/Source/PhysXCooking/src/convex/VolumeIntegration.cpp b/PhysX_3.4/Source/PhysXCooking/src/convex/VolumeIntegration.cpp new file mode 100644 index 00000000..f388a32c --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/convex/VolumeIntegration.cpp @@ -0,0 +1,797 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + + +//#ifdef PX_COOKING + +/* +* This code computes volume integrals needed to compute mass properties of polyhedral bodies. +* Based on public domain code by Brian Mirtich. +*/ +#include "foundation/PxMemory.h" +#include "VolumeIntegration.h" +#include "PxSimpleTriangleMesh.h" +#include "PxConvexMeshDesc.h" +#include "GuConvexMeshData.h" +#include "PsUtilities.h" +#include "PsVecMath.h" + + +namespace physx +{ + + using namespace Ps::aos; + +namespace +{ + + class VolumeIntegrator + { + public: + VolumeIntegrator(PxSimpleTriangleMesh mesh, PxF64 mDensity); + ~VolumeIntegrator(); + bool computeVolumeIntegrals(PxIntegrals& ir); + private: + struct Normal + { + PxVec3 normal; + PxF32 w; + }; + + struct Face + { + PxF64 Norm[3]; + PxF64 w; + PxU32 Verts[3]; + }; + + // Data structures + PxF64 mMass; //!< Mass + PxF64 mDensity; //!< Density + PxSimpleTriangleMesh mesh; + //Normal * faceNormals; //!< temp face normal data structure + + + + + unsigned int mA; //!< Alpha + unsigned int mB; //!< Beta + unsigned int mC; //!< Gamma + + // Projection integrals + PxF64 mP1; + PxF64 mPa; //!< Pi Alpha + PxF64 mPb; //!< Pi Beta + PxF64 mPaa; //!< Pi Alpha^2 + PxF64 mPab; //!< Pi AlphaBeta + PxF64 mPbb; //!< Pi Beta^2 + PxF64 mPaaa; //!< Pi Alpha^3 + PxF64 mPaab; //!< Pi Alpha^2Beta + PxF64 mPabb; //!< Pi AlphaBeta^2 + PxF64 mPbbb; //!< Pi Beta^3 + + // Face integrals + PxF64 mFa; //!< FAlpha + PxF64 mFb; //!< FBeta + PxF64 mFc; //!< FGamma + PxF64 mFaa; //!< FAlpha^2 + PxF64 mFbb; //!< FBeta^2 + PxF64 mFcc; //!< FGamma^2 + PxF64 mFaaa; //!< FAlpha^3 + PxF64 mFbbb; //!< FBeta^3 + PxF64 mFccc; //!< FGamma^3 + PxF64 mFaab; //!< FAlpha^2Beta + PxF64 mFbbc; //!< FBeta^2Gamma + PxF64 mFcca; //!< FGamma^2Alpha + + // The 10 volume integrals + PxF64 mT0; //!< ~Total mass + PxF64 mT1[3]; //!< Location of the center of mass + PxF64 mT2[3]; //!< Moments of inertia + PxF64 mTP[3]; //!< Products of inertia + + // Internal methods + // bool Init(); + PxVec3 computeCenterOfMass(); + void computeInertiaTensor(PxF64* J); + void computeCOMInertiaTensor(PxF64* J); + void computeFaceNormal(Face & f, PxU32 * indices); + + void computeProjectionIntegrals(const Face& f); + void computeFaceIntegrals(const Face& f); + }; + + #define X 0u + #define Y 1u + #define Z 2u + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + /** + * Constructor. + */ + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + VolumeIntegrator::VolumeIntegrator(PxSimpleTriangleMesh mesh_, PxF64 density) + { + mDensity = density; + mMass = 0.0; + this->mesh = mesh_; + } + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + /** + * Destructor. + */ + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + VolumeIntegrator::~VolumeIntegrator() + { + } + + void VolumeIntegrator::computeFaceNormal(Face & f, PxU32 * indices) + { + const PxU8 * vertPointer = reinterpret_cast<const PxU8*>(mesh.points.data); + + //two edges + PxVec3 d1 = (*reinterpret_cast<const PxVec3 *>(vertPointer + mesh.points.stride * indices[1] )) - (*reinterpret_cast<const PxVec3 *>(vertPointer + mesh.points.stride * indices[0] )); + PxVec3 d2 = (*reinterpret_cast<const PxVec3 *>(vertPointer + mesh.points.stride * indices[2] )) - (*reinterpret_cast<const PxVec3 *>(vertPointer + mesh.points.stride * indices[1] )); + + + PxVec3 normal = d1.cross(d2); + + normal.normalize(); + + f.w = - PxF64(normal.dot( (*reinterpret_cast<const PxVec3 *>(vertPointer + mesh.points.stride * indices[0] )) )); + + f.Norm[0] = PxF64(normal.x); + f.Norm[1] = PxF64(normal.y); + f.Norm[2] = PxF64(normal.z); + } + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + /** + * Computes volume integrals for a polyhedron by summing surface integrals over its faces. + * \param ir [out] a result structure. + * \return true if success + */ + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + bool VolumeIntegrator::computeVolumeIntegrals(PxIntegrals& ir) + { + // Clear all integrals + mT0 = mT1[X] = mT1[Y] = mT1[Z] = mT2[X] = mT2[Y] = mT2[Z] = mTP[X] = mTP[Y] = mTP[Z] = 0; + + Face f; + const PxU8 * trigPointer = reinterpret_cast<const PxU8*>(mesh.triangles.data); + for(PxU32 i=0;i<mesh.triangles.count;i++, trigPointer += mesh.triangles.stride) + { + + if (mesh.flags & PxMeshFlag::e16_BIT_INDICES) + { + f.Verts[0] = (reinterpret_cast<const PxU16 *>(trigPointer))[0]; + f.Verts[1] = (reinterpret_cast<const PxU16 *>(trigPointer))[1]; + f.Verts[2] = (reinterpret_cast<const PxU16 *>(trigPointer))[2]; + } + else + { + f.Verts[0] = (reinterpret_cast<const PxU32 *>(trigPointer)[0]); + f.Verts[1] = (reinterpret_cast<const PxU32 *>(trigPointer)[1]); + f.Verts[2] = (reinterpret_cast<const PxU32 *>(trigPointer)[2]); + } + + if (mesh.flags & PxMeshFlag::eFLIPNORMALS) + { + PxU32 t = f.Verts[1]; + f.Verts[1] = f.Verts[2]; + f.Verts[2] = t; + } + + //compute face normal: + computeFaceNormal(f,f.Verts); + + // Compute alpha/beta/gamma as the right-handed permutation of (x,y,z) that maximizes |n| + PxF64 nx = fabs(f.Norm[X]); + PxF64 ny = fabs(f.Norm[Y]); + PxF64 nz = fabs(f.Norm[Z]); + if (nx > ny && nx > nz) mC = X; + else mC = (ny > nz) ? Y : Z; + mA = (mC + 1) % 3; + mB = (mA + 1) % 3; + + // Compute face contribution + computeFaceIntegrals(f); + + // Update integrals + mT0 += f.Norm[X] * ((mA == X) ? mFa : ((mB == X) ? mFb : mFc)); + + mT1[mA] += f.Norm[mA] * mFaa; + mT1[mB] += f.Norm[mB] * mFbb; + mT1[mC] += f.Norm[mC] * mFcc; + + mT2[mA] += f.Norm[mA] * mFaaa; + mT2[mB] += f.Norm[mB] * mFbbb; + mT2[mC] += f.Norm[mC] * mFccc; + + mTP[mA] += f.Norm[mA] * mFaab; + mTP[mB] += f.Norm[mB] * mFbbc; + mTP[mC] += f.Norm[mC] * mFcca; + } + + mT1[X] /= 2; mT1[Y] /= 2; mT1[Z] /= 2; + mT2[X] /= 3; mT2[Y] /= 3; mT2[Z] /= 3; + mTP[X] /= 2; mTP[Y] /= 2; mTP[Z] /= 2; + + // Fill result structure + ir.COM = computeCenterOfMass(); + computeInertiaTensor(reinterpret_cast<PxF64*>(ir.inertiaTensor)); + computeCOMInertiaTensor(reinterpret_cast<PxF64*>(ir.COMInertiaTensor)); + ir.mass = mMass; + return true; + } + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + /** + * Computes the center of mass. + * \return The center of mass. + */ + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + PxVec3 VolumeIntegrator::computeCenterOfMass() + { + // Compute center of mass + PxVec3 COM(0.0f, 0.0f, 0.0f); + if(mT0!=0.0) + { + COM.x = float(mT1[X] / mT0); + COM.y = float(mT1[Y] / mT0); + COM.z = float(mT1[Z] / mT0); + } + return COM; + } + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + /** + * Setups the inertia tensor relative to the origin. + * \param it [out] the returned inertia tensor. + */ + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + void VolumeIntegrator::computeInertiaTensor(PxF64* it) + { + PxF64 J[3][3]; + + // Compute inertia tensor + J[X][X] = mDensity * (mT2[Y] + mT2[Z]); + J[Y][Y] = mDensity * (mT2[Z] + mT2[X]); + J[Z][Z] = mDensity * (mT2[X] + mT2[Y]); + + J[X][Y] = J[Y][X] = - mDensity * mTP[X]; + J[Y][Z] = J[Z][Y] = - mDensity * mTP[Y]; + J[Z][X] = J[X][Z] = - mDensity * mTP[Z]; + + PxMemCopy(it, J, 9*sizeof(PxF64)); + } + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + /** + * Setups the inertia tensor relative to the COM. + * \param it [out] the returned inertia tensor. + */ + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + void VolumeIntegrator::computeCOMInertiaTensor(PxF64* it) + { + PxF64 J[3][3]; + + mMass = mDensity * mT0; + + const PxVec3 COM = computeCenterOfMass(); + const PxVec3 MassCOM(PxF32(mMass) * COM); + const PxVec3 MassCOM2(MassCOM.x * COM.x, MassCOM.y * COM.y, MassCOM.z * COM.z); + + // Compute initial inertia tensor + computeInertiaTensor(reinterpret_cast<PxF64*>(J)); + + // Translate inertia tensor to center of mass + // Huyghens' theorem: + // Jx'x' = Jxx - m*(YG^2+ZG^2) + // Jy'y' = Jyy - m*(ZG^2+XG^2) + // Jz'z' = Jzz - m*(XG^2+YG^2) + // XG, YG, ZG = new origin + // YG^2+ZG^2 = dx^2 + J[X][X] -= PxF64(MassCOM2.y + MassCOM2.z); + J[Y][Y] -= PxF64(MassCOM2.z + MassCOM2.x); + J[Z][Z] -= PxF64(MassCOM2.x + MassCOM2.y); + + // Huyghens' theorem: + // Jx'y' = Jxy - m*XG*YG + // Jy'z' = Jyz - m*YG*ZG + // Jz'x' = Jzx - m*ZG*XG + // ### IS THE SIGN CORRECT ? + J[X][Y] = J[Y][X] += PxF64(MassCOM.x * COM.y); + J[Y][Z] = J[Z][Y] += PxF64(MassCOM.y * COM.z); + J[Z][X] = J[X][Z] += PxF64(MassCOM.z * COM.x); + + PxMemCopy(it, J, 9*sizeof(PxF64)); + } + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + /** + * Computes integrals over a face projection from the coordinates of the projections vertices. + * \param f [in] a face structure. + */ + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + void VolumeIntegrator::computeProjectionIntegrals(const Face& f) + { + mP1 = mPa = mPb = mPaa = mPab = mPbb = mPaaa = mPaab = mPabb = mPbbb = 0.0; + + const PxU8* vertPointer = reinterpret_cast<const PxU8*>(mesh.points.data); + for(PxU32 i=0;i<3;i++) + { + const PxVec3& p0 = *reinterpret_cast<const PxVec3 *>(vertPointer + mesh.points.stride * (f.Verts[i]) ); + const PxVec3& p1 = *reinterpret_cast<const PxVec3 *>(vertPointer + mesh.points.stride * (f.Verts[(i+1) % 3]) ); + + + PxF64 a0 = PxF64(p0[mA]); + PxF64 b0 = PxF64(p0[mB]); + PxF64 a1 = PxF64(p1[mA]); + PxF64 b1 = PxF64(p1[mB]); + + PxF64 da = a1 - a0; // DeltaA + PxF64 db = b1 - b0; // DeltaB + + PxF64 a0_2 = a0 * a0; // Alpha0^2 + PxF64 a0_3 = a0_2 * a0; // ... + PxF64 a0_4 = a0_3 * a0; + + PxF64 b0_2 = b0 * b0; + PxF64 b0_3 = b0_2 * b0; + PxF64 b0_4 = b0_3 * b0; + + PxF64 a1_2 = a1 * a1; + PxF64 a1_3 = a1_2 * a1; + + PxF64 b1_2 = b1 * b1; + PxF64 b1_3 = b1_2 * b1; + + PxF64 C1 = a1 + a0; + + PxF64 Ca = a1*C1 + a0_2; + PxF64 Caa = a1*Ca + a0_3; + PxF64 Caaa = a1*Caa + a0_4; + + PxF64 Cb = b1*(b1 + b0) + b0_2; + PxF64 Cbb = b1*Cb + b0_3; + PxF64 Cbbb = b1*Cbb + b0_4; + + PxF64 Cab = 3*a1_2 + 2*a1*a0 + a0_2; + PxF64 Kab = a1_2 + 2*a1*a0 + 3*a0_2; + + PxF64 Caab = a0*Cab + 4*a1_3; + PxF64 Kaab = a1*Kab + 4*a0_3; + + PxF64 Cabb = 4*b1_3 + 3*b1_2*b0 + 2*b1*b0_2 + b0_3; + PxF64 Kabb = b1_3 + 2*b1_2*b0 + 3*b1*b0_2 + 4*b0_3; + + mP1 += db*C1; + mPa += db*Ca; + mPaa += db*Caa; + mPaaa += db*Caaa; + mPb += da*Cb; + mPbb += da*Cbb; + mPbbb += da*Cbbb; + mPab += db*(b1*Cab + b0*Kab); + mPaab += db*(b1*Caab + b0*Kaab); + mPabb += da*(a1*Cabb + a0*Kabb); + } + + mP1 /= 2.0; + mPa /= 6.0; + mPaa /= 12.0; + mPaaa /= 20.0; + mPb /= -6.0; + mPbb /= -12.0; + mPbbb /= -20.0; + mPab /= 24.0; + mPaab /= 60.0; + mPabb /= -60.0; + } + + #define SQR(x) ((x)*(x)) //!< Returns x square + #define CUBE(x) ((x)*(x)*(x)) //!< Returns x cube + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + /** + * Computes surface integrals over a polyhedral face from the integrals over its projection. + * \param f [in] a face structure. + */ + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + void VolumeIntegrator::computeFaceIntegrals(const Face& f) + { + computeProjectionIntegrals(f); + + PxF64 w = f.w; + const PxF64* n = f.Norm; + PxF64 k1 = 1 / n[mC]; + PxF64 k2 = k1 * k1; + PxF64 k3 = k2 * k1; + PxF64 k4 = k3 * k1; + + mFa = k1 * mPa; + mFb = k1 * mPb; + mFc = -k2 * (n[mA]*mPa + n[mB]*mPb + w*mP1); + + mFaa = k1 * mPaa; + mFbb = k1 * mPbb; + mFcc = k3 * (SQR(n[mA])*mPaa + 2*n[mA]*n[mB]*mPab + SQR(n[mB])*mPbb + w*(2*(n[mA]*mPa + n[mB]*mPb) + w*mP1)); + + mFaaa = k1 * mPaaa; + mFbbb = k1 * mPbbb; + mFccc = -k4 * (CUBE(n[mA])*mPaaa + 3*SQR(n[mA])*n[mB]*mPaab + + 3*n[mA]*SQR(n[mB])*mPabb + CUBE(n[mB])*mPbbb + + 3*w*(SQR(n[mA])*mPaa + 2*n[mA]*n[mB]*mPab + SQR(n[mB])*mPbb) + + w*w*(3*(n[mA]*mPa + n[mB]*mPb) + w*mP1)); + + mFaab = k1 * mPaab; + mFbbc = -k2 * (n[mA]*mPabb + n[mB]*mPbbb + w*mPbb); + mFcca = k3 * (SQR(n[mA])*mPaaa + 2*n[mA]*n[mB]*mPaab + SQR(n[mB])*mPabb + w*(2*(n[mA]*mPaa + n[mB]*mPab) + w*mPa)); + } + + /* + * This code computes volume integrals needed to compute mass properties of polyhedral bodies. + * Based on public domain code by David Eberly. + */ + + class VolumeIntegratorEberly + { + public: + VolumeIntegratorEberly(const PxConvexMeshDesc& mesh, PxF64 mDensity); + ~VolumeIntegratorEberly(); + bool computeVolumeIntegralsSIMD(PxIntegrals& ir, const PxVec3& origin); + bool computeVolumeIntegrals(PxIntegrals& ir, const PxVec3& origin); + + private: + VolumeIntegratorEberly& operator=(const VolumeIntegratorEberly&); + const PxConvexMeshDesc& mDesc; + PxF64 mMass; + PxReal mMassR; + PxF64 mDensity; + }; + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + /** + * Constructor. + */ + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + VolumeIntegratorEberly::VolumeIntegratorEberly(const PxConvexMeshDesc& desc, PxF64 density) + : mDesc(desc), mMass(0), mMassR(0), mDensity(density) + { + } + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + /** + * Destructor. + */ + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + VolumeIntegratorEberly::~VolumeIntegratorEberly() + { + } + + PX_FORCE_INLINE void subexpressions(PxF64 w0, PxF64 w1, PxF64 w2, PxF64& f1, PxF64& f2, PxF64& f3, PxF64& g0, PxF64& g1, PxF64& g2) + { + PxF64 temp0 = w0 + w1; + f1 = temp0 + w2; + PxF64 temp1 = w0*w0; + PxF64 temp2 = temp1 + w1*temp0; + f2 = temp2 + w2*f1; + f3 = w0*temp1 + w1*temp2 + w2*f2; + g0 = f2 + w0*(f1 + w0); + g1 = f2 + w1*(f1 + w1); + g2 = f2 + w2*(f1 + w2); + } + + PX_FORCE_INLINE void subexpressionsSIMD(const Vec4V& w0, const Vec4V& w1, const Vec4V& w2, + Vec4V& f1, Vec4V& f2, Vec4V& f3, Vec4V& g0, Vec4V& g1, Vec4V& g2) + { + const Vec4V temp0 = V4Add(w0, w1); + f1 = V4Add(temp0, w2); + const Vec4V temp1 = V4Mul(w0,w0); + const Vec4V temp2 = V4MulAdd(w1, temp0, temp1); + f2 = V4MulAdd(w2, f1, temp2); + + // f3 = w0.multiply(temp1) + w1.multiply(temp2) + w2.multiply(f2); + const Vec4V ad0 = V4Mul(w0, temp1); + const Vec4V ad1 = V4MulAdd(w1, temp2, ad0); + f3 = V4MulAdd(w2, f2, ad1); + + g0 = V4MulAdd(w0, V4Add(f1, w0), f2); // f2 + w0.multiply(f1 + w0); + g1 = V4MulAdd(w1, V4Add(f1, w1), f2); // f2 + w1.multiply(f1 + w1); + g2 = V4MulAdd(w2, V4Add(f1, w2), f2); // f2 + w2.multiply(f1 + w2); + } + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + /** + * Computes volume integrals for a polyhedron by summing surface integrals over its faces. SIMD version + * \param ir [out] a result structure. + * \param origin [in] the origin of the mesh vertices. All vertices will be shifted accordingly prior to computing the volume integrals. + Can improve accuracy, for example, if the centroid is used in the case of a convex mesh. Note: the returned inertia will not be relative to this origin but relative to (0,0,0). + * \return true if success + */ + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + bool VolumeIntegratorEberly::computeVolumeIntegralsSIMD(PxIntegrals& ir, const PxVec3& origin) + { + FloatV mult = FLoad(1.0f/6.0f); + const Vec4V multV = V4Load(1.0f/24.0f); + const Vec4V multV2 = V4Load(1.0f/60.0f); + const Vec4V multVV = V4Load(1.0f/120.0f); + + // order: 1, x, y, z, x^2, y^2, z^2, xy, yz, zx + FloatV intg = FLoad(0.0f); + Vec4V intgV = V4Load(0.0f); + Vec4V intgV2 = V4Load(0.0f); + Vec4V intgVV = V4Load(0.0f); + + const Vec4V originV = Vec4V_From_PxVec3_WUndefined(origin); + const FloatV zeroV = FLoad(0.0f); + + const PxVec3* hullVerts = static_cast<const PxVec3*> (mDesc.points.data); + const Gu::HullPolygonData* hullPolygons = static_cast<const Gu::HullPolygonData*> (mDesc.polygons.data); + + for (PxU32 i = 0; i < mDesc.polygons.count; i++) + { + const Gu::HullPolygonData& polygon = hullPolygons[i]; + const PxU8* data = static_cast<const PxU8*>(mDesc.indices.data) + polygon.mVRef8; + const PxU32 nbVerts = polygon.mNbVerts; + + PX_ASSERT(nbVerts > 2); + + const Vec4V normalV = V4LoadU(&polygon.mPlane.n.x); + + for (PxU32 j = 0; j < nbVerts - 2; j++) + { + // Should be safe to V4Load, we allocate one more vertex each time + const Vec4V vertex0 = V4LoadU(&hullVerts[data[0]].x); + const Vec4V vertex1 = V4LoadU(&hullVerts[data[j + 1]].x); + const Vec4V vertex2 = V4LoadU(&hullVerts[data[j + 2]].x); + + const Vec4V p0 = V4Sub(vertex0, originV); + Vec4V p1 = V4Sub(vertex1, originV); + Vec4V p2 = V4Sub(vertex2, originV); + + const Vec4V p0YZX = V4PermYZXW(p0); + const Vec4V p1YZX = V4PermYZXW(p1); + const Vec4V p2YZX = V4PermYZXW(p2); + + // get edges and cross product of edges + Vec4V d = V4Cross(V4Sub(p1, p0), V4Sub(p2, p0)); // (p1 - p0).cross(p2 - p0); + + const FloatV dist = V4Dot3(d, normalV); + //if(cp.dot(normalV) < 0) + if(FAllGrtr(zeroV, dist)) + { + d = V4Neg(d); + Vec4V temp = p1; + p1 = p2; + p2 = temp; + } + + // compute integral terms + Vec4V f1; Vec4V f2; Vec4V f3; Vec4V g0; Vec4V g1; Vec4V g2; + + subexpressionsSIMD(p0, p1, p2, f1, f2, f3, g0, g1, g2); + + // update integrals + intg = FScaleAdd(V4GetX(d), V4GetX(f1), intg); //intg += d.x*f1.x; + + intgV = V4MulAdd(d, f2, intgV); // intgV +=d.multiply(f2); + intgV2 = V4MulAdd(d, f3, intgV2); // intgV2 += d.multiply(f3); + + const Vec4V ad0 = V4Mul(p0YZX, g0); + const Vec4V ad1 = V4MulAdd(p1YZX, g1, ad0); + const Vec4V ad2 = V4MulAdd(p2YZX, g2, ad1); + intgVV = V4MulAdd(d, ad2, intgVV); //intgVV += d.multiply(p0YZX.multiply(g0) + p1YZX.multiply(g1) + p2YZX.multiply(g2)); + } + } + + intg = FMul(intg, mult); // intg *= mult; + intgV = V4Mul(intgV, multV); + intgV2 = V4Mul(intgV2, multV2); + intgVV = V4Mul(intgVV, multVV); + + // center of mass ir.COM = intgV/mMassR; + const Vec4V comV = V4ScaleInv(intgV, intg); + // we rewrite the mass, but then we set it back + V4StoreU(comV, &ir.COM.x); + + FStore(intg, &mMassR); + ir.mass = PxF64(mMassR); // = intg; + + PxVec3 intg2; + V3StoreU(Vec3V_From_Vec4V(intgV2), intg2); + + PxVec3 intVV; + V3StoreU(Vec3V_From_Vec4V(intgVV), intVV); + + // inertia tensor relative to the provided origin parameter + ir.inertiaTensor[0][0] = PxF64(intg2.y + intg2.z); + ir.inertiaTensor[1][1] = PxF64(intg2.x + intg2.z); + ir.inertiaTensor[2][2] = PxF64(intg2.x + intg2.y); + ir.inertiaTensor[0][1] = ir.inertiaTensor[1][0] = PxF64(-intVV.x); + ir.inertiaTensor[1][2] = ir.inertiaTensor[2][1] = PxF64(-intVV.y); + ir.inertiaTensor[0][2] = ir.inertiaTensor[2][0] = PxF64(-intVV.z); + + // inertia tensor relative to center of mass + ir.COMInertiaTensor[0][0] = ir.inertiaTensor[0][0] -PxF64(mMassR*(ir.COM.y*ir.COM.y+ir.COM.z*ir.COM.z)); + ir.COMInertiaTensor[1][1] = ir.inertiaTensor[1][1] -PxF64(mMassR*(ir.COM.z*ir.COM.z+ir.COM.x*ir.COM.x)); + ir.COMInertiaTensor[2][2] = ir.inertiaTensor[2][2] -PxF64(mMassR*(ir.COM.x*ir.COM.x+ir.COM.y*ir.COM.y)); + ir.COMInertiaTensor[0][1] = ir.COMInertiaTensor[1][0] = (ir.inertiaTensor[0][1] +PxF64(mMassR*ir.COM.x*ir.COM.y)); + ir.COMInertiaTensor[1][2] = ir.COMInertiaTensor[2][1] = (ir.inertiaTensor[1][2] +PxF64(mMassR*ir.COM.y*ir.COM.z)); + ir.COMInertiaTensor[0][2] = ir.COMInertiaTensor[2][0] = (ir.inertiaTensor[0][2] +PxF64(mMassR*ir.COM.z*ir.COM.x)); + + // inertia tensor relative to (0,0,0) + if (!origin.isZero()) + { + PxVec3 sum = ir.COM + origin; + ir.inertiaTensor[0][0] -= PxF64(mMassR*((ir.COM.y*ir.COM.y+ir.COM.z*ir.COM.z) - (sum.y*sum.y+sum.z*sum.z))); + ir.inertiaTensor[1][1] -= PxF64(mMassR*((ir.COM.z*ir.COM.z+ir.COM.x*ir.COM.x) - (sum.z*sum.z+sum.x*sum.x))); + ir.inertiaTensor[2][2] -= PxF64(mMassR*((ir.COM.x*ir.COM.x+ir.COM.y*ir.COM.y) - (sum.x*sum.x+sum.y*sum.y))); + ir.inertiaTensor[0][1] = ir.inertiaTensor[1][0] = ir.inertiaTensor[0][1] + PxF64(mMassR*((ir.COM.x*ir.COM.y) - (sum.x*sum.y))); + ir.inertiaTensor[1][2] = ir.inertiaTensor[2][1] = ir.inertiaTensor[1][2] + PxF64(mMassR*((ir.COM.y*ir.COM.z) - (sum.y*sum.z))); + ir.inertiaTensor[0][2] = ir.inertiaTensor[2][0] = ir.inertiaTensor[0][2] + PxF64(mMassR*((ir.COM.z*ir.COM.x) - (sum.z*sum.x))); + ir.COM = sum; + } + + return true; + } + + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + /** + * Computes volume integrals for a polyhedron by summing surface integrals over its faces. + * \param ir [out] a result structure. + * \param origin [in] the origin of the mesh vertices. All vertices will be shifted accordingly prior to computing the volume integrals. + Can improve accuracy, for example, if the centroid is used in the case of a convex mesh. Note: the returned inertia will not be relative to this origin but relative to (0,0,0). + * \return true if success + */ + /////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + bool VolumeIntegratorEberly::computeVolumeIntegrals(PxIntegrals& ir, const PxVec3& origin) + { + const PxF64 mult[10] = {1.0/6.0,1.0/24.0,1.0/24.0,1.0/24.0,1.0/60.0,1.0/60.0,1.0/60.0,1.0/120.0,1.0/120.0,1.0/120.0}; + PxF64 intg[10] = {0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0,0.0}; // order: 1, x, y, z, x^2, y^2, z^2, xy, yz, zx + const PxVec3* hullVerts = static_cast<const PxVec3*> (mDesc.points.data); + + for (PxU32 i = 0; i < mDesc.polygons.count; i++) + { + const Gu::HullPolygonData& polygon = (static_cast<const Gu::HullPolygonData*> (mDesc.polygons.data))[i]; + const PxU8* Data = static_cast<const PxU8*>(mDesc.indices.data) + polygon.mVRef8; + const PxU32 NbVerts = polygon.mNbVerts; + for (PxU32 j = 0; j < NbVerts - 2; j++) + { + const PxVec3 p0 = hullVerts[Data[0]] - origin; + PxVec3 p1 = hullVerts[Data[(j + 1) % NbVerts]] - origin; + PxVec3 p2 = hullVerts[Data[(j + 2) % NbVerts]] - origin; + + PxVec3 cp = (p1 - p0).cross(p2 - p0); + + if(cp.dot(polygon.mPlane.n) < 0) + { + cp = -cp; + Ps::swap(p1,p2); + } + + PxF64 x0 = PxF64(p0.x); PxF64 y0 = PxF64(p0.y); PxF64 z0 = PxF64(p0.z); + PxF64 x1 = PxF64(p1.x); PxF64 y1 = PxF64(p1.y); PxF64 z1 = PxF64(p1.z); + PxF64 x2 = PxF64(p2.x); PxF64 y2 = PxF64(p2.y); PxF64 z2 = PxF64(p2.z); + + // get edges and cross product of edges + PxF64 d0 = PxF64(cp.x); PxF64 d1 = PxF64(cp.y); PxF64 d2 = PxF64(cp.z); + + // compute integral terms + PxF64 f1x; PxF64 f2x; PxF64 f3x; PxF64 g0x; PxF64 g1x; PxF64 g2x; + PxF64 f1y; PxF64 f2y; PxF64 f3y; PxF64 g0y; PxF64 g1y; PxF64 g2y; + PxF64 f1z; PxF64 f2z; PxF64 f3z; PxF64 g0z; PxF64 g1z; PxF64 g2z; + + subexpressions(x0, x1, x2, f1x, f2x, f3x, g0x, g1x, g2x); + subexpressions(y0, y1, y2, f1y, f2y, f3y, g0y, g1y, g2y); + subexpressions(z0, z1, z2, f1z, f2z, f3z, g0z, g1z, g2z); + + // update integrals + intg[0] += d0*f1x; + intg[1] += d0*f2x; intg[2] += d1*f2y; intg[3] += d2*f2z; + intg[4] += d0*f3x; intg[5] += d1*f3y; intg[6] += d2*f3z; + intg[7] += d0*(y0*g0x + y1*g1x + y2*g2x); + intg[8] += d1*(z0*g0y + z1*g1y + z2*g2y); + intg[9] += d2*(x0*g0z + x1*g1z + x2*g2z); + + } + } + + for (PxU32 i = 0; i < 10; i++) + { + intg[i] *= mult[i]; + } + + ir.mass = mMass = intg[0]; + // center of mass + ir.COM.x = PxReal(intg[1]/mMass); + ir.COM.y = PxReal(intg[2]/mMass); + ir.COM.z = PxReal(intg[3]/mMass); + + // inertia tensor relative to the provided origin parameter + ir.inertiaTensor[0][0] = intg[5]+intg[6]; + ir.inertiaTensor[1][1] = intg[4]+intg[6]; + ir.inertiaTensor[2][2] = intg[4]+intg[5]; + ir.inertiaTensor[0][1] = ir.inertiaTensor[1][0] = -intg[7]; + ir.inertiaTensor[1][2] = ir.inertiaTensor[2][1] = -intg[8]; + ir.inertiaTensor[0][2] = ir.inertiaTensor[2][0] = -intg[9]; + + // inertia tensor relative to center of mass + ir.COMInertiaTensor[0][0] = ir.inertiaTensor[0][0] -mMass*PxF64((ir.COM.y*ir.COM.y+ir.COM.z*ir.COM.z)); + ir.COMInertiaTensor[1][1] = ir.inertiaTensor[1][1] -mMass*PxF64((ir.COM.z*ir.COM.z+ir.COM.x*ir.COM.x)); + ir.COMInertiaTensor[2][2] = ir.inertiaTensor[2][2] -mMass*PxF64((ir.COM.x*ir.COM.x+ir.COM.y*ir.COM.y)); + ir.COMInertiaTensor[0][1] = ir.COMInertiaTensor[1][0] = (ir.inertiaTensor[0][1] +mMass*PxF64(ir.COM.x*ir.COM.y)); + ir.COMInertiaTensor[1][2] = ir.COMInertiaTensor[2][1] = (ir.inertiaTensor[1][2] +mMass*PxF64(ir.COM.y*ir.COM.z)); + ir.COMInertiaTensor[0][2] = ir.COMInertiaTensor[2][0] = (ir.inertiaTensor[0][2] +mMass*PxF64(ir.COM.z*ir.COM.x)); + + // inertia tensor relative to (0,0,0) + if (!origin.isZero()) + { + PxVec3 sum = ir.COM + origin; + ir.inertiaTensor[0][0] -= mMass*PxF64((ir.COM.y*ir.COM.y+ir.COM.z*ir.COM.z) - (sum.y*sum.y+sum.z*sum.z)); + ir.inertiaTensor[1][1] -= mMass*PxF64((ir.COM.z*ir.COM.z+ir.COM.x*ir.COM.x) - (sum.z*sum.z+sum.x*sum.x)); + ir.inertiaTensor[2][2] -= mMass*PxF64((ir.COM.x*ir.COM.x+ir.COM.y*ir.COM.y) - (sum.x*sum.x+sum.y*sum.y)); + ir.inertiaTensor[0][1] = ir.inertiaTensor[1][0] = ir.inertiaTensor[0][1] + mMass*PxF64((ir.COM.x*ir.COM.y) - (sum.x*sum.y)); + ir.inertiaTensor[1][2] = ir.inertiaTensor[2][1] = ir.inertiaTensor[1][2] + mMass*PxF64((ir.COM.y*ir.COM.z) - (sum.y*sum.z)); + ir.inertiaTensor[0][2] = ir.inertiaTensor[2][0] = ir.inertiaTensor[0][2] + mMass*PxF64((ir.COM.z*ir.COM.x) - (sum.z*sum.x)); + ir.COM = sum; + } + + return true; + } +} // namespace + +// Wrapper +bool computeVolumeIntegrals(const PxSimpleTriangleMesh& mesh, PxReal density, PxIntegrals& integrals) +{ + VolumeIntegrator v(mesh, PxF64(density)); + return v.computeVolumeIntegrals(integrals); +} + +// Wrapper +bool computeVolumeIntegralsEberly(const PxConvexMeshDesc& mesh, PxReal density, PxIntegrals& integrals, const PxVec3& origin) +{ + VolumeIntegratorEberly v(mesh, PxF64(density)); + v.computeVolumeIntegrals(integrals, origin); + return true; +} + +// Wrapper +bool computeVolumeIntegralsEberlySIMD(const PxConvexMeshDesc& mesh, PxReal density, PxIntegrals& integrals, const PxVec3& origin) +{ + VolumeIntegratorEberly v(mesh, PxF64(density)); + v.computeVolumeIntegralsSIMD(integrals, origin); + return true; +} + +} + +//#endif diff --git a/PhysX_3.4/Source/PhysXCooking/src/convex/VolumeIntegration.h b/PhysX_3.4/Source/PhysXCooking/src/convex/VolumeIntegration.h new file mode 100644 index 00000000..559dc2f9 --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/convex/VolumeIntegration.h @@ -0,0 +1,102 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + + +#ifndef PX_FOUNDATION_NXVOLUMEINTEGRATION +#define PX_FOUNDATION_NXVOLUMEINTEGRATION +/** \addtogroup foundation + @{ +*/ + + +#include "foundation/Px.h" +#include "foundation/PxVec3.h" +#include "foundation/PxMat33.h" +#include "CmPhysXCommon.h" + +namespace physx +{ + +class PxSimpleTriangleMesh; +class PxConvexMeshDesc; + +/** +\brief Data structure used to store mass properties. +*/ +struct PxIntegrals + { + PxVec3 COM; //!< Center of mass + PxF64 mass; //!< Total mass + PxF64 inertiaTensor[3][3]; //!< Inertia tensor (mass matrix) relative to the origin + PxF64 COMInertiaTensor[3][3]; //!< Inertia tensor (mass matrix) relative to the COM + + /** + \brief Retrieve the inertia tensor relative to the center of mass. + + \param inertia Inertia tensor. + */ + void getInertia(PxMat33& inertia) + { + for(PxU32 j=0;j<3;j++) + { + for(PxU32 i=0;i<3;i++) + { + inertia(i,j) = PxF32(COMInertiaTensor[i][j]); + } + } + } + + /** + \brief Retrieve the inertia tensor relative to the origin. + + \param inertia Inertia tensor. + */ + void getOriginInertia(PxMat33& inertia) + { + for(PxU32 j=0;j<3;j++) + { + for(PxU32 i=0;i<3;i++) + { + inertia(i,j) = PxF32(inertiaTensor[i][j]); + } + } + } + }; + + bool computeVolumeIntegrals(const PxSimpleTriangleMesh& mesh, PxReal density, PxIntegrals& integrals); + + // specialized method taking polygons directly, so we don't need to compute and store triangles for each polygon + bool computeVolumeIntegralsEberly(const PxConvexMeshDesc& mesh, PxReal density, PxIntegrals& integrals, const PxVec3& origin); // Eberly simplified method + + // specialized method taking polygons directly, so we don't need to compute and store triangles for each polygon, SIMD version + bool computeVolumeIntegralsEberlySIMD(const PxConvexMeshDesc& mesh, PxReal density, PxIntegrals& integrals, const PxVec3& origin); // Eberly simplified method +} + + /** @} */ +#endif diff --git a/PhysX_3.4/Source/PhysXCooking/src/mesh/GrbTriangleMeshCooking.cpp b/PhysX_3.4/Source/PhysXCooking/src/mesh/GrbTriangleMeshCooking.cpp new file mode 100644 index 00000000..974e1faa --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/mesh/GrbTriangleMeshCooking.cpp @@ -0,0 +1,29 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + diff --git a/PhysX_3.4/Source/PhysXCooking/src/mesh/GrbTriangleMeshCooking.h b/PhysX_3.4/Source/PhysXCooking/src/mesh/GrbTriangleMeshCooking.h new file mode 100644 index 00000000..a41889ed --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/mesh/GrbTriangleMeshCooking.h @@ -0,0 +1,337 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + + +#ifndef PX_COLLISION_GRBTRIANGLEMESHCOOKING +#define PX_COLLISION_GRBTRIANGLEMESHCOOKING + +#include "GuMeshData.h" +#include "cooking/PxCooking.h" + +namespace physx +{ + namespace Gu + { + + } + +// TODO avoroshilov: remove duplicate definitions +static const PxU32 BOUNDARY = 0xffffffff; +static const PxU32 NONCONVEX_FLAG = 0x80000000; + +struct EdgeTriLookup +{ + PxU32 edgeId0, edgeId1; + PxU32 triId; + + bool operator < (const EdgeTriLookup& edge1) const + { + return edgeId0 < edge1.edgeId0 || (edgeId0 == edge1.edgeId0 && edgeId1 < edge1.edgeId1); + } + + bool operator <=(const EdgeTriLookup& edge1) const + { + return edgeId0 < edge1.edgeId0 || (edgeId0 == edge1.edgeId0 && edgeId1 <= edge1.edgeId1); + } +}; + + +static PxU32 binarySearch(const EdgeTriLookup* __restrict data, const PxU32 numElements, const EdgeTriLookup& value) +{ + PxU32 left = 0; + PxU32 right = numElements; + + while ((right - left) > 1) + { + PxU32 pos = (left + right) / 2; + const EdgeTriLookup& element = data[pos]; + if (element <= value) + { + left = pos; + } + else + { + right = pos; + } + } + + return left; +} + +// slightly different behavior from collide2: boundary edges are filtered out + +static PxU32 findAdjacent(const PxVec3* triVertices, const PxVec3* triNormals, const uint3* triIndices, + PxU32 nbTris, PxU32 i0, PxU32 i1, const PxPlane& plane, + EdgeTriLookup* triLookups, PxU32 triangleIndex) +{ + PxU32 result = BOUNDARY; + PxReal bestCos = -FLT_MAX; + + EdgeTriLookup lookup; + lookup.edgeId0 = PxMin(i0, i1); + lookup.edgeId1 = PxMax(i0, i1); + + PxU32 startIndex = binarySearch(triLookups, nbTris * 3, lookup); + + for (PxU32 a = startIndex; a > 0; --a) + { + if (triLookups[a - 1].edgeId0 == lookup.edgeId0 && triLookups[a - 1].edgeId1 == lookup.edgeId1) + startIndex = a - 1; + else + break; + } + + for (PxU32 a = startIndex; a < nbTris * 3; ++a) + { + EdgeTriLookup& edgeTri = triLookups[a]; + + if (edgeTri.edgeId0 != lookup.edgeId0 || edgeTri.edgeId1 != lookup.edgeId1) + break; + + if (edgeTri.triId == triangleIndex) + continue; + + const uint3& triIdx = triIndices[edgeTri.triId]; + PxU32 vIdx0 = triIdx.x; + PxU32 vIdx1 = triIdx.y; + PxU32 vIdx2 = triIdx.z; + + PxU32 other = vIdx0 + vIdx1 + vIdx2 - (i0 + i1); + + if (plane.distance(triVertices[other]) >= 0) + return NONCONVEX_FLAG | edgeTri.triId; + + PxReal c = plane.n.dot(triNormals[edgeTri.triId]); + if (c>bestCos) + { + bestCos = c; + result = edgeTri.triId; + } + + } + + return result; +} + + +static void buildAdjacencies(uint4* triAdjacencies, PxVec3* tempNormalsPerTri_prealloc, const PxVec3* triVertices, const uint3* triIndices, PxU32 nbTris) +{ + //PxVec3 * triNormals = new PxVec3[nbTris]; + + EdgeTriLookup* edgeLookups = reinterpret_cast<EdgeTriLookup*>(PX_ALLOC(sizeof(EdgeTriLookup) * nbTris * 3, PX_DEBUG_EXP("edgeLookups"))); + + + for (PxU32 i = 0; i < nbTris; i++) + { + const uint3& triIdx = triIndices[i]; + PxU32 vIdx0 = triIdx.x; + PxU32 vIdx1 = triIdx.y; + PxU32 vIdx2 = triIdx.z; + + tempNormalsPerTri_prealloc[i] = (triVertices[vIdx1] - triVertices[vIdx0]).cross(triVertices[vIdx2] - triVertices[vIdx0]).getNormalized(); + + edgeLookups[i * 3].edgeId0 = PxMin(vIdx0, vIdx1); + edgeLookups[i * 3].edgeId1 = PxMax(vIdx0, vIdx1); + edgeLookups[i * 3].triId = i; + + edgeLookups[i * 3 + 1].edgeId0 = PxMin(vIdx1, vIdx2); + edgeLookups[i * 3 + 1].edgeId1 = PxMax(vIdx1, vIdx2); + edgeLookups[i * 3 + 1].triId = i; + + edgeLookups[i * 3 + 2].edgeId0 = PxMin(vIdx0, vIdx2); + edgeLookups[i * 3 + 2].edgeId1 = PxMax(vIdx0, vIdx2); + edgeLookups[i * 3 + 2].triId = i; + } + + Ps::sort<EdgeTriLookup>(edgeLookups, PxU32(nbTris * 3)); + + for (PxU32 i = 0; i < nbTris; i++) + { + const uint3& triIdx = triIndices[i]; + PxU32 vIdx0 = triIdx.x; + PxU32 vIdx1 = triIdx.y; + PxU32 vIdx2 = triIdx.z; + + PxPlane triPlane(triVertices[vIdx0], tempNormalsPerTri_prealloc[i]); + uint4 triAdjIdx; + + triAdjIdx.x = findAdjacent(triVertices, tempNormalsPerTri_prealloc, triIndices, nbTris, vIdx0, vIdx1, triPlane, edgeLookups, i); + triAdjIdx.y = findAdjacent(triVertices, tempNormalsPerTri_prealloc, triIndices, nbTris, vIdx1, vIdx2, triPlane, edgeLookups, i); + triAdjIdx.z = findAdjacent(triVertices, tempNormalsPerTri_prealloc, triIndices, nbTris, vIdx2, vIdx0, triPlane, edgeLookups, i); + triAdjIdx.w = 0; + + triAdjacencies[i] = triAdjIdx; + } + + + PX_FREE(edgeLookups); +} + +static bool isEdgeNonconvex(PxU32 adjEdgeIndex) +{ + return (adjEdgeIndex != BOUNDARY) && (adjEdgeIndex & NONCONVEX_FLAG); +} + +PX_INLINE void buildVertexConnection_p1(PxU32 * vertValency, PxU32 * vertNeighborStart, PxU32 & tempNumAdjVertices, const float4 * /*triVertices*/, const uint4 * triIndices, const uint4 * triAdjacencies, PxU32 nbVerts, PxU32 nbTris) +{ + tempNumAdjVertices = 0; + memset(vertValency, 0, nbVerts*sizeof(PxU32)); + + // Calculate max num of adjVerts + for (PxU32 i = 0; i < nbTris; i++) + { + uint4 triIdx = triIndices[i]; + PxU32 vi0 = triIdx.x; + PxU32 vi1 = triIdx.y; + PxU32 vi2 = triIdx.z; + + uint4 triAdjIdx = triAdjacencies[i]; + + PxU32 totalVertsAdded = 0; + if (!isEdgeNonconvex(triAdjIdx.x)) + { + ++vertValency[vi0]; + ++vertValency[vi1]; + totalVertsAdded += 2; + } + if (!isEdgeNonconvex(triAdjIdx.y)) + { + ++vertValency[vi1]; + ++vertValency[vi2]; + totalVertsAdded += 2; + } + if (!isEdgeNonconvex(triAdjIdx.z)) + { + ++vertValency[vi2]; + ++vertValency[vi0]; + totalVertsAdded += 2; + } + tempNumAdjVertices += totalVertsAdded; + } + PxU32 offset = 0; + for (PxU32 i = 0; i < nbVerts; i++) + { + vertNeighborStart[i] = offset; + offset += vertValency[i]; + } + + memset(vertValency, 0, nbVerts*sizeof(PxU32)); +} + +PX_INLINE PxU32 buildVertexConnection_p2(PxU32 * vertValency, PxU32 * vertNeighborStart, PxU32 * vertNeighboringPairs_prealloc, PxU32 tempNumAdjVertices, const float4 * /*triVertices*/, const uint4 * triIndices, const uint4 * triAdjacencies, PxU32 /*nbVerts*/, PxU32 nbTris) +{ + memset(vertNeighboringPairs_prealloc, 0xff, tempNumAdjVertices*2*sizeof(PxU32)); + + PxU32 newAdjVertsNum = 0; + for (PxU32 i = 0; i < nbTris; i++) + { + uint4 triIdx = triIndices[i]; + PxU32 vi[3] = + { + triIdx.x, + triIdx.y, + triIdx.z + }; + uint4 triAdjIdx = triAdjacencies[i]; + PxU32 ta[3] = + { + triAdjIdx.x, + triAdjIdx.y, + triAdjIdx.z + }; + + for (int tvi = 0; tvi < 3; ++tvi) + { + PxU32 curIdx = vi[tvi]; + PxU32 nextIdx = vi[(tvi+1)%3]; + if (!isEdgeNonconvex(ta[tvi])) + { + bool matchFound = false; + for (PxU32 valIdx = vertNeighborStart[curIdx], valIdxEnd = vertNeighborStart[curIdx] + vertValency[curIdx]; valIdx < valIdxEnd; ++valIdx) + { + if (vertNeighboringPairs_prealloc[valIdx*2+1] == nextIdx) + { + matchFound = true; + break; + } + } + + if (!matchFound) + { + PxU32 curPairIdx; + + curPairIdx = vertNeighborStart[curIdx] + vertValency[curIdx]; + vertNeighboringPairs_prealloc[curPairIdx*2+0] = curIdx; + vertNeighboringPairs_prealloc[curPairIdx*2+1] = nextIdx; + ++vertValency[curIdx]; + + curPairIdx = vertNeighborStart[nextIdx] + vertValency[nextIdx]; + vertNeighboringPairs_prealloc[curPairIdx*2+0] = nextIdx; + vertNeighboringPairs_prealloc[curPairIdx*2+1] = curIdx; + ++vertValency[nextIdx]; + + newAdjVertsNum += 2; + } + } + } + } + + return newAdjVertsNum; +} + +PX_INLINE void buildVertexConnection_p3(PxU32 * vertNeighbors, PxU32 * /*vertValency*/, PxU32 * vertNeighborStart, PxU32 * vertNeighboringPairs_prealloc, PxU32 tempNumAdjVertices, PxU32 newNumAdjVertices, const float4 * /*triVertices*/, const uint4 * /*triIndices*/, const uint4 * /*triAdjacencies*/, PxU32 /*nbVerts*/, PxU32 /*nbTris*/) +{ + PX_UNUSED(newNumAdjVertices); + PxU32 prevVertex = 0xFFffFFff; + PxU32 writingIndex = 0; + for (PxU32 i = 0; i < tempNumAdjVertices; ++i) + { + PxU32 curPairIdx0 = vertNeighboringPairs_prealloc[i*2+0]; + if (curPairIdx0 == 0xFFffFFff) + { + continue; + } + + PxU32 curPairIdx1 = vertNeighboringPairs_prealloc[i*2+1]; + vertNeighbors[writingIndex] = curPairIdx1; + if (curPairIdx0 != prevVertex) + { + vertNeighborStart[curPairIdx0] = writingIndex; + } + prevVertex = curPairIdx0; + + ++writingIndex; + } + + PX_ASSERT(writingIndex == newNumAdjVertices); +} + +} // namespace physx + +#endif diff --git a/PhysX_3.4/Source/PhysXCooking/src/mesh/HeightFieldCooking.cpp b/PhysX_3.4/Source/PhysXCooking/src/mesh/HeightFieldCooking.cpp new file mode 100644 index 00000000..7215b1c7 --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/mesh/HeightFieldCooking.cpp @@ -0,0 +1,84 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + +#include "foundation/PxIO.h" +#include "GuHeightField.h" +#include "GuSerialize.h" + +using namespace physx; +using namespace Gu; + +namespace physx +{ + +bool saveHeightField(const HeightField& hf, PxOutputStream& stream, bool endian) +{ + // write header + if(!writeHeader('H', 'F', 'H', 'F', PX_HEIGHTFIELD_VERSION, endian, stream)) + return false; + + const Gu::HeightFieldData& hfData = hf.getData(); + + // write mData members + writeDword(hfData.rows, endian, stream); + writeDword(hfData.columns, endian, stream); + writeFloat(hfData.rowLimit, endian, stream); + writeFloat(hfData.colLimit, endian, stream); + writeFloat(hfData.nbColumns, endian, stream); + writeFloat(hfData.thickness, endian, stream); + writeFloat(hfData.convexEdgeThreshold, endian, stream); + writeWord(hfData.flags, endian, stream); + writeDword(hfData.format, endian, stream); + + writeFloat(hfData.mAABB.getMin(0), endian, stream); + writeFloat(hfData.mAABB.getMin(1), endian, stream); + writeFloat(hfData.mAABB.getMin(2), endian, stream); + writeFloat(hfData.mAABB.getMax(0), endian, stream); + writeFloat(hfData.mAABB.getMax(1), endian, stream); + writeFloat(hfData.mAABB.getMax(2), endian, stream); + + // write this-> members + writeDword(hf.mSampleStride, endian, stream); + writeDword(hf.mNbSamples, endian, stream); + writeFloat(hf.mMinHeight, endian, stream); + writeFloat(hf.mMaxHeight, endian, stream); + + // write samples + for(PxU32 i = 0; i < hf.mNbSamples; i++) + { + const PxHeightFieldSample& s = hfData.samples[i]; + writeWord(PxU16(s.height), endian, stream); + stream.write(&s.materialIndex0, sizeof(s.materialIndex0)); + stream.write(&s.materialIndex1, sizeof(s.materialIndex1)); + } + + return true; +} + +} diff --git a/PhysX_3.4/Source/PhysXCooking/src/mesh/HeightFieldCooking.h b/PhysX_3.4/Source/PhysXCooking/src/mesh/HeightFieldCooking.h new file mode 100644 index 00000000..9e1e2ce4 --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/mesh/HeightFieldCooking.h @@ -0,0 +1,35 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + +#include "GuHeightField.h" + +namespace physx +{ + bool saveHeightField(const Gu::HeightField& hf, PxOutputStream& stream, bool endianSwap); +} diff --git a/PhysX_3.4/Source/PhysXCooking/src/mesh/QuickSelect.h b/PhysX_3.4/Source/PhysXCooking/src/mesh/QuickSelect.h new file mode 100644 index 00000000..7dddd554 --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/mesh/QuickSelect.h @@ -0,0 +1,114 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + +#ifndef QUICKSELECT_H +#define QUICKSELECT_H + +#include "foundation/PxSimpleTypes.h" + +// Google "wikipedia QuickSelect" for algorithm explanation +namespace physx { namespace quickSelect { + + + #define SWAP32(x, y) { PxU32 tmp = y; y = x; x = tmp; } + + // left is the index of the leftmost element of the subarray + // right is the index of the rightmost element of the subarray (inclusive) + // number of elements in subarray = right-left+1 + template<typename LtEq> + PxU32 partition(PxU32* PX_RESTRICT a, PxU32 left, PxU32 right, PxU32 pivotIndex, const LtEq& cmpLtEq) + { + PX_ASSERT(pivotIndex >= left && pivotIndex <= right); + PxU32 pivotValue = a[pivotIndex]; + SWAP32(a[pivotIndex], a[right]) // Move pivot to end + PxU32 storeIndex = left; + for (PxU32 i = left; i < right; i++) // left <= i < right + if (cmpLtEq(a[i], pivotValue)) + { + SWAP32(a[i], a[storeIndex]); + storeIndex++; + } + SWAP32(a[storeIndex], a[right]); // Move pivot to its final place + for (PxU32 i = left; i < storeIndex; i++) + PX_ASSERT(cmpLtEq(a[i], a[storeIndex])); + for (PxU32 i = storeIndex+1; i <= right; i++) + PX_ASSERT(cmpLtEq(a[storeIndex], a[i])); + return storeIndex; + } + + // left is the index of the leftmost element of the subarray + // right is the index of the rightmost element of the subarray (inclusive) + // number of elements in subarray = right-left+1 + // recursive version + template<typename LtEq> + void quickFindFirstK(PxU32* PX_RESTRICT a, PxU32 left, PxU32 right, PxU32 k, const LtEq& cmpLtEq) + { + PX_ASSERT(k <= right-left+1); + if (right > left) + { + // select pivotIndex between left and right + PxU32 pivotIndex = (left + right) >> 1; + PxU32 pivotNewIndex = partition(a, left, right, pivotIndex, cmpLtEq); + // now all elements to the left of pivotNewIndex are < old value of a[pivotIndex] (bottom half values) + if (pivotNewIndex > left + k) // new condition + quickFindFirstK(a, left, pivotNewIndex-1, k, cmpLtEq); + if (pivotNewIndex < left + k) + quickFindFirstK(a, pivotNewIndex+1, right, k+left-pivotNewIndex-1, cmpLtEq); + } + } + + // non-recursive version + template<typename LtEq> + void quickSelectFirstK(PxU32* PX_RESTRICT a, PxU32 left, PxU32 right, PxU32 k, const LtEq& cmpLtEq) + { + PX_ASSERT(k <= right-left+1); + for (;;) + { + PxU32 pivotIndex = (left+right) >> 1; + PxU32 pivotNewIndex = partition(a, left, right, pivotIndex, cmpLtEq); + PxU32 pivotDist = pivotNewIndex - left + 1; + if (pivotDist == k) + return; + else if (k < pivotDist) + { + PX_ASSERT(pivotNewIndex > 0); + right = pivotNewIndex - 1; + } + else + { + k = k - pivotDist; + left = pivotNewIndex+1; + } + } + } + +} } // namespace quickSelect, physx + +#endif + diff --git a/PhysX_3.4/Source/PhysXCooking/src/mesh/RTreeCooking.cpp b/PhysX_3.4/Source/PhysXCooking/src/mesh/RTreeCooking.cpp new file mode 100644 index 00000000..08ab1a1b --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/mesh/RTreeCooking.cpp @@ -0,0 +1,893 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + +#include "foundation/PxBounds3.h" +#include "CmPhysXCommon.h" +#include "RTreeCooking.h" +#include "PsSort.h" +#include "PsMathUtils.h" +#include "PsAllocator.h" +#include "PsVecMath.h" +#include "PxTolerancesScale.h" +#include "QuickSelect.h" +#include "PsInlineArray.h" +#include "GuRTree.h" + +#define PRINT_RTREE_COOKING_STATS 0 // AP: keeping this frequently used macro for diagnostics/benchmarking + +#if PRINT_RTREE_COOKING_STATS +#include <stdio.h> +#endif + +using namespace physx::Gu; +using namespace physx::shdfnd; +using namespace physx::shdfnd::aos; + +namespace physx +{ + +// Intermediate non-quantized representation for RTree node in a page (final format is SIMD transposed page) +struct RTreeNodeNQ +{ + PxBounds3 bounds; + PxI32 childPageFirstNodeIndex; // relative to the beginning of all build tree nodes array + PxI32 leafCount; // -1 for empty nodes, 0 for non-terminal nodes, number of enclosed tris if non-zero (LeafTriangles), also means a terminal node + + struct U {}; // selector struct for uninitialized constructor + RTreeNodeNQ(U) {} // uninitialized constructor + RTreeNodeNQ() : bounds(PxBounds3::empty()), childPageFirstNodeIndex(-1), leafCount(0) {} +}; + +// SIMD version of bounds class +struct PxBounds3V +{ + struct U {}; // selector struct for uninitialized constructor + Vec3V mn, mx; + PxBounds3V(Vec3VArg mn_, Vec3VArg mx_) : mn(mn_), mx(mx_) {} + PxBounds3V(U) {} // uninitialized constructor + + PX_FORCE_INLINE Vec3V getExtents() const { return V3Sub(mx, mn); } + PX_FORCE_INLINE void include(const PxBounds3V& other) { mn = V3Min(mn, other.mn); mx = V3Max(mx, other.mx); } + + // convert vector extents to PxVec3 + PX_FORCE_INLINE const PxVec3 getMinVec3() const { PxVec3 ret; V3StoreU(mn, ret); return ret; } + PX_FORCE_INLINE const PxVec3 getMaxVec3() const { PxVec3 ret; V3StoreU(mx, ret); return ret; } +}; + +static void buildFromBounds( + Gu::RTree& resultTree, const PxBounds3V* allBounds, PxU32 numBounds, + Array<PxU32>& resultPermute, RTreeCooker::RemapCallback* rc, Vec3VArg allMn, Vec3VArg allMx, + PxReal sizePerfTradeOff, PxMeshCookingHint::Enum hint); + +///////////////////////////////////////////////////////////////////////// +void RTreeCooker::buildFromTriangles( + Gu::RTree& result, const PxVec3* verts, PxU32 numVerts, const PxU16* tris16, const PxU32* tris32, PxU32 numTris, + Array<PxU32>& resultPermute, RTreeCooker::RemapCallback* rc, PxReal sizePerfTradeOff01, PxMeshCookingHint::Enum hint) +{ + PX_UNUSED(numVerts); + Array<PxBounds3V> allBounds; + allBounds.reserve(numTris); + Vec3V allMn = Vec3V_From_FloatV(FMax()), allMx = Vec3V_From_FloatV(FNegMax()); + Vec3V eps = V3Splat(FLoad(5e-4f)); // AP scaffold: use PxTolerancesScale here? + + // build RTree AABB bounds from triangles, conservative bound inflation is also performed here + for(PxU32 i = 0; i < numTris; i ++) + { + PxU32 i0, i1, i2; + PxU32 i3 = i*3; + if(tris16) + { + i0 = tris16[i3]; i1 = tris16[i3+1]; i2 = tris16[i3+2]; + } else + { + i0 = tris32[i3]; i1 = tris32[i3+1]; i2 = tris32[i3+2]; + } + PX_ASSERT_WITH_MESSAGE(i0 < numVerts && i1 < numVerts && i2 < numVerts ,"Input mesh triangle's vertex index exceeds specified numVerts."); + Vec3V v0 = V3LoadU(verts[i0]), v1 = V3LoadU(verts[i1]), v2 = V3LoadU(verts[i2]); + Vec3V mn = V3Sub(V3Min(V3Min(v0, v1), v2), eps); // min over 3 verts, subtract eps to inflate + Vec3V mx = V3Add(V3Max(V3Max(v0, v1), v2), eps); // max over 3 verts, add eps to inflate + allMn = V3Min(allMn, mn); allMx = V3Max(allMx, mx); + allBounds.pushBack(PxBounds3V(mn, mx)); + } + + buildFromBounds(result, allBounds.begin(), numTris, resultPermute, rc, allMn, allMx, sizePerfTradeOff01, hint); +} + +///////////////////////////////////////////////////////////////////////// +// Fast but lower quality 4-way split sorting using repeated application of quickselect + +// comparator template struct for sortin gbounds centers given a coordinate index (x,y,z=0,1,2) +struct BoundsLTE +{ + PxU32 coordIndex; + const PxVec3* PX_RESTRICT boundCenters; // AP: precomputed centers are faster than recomputing the centers + BoundsLTE(PxU32 coordIndex_, const PxVec3* boundCenters_) + : coordIndex(coordIndex_), boundCenters(boundCenters_) + {} + + PX_FORCE_INLINE bool operator()(const PxU32 & idx1, const PxU32 & idx2) const + { + PxF32 center1 = boundCenters[idx1][coordIndex]; + PxF32 center2 = boundCenters[idx2][coordIndex]; + return (center1 <= center2); + } +}; + +// ====================================================================== +// Quick sorting method +// recursive sorting procedure: +// 1. find min and max extent along each axis for the current cluster +// 2. split input cluster into two 3 times using quickselect, splitting off a quarter of the initial cluster size each time +// 3. the axis is potentialy different for each split using the following +// approximate splitting heuristic - reduce max length by some estimated factor to encourage split along other axis +// since we cut off between a quarter to a half of elements in this direction per split +// the reduction for first split should be *0.75f but we use 0.8 +// to account for some node overlap. This is somewhat of an arbitrary choice and there's room for improvement. +// 4. recurse on new clusters (goto step 1) +// +struct SubSortQuick +{ + static const PxReal reductionFactors[RTREE_N-1]; + + enum { NTRADEOFF = 9 }; + static const PxU32 stopAtTrisPerLeaf1[NTRADEOFF]; // presets for PxCookingParams::meshSizePerformanceTradeoff implementation + + const PxU32* permuteEnd; + const PxU32* permuteStart; + const PxBounds3V* allBounds; + Array<PxVec3> boundCenters; + PxU32 maxBoundsPerLeafPage; + + // initialize the context for the sorting routine + SubSortQuick(PxU32* permute, const PxBounds3V* allBounds_, PxU32 allBoundsSize, PxReal sizePerfTradeOff01) + : allBounds(allBounds_) + { + permuteEnd = permute + allBoundsSize; + permuteStart = permute; + PxU32 boundsCount = allBoundsSize; + boundCenters.reserve(boundsCount); // AP - measured that precomputing centers helps with perf significantly (~20% on 1k verts) + for(PxU32 i = 0; i < boundsCount; i++) + boundCenters.pushBack( allBounds[i].getMinVec3() + allBounds[i].getMaxVec3() ); + PxU32 iTradeOff = PxMin<PxU32>( PxU32(PxMax<PxReal>(0.0f, sizePerfTradeOff01)*NTRADEOFF), NTRADEOFF-1 ); + maxBoundsPerLeafPage = stopAtTrisPerLeaf1[iTradeOff]; + } + + // implements the sorting/splitting procedure + void sort4( + PxU32* PX_RESTRICT permute, const PxU32 clusterSize, // beginning and size of current recursively processed cluster + Array<RTreeNodeNQ>& resultTree, PxU32& maxLevels, + PxBounds3V& subTreeBound, PxU32 level = 0) + { + if(level == 0) + maxLevels = 1; + else + maxLevels = PxMax(maxLevels, level+1); + + PX_ASSERT(permute + clusterSize <= permuteEnd); + PX_ASSERT(maxBoundsPerLeafPage >= RTREE_N-1); + + const PxU32 cluster4 = PxMax<PxU32>(clusterSize/RTREE_N, 1); + + PX_ASSERT(clusterSize > 0); + // find min and max world bound for current cluster + Vec3V mx = allBounds[permute[0]].mx, mn = allBounds[permute[0]].mn; PX_ASSERT(permute[0] < boundCenters.size()); + for(PxU32 i = 1; i < clusterSize; i ++) + { + PX_ASSERT(permute[i] < boundCenters.size()); + mx = V3Max(mx, allBounds[permute[i]].mx); + mn = V3Min(mn, allBounds[permute[i]].mn); + } + PX_ALIGN_PREFIX(16) PxReal maxElem[4] PX_ALIGN_SUFFIX(16); + V3StoreA(V3Sub(mx, mn), *reinterpret_cast<PxVec3*>(maxElem)); // compute the dimensions and store into a scalar maxElem array + + // split along the longest axis + const PxU32 maxDiagElement = PxU32(maxElem[0] > maxElem[1] && maxElem[0] > maxElem[2] ? 0 : (maxElem[1] > maxElem[2] ? 1 : 2)); + BoundsLTE cmpLte(maxDiagElement, boundCenters.begin()); + + const PxU32 startNodeIndex = resultTree.size(); + resultTree.resizeUninitialized(startNodeIndex+RTREE_N); // at each recursion level we add 4 nodes to the tree + + PxBounds3V childBound( (PxBounds3V::U()) ); // start off uninitialized for performance + const PxI32 leftover = PxMax<PxI32>(PxI32(clusterSize - cluster4*(RTREE_N-1)), 0); + PxU32 totalCount = 0; + for(PxU32 i = 0; i < RTREE_N; i++) + { + // split off cluster4 count nodes out of the entire cluster for each i + const PxU32 clusterOffset = cluster4*i; + PxU32 count1; // cluster4 or leftover depending on whether it's the last cluster + if(i < RTREE_N-1) + { + // only need to so quickSelect for the first pagesize-1 clusters + if(clusterOffset <= clusterSize-1) + { + quickSelect::quickSelectFirstK(permute, clusterOffset, clusterSize-1, cluster4, cmpLte); + // approximate heuristic - reduce max length by some estimated factor to encourage split along other axis + // since we cut off a quarter of elements in this direction the reduction should be *0.75f but we use 0.8 + // to account for some node overlap. This is somewhat of an arbitrary choice though + maxElem[cmpLte.coordIndex] *= reductionFactors[i]; + // recompute cmpLte.coordIndex from updated maxElements + cmpLte.coordIndex = PxU32(maxElem[0] > maxElem[1] && maxElem[0] > maxElem[2] ? 0 : (maxElem[1] > maxElem[2] ? 1 : 2)); + } + count1 = cluster4; + } else + { + count1 = PxU32(leftover); + // verify that leftover + sum of previous clusters adds up to clusterSize or leftover is 0 + // leftover can be 0 if clusterSize<RTREE_N, this is generally rare, can happen for meshes with < RTREE_N tris + PX_ASSERT(leftover == 0 || cluster4*i + count1 == clusterSize); + } + + RTreeNodeNQ& curNode = resultTree[startNodeIndex+i]; + + totalCount += count1; // accumulate total node count + if(count1 <= maxBoundsPerLeafPage) // terminal page according to specified maxBoundsPerLeafPage + { + if(count1 && totalCount <= clusterSize) + { + // this will be true most of the time except when the total number of triangles in the mesh is < PAGESIZE + curNode.leafCount = PxI32(count1); + curNode.childPageFirstNodeIndex = PxI32(clusterOffset + PxU32(permute-permuteStart)); + childBound = allBounds[permute[clusterOffset+0]]; + for(PxU32 i1 = 1; i1 < count1; i1++) + { + const PxBounds3V& bnd = allBounds[permute[clusterOffset+i1]]; + childBound.include(bnd); + } + } else + { + // since we are required to have PAGESIZE nodes per page for simd, we fill any leftover with empty nodes + // we should only hit this if the total number of triangles in the mesh is < PAGESIZE + childBound.mn = childBound.mx = V3Zero(); // shouldn't be necessary but setting just in case + curNode.bounds.setEmpty(); + curNode.leafCount = -1; + curNode.childPageFirstNodeIndex = -1; // using -1 for empty node + } + } else // not a terminal page, recurse on count1 nodes cluster + { + curNode.childPageFirstNodeIndex = PxI32(resultTree.size()); + curNode.leafCount = 0; + sort4(permute+cluster4*i, count1, resultTree, maxLevels, childBound, level+1); + } + if(i == 0) + subTreeBound = childBound; // initialize subTreeBound with first childBound + else + subTreeBound.include(childBound); // expand subTreeBound with current childBound + + // can use curNode since the reference change due to resizing in recursive call, need to recompute the pointer + RTreeNodeNQ& curNode1 = resultTree[startNodeIndex+i]; + curNode1.bounds.minimum = childBound.getMinVec3(); // update node bounds using recursively computed childBound + curNode1.bounds.maximum = childBound.getMaxVec3(); + } + } +}; + +// heuristic size reduction factors for splitting heuristic (see how it's used above) +const PxReal SubSortQuick::reductionFactors[RTREE_N-1] = {0.8f, 0.7f, 0.6f}; + +// sizePerf trade-off presets for sorting routines +const PxU32 SubSortQuick::stopAtTrisPerLeaf1[SubSortQuick::NTRADEOFF] = {16, 14, 12, 10, 8, 7, 6, 5, 4}; + +///////////////////////////////////////////////////////////////////////// +// SAH sorting method +// +// Preset table: lower index=better size -> higher index = better perf +static const PxU32 NTRADEOFF = 15; + // % -24 -23 -17 -15 -10 -8 -5 -3 0 +3 +3 +5 +7 +8 +9 - % raycast MeshSurface*Random benchmark perf + // K 717 734 752 777 793 811 824 866 903 939 971 1030 1087 1139 1266 - testzone size in K + // # 0 1 2 3 4 5 6 7 8 9 10 11 12 13 14 - preset number +static const PxU32 stopAtTrisPerPage[NTRADEOFF] = { 64, 60, 56, 48, 46, 44, 40, 36, 32, 28, 24, 20, 16, 12, 12}; +static const PxU32 stopAtTrisPerLeaf[NTRADEOFF] = { 16, 14, 12, 10, 9, 8, 8, 6, 5, 5, 5, 4, 4, 4, 2}; // capped at 2 anyway + +///////////////////////////////////////////////////////////////////////// +// comparator struct for sorting the bounds along a specified coordIndex (coordIndex=0,1,2 for X,Y,Z) +struct SortBoundsPredicate +{ + PxU32 coordIndex; + const PxBounds3V* allBounds; + SortBoundsPredicate(PxU32 coordIndex_, const PxBounds3V* allBounds_) : coordIndex(coordIndex_), allBounds(allBounds_) + {} + + bool operator()(const PxU32 & idx1, const PxU32 & idx2) const + { + // using the bounds center for comparison + PxF32 center1 = V3ReadXYZ(allBounds[idx1].mn)[coordIndex] + V3ReadXYZ(allBounds[idx1].mx)[coordIndex]; + PxF32 center2 = V3ReadXYZ(allBounds[idx2].mn)[coordIndex] + V3ReadXYZ(allBounds[idx2].mx)[coordIndex]; + return (center1 < center2); + } +}; + + +///////////////////////////////////////////////////////////////////////// +// auxiliary class for SAH build (SAH = surface area heuristic) +struct Interval +{ + PxU32 start, count; + Interval(PxU32 s, PxU32 c) : start(s), count(c) {} +}; + +// SAH function - returns surface area for given AABB extents +static PX_FORCE_INLINE void PxSAH(const Vec3VArg v, PxF32& sah) +{ + FStore(V3Dot(v, V3PermZXY(v)), &sah); // v.x*v.y + v.y*v.z + v.x*v.z; +} + +struct SubSortSAH +{ + PxU32* PX_RESTRICT permuteStart, *PX_RESTRICT tempPermute; + const PxBounds3V* PX_RESTRICT allBounds; + PxF32* PX_RESTRICT metricL; + PxF32* PX_RESTRICT metricR; + const PxU32* PX_RESTRICT xOrder, *PX_RESTRICT yOrder, *PX_RESTRICT zOrder; + const PxU32* PX_RESTRICT xRanks, *PX_RESTRICT yRanks, *PX_RESTRICT zRanks; + PxU32* PX_RESTRICT tempRanks; + PxU32 nbTotalBounds; + PxU32 iTradeOff; + + // precompute various values used during sort + SubSortSAH( + PxU32* permute, const PxBounds3V* allBounds_, PxU32 numBounds, + const PxU32* xOrder_, const PxU32* yOrder_, const PxU32* zOrder_, + const PxU32* xRanks_, const PxU32* yRanks_, const PxU32* zRanks_, PxReal sizePerfTradeOff01) + : permuteStart(permute), allBounds(allBounds_), + xOrder(xOrder_), yOrder(yOrder_), zOrder(zOrder_), + xRanks(xRanks_), yRanks(yRanks_), zRanks(zRanks_), nbTotalBounds(numBounds) + { + metricL = new PxF32[numBounds]; + metricR = new PxF32[numBounds]; + tempPermute = new PxU32[numBounds*2+1]; + tempRanks = new PxU32[numBounds]; + iTradeOff = PxMin<PxU32>( PxU32(PxMax<PxReal>(0.0f, sizePerfTradeOff01)*NTRADEOFF), NTRADEOFF-1 ); + } + + ~SubSortSAH() // release temporarily used memory + { + delete [] metricL; metricL = NULL; + delete [] metricR; metricR = NULL; + delete [] tempPermute; tempPermute = NULL; + delete [] tempRanks; tempRanks = NULL; + } + + //////////////////////////////////////////////////////////////////// + // returns split position for second array start relative to permute ptr + PxU32 split(PxU32* permute, PxU32 clusterSize) + { + if(clusterSize <= 1) + return 0; + if(clusterSize == 2) + return 1; + + PxI32 minCount = clusterSize >= 4 ? 2 : 1; + PxI32 splitStartL = minCount; // range=[startL->endL) + PxI32 splitEndL = PxI32(clusterSize-minCount); + PxI32 splitStartR = PxI32(clusterSize-splitStartL); // range=(endR<-startR], startR > endR + PxI32 splitEndR = PxI32(clusterSize-splitEndL); + PX_ASSERT(splitEndL-splitStartL == splitStartR-splitEndR); + PX_ASSERT(splitStartL <= splitEndL); + PX_ASSERT(splitStartR >= splitEndR); + PX_ASSERT(splitEndR >= 1); + PX_ASSERT(splitEndL < PxI32(clusterSize)); + + // pick the best axis with some splitting metric + // axis index is X=0, Y=1, Z=2 + PxF32 minMetric[3]; + PxU32 minMetricSplit[3]; + const PxU32* ranks3[3] = { xRanks, yRanks, zRanks }; + const PxU32* orders3[3] = { xOrder, yOrder, zOrder }; + for(PxU32 coordIndex = 0; coordIndex <= 2; coordIndex++) + { + SortBoundsPredicate sortPredicateLR(coordIndex, allBounds); + + const PxU32* rank = ranks3[coordIndex]; + const PxU32* order = orders3[coordIndex]; + + // build ranks in tempPermute + if(clusterSize == nbTotalBounds) // AP: about 4% perf gain from this optimization + { + // if this is a full cluster sort, we already have it done + for(PxU32 i = 0; i < clusterSize; i ++) + tempPermute[i] = order[i]; + } else + { + // sort the tempRanks + for(PxU32 i = 0; i < clusterSize; i ++) + tempRanks[i] = rank[permute[i]]; + Ps::sort(tempRanks, clusterSize); + for(PxU32 i = 0; i < clusterSize; i ++) // convert back from ranks to indices + tempPermute[i] = order[tempRanks[i]]; + } + + // we consider overlapping intervals for minimum sum of metrics + // left interval is from splitStartL up to splitEndL + // right interval is from splitStartR down to splitEndR + + + // first compute the array metricL + Vec3V boundsLmn = allBounds[tempPermute[0]].mn; // init with 0th bound + Vec3V boundsLmx = allBounds[tempPermute[0]].mx; // init with 0th bound + PxI32 ii; + for(ii = 1; ii < splitStartL; ii++) // sweep right to include all bounds up to splitStartL-1 + { + boundsLmn = V3Min(boundsLmn, allBounds[tempPermute[ii]].mn); + boundsLmx = V3Max(boundsLmx, allBounds[tempPermute[ii]].mx); + } + + PxU32 countL0 = 0; + for(ii = splitStartL; ii <= splitEndL; ii++) // compute metric for inclusive bounds from splitStartL to splitEndL + { + boundsLmn = V3Min(boundsLmn, allBounds[tempPermute[ii]].mn); + boundsLmx = V3Max(boundsLmx, allBounds[tempPermute[ii]].mx); + PxSAH(V3Sub(boundsLmx, boundsLmn), metricL[countL0++]); + } + // now we have metricL + + // now compute the array metricR + Vec3V boundsRmn = allBounds[tempPermute[clusterSize-1]].mn; // init with last bound + Vec3V boundsRmx = allBounds[tempPermute[clusterSize-1]].mx; // init with last bound + for(ii = PxI32(clusterSize-2); ii > splitStartR; ii--) // include bounds to the left of splitEndR down to splitStartR + { + boundsRmn = V3Min(boundsRmn, allBounds[tempPermute[ii]].mn); + boundsRmx = V3Max(boundsRmx, allBounds[tempPermute[ii]].mx); + } + + PxU32 countR0 = 0; + for(ii = splitStartR; ii >= splitEndR; ii--) // continue sweeping left, including bounds and recomputing the metric + { + boundsRmn = V3Min(boundsRmn, allBounds[tempPermute[ii]].mn); + boundsRmx = V3Max(boundsRmx, allBounds[tempPermute[ii]].mx); + PxSAH(V3Sub(boundsRmx, boundsRmn), metricR[countR0++]); + } + + PX_ASSERT((countL0 == countR0) && (countL0 == PxU32(splitEndL-splitStartL+1))); + + // now iterate over splitRange and compute the minimum sum of SAHLeft*countLeft + SAHRight*countRight + PxU32 minMetricSplitPosition = 0; + PxF32 minMetricLocal = PX_MAX_REAL; + const PxI32 hsI32 = PxI32(clusterSize/2); + const PxI32 splitRange = (splitEndL-splitStartL+1); + for(ii = 0; ii < splitRange; ii++) + { + PxF32 countL = PxF32(ii+minCount); // need to add minCount since ii iterates over splitRange + PxF32 countR = PxF32(splitRange-ii-1+minCount); + PX_ASSERT(PxU32(countL + countR) == clusterSize); + + const PxF32 metric = (countL*metricL[ii] + countR*metricR[splitRange-ii-1]); + const PxU32 splitPos = PxU32(ii+splitStartL); + if(metric < minMetricLocal || + (metric <= minMetricLocal && // same metric but more even split + PxAbs(PxI32(splitPos)-hsI32) < PxAbs(PxI32(minMetricSplitPosition)-hsI32))) + { + minMetricLocal = metric; + minMetricSplitPosition = splitPos; + } + } + + minMetric[coordIndex] = minMetricLocal; + minMetricSplit[coordIndex] = minMetricSplitPosition; + + // sum of axis lengths for both left and right AABBs + } + + PxU32 winIndex = 2; + if(minMetric[0] <= minMetric[1] && minMetric[0] <= minMetric[2]) + winIndex = 0; + else if(minMetric[1] <= minMetric[2]) + winIndex = 1; + + const PxU32* rank = ranks3[winIndex]; + const PxU32* order = orders3[winIndex]; + if(clusterSize == nbTotalBounds) // AP: about 4% gain from this special case optimization + { + // if this is a full cluster sort, we already have it done + for(PxU32 i = 0; i < clusterSize; i ++) + permute[i] = order[i]; + } else + { + // sort the tempRanks + for(PxU32 i = 0; i < clusterSize; i ++) + tempRanks[i] = rank[permute[i]]; + Ps::sort(tempRanks, clusterSize); + for(PxU32 i = 0; i < clusterSize; i ++) + permute[i] = order[tempRanks[i]]; + } + + PxU32 splitPoint = minMetricSplit[winIndex]; + if(clusterSize == 3 && splitPoint == 0) + splitPoint = 1; // special case due to rounding + return splitPoint; + } + + // compute surface area for a given split + PxF32 computeSA(const PxU32* permute, const Interval& split) // both permute and i are relative + { + PX_ASSERT(split.count >= 1); + Vec3V bmn = allBounds[permute[split.start]].mn; + Vec3V bmx = allBounds[permute[split.start]].mx; + for(PxU32 i = 1; i < split.count; i++) + { + const PxBounds3V& b1 = allBounds[permute[split.start+i]]; + bmn = V3Min(bmn, b1.mn); bmx = V3Max(bmx, b1.mx); + } + + PxF32 ret; PxSAH(V3Sub(bmx, bmn), ret); + return ret; + } + + //////////////////////////////////////////////////////////////////// + // main SAH sort routine + void sort4(PxU32* permute, PxU32 clusterSize, + Array<RTreeNodeNQ>& resultTree, PxU32& maxLevels, PxU32 level = 0, RTreeNodeNQ* parentNode = NULL) + { + PX_UNUSED(parentNode); + + if(level == 0) + maxLevels = 1; + else + maxLevels = PxMax(maxLevels, level+1); + + PxU32 splitPos[RTREE_N]; + for(PxU32 j = 0; j < RTREE_N; j++) + splitPos[j] = j+1; + + if(clusterSize >= RTREE_N) + { + // split into RTREE_N number of regions via RTREE_N-1 subsequent splits + // each split is represented as a current interval + // we iterate over currently active intervals and compute it's surface area + // then we split the interval with maximum surface area + // AP scaffold: possible optimization - seems like computeSA can be cached for unchanged intervals + InlineArray<Interval, 4> splits; + splits.pushBack(Interval(0, clusterSize)); + for(PxU32 iSplit = 0; iSplit < RTREE_N-1; iSplit++) + { + PxF32 maxSAH = -FLT_MAX; + PxU32 maxSplit = 0xFFFFffff; + for(PxU32 i = 0; i < splits.size(); i++) + { + if(splits[i].count == 1) + continue; + PxF32 SAH = computeSA(permute, splits[i])*splits[i].count; + if(SAH > maxSAH) + { + maxSAH = SAH; + maxSplit = i; + } + } + PX_ASSERT(maxSplit != 0xFFFFffff); + + // maxSplit is now the index of the interval in splits array with maximum surface area + // we now split it into 2 using the split() function + Interval old = splits[maxSplit]; + PX_ASSERT(old.count > 1); + PxU32 splitLocal = split(permute+old.start, old.count); // relative split pos + + PX_ASSERT(splitLocal >= 1); + PX_ASSERT(old.count-splitLocal >= 1); + splits.pushBack(Interval(old.start, splitLocal)); + splits.pushBack(Interval(old.start+splitLocal, old.count-splitLocal)); + splits.replaceWithLast(maxSplit); + splitPos[iSplit] = old.start+splitLocal; + } + + // verification code, make sure split counts add up to clusterSize + PX_ASSERT(splits.size() == RTREE_N); + PxU32 sum = 0; + for(PxU32 j = 0; j < RTREE_N; j++) + sum += splits[j].count; + PX_ASSERT(sum == clusterSize); + } + else // clusterSize < RTREE_N + { + // make it so splitCounts based on splitPos add up correctly for small cluster sizes + for(PxU32 i = clusterSize; i < RTREE_N-1; i++) + splitPos[i] = clusterSize; + } + + // sort splitPos index array using quicksort (just a few values) + Ps::sort(splitPos, RTREE_N-1); + splitPos[RTREE_N-1] = clusterSize; // splitCount[n] is computed as splitPos[n+1]-splitPos[n], so we need to add this last value + + // now compute splitStarts and splitCounts from splitPos[] array. Also perform a bunch of correctness verification + PxU32 splitStarts[RTREE_N]; + PxU32 splitCounts[RTREE_N]; + splitStarts[0] = 0; + splitCounts[0] = splitPos[0]; + PxU32 sumCounts = splitCounts[0]; + for(PxU32 j = 1; j < RTREE_N; j++) + { + splitStarts[j] = splitPos[j-1]; + PX_ASSERT(splitStarts[j-1]<=splitStarts[j]); + splitCounts[j] = splitPos[j]-splitPos[j-1]; + PX_ASSERT(splitCounts[j] > 0 || clusterSize < RTREE_N); + sumCounts += splitCounts[j]; + PX_ASSERT(splitStarts[j-1]+splitCounts[j-1]<=splitStarts[j]); + } + PX_ASSERT(sumCounts == clusterSize); + PX_ASSERT(splitStarts[RTREE_N-1]+splitCounts[RTREE_N-1]<=clusterSize); + + // mark this cluster as terminal based on clusterSize <= stopAtTrisPerPage parameter for current iTradeOff user specified preset + bool terminalClusterByTotalCount = (clusterSize <= stopAtTrisPerPage[iTradeOff]); + // iterate over splitCounts for the current cluster, if any of counts exceed 16 (which is the maximum supported by LeafTriangles + // we cannot mark this cluster as terminal (has to be split more) + for(PxU32 s = 0; s < RTREE_N; s++) + if(splitCounts[s] > 16) // LeafTriangles doesn't support > 16 tris + terminalClusterByTotalCount = false; + + // iterate over all the splits + for(PxU32 s = 0; s < RTREE_N; s++) + { + RTreeNodeNQ rtn; + PxU32 splitCount = splitCounts[s]; + if(splitCount > 0) // splits shouldn't be empty generally + { + // sweep left to right and compute min and max SAH for each individual bound in current split + PxBounds3V b = allBounds[permute[splitStarts[s]]]; + PxF32 sahMin; PxSAH(b.getExtents(), sahMin); + PxF32 sahMax = sahMin; + // AP scaffold - looks like this could be optimized (we are recomputing bounds top down) + for(PxU32 i = 1; i < splitCount; i++) + { + PxU32 localIndex = i + splitStarts[s]; + const PxBounds3V& b1 = allBounds[permute[localIndex]]; + PxF32 sah1; PxSAH(b1.getExtents(), sah1); + sahMin = PxMin(sahMin, sah1); + sahMax = PxMax(sahMax, sah1); + b.include(b1); + } + + rtn.bounds.minimum = V3ReadXYZ(b.mn); + rtn.bounds.maximum = V3ReadXYZ(b.mx); + + // if bounds differ widely (according to some heuristic preset), we continue splitting + // this is important for a mixed cluster with large and small triangles + bool okSAH = (sahMax/sahMin < 40.0f); + if(!okSAH) + terminalClusterByTotalCount = false; // force splitting this cluster + + bool stopSplitting = // compute the final splitting criterion + splitCount <= 2 || (okSAH && splitCount <= 3) // stop splitting at 2 nodes or if SAH ratio is OK and splitCount <= 3 + || terminalClusterByTotalCount || splitCount <= stopAtTrisPerLeaf[iTradeOff]; + if(stopSplitting) + { + // this is a terminal page then, mark as such + // first node index is relative to the top level input array beginning + rtn.childPageFirstNodeIndex = PxI32(splitStarts[s]+(permute-permuteStart)); + rtn.leafCount = PxI32(splitCount); + PX_ASSERT(splitCount <= 16); // LeafTriangles doesn't support more + } + else + { + // this is not a terminal page, we will recompute this later, after we recurse on subpages (label ZZZ) + rtn.childPageFirstNodeIndex = -1; + rtn.leafCount = 0; + } + } + else // splitCount == 0 at this point, this is an empty paddding node (with current presets it's very rare) + { + PX_ASSERT(splitCount == 0); + rtn.bounds.setEmpty(); + rtn.childPageFirstNodeIndex = -1; + rtn.leafCount = -1; + } + resultTree.pushBack(rtn); // push the new node into the resultTree array + } + + if(terminalClusterByTotalCount) // abort recursion if terminal cluster + return; + + // recurse on subpages + PxU32 parentIndex = resultTree.size() - RTREE_N; // save the parentIndex as specified (array can be resized during recursion) + for(PxU32 s = 0; s<RTREE_N; s++) + { + RTreeNodeNQ* sParent = &resultTree[parentIndex+s]; // array can be resized and relocated during recursion + if(sParent->leafCount == 0) // only split pages that were marked as non-terminal during splitting (see "label ZZZ" above) + { + // all child nodes will be pushed inside of this recursive call, + // so we set the child pointer for parent node to resultTree.size() + sParent->childPageFirstNodeIndex = PxI32(resultTree.size()); + sort4(permute+splitStarts[s], splitCounts[s], resultTree, maxLevels, level+1, sParent); + } + } + } +}; + + + + +///////////////////////////////////////////////////////////////////////// +// initializes the input permute array with identity permutation +// and shuffles it so that new sorted index, newIndex = resultPermute[oldIndex] +static void buildFromBounds( + Gu::RTree& result, const PxBounds3V* allBounds, PxU32 numBounds, + Array<PxU32>& permute, RTreeCooker::RemapCallback* rc, Vec3VArg allMn, Vec3VArg allMx, + PxReal sizePerfTradeOff01, PxMeshCookingHint::Enum hint) +{ + PX_UNUSED(sizePerfTradeOff01); + PxBounds3V treeBounds(allMn, allMx); + + // start off with an identity permutation + permute.resize(0); + permute.reserve(numBounds+1); + for(PxU32 j = 0; j < numBounds; j ++) + permute.pushBack(j); + const PxU32 sentinel = 0xABCDEF01; + permute.pushBack(sentinel); + + // load sorted nodes into an RTreeNodeNQ tree representation + // build the tree structure from sorted nodes + const PxU32 pageSize = RTREE_N; + Array<RTreeNodeNQ> resultTree; + resultTree.reserve(numBounds*2); + + PxU32 maxLevels = 0; + if(hint == PxMeshCookingHint::eSIM_PERFORMANCE) // use high quality SAH build + { + Array<PxU32> xRanks(numBounds), yRanks(numBounds), zRanks(numBounds), xOrder(numBounds), yOrder(numBounds), zOrder(numBounds); + memcpy(xOrder.begin(), permute.begin(), sizeof(xOrder[0])*numBounds); + memcpy(yOrder.begin(), permute.begin(), sizeof(yOrder[0])*numBounds); + memcpy(zOrder.begin(), permute.begin(), sizeof(zOrder[0])*numBounds); + // sort by shuffling the permutation, precompute sorted ranks for x,y,z-orders + Ps::sort(xOrder.begin(), xOrder.size(), SortBoundsPredicate(0, allBounds)); + for(PxU32 i = 0; i < numBounds; i++) xRanks[xOrder[i]] = i; + Ps::sort(yOrder.begin(), yOrder.size(), SortBoundsPredicate(1, allBounds)); + for(PxU32 i = 0; i < numBounds; i++) yRanks[yOrder[i]] = i; + Ps::sort(zOrder.begin(), zOrder.size(), SortBoundsPredicate(2, allBounds)); + for(PxU32 i = 0; i < numBounds; i++) zRanks[zOrder[i]] = i; + + SubSortSAH ss(permute.begin(), allBounds, numBounds, + xOrder.begin(), yOrder.begin(), zOrder.begin(), xRanks.begin(), yRanks.begin(), zRanks.begin(), sizePerfTradeOff01); + ss.sort4(permute.begin(), numBounds, resultTree, maxLevels); + } else + { // use fast cooking path + PX_ASSERT(hint == PxMeshCookingHint::eCOOKING_PERFORMANCE); + SubSortQuick ss(permute.begin(), allBounds, numBounds, sizePerfTradeOff01); + PxBounds3V discard((PxBounds3V::U())); + ss.sort4(permute.begin(), permute.size()-1, resultTree, maxLevels, discard); // AP scaffold: need to implement build speed/runtime perf slider + } + + PX_ASSERT(permute[numBounds] == sentinel); // verify we didn't write past the array + permute.popBack(); // discard the sentinel value + + #if PRINT_RTREE_COOKING_STATS // stats code + PxU32 totalLeafTris = 0; + PxU32 numLeaves = 0; + PxI32 maxLeafTris = 0; + PxU32 numEmpty = 0; + for(PxU32 i = 0; i < resultTree.size(); i++) + { + PxI32 leafCount = resultTree[i].leafCount; + numEmpty += (resultTree[i].bounds.isEmpty()); + if(leafCount > 0) + { + numLeaves++; + totalLeafTris += leafCount; + if(leafCount > maxLeafTris) + maxLeafTris = leafCount; + } + } + + printf("AABBs total/empty=%d/%d\n", resultTree.size(), numEmpty); + printf("numTris=%d, numLeafAABBs=%d, avgTrisPerLeaf=%.2f, maxTrisPerLeaf = %d\n", + numBounds, numLeaves, PxF32(totalLeafTris)/numLeaves, maxLeafTris); + #endif + + PX_ASSERT(RTREE_N*sizeof(RTreeNodeQ) == sizeof(RTreePage)); // needed for nodePtrMultiplier computation to be correct + const int nodePtrMultiplier = sizeof(RTreeNodeQ); // convert offset as count in qnodes to page ptr + + // Quantize the tree. AP scaffold - might be possible to merge this phase with the page pass below this loop + Array<RTreeNodeQ> qtreeNodes; + PxU32 firstEmptyIndex = PxU32(-1); + PxU32 resultCount = resultTree.size(); + qtreeNodes.reserve(resultCount); + + for(PxU32 i = 0; i < resultCount; i++) // AP scaffold - eliminate this pass + { + RTreeNodeNQ & u = resultTree[i]; + RTreeNodeQ q; + q.setLeaf(u.leafCount > 0); // set the leaf flag + if(u.childPageFirstNodeIndex == -1) // empty node? + { + if(firstEmptyIndex == PxU32(-1)) + firstEmptyIndex = qtreeNodes.size(); + q.minx = q.miny = q.minz = FLT_MAX; // AP scaffold improvement - use empty 1e30 bounds instead and reference a valid leaf + q.maxx = q.maxy = q.maxz = -FLT_MAX; // that will allow to remove the empty node test from the runtime + + q.ptr = firstEmptyIndex*nodePtrMultiplier; PX_ASSERT((q.ptr & 1) == 0); + q.setLeaf(true); // label empty node as leaf node + } else + { + // non-leaf node + q.minx = u.bounds.minimum.x; + q.miny = u.bounds.minimum.y; + q.minz = u.bounds.minimum.z; + q.maxx = u.bounds.maximum.x; + q.maxy = u.bounds.maximum.y; + q.maxz = u.bounds.maximum.z; + if(u.leafCount > 0) + { + q.ptr = PxU32(u.childPageFirstNodeIndex); + rc->remap(&q.ptr, q.ptr, PxU32(u.leafCount)); + PX_ASSERT(q.isLeaf()); // remap is expected to set the isLeaf bit + } + else + { + // verify that all children bounds are included in the parent bounds + for(PxU32 s = 0; s < RTREE_N; s++) + { + const RTreeNodeNQ& child = resultTree[u.childPageFirstNodeIndex+s]; + PX_UNUSED(child); + // is a sentinel node or is inside parent's bounds + PX_ASSERT(child.leafCount == -1 || child.bounds.isInside(u.bounds)); + } + + q.ptr = PxU32(u.childPageFirstNodeIndex * nodePtrMultiplier); + PX_ASSERT(q.ptr % RTREE_N == 0); + q.setLeaf(false); + } + } + qtreeNodes.pushBack(q); + } + + // build the final rtree image + result.mInvDiagonal = PxVec4(1.0f); + PX_ASSERT(qtreeNodes.size() % RTREE_N == 0); + result.mTotalNodes = qtreeNodes.size(); + result.mTotalPages = result.mTotalNodes / pageSize; + result.mPages = static_cast<RTreePage*>( + Ps::AlignedAllocator<128>().allocate(sizeof(RTreePage)*result.mTotalPages, __FILE__, __LINE__)); + result.mBoundsMin = PxVec4(V3ReadXYZ(treeBounds.mn), 0.0f); + result.mBoundsMax = PxVec4(V3ReadXYZ(treeBounds.mx), 0.0f); + result.mDiagonalScaler = (result.mBoundsMax - result.mBoundsMin) / 65535.0f; + result.mPageSize = pageSize; + result.mNumLevels = maxLevels; + PX_ASSERT(result.mTotalNodes % pageSize == 0); + result.mNumRootPages = 1; + + for(PxU32 j = 0; j < result.mTotalPages; j++) + { + RTreePage& page = result.mPages[j]; + for(PxU32 k = 0; k < RTREE_N; k ++) + { + const RTreeNodeQ& n = qtreeNodes[j*RTREE_N+k]; + page.maxx[k] = n.maxx; + page.maxy[k] = n.maxy; + page.maxz[k] = n.maxz; + page.minx[k] = n.minx; + page.miny[k] = n.miny; + page.minz[k] = n.minz; + page.ptrs[k] = n.ptr; + } + } + + //printf("Tree size=%d\n", result.mTotalPages*sizeof(RTreePage)); +#if PX_DEBUG + result.validate(); // make sure the child bounds are included in the parent and other validation +#endif +} + +} // namespace physx diff --git a/PhysX_3.4/Source/PhysXCooking/src/mesh/RTreeCooking.h b/PhysX_3.4/Source/PhysXCooking/src/mesh/RTreeCooking.h new file mode 100644 index 00000000..04a0b15c --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/mesh/RTreeCooking.h @@ -0,0 +1,51 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + +#include "CmPhysXCommon.h" +#include "GuMeshData.h" +#include "PxCooking.h" +#include "PsArray.h" +#include "GuRTree.h" + +namespace physx +{ + struct RTreeCooker + { + struct RemapCallback // a callback to convert indices from triangle to LeafTriangles or other uses + { + virtual ~RemapCallback() {} + virtual void remap(PxU32* rtreePtr, PxU32 start, PxU32 leafCount) = 0; + }; + + // triangles will be remapped so that newIndex = resultPermute[oldIndex] + static void buildFromTriangles( + Gu::RTree& resultTree, const PxVec3* verts, PxU32 numVerts, const PxU16* tris16, const PxU32* tris32, PxU32 numTris, + Ps::Array<PxU32>& resultPermute, RemapCallback* rc, PxReal sizePerfTradeOff01, PxMeshCookingHint::Enum hint); + }; +} diff --git a/PhysX_3.4/Source/PhysXCooking/src/mesh/TriangleMeshBuilder.cpp b/PhysX_3.4/Source/PhysXCooking/src/mesh/TriangleMeshBuilder.cpp new file mode 100644 index 00000000..877d752e --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/mesh/TriangleMeshBuilder.cpp @@ -0,0 +1,1443 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + +#include "RTreeCooking.h" +#include "TriangleMeshBuilder.h" +#include "EdgeList.h" +#include "MeshCleaner.h" +#include "GuConvexEdgeFlags.h" +#include "PxTriangleMeshDesc.h" +#include "GuSerialize.h" +#include "Cooking.h" +#include "GuMeshData.h" +#include "GuTriangle32.h" +#include "GuRTree.h" +#include "GuInternal.h" +#include "GuBV4Build.h" +#include "GuBV32Build.h" +#include "PsFoundation.h" +#include "PsHashMap.h" +#include "PsSort.h" + +namespace physx { + +struct int3 +{ + int x, y, z; +}; + +struct uint3 +{ + unsigned int x, y, z; +}; + +PX_ALIGN_PREFIX(16) +struct uint4 +{ + unsigned int x, y, z, w; +} +PX_ALIGN_SUFFIX(16); + +PX_ALIGN_PREFIX(16) +struct float4 +{ + float x, y, z, w; +} +PX_ALIGN_SUFFIX(16); + +} + +#include "GrbTriangleMeshCooking.h" + +using namespace physx; +using namespace Gu; +using namespace Ps; + +namespace physx { + +TriangleMeshBuilder::TriangleMeshBuilder(TriangleMeshData& m, const PxCookingParams& params) : + edgeList (NULL), + mParams (params), + mMeshData (m) +{ +} + +TriangleMeshBuilder::~TriangleMeshBuilder() +{ + releaseEdgeList(); +} + +void TriangleMeshBuilder::remapTopology(const PxU32* order) +{ + if(!mMeshData.mNbTriangles) + return; + + // Remap one array at a time to limit memory usage + + Gu::TriangleT<PxU32>* newTopo = reinterpret_cast<Gu::TriangleT<PxU32>*>(PX_ALLOC(mMeshData.mNbTriangles * sizeof(Gu::TriangleT<PxU32>), "Gu::TriangleT<PxU32>")); + for(PxU32 i=0;i<mMeshData.mNbTriangles;i++) + newTopo[i] = reinterpret_cast<Gu::TriangleT<PxU32>*>(mMeshData.mTriangles)[order[i]]; + PX_FREE_AND_RESET(mMeshData.mTriangles); + mMeshData.mTriangles = newTopo; + + if(mMeshData.mMaterialIndices) + { + PxMaterialTableIndex* newMat = PX_NEW(PxMaterialTableIndex)[mMeshData.mNbTriangles]; + for(PxU32 i=0;i<mMeshData.mNbTriangles;i++) + newMat[i] = mMeshData.mMaterialIndices[order[i]]; + PX_DELETE_POD(mMeshData.mMaterialIndices); + mMeshData.mMaterialIndices = newMat; + } + + if(!mParams.suppressTriangleMeshRemapTable || mParams.buildGPUData) + { + PxU32* newMap = PX_NEW(PxU32)[mMeshData.mNbTriangles]; + for(PxU32 i=0;i<mMeshData.mNbTriangles;i++) + newMap[i] = mMeshData.mFaceRemap ? mMeshData.mFaceRemap[order[i]] : order[i]; + PX_DELETE_POD(mMeshData.mFaceRemap); + mMeshData.mFaceRemap = newMap; + } +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + +bool TriangleMeshBuilder::cleanMesh(bool validate, PxTriangleMeshCookingResult::Enum* condition) +{ + PX_ASSERT(mMeshData.mFaceRemap == NULL); + + PxF32 meshWeldTolerance = 0.0f; + if(mParams.meshPreprocessParams & PxMeshPreprocessingFlag::eWELD_VERTICES) + { + if(mParams.meshWeldTolerance == 0.f) + { + Ps::getFoundation().error(PxErrorCode::eDEBUG_WARNING, __FILE__, __LINE__, "TriangleMesh: Enable mesh welding with 0 weld tolerance!"); + } + else + { + meshWeldTolerance = mParams.meshWeldTolerance; + } + } + MeshCleaner cleaner(mMeshData.mNbVertices, mMeshData.mVertices, mMeshData.mNbTriangles, reinterpret_cast<const PxU32*>(mMeshData.mTriangles), meshWeldTolerance); + if(!cleaner.mNbTris) + return false; + + if(validate) + { + // if we do only validate, we check if cleaning did not remove any verts or triangles. + // such a mesh can be then directly used for cooking without clean flag + if((cleaner.mNbVerts != mMeshData.mNbVertices) || (cleaner.mNbTris != mMeshData.mNbTriangles)) + { + return false; + } + } + + // PT: deal with the remap table + { + // PT: TODO: optimize this + if(cleaner.mRemap) + { + const PxU32 newNbTris = cleaner.mNbTris; + + // Remap material array + if(mMeshData.mMaterialIndices) + { + PxMaterialTableIndex* tmp = PX_NEW(PxMaterialTableIndex)[newNbTris]; + for(PxU32 i=0;i<newNbTris;i++) + tmp[i] = mMeshData.mMaterialIndices[cleaner.mRemap[i]]; + + PX_DELETE_POD(mMeshData.mMaterialIndices); + mMeshData.mMaterialIndices = tmp; + } + + if (!mParams.suppressTriangleMeshRemapTable || mParams.buildGPUData) + { + mMeshData.mFaceRemap = PX_NEW(PxU32)[newNbTris]; + PxMemCopy(mMeshData.mFaceRemap, cleaner.mRemap, newNbTris*sizeof(PxU32)); + } + } + } + + // PT: deal with geometry + { + if(mMeshData.mNbVertices!=cleaner.mNbVerts) + { + PX_FREE_AND_RESET(mMeshData.mVertices); + mMeshData.allocateVertices(cleaner.mNbVerts); + } + PxMemCopy(mMeshData.mVertices, cleaner.mVerts, mMeshData.mNbVertices*sizeof(PxVec3)); + } + + // PT: deal with topology + { + PX_ASSERT(!(mMeshData.mFlags & PxTriangleMeshFlag::e16_BIT_INDICES)); + if(mMeshData.mNbTriangles!=cleaner.mNbTris) + { + PX_FREE_AND_RESET(mMeshData.mTriangles); + mMeshData.allocateTriangles(cleaner.mNbTris, true); + } + + const float testLength = 500.0f*500.0f*mParams.scale.length*mParams.scale.length; + bool bigTriangle = false; + const PxVec3* v = mMeshData.mVertices; + for(PxU32 i=0;i<mMeshData.mNbTriangles;i++) + { + const PxU32 vref0 = cleaner.mIndices[i*3+0]; + const PxU32 vref1 = cleaner.mIndices[i*3+1]; + const PxU32 vref2 = cleaner.mIndices[i*3+2]; + PX_ASSERT(vref0!=vref1 && vref0!=vref2 && vref1!=vref2); + + reinterpret_cast<Gu::TriangleT<PxU32>*>(mMeshData.mTriangles)[i].v[0] = vref0; + reinterpret_cast<Gu::TriangleT<PxU32>*>(mMeshData.mTriangles)[i].v[1] = vref1; + reinterpret_cast<Gu::TriangleT<PxU32>*>(mMeshData.mTriangles)[i].v[2] = vref2; + + if( (v[vref0] - v[vref1]).magnitudeSquared() >= testLength + || (v[vref1] - v[vref2]).magnitudeSquared() >= testLength + || (v[vref2] - v[vref0]).magnitudeSquared() >= testLength + ) + bigTriangle = true; + } + if(bigTriangle) + { + if(condition) + *condition = PxTriangleMeshCookingResult::eLARGE_TRIANGLE; + Ps::getFoundation().error(PxErrorCode::eDEBUG_WARNING, __FILE__, __LINE__, "TriangleMesh: triangles are too big, reduce their size to increase simulation stability!"); + } + } + + return true; +} + +void TriangleMeshBuilder::createSharedEdgeData(bool buildAdjacencies, bool buildActiveEdges) +{ + if(buildAdjacencies) // building edges is required if buildAdjacencies is requested + buildActiveEdges = true; + + PX_ASSERT(mMeshData.mExtraTrigData == NULL); + PX_ASSERT(mMeshData.mAdjacencies == NULL); + + if(!buildActiveEdges) + return; + + const PxU32 nTrigs = mMeshData.mNbTriangles; + + mMeshData.mExtraTrigData = PX_NEW(PxU8)[nTrigs]; + memset(mMeshData.mExtraTrigData, 0, sizeof(PxU8)*nTrigs); + + const Gu::TriangleT<PxU32>* trigs = reinterpret_cast<const Gu::TriangleT<PxU32>*>(mMeshData.mTriangles); + if(0x40000000 <= nTrigs) + { + //mesh is too big for this algo, need to be able to express trig indices in 30 bits, and still have an index reserved for "unused": + Ps::getFoundation().error(PxErrorCode::eINVALID_PARAMETER, __FILE__, __LINE__, "TriangleMesh: mesh is too big for this algo!"); + return; + } + + createEdgeList(); + if(edgeList) + { + PX_ASSERT(edgeList->getNbFaces()==mMeshData.mNbTriangles); + if(edgeList->getNbFaces()==mMeshData.mNbTriangles) + { + for(PxU32 i=0;i<edgeList->getNbFaces();i++) + { + const Gu::EdgeTriangleData& ET = edgeList->getEdgeTriangle(i); + // Replicate flags + if(Gu::EdgeTriangleAC::HasActiveEdge01(ET)) mMeshData.mExtraTrigData[i] |= Gu::ETD_CONVEX_EDGE_01; + if(Gu::EdgeTriangleAC::HasActiveEdge12(ET)) mMeshData.mExtraTrigData[i] |= Gu::ETD_CONVEX_EDGE_12; + if(Gu::EdgeTriangleAC::HasActiveEdge20(ET)) mMeshData.mExtraTrigData[i] |= Gu::ETD_CONVEX_EDGE_20; + } + } + } + + // fill the adjacencies + if(buildAdjacencies) + { + mMeshData.mAdjacencies = PX_NEW(PxU32)[nTrigs*3]; + memset(mMeshData.mAdjacencies, 0xFFFFffff, sizeof(PxU32)*nTrigs*3); + + PxU32 NbEdges = edgeList->getNbEdges(); + const Gu::EdgeDescData* ED = edgeList->getEdgeToTriangles(); + const Gu::EdgeData* Edges = edgeList->getEdges(); + const PxU32* FBE = edgeList->getFacesByEdges(); + + while(NbEdges--) + { + // Get number of triangles sharing current edge + PxU32 Count = ED->Count; + + if(Count > 1) + { + PxU32 FaceIndex0 = FBE[ED->Offset+0]; + PxU32 FaceIndex1 = FBE[ED->Offset+1]; + + const Gu::EdgeData& edgeData = *Edges; + const Gu::TriangleT<PxU32>& T0 = trigs[FaceIndex0]; + const Gu::TriangleT<PxU32>& T1 = trigs[FaceIndex1]; + + PxU32 offset0 = T0.findEdgeCCW(edgeData.Ref0,edgeData.Ref1); + PxU32 offset1 = T1.findEdgeCCW(edgeData.Ref0,edgeData.Ref1); + + mMeshData.setTriangleAdjacency(FaceIndex0, FaceIndex1, offset0); + mMeshData.setTriangleAdjacency(FaceIndex1, FaceIndex0, offset1); + } + ED++; + Edges++; + } + } + +#if PX_DEBUG + for(PxU32 i=0;i<mMeshData.mNbTriangles;i++) + { + const Gu::TriangleT<PxU32>& T = trigs[i]; + PX_UNUSED(T); + const Gu::EdgeTriangleData& ET = edgeList->getEdgeTriangle(i); + PX_ASSERT((Gu::EdgeTriangleAC::HasActiveEdge01(ET) && (mMeshData.mExtraTrigData[i] & Gu::ETD_CONVEX_EDGE_01)) || (!Gu::EdgeTriangleAC::HasActiveEdge01(ET) && !(mMeshData.mExtraTrigData[i] & Gu::ETD_CONVEX_EDGE_01))); + PX_ASSERT((Gu::EdgeTriangleAC::HasActiveEdge12(ET) && (mMeshData.mExtraTrigData[i] & Gu::ETD_CONVEX_EDGE_12)) || (!Gu::EdgeTriangleAC::HasActiveEdge12(ET) && !(mMeshData.mExtraTrigData[i] & Gu::ETD_CONVEX_EDGE_12))); + PX_ASSERT((Gu::EdgeTriangleAC::HasActiveEdge20(ET) && (mMeshData.mExtraTrigData[i] & Gu::ETD_CONVEX_EDGE_20)) || (!Gu::EdgeTriangleAC::HasActiveEdge20(ET) && !(mMeshData.mExtraTrigData[i] & Gu::ETD_CONVEX_EDGE_20))); + } +#endif + return; +} + +namespace GrbTrimeshCookerHelper +{ + +struct SortedNeighbor +{ + PxU32 v, a; // vertex and adjacent vertex + bool boundary; + + SortedNeighbor(PxU32 v_, PxU32 a_, bool b_): v(v_), a(a_), boundary(b_) {} + + // sort boundary edges to the front so that they are kept when duplicates are removed + bool operator<(const SortedNeighbor& b) const + { + return (v<b.v || (v == b.v && a<b.a) || (v == b.v && a == b.a && boundary && !b.boundary)); + } +}; + +struct SharpEdgeRange +{ + PxU32 start, length; + SharpEdgeRange(): start(0), length(0) {} + SharpEdgeRange(PxU32 s, PxU32 l): start(s), length(l) {} +}; + +class LocalIndexer +{ +public: + bool insert(PxU32 meshIndex) // returns true if this is a new index + { + bool isNew = mMeshToLocal.insert(meshIndex, mLocalToMesh.size()); + if(isNew) + mLocalToMesh.pushBack(meshIndex); + return isNew; + } + + PxU32 meshIndex(PxU32 localIndex) + { + PX_ASSERT(localIndex<mLocalToMesh.size()); + return mLocalToMesh[localIndex]; + } + + PxU32 localIndex(PxU32 meshIndex) + { + PX_ASSERT(mMeshToLocal.find(meshIndex)); + return mMeshToLocal[meshIndex]; + } + + bool contains(PxU32 meshIndex) + { + return mMeshToLocal.find(meshIndex) != 0; + } + + PxU32 size() + { + return mLocalToMesh.size(); + } + +private: + Ps::Array<PxU32> mLocalToMesh; + Ps::HashMap<PxU32, PxU32> mMeshToLocal; +}; + +#include <stdio.h> + + +void findSharpVertices( + Ps::Array<SortedNeighbor>& pairList, + Ps::Array<SharpEdgeRange>& edgeRanges, + /*const Ps::Array<Triangle>& triangles,*/ + const uint3* triIndices, + const uint4* triAdjacencies, + PxU32 nbTris, + PxU32 nbVerts + ) +{ + // sort the edges which are sharp or boundary + for(PxU32 i=0;i<nbTris;i++) + { + const uint4& triAdj = triAdjacencies[i]; + const uint3& triIdx = triIndices[i]; + + if (!isEdgeNonconvex(triAdj.x)) + { + pairList.pushBack(SortedNeighbor(triIdx.x, triIdx.y, triAdj.x == BOUNDARY)); + pairList.pushBack(SortedNeighbor(triIdx.y, triIdx.x, triAdj.x == BOUNDARY)); + } + + if (!isEdgeNonconvex(triAdj.y)) + { + pairList.pushBack(SortedNeighbor(triIdx.y, triIdx.z, triAdj.y == BOUNDARY)); + pairList.pushBack(SortedNeighbor(triIdx.z, triIdx.y, triAdj.y == BOUNDARY)); + } + + if (!isEdgeNonconvex(triAdj.z)) + { + pairList.pushBack(SortedNeighbor(triIdx.z, triIdx.x, triAdj.z == BOUNDARY)); + pairList.pushBack(SortedNeighbor(triIdx.x, triIdx.z, triAdj.z == BOUNDARY)); + } + } + + Ps::sort(pairList.begin(), pairList.size()); + + // remove duplicates - note that boundary edges are sorted earlier, so we keep them + PxU32 unique = 1; + for(PxU32 i=1;i<pairList.size();i++) + { + if(pairList[i].v != pairList[i-1].v || pairList[i].a != pairList[i-1].a) + pairList[unique++] = pairList[i]; + } + pairList.resizeUninitialized(unique); + + // a vertex is marked for sharp vertex processing if it has a boundary edge or at least three convex edges + edgeRanges.resize(nbVerts); + for(PxU32 p = 0, u ; p<pairList.size(); p = u) + { + bool boundary = false; + for(u=p+1; u<pairList.size() && pairList[u].v == pairList[p].v; u++) + boundary |= pairList[u].boundary; + if(boundary || u-p>=3) + edgeRanges[pairList[p].v] = SharpEdgeRange(p, u-p); + } +} + +#if 0 +PxU32 buildVertexConnectionNew_p1( + Ps::Array<SortedNeighbor> & pairList, + Ps::Array<SharpEdgeRange> & edgeRanges, + LocalIndexer & vertexMap, + + const uint4 * triIndices, + const uint4 * triAdjacencies, + + PxU32 nbTris, + PxU32 nbVerts + ) +{ + findSharpVertices( + pairList, + edgeRanges, + triIndices, + triAdjacencies, + nbTris, + nbVerts + ); + + // add all the original triangles and vertices and record how big the core is + for(PxU32 i=0; i<nbTris; i++) + { + const uint4 & triIdx = triIndices[i]; + vertexMap.insert(triIdx.x); + vertexMap.insert(triIdx.y); + vertexMap.insert(triIdx.z); + } + PxU32 nbCoreVerts = vertexMap.size(); + + PX_ASSERT(nbCoreVerts == nbVerts); + + // add adjacent triangles + for(PxU32 i=0;i<nbTris;i++) + { + const uint4 & triAdj = triAdjacencies[i]; + +#define IS_TRI(triAdjIdx) (( (triAdjIdx) != BOUNDARY ) && ( !((triAdjIdx) & NONCONVEX_FLAG) )) + + if(IS_TRI(triAdj.x)) + { + const uint4 & triIdx = triIndices[triAdj.x]; + vertexMap.insert(triIdx.x); + vertexMap.insert(triIdx.y); + vertexMap.insert(triIdx.z); + } + + if(IS_TRI(triAdj.y)) + { + const uint4 & triIdx = triIndices[triAdj.y]; + vertexMap.insert(triIdx.x); + vertexMap.insert(triIdx.y); + vertexMap.insert(triIdx.z); + } + + if(IS_TRI(triAdj.z)) + { + const uint4 & triIdx = triIndices[triAdj.z]; + vertexMap.insert(triIdx.x); + vertexMap.insert(triIdx.y); + vertexMap.insert(triIdx.z); + + } + +#undef IS_TRI + } + + // add the neighbors of the sharp vertices + PxU32 nbNeighbors = 0; + for(PxU32 i=0;i<nbCoreVerts;i++) + { + PxU32 meshIndex = vertexMap.meshIndex(i); + const SharpEdgeRange& er = edgeRanges[meshIndex]; + for(PxU32 j = 0;j<er.length;j++) + { + PX_ASSERT(pairList[er.start+j].v == meshIndex); + vertexMap.insert(pairList[er.start + j].a); + } + nbNeighbors += er.length; + } + + return nbNeighbors; +} + +void buildVertexConnectionNew_p2( + PxU32 * adjVertStart, + PxU32 * vertValency, + PxU32 * adjVertices, + + Ps::Array<SortedNeighbor>& pairList, + Ps::Array<SharpEdgeRange>& edgeRanges, + LocalIndexer & vertexMap, + + const uint4 * /*triIndices*/, + const uint4 * /*triAdjacencies*/, + + PxU32 /*nbTris*/, + PxU32 nbVerts, + PxU32 /*nbNeighbors*/ + ) +{ + PxU32 n = 0; + for(PxU32 i=0;i<nbVerts;i++) + { + PxU32 meshIdx = vertexMap.meshIndex(i); + const SharpEdgeRange& er = edgeRanges[vertexMap.meshIndex(i)]; + adjVertStart[meshIdx] = n; + vertValency[meshIdx] = er.length; + for(PxU32 j = 0;j<er.length;j++) + adjVertices[n++] = pairList[er.start+j].a; + } +} +#else + + +PxU32 buildVertexConnectionNew_p1( + Ps::Array<SortedNeighbor> & pairList, + Ps::Array<SharpEdgeRange> & edgeRanges, + + const uint3* triIndices, + const uint4 * triAdjacencies, + + PxU32 nbTris, + PxU32 nbVerts + ) +{ + findSharpVertices( + pairList, + edgeRanges, + triIndices, + triAdjacencies, + nbTris, + nbVerts + ); + + + // add the neighbors of the sharp vertices + PxU32 nbNeighbors = 0; + for (PxU32 i = 0; i<nbVerts; i++) + { + const SharpEdgeRange& er = edgeRanges[i]; + nbNeighbors += er.length; + } + + return nbNeighbors; +} + +void buildVertexConnectionNew_p2( + PxU32 * adjVertStart, + PxU32 * vertValency, + PxU32 * adjVertices, + + Ps::Array<SortedNeighbor>& pairList, + Ps::Array<SharpEdgeRange>& edgeRanges, + PxU32 nbVerts + ) +{ + PxU32 n = 0; + for (PxU32 i = 0; i<nbVerts; i++) + { + const SharpEdgeRange& er = edgeRanges[i]; + adjVertStart[i] = n; + vertValency[i] = er.length; + for (PxU32 j = 0; j<er.length; j++) + adjVertices[n++] = pairList[er.start + j].a; + } +} +#endif + +} // namespace GrbTrimeshCookerHelper + +void TriangleMeshBuilder::recordTriangleIndices() +{ + if (mParams.buildGPUData) + { + PX_ASSERT(!(mMeshData.mFlags & PxTriangleMeshFlag::e16_BIT_INDICES)); + PX_ASSERT(mMeshData.mGRB_triIndices); + + //copy the original traingle indices to originalTrangles32 + PxMemCopy(mMeshData.mGRB_triIndices, mMeshData.mTriangles, sizeof(IndTri32) *mMeshData.mNbTriangles); + + + if (mMeshData.mFaceRemap) + { + //We must have discarded some triangles so let's + mMeshData.mGRB_faceRemap = PX_NEW(PxU32)[mMeshData.mNbTriangles]; + PxMemCopy(mMeshData.mGRB_faceRemap, mMeshData.mFaceRemap, sizeof(PxU32)*mMeshData.mNbTriangles); + } + + } +} + +void TriangleMeshBuilder::createGRBData() +{ + + const PxU32 & numTris = mMeshData.mNbTriangles; + const PxU32 & numVerts = mMeshData.mNbVertices; + + PX_ASSERT(!(mMeshData.mFlags & PxTriangleMeshFlag::e16_BIT_INDICES)); + + + // Core: Mesh data + /////////////////////////////////////////////////////////////////////////////////// + + // (by using adjacency info generated by physx cooker) + PxVec3 * tempNormalsPerTri_prealloc = reinterpret_cast<PxVec3 *>(PX_ALLOC(numTris * sizeof(PxVec3), PX_DEBUG_EXP("tempNormalsPerTri_prealloc"))); + + mMeshData.mGRB_triAdjacencies = PX_ALLOC(sizeof(uint4)*numTris, PX_DEBUG_EXP("GRB_triAdjacencies")); + + + buildAdjacencies( + reinterpret_cast<uint4 *>(mMeshData.mGRB_triAdjacencies), + tempNormalsPerTri_prealloc, + mMeshData.mVertices, + reinterpret_cast<uint3*>(mMeshData.mGRB_triIndices), + numTris + ); + + + PX_FREE(tempNormalsPerTri_prealloc); + + mMeshData.mGRB_vertValency = PX_NEW(PxU32)[numVerts]; + mMeshData.mGRB_adjVertStart = PX_NEW(PxU32)[numVerts]; + + + Ps::Array<GrbTrimeshCookerHelper::SortedNeighbor> pairsList; + Ps::Array<GrbTrimeshCookerHelper::SharpEdgeRange> edgeRanges; + + + mMeshData.mGRB_meshAdjVerticiesTotal = GrbTrimeshCookerHelper::buildVertexConnectionNew_p1( + pairsList, + edgeRanges, + + reinterpret_cast<uint3*>(mMeshData.mGRB_triIndices), + reinterpret_cast<uint4 *>(mMeshData.mGRB_triAdjacencies), + numTris, + numVerts + ); + + + + mMeshData.mGRB_adjVertices = PX_NEW(PxU32)[mMeshData.mGRB_meshAdjVerticiesTotal]; + GrbTrimeshCookerHelper::buildVertexConnectionNew_p2( + mMeshData.mGRB_adjVertStart, + mMeshData.mGRB_vertValency, + mMeshData.mGRB_adjVertices, + pairsList, + edgeRanges, + numVerts + ); + + +} + +void TriangleMeshBuilder::createGRBMidPhaseAndData(const PxU32 originalTriangleCount) +{ + if (mParams.buildGPUData) + { + + PX_ASSERT(!(mMeshData.mFlags & PxTriangleMeshFlag::e16_BIT_INDICES)); + + BV32Tree* bv32Tree = PX_NEW(BV32Tree); + mMeshData.mGRB_BV32Tree = bv32Tree; + + BV32TriangleMeshBuilder::createMidPhaseStructure(mParams, mMeshData, *bv32Tree); + + createGRBData(); + + //create a remap table from GPU to CPU remap table + PxU32* orignalToRemap = PX_NEW(PxU32)[originalTriangleCount]; + + PX_ASSERT(mMeshData.mFaceRemap); + + + for (PxU32 i = 0; i < mMeshData.mNbTriangles; ++i) + { + const PxU32 index = mMeshData.mFaceRemap[i]; + PX_ASSERT(index < originalTriangleCount); + orignalToRemap[index] = i; + } + + + //map CPU remap triangle index to GPU remap triangle index + for (PxU32 i = 0; i < mMeshData.mNbTriangles; ++i) + { + const PxU32 index = mMeshData.mGRB_faceRemap[i]; + mMeshData.mGRB_faceRemap[i] = orignalToRemap[index]; + } + +#if BV32_VALIDATE + IndTri32* grbTriIndices = reinterpret_cast<IndTri32*>(mMeshData.mGRB_triIndices); + IndTri32* cpuTriIndices = reinterpret_cast<IndTri32*>(mMeshData.mTriangles); + //map CPU remap triangle index to GPU remap triangle index + for (PxU32 i = 0; i < mMeshData.mNbTriangles; ++i) + { + PX_ASSERT(grbTriIndices[i].mRef[0] == cpuTriIndices[mMeshData.mGRB_faceRemap[i]].mRef[0]); + PX_ASSERT(grbTriIndices[i].mRef[1] == cpuTriIndices[mMeshData.mGRB_faceRemap[i]].mRef[1]); + PX_ASSERT(grbTriIndices[i].mRef[2] == cpuTriIndices[mMeshData.mGRB_faceRemap[i]].mRef[2]); + } +#endif + + if (orignalToRemap) + PX_DELETE_POD(orignalToRemap); + + } +} + +void TriangleMeshBuilder::createEdgeList() +{ + Gu::EDGELISTCREATE create; + create.NbFaces = mMeshData.mNbTriangles; + if(mMeshData.has16BitIndices()) + { + create.DFaces = NULL; + create.WFaces = reinterpret_cast<PxU16*>(mMeshData.mTriangles); + } + else + { + create.DFaces = reinterpret_cast<PxU32*>(mMeshData.mTriangles); + create.WFaces = NULL; + } + create.FacesToEdges = true; + create.EdgesToFaces = true; + create.Verts = mMeshData.mVertices; + //create.Epsilon = 0.1f; + // create.Epsilon = convexEdgeThreshold; + edgeList = PX_NEW(Gu::EdgeListBuilder); + if(!edgeList->init(create)) + { + PX_DELETE(edgeList); + edgeList = 0; + } +} + +void TriangleMeshBuilder::releaseEdgeList() +{ + PX_DELETE_AND_RESET(edgeList); +} + +// +// When suppressTriangleMeshRemapTable is true, the face remap table is not created. This saves a significant amount of memory, +// but the SDK will not be able to provide information about which mesh triangle is hit in collisions, sweeps or raycasts hits. +// +// The sequence is as follows: + +bool TriangleMeshBuilder::loadFromDesc(const PxTriangleMeshDesc& _desc, PxTriangleMeshCookingResult::Enum* condition, bool validateMesh) +{ + const PxU32 originalTriangleCount = _desc.triangles.count; + if(!_desc.isValid()) + { + Ps::getFoundation().error(PxErrorCode::eINVALID_PARAMETER, __FILE__, __LINE__, "TriangleMesh::loadFromDesc: desc.isValid() failed!"); + return false; + } + + // verify the mesh params + if(!mParams.midphaseDesc.isValid()) + { + Ps::getFoundation().error(PxErrorCode::eINVALID_PARAMETER, __FILE__, __LINE__, "TriangleMesh::loadFromDesc: mParams.midphaseDesc.isValid() failed!"); + return false; + } + + // Create a local copy that we can modify + PxTriangleMeshDesc desc = _desc; + + // Save simple params + { + // Handle implicit topology + PxU32* topology = NULL; + if(!desc.triangles.data) + { + // We'll create 32-bit indices + desc.flags &= ~PxMeshFlag::e16_BIT_INDICES; + desc.triangles.stride = sizeof(PxU32)*3; + + { + // Non-indexed mesh => create implicit topology + desc.triangles.count = desc.points.count/3; + // Create default implicit topology + topology = PX_NEW_TEMP(PxU32)[desc.points.count]; + for(PxU32 i=0;i<desc.points.count;i++) + topology[i] = i; + desc.triangles.data = topology; + } + } + // Continue as usual using our new descriptor + + // Convert and clean the input mesh + if (!importMesh(desc, mParams, condition, validateMesh)) + return false; + + // Cleanup if needed + PX_DELETE_POD(topology); + } + + + //copy the original triangle indices to grb triangle indices if buildGRBData is true + recordTriangleIndices(); + + createMidPhaseStructure(); + + // Compute local bounds + computeLocalBounds(); // AP scaffold: local bounds are already computed in builder.createRTree efficiently with SIMD + + createSharedEdgeData(mParams.buildTriangleAdjacencies, !(mParams.meshPreprocessParams & PxMeshPreprocessingFlag::eDISABLE_ACTIVE_EDGES_PRECOMPUTE)); + + createGRBMidPhaseAndData(originalTriangleCount); + + + return true; +} + +///////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + +bool TriangleMeshBuilder::save(PxOutputStream& stream, bool platformMismatch, const PxCookingParams& params) const +{ + // Export header + if(!writeHeader('M', 'E', 'S', 'H', PX_MESH_VERSION, platformMismatch, stream)) + return false; + + // Export midphase ID + writeDword(getMidphaseID(), platformMismatch, stream); + + // Export serialization flags + PxU32 serialFlags = 0; + if(mMeshData.mMaterialIndices) serialFlags |= Gu::IMSF_MATERIALS; + if(mMeshData.mFaceRemap) serialFlags |= Gu::IMSF_FACE_REMAP; + if(mMeshData.mAdjacencies) serialFlags |= Gu::IMSF_ADJACENCIES; + if (params.buildGPUData) serialFlags |= Gu::IMSF_GRB_DATA; + // Compute serialization flags for indices + PxU32 maxIndex=0; + const Gu::TriangleT<PxU32>* tris = reinterpret_cast<const Gu::TriangleT<PxU32>*>(mMeshData.mTriangles); + for(PxU32 i=0;i<mMeshData.mNbTriangles;i++) + { + if(tris[i].v[0]>maxIndex) maxIndex = tris[i].v[0]; + if(tris[i].v[1]>maxIndex) maxIndex = tris[i].v[1]; + if(tris[i].v[2]>maxIndex) maxIndex = tris[i].v[2]; + } + + bool force32 = (params.meshPreprocessParams & PxMeshPreprocessingFlag::eFORCE_32BIT_INDICES); + if (maxIndex <= 0xFFFF && !force32) + serialFlags |= (maxIndex <= 0xFF ? Gu::IMSF_8BIT_INDICES : Gu::IMSF_16BIT_INDICES); + writeDword(serialFlags, platformMismatch, stream); + + // Export mesh + writeDword(mMeshData.mNbVertices, platformMismatch, stream); + writeDword(mMeshData.mNbTriangles, platformMismatch, stream); + writeFloatBuffer(&mMeshData.mVertices->x, mMeshData.mNbVertices*3, platformMismatch, stream); + if(serialFlags & Gu::IMSF_8BIT_INDICES) + { + const PxU32* indices = tris->v; + for(PxU32 i=0;i<mMeshData.mNbTriangles*3;i++) + { + PxI8 data = PxI8(indices[i]); + stream.write(&data, sizeof(PxU8)); + } + } + else if(serialFlags & Gu::IMSF_16BIT_INDICES) + { + const PxU32* indices = tris->v; + for(PxU32 i=0;i<mMeshData.mNbTriangles*3;i++) + writeWord(Ps::to16(indices[i]), platformMismatch, stream); + } + else + writeIntBuffer(tris->v, mMeshData.mNbTriangles*3, platformMismatch, stream); + + if(mMeshData.mMaterialIndices) + writeWordBuffer(mMeshData.mMaterialIndices, mMeshData.mNbTriangles, platformMismatch, stream); + + if(mMeshData.mFaceRemap) + { + PxU32 maxId = computeMaxIndex(mMeshData.mFaceRemap, mMeshData.mNbTriangles); + writeDword(maxId, platformMismatch, stream); + storeIndices(maxId, mMeshData.mNbTriangles, mMeshData.mFaceRemap, stream, platformMismatch); +// writeIntBuffer(mMeshData.mFaceRemap, mMeshData.mNbTriangles, platformMismatch, stream); + } + + if(mMeshData.mAdjacencies) + writeIntBuffer(mMeshData.mAdjacencies, mMeshData.mNbTriangles*3, platformMismatch, stream); + + // Export midphase structure + saveMidPhaseStructure(stream); + + + // Export local bounds + writeFloat(mMeshData.mGeomEpsilon, platformMismatch, stream); + + writeFloat(mMeshData.mAABB.minimum.x, platformMismatch, stream); + writeFloat(mMeshData.mAABB.minimum.y, platformMismatch, stream); + writeFloat(mMeshData.mAABB.minimum.z, platformMismatch, stream); + writeFloat(mMeshData.mAABB.maximum.x, platformMismatch, stream); + writeFloat(mMeshData.mAABB.maximum.y, platformMismatch, stream); + writeFloat(mMeshData.mAABB.maximum.z, platformMismatch, stream); + + if(mMeshData.mExtraTrigData) + { + writeDword(mMeshData.mNbTriangles, platformMismatch, stream); + // No need to convert those bytes + stream.write(mMeshData.mExtraTrigData, mMeshData.mNbTriangles*sizeof(PxU8)); + } + else + writeDword(0, platformMismatch, stream); + + // GRB write ----------------------------------------------------------------- + if (params.buildGPUData) + { + writeDword(mMeshData.mGRB_meshAdjVerticiesTotal, platformMismatch, stream); + + const PxU32* indices = reinterpret_cast<PxU32*>(mMeshData.mGRB_triIndices); + if (serialFlags & Gu::IMSF_8BIT_INDICES) + { + for (PxU32 i = 0; i<mMeshData.mNbTriangles * 3; i++) + { + PxI8 data = PxI8(indices[i]); + stream.write(&data, sizeof(PxU8)); + } + } + else if (serialFlags & Gu::IMSF_16BIT_INDICES) + { + for (PxU32 i = 0; i<mMeshData.mNbTriangles * 3; i++) + writeWord(Ps::to16(indices[i]), platformMismatch, stream); + } + else + writeIntBuffer(indices, mMeshData.mNbTriangles * 3, platformMismatch, stream); + + + //writeIntBuffer(reinterpret_cast<PxU32*>(mMeshData.mGRB_triIndices), , mMeshData.mNbTriangles*3, platformMismatch, stream); + + //writeIntBuffer(reinterpret_cast<PxU32 *>(mMeshData.mGRB_triIndices), mMeshData.mNbTriangles*4, platformMismatch, stream); + + writeIntBuffer(reinterpret_cast<PxU32 *>(mMeshData.mGRB_triAdjacencies), mMeshData.mNbTriangles*4, platformMismatch, stream); + writeIntBuffer(mMeshData.mGRB_vertValency, mMeshData.mNbVertices, platformMismatch, stream); + writeIntBuffer(mMeshData.mGRB_adjVertStart, mMeshData.mNbVertices, platformMismatch, stream); + writeIntBuffer(mMeshData.mGRB_adjVertices, mMeshData.mGRB_meshAdjVerticiesTotal, platformMismatch, stream); + writeIntBuffer(mMeshData.mGRB_faceRemap, mMeshData.mNbTriangles, platformMismatch, stream); + + //Export GPU midphase structure + BV32Tree* bv32Tree = reinterpret_cast<BV32Tree*>(mMeshData.mGRB_BV32Tree); + BV32TriangleMeshBuilder::saveMidPhaseStructure(bv32Tree, stream); + } + + // End of GRB write ---------------------------------------------------------- + + return true; +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + +#if PX_VC +#pragma warning(push) +#pragma warning(disable:4996) // permitting use of gatherStrided until we have a replacement. +#endif + +bool TriangleMeshBuilder::importMesh(const PxTriangleMeshDesc& desc,const PxCookingParams& params,PxTriangleMeshCookingResult::Enum* condition, bool validate) +{ + //convert and clean the input mesh + //this is where the mesh data gets copied from user mem to our mem + + PxVec3* verts = mMeshData.allocateVertices(desc.points.count); + Gu::TriangleT<PxU32>* tris = reinterpret_cast<Gu::TriangleT<PxU32>*>(mMeshData.allocateTriangles(desc.triangles.count, true, PxU32(params.buildGPUData))); + + //copy, and compact to get rid of strides: + Cooking::gatherStrided(desc.points.data, verts, mMeshData.mNbVertices, sizeof(PxVec3), desc.points.stride); + +#if PX_CHECKED + // PT: check all input vertices are valid + for(PxU32 i=0;i<desc.points.count;i++) + { + const PxVec3& p = verts[i]; + if(!PxIsFinite(p.x) || !PxIsFinite(p.y) || !PxIsFinite(p.z)) + { + Ps::getFoundation().error(PxErrorCode::eINTERNAL_ERROR, __FILE__, __LINE__, "input mesh contains corrupted vertex data"); + return false; + } + } +#endif + + //for trigs index stride conversion and eventual reordering is also needed, I don't think flexicopy can do that for us. + + Gu::TriangleT<PxU32>* dest = tris; + const Gu::TriangleT<PxU32>* pastLastDest = tris + mMeshData.mNbTriangles; + const PxU8* source = reinterpret_cast<const PxU8*>(desc.triangles.data); + + //4 combos of 16 vs 32 and flip vs no flip + PxU32 c = (desc.flags & PxMeshFlag::eFLIPNORMALS)?PxU32(1):0; + if (desc.flags & PxMeshFlag::e16_BIT_INDICES) + { + //index stride conversion is also needed, I don't think flexicopy can do that for us. + while (dest < pastLastDest) + { + const PxU16 * trig16 = reinterpret_cast<const PxU16*>(source); + dest->v[0] = trig16[0]; + dest->v[1] = trig16[1+c]; + dest->v[2] = trig16[2-c]; + dest ++; + source += desc.triangles.stride; + } + } + else + { + while (dest < pastLastDest) + { + const PxU32 * trig32 = reinterpret_cast<const PxU32*>(source); + dest->v[0] = trig32[0]; + dest->v[1] = trig32[1+c]; + dest->v[2] = trig32[2-c]; + dest ++; + source += desc.triangles.stride; + } + } + + //copy the material index list if any: + if(desc.materialIndices.data) + { + PxMaterialTableIndex* materials = mMeshData.allocateMaterials(); + Cooking::gatherStrided(desc.materialIndices.data, materials, mMeshData.mNbTriangles, sizeof(PxMaterialTableIndex), desc.materialIndices.stride); + + // Check material indices + for(PxU32 i=0;i<mMeshData.mNbTriangles;i++) PX_ASSERT(materials[i]!=0xffff); + } + + // Clean the mesh using ICE's MeshBuilder + // This fixes the bug in ConvexTest06 where the inertia tensor computation fails for a mesh => it works with a clean mesh + + if (!(params.meshPreprocessParams & PxMeshPreprocessingFlag::eDISABLE_CLEAN_MESH) || validate) + { + if(!cleanMesh(validate, condition)) + { + if(!validate) + Ps::getFoundation().error(PxErrorCode::eINTERNAL_ERROR, __FILE__, __LINE__, "cleaning the mesh failed"); + return false; + } + } + else + { + // we need to fill the remap table if no cleaning was done + if(params.suppressTriangleMeshRemapTable == false) + { + PX_ASSERT(mMeshData.mFaceRemap == NULL); + mMeshData.mFaceRemap = PX_NEW(PxU32)[mMeshData.mNbTriangles]; + for (PxU32 i = 0; i < mMeshData.mNbTriangles; i++) + mMeshData.mFaceRemap[i] = i; + } + } + return true; +} + +#if PX_VC +#pragma warning(pop) +#endif +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + +//#define PROFILE_BOUNDS +#ifdef PROFILE_BOUNDS + #include <windows.h> + #pragma comment(lib, "winmm.lib") +#endif + +void TriangleMeshBuilder::computeLocalBounds() +{ +#ifdef PROFILE_BOUNDS + int time = timeGetTime(); +#endif + + PxBounds3& localBounds = mMeshData.mAABB; + computeBoundsAroundVertices(localBounds, mMeshData.mNbVertices, mMeshData.mVertices); + + // Derive a good geometric epsilon from local bounds. We must do this before bounds extrusion for heightfields. + // + // From Charles Bloom: + // "Epsilon must be big enough so that the consistency condition abs(D(Hit)) + // <= Epsilon is satisfied for all queries. You want the smallest epsilon + // you can have that meets that constraint. Normal floats have a 24 bit + // mantissa. When you do any float addition, you may have round-off error + // that makes the result off by roughly 2^-24 * result. Our result is + // scaled by the position values. If our world is strictly required to be + // in a box of world size W (each coordinate in -W to W), then the maximum + // error is 2^-24 * W. Thus Epsilon must be at least >= 2^-24 * W. If + // you're doing coordinate transforms, that may scale your error up by some + // amount, so you'll need a bigger epsilon. In general something like + // 2^-22*W is reasonable. If you allow scaled transforms, it needs to be + // something like 2^-22*W*MAX_SCALE." + // PT: TODO: runtime checkings for this + PxReal geomEpsilon = 0.0f; + for (PxU32 i = 0; i < 3; i++) + geomEpsilon = PxMax(geomEpsilon, PxMax(PxAbs(localBounds.maximum[i]), PxAbs(localBounds.minimum[i]))); + geomEpsilon *= powf(2.0f, -22.0f); + mMeshData.mGeomEpsilon = geomEpsilon; + +#ifdef PROFILE_BOUNDS + int deltaTime = timeGetTime() - time; + printf("Bounds time: %f\n", float(deltaTime)*0.001f); +#endif +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + +void TriangleMeshBuilder::checkMeshIndicesSize() +{ + Gu::TriangleMeshData& m = mMeshData; + + // check if we can change indices from 32bits to 16bits + if(m.mNbVertices <= 0xffff && !m.has16BitIndices()) + { + const PxU32 numTriangles = m.mNbTriangles; + PxU32* PX_RESTRICT indices32 = reinterpret_cast<PxU32*> (m.mTriangles); + + m.mTriangles = 0; // force a realloc + m.allocateTriangles(numTriangles, false); + PX_ASSERT(m.has16BitIndices()); // realloc'ing without the force32bit flag changed it. + + PxU16* PX_RESTRICT indices16 = reinterpret_cast<PxU16*> (m.mTriangles); + for (PxU32 i = 0; i < numTriangles*3; i++) + indices16[i] = Ps::to16(indices32[i]); + + PX_FREE(indices32); + + onMeshIndexFormatChange(); + } +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + +BV4TriangleMeshBuilder::BV4TriangleMeshBuilder(const PxCookingParams& params) : TriangleMeshBuilder(mData, params) +{ +} + +BV4TriangleMeshBuilder::~BV4TriangleMeshBuilder() +{ +} + +void BV4TriangleMeshBuilder::onMeshIndexFormatChange() +{ + IndTri32* triangles32 = NULL; + IndTri16* triangles16 = NULL; + if(mMeshData.mFlags & PxTriangleMeshFlag::e16_BIT_INDICES) + triangles16 = reinterpret_cast<IndTri16*>(mMeshData.mTriangles); + else + triangles32 = reinterpret_cast<IndTri32*>(mMeshData.mTriangles); + + mData.mMeshInterface.setPointers(triangles32, triangles16, mMeshData.mVertices); +} + +void BV4TriangleMeshBuilder::createMidPhaseStructure() +{ + const float gBoxEpsilon = 2e-4f; +// const float gBoxEpsilon = 0.1f; + mData.mMeshInterface.initRemap(); + mData.mMeshInterface.setNbVertices(mMeshData.mNbVertices); + mData.mMeshInterface.setNbTriangles(mMeshData.mNbTriangles); + + IndTri32* triangles32 = NULL; + IndTri16* triangles16 = NULL; + if (mMeshData.mFlags & PxTriangleMeshFlag::e16_BIT_INDICES) + { + triangles16 = reinterpret_cast<IndTri16*>(mMeshData.mTriangles); + } + else + { + triangles32 = reinterpret_cast<IndTri32*>(mMeshData.mTriangles); + } + + mData.mMeshInterface.setPointers(triangles32, triangles16, mMeshData.mVertices); + + const PxU32 nbTrisPerLeaf = (mParams.midphaseDesc.getType() == PxMeshMidPhase::eBVH34) ? mParams.midphaseDesc.mBVH34Desc.numTrisPerLeaf : 4; + + if(!BuildBV4Ex(mData.mBV4Tree, mData.mMeshInterface, gBoxEpsilon, nbTrisPerLeaf)) + { + Ps::getFoundation().error(PxErrorCode::eINTERNAL_ERROR, __FILE__, __LINE__, "BV4 tree failed to build."); + return; + } + +// remapTopology(mData.mMeshInterface); + + const PxU32* order = mData.mMeshInterface.getRemap(); + if(mMeshData.mMaterialIndices) + { + PxMaterialTableIndex* newMat = PX_NEW(PxMaterialTableIndex)[mMeshData.mNbTriangles]; + for(PxU32 i=0;i<mMeshData.mNbTriangles;i++) + newMat[i] = mMeshData.mMaterialIndices[order[i]]; + PX_DELETE_POD(mMeshData.mMaterialIndices); + mMeshData.mMaterialIndices = newMat; + } + + if (!mParams.suppressTriangleMeshRemapTable || mParams.buildGPUData) + { + PxU32* newMap = PX_NEW(PxU32)[mMeshData.mNbTriangles]; + for(PxU32 i=0;i<mMeshData.mNbTriangles;i++) + newMap[i] = mMeshData.mFaceRemap ? mMeshData.mFaceRemap[order[i]] : order[i]; + PX_DELETE_POD(mMeshData.mFaceRemap); + mMeshData.mFaceRemap = newMap; + } + mData.mMeshInterface.releaseRemap(); +} + +void BV4TriangleMeshBuilder::saveMidPhaseStructure(PxOutputStream& stream) const +{ + const PxU32 version = 1; + + const bool mismatch = (littleEndian() == 1); + writeChunk('B', 'V', '4', ' ', stream); + writeDword(version, mismatch, stream); + + writeFloat(mData.mBV4Tree.mLocalBounds.mCenter.x, mismatch, stream); + writeFloat(mData.mBV4Tree.mLocalBounds.mCenter.y, mismatch, stream); + writeFloat(mData.mBV4Tree.mLocalBounds.mCenter.z, mismatch, stream); + writeFloat(mData.mBV4Tree.mLocalBounds.mExtentsMagnitude, mismatch, stream); + + writeDword(mData.mBV4Tree.mInitData, mismatch, stream); +#ifdef GU_BV4_QUANTIZED_TREE + writeFloat(mData.mBV4Tree.mCenterOrMinCoeff.x, mismatch, stream); + writeFloat(mData.mBV4Tree.mCenterOrMinCoeff.y, mismatch, stream); + writeFloat(mData.mBV4Tree.mCenterOrMinCoeff.z, mismatch, stream); + writeFloat(mData.mBV4Tree.mExtentsOrMaxCoeff.x, mismatch, stream); + writeFloat(mData.mBV4Tree.mExtentsOrMaxCoeff.y, mismatch, stream); + writeFloat(mData.mBV4Tree.mExtentsOrMaxCoeff.z, mismatch, stream); +#endif + writeDword(mData.mBV4Tree.mNbNodes, mismatch, stream); + for(PxU32 i=0;i<mData.mBV4Tree.mNbNodes;i++) + { + const BVDataPacked& node = mData.mBV4Tree.mNodes[i]; +#ifdef GU_BV4_QUANTIZED_TREE + writeWordBuffer(&node.mAABB.mData[0].mExtents, 6, mismatch, stream); +#else + writeFloatBuffer(&node.mAABB.mCenter.x, 6, mismatch, stream); +#endif + writeDword(node.mData, mismatch, stream); + } +} + + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + +void BV32TriangleMeshBuilder::createMidPhaseStructure(const PxCookingParams& params, Gu::TriangleMeshData& meshData, Gu::BV32Tree& bv32Tree) +{ + const float gBoxEpsilon = 2e-4f; + + Gu::SourceMesh meshInterface; + // const float gBoxEpsilon = 0.1f; + meshInterface.initRemap(); + meshInterface.setNbVertices(meshData.mNbVertices); + meshInterface.setNbTriangles(meshData.mNbTriangles); + + PX_ASSERT(!(meshData.mFlags & PxTriangleMeshFlag::e16_BIT_INDICES)); + + IndTri32* triangles32 = reinterpret_cast<IndTri32*>(meshData.mGRB_triIndices); + + meshInterface.setPointers(triangles32, NULL, meshData.mVertices); + + PxU32 nbTrisPerLeaf = 32; + + if (!BuildBV32Ex(bv32Tree, meshInterface, gBoxEpsilon, nbTrisPerLeaf)) + { + Ps::getFoundation().error(PxErrorCode::eINTERNAL_ERROR, __FILE__, __LINE__, "BV32 tree failed to build."); + return; + } + + const PxU32* order = meshInterface.getRemap(); + + if (!params.suppressTriangleMeshRemapTable || params.buildGPUData) + { + PxU32* newMap = PX_NEW(PxU32)[meshData.mNbTriangles]; + for (PxU32 i = 0; i<meshData.mNbTriangles; i++) + newMap[i] = meshData.mGRB_faceRemap ? meshData.mGRB_faceRemap[order[i]] : order[i]; + PX_DELETE_POD(meshData.mGRB_faceRemap); + meshData.mGRB_faceRemap = newMap; + } + + meshInterface.releaseRemap(); + +} + +void BV32TriangleMeshBuilder::saveMidPhaseStructure(Gu::BV32Tree* bv32Tree, PxOutputStream& stream) +{ + const PxU32 version = 1; + + const bool mismatch = (littleEndian() == 1); + writeChunk('B', 'V', '3', '2', stream); + writeDword(version, mismatch, stream); + + writeFloat(bv32Tree->mLocalBounds.mCenter.x, mismatch, stream); + writeFloat(bv32Tree->mLocalBounds.mCenter.y, mismatch, stream); + writeFloat(bv32Tree->mLocalBounds.mCenter.z, mismatch, stream); + writeFloat(bv32Tree->mLocalBounds.mExtentsMagnitude, mismatch, stream); + + writeDword(bv32Tree->mInitData, mismatch, stream); + + writeDword(bv32Tree->mNbPackedNodes, mismatch, stream); + + PX_ASSERT(bv32Tree->mNbPackedNodes > 0); + for (PxU32 i = 0; i < bv32Tree->mNbPackedNodes; ++i) + { + BV32DataPacked& node = bv32Tree->mPackedNodes[i]; + + const PxU32 nbElements = node.mNbNodes * 4; + writeDword(node.mNbNodes, mismatch, stream); + WriteDwordBuffer(node.mData, node.mNbNodes, mismatch, stream); + writeFloatBuffer(&node.mCenter[0].x, nbElements, mismatch, stream); + writeFloatBuffer(&node.mExtents[0].x, nbElements, mismatch, stream); + + } +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + +RTreeTriangleMeshBuilder::RTreeTriangleMeshBuilder(const PxCookingParams& params) : TriangleMeshBuilder(mData, params) +{ +} + +RTreeTriangleMeshBuilder::~RTreeTriangleMeshBuilder() +{ +} + +struct RTreeCookerRemap : RTreeCooker::RemapCallback +{ + PxU32 mNbTris; + RTreeCookerRemap(PxU32 numTris) : mNbTris(numTris) + { + } + + virtual void remap(PxU32* val, PxU32 start, PxU32 leafCount) + { + PX_ASSERT(leafCount > 0); + PX_ASSERT(leafCount <= 16); // sanity check + PX_ASSERT(start < mNbTris); + PX_ASSERT(start+leafCount <= mNbTris); + PX_ASSERT(val); + LeafTriangles lt; + // here we remap from ordered leaf index in the rtree to index in post-remap in triangles + // this post-remap will happen later + lt.SetData(leafCount, start); + *val = lt.Data; + } +}; + +void RTreeTriangleMeshBuilder::createMidPhaseStructure() +{ + const PxReal meshSizePerformanceTradeOff = (mParams.midphaseDesc.getType() == PxMeshMidPhase::eINVALID) ? + mParams.meshSizePerformanceTradeOff : mParams.midphaseDesc.mBVH33Desc.meshSizePerformanceTradeOff; + const PxMeshCookingHint::Enum meshCookingHint = (mParams.midphaseDesc.getType() == PxMeshMidPhase::eINVALID) ? + mParams.meshCookingHint : mParams.midphaseDesc.mBVH33Desc.meshCookingHint; + + Array<PxU32> resultPermute; + RTreeCookerRemap rc(mMeshData.mNbTriangles); + RTreeCooker::buildFromTriangles( + mData.mRTree, + mMeshData.mVertices, mMeshData.mNbVertices, + (mMeshData.mFlags & PxTriangleMeshFlag::e16_BIT_INDICES) ? reinterpret_cast<PxU16*>(mMeshData.mTriangles) : NULL, + !(mMeshData.mFlags & PxTriangleMeshFlag::e16_BIT_INDICES) ? reinterpret_cast<PxU32*>(mMeshData.mTriangles) : NULL, + mMeshData.mNbTriangles, resultPermute, &rc, meshSizePerformanceTradeOff, meshCookingHint); + + PX_ASSERT(resultPermute.size() == mMeshData.mNbTriangles); + + remapTopology(resultPermute.begin()); +} + +static void saveRTreeData(PxOutputStream& stream, const RTree& d) +{ + // save the RTree root structure followed immediately by RTreePage pages to an output stream + const bool mismatch = (littleEndian() == 1); + writeChunk('R', 'T', 'R', 'E', stream); + writeDword(RTREE_COOK_VERSION, mismatch, stream); + writeFloatBuffer(&d.mBoundsMin.x, 4, mismatch, stream); + writeFloatBuffer(&d.mBoundsMax.x, 4, mismatch, stream); + writeFloatBuffer(&d.mInvDiagonal.x, 4, mismatch, stream); + writeFloatBuffer(&d.mDiagonalScaler.x, 4, mismatch, stream); + writeDword(d.mPageSize, mismatch, stream); + writeDword(d.mNumRootPages, mismatch, stream); + writeDword(d.mNumLevels, mismatch, stream); + writeDword(d.mTotalNodes, mismatch, stream); + writeDword(d.mTotalPages, mismatch, stream); + PxU32 unused = 0; writeDword(unused, mismatch, stream); // backwards compatibility + for (PxU32 j = 0; j < d.mTotalPages; j++) + { + writeFloatBuffer(d.mPages[j].minx, RTREE_N, mismatch, stream); + writeFloatBuffer(d.mPages[j].miny, RTREE_N, mismatch, stream); + writeFloatBuffer(d.mPages[j].minz, RTREE_N, mismatch, stream); + writeFloatBuffer(d.mPages[j].maxx, RTREE_N, mismatch, stream); + writeFloatBuffer(d.mPages[j].maxy, RTREE_N, mismatch, stream); + writeFloatBuffer(d.mPages[j].maxz, RTREE_N, mismatch, stream); + WriteDwordBuffer(d.mPages[j].ptrs, RTREE_N, mismatch, stream); + } +} + +void RTreeTriangleMeshBuilder::saveMidPhaseStructure(PxOutputStream& stream) const +{ + // Export RTree + saveRTreeData(stream, mData.mRTree); +} + +/////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////////// + +} diff --git a/PhysX_3.4/Source/PhysXCooking/src/mesh/TriangleMeshBuilder.h b/PhysX_3.4/Source/PhysXCooking/src/mesh/TriangleMeshBuilder.h new file mode 100644 index 00000000..639d0a12 --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/mesh/TriangleMeshBuilder.h @@ -0,0 +1,120 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + + +#ifndef PX_COLLISION_TriangleMeshBUILDER +#define PX_COLLISION_TriangleMeshBUILDER + +#include "GuMeshData.h" +#include "cooking/PxCooking.h" + +namespace physx +{ + namespace Gu + { + class EdgeListBuilder; + } + + class TriangleMeshBuilder + { + public: + TriangleMeshBuilder(Gu::TriangleMeshData& mesh, const PxCookingParams& params); + virtual ~TriangleMeshBuilder(); + + virtual PxMeshMidPhase::Enum getMidphaseID() const = 0; + // Called by base code when midphase structure should be built + virtual void createMidPhaseStructure() = 0; + // Called by base code when midphase structure should be saved + virtual void saveMidPhaseStructure(PxOutputStream& stream) const = 0; + // Called by base code when mesh index format has changed and the change should be reflected in midphase structure + virtual void onMeshIndexFormatChange() {} + + bool cleanMesh(bool validate, PxTriangleMeshCookingResult::Enum* condition); + void remapTopology(const PxU32* order); + + void createSharedEdgeData(bool buildAdjacencies, bool buildActiveEdges); + + void recordTriangleIndices(); + void createGRBMidPhaseAndData(const PxU32 originalTriangleCount); + void createGRBData(); + + bool loadFromDesc(const PxTriangleMeshDesc&, PxTriangleMeshCookingResult::Enum* condition ,bool validate = false); + bool save(PxOutputStream& stream, bool platformMismatch, const PxCookingParams& params) const; + void checkMeshIndicesSize(); + PX_FORCE_INLINE Gu::TriangleMeshData& getMeshData() { return mMeshData; } + protected: + void computeLocalBounds(); + bool importMesh(const PxTriangleMeshDesc& desc, const PxCookingParams& params, PxTriangleMeshCookingResult::Enum* condition ,bool validate = false); + + TriangleMeshBuilder& operator=(const TriangleMeshBuilder&); + Gu::EdgeListBuilder* edgeList; + const PxCookingParams& mParams; + Gu::TriangleMeshData& mMeshData; + + void releaseEdgeList(); + void createEdgeList(); + }; + + class RTreeTriangleMeshBuilder : public TriangleMeshBuilder + { + public: + RTreeTriangleMeshBuilder(const PxCookingParams& params); + virtual ~RTreeTriangleMeshBuilder(); + + virtual PxMeshMidPhase::Enum getMidphaseID() const { return PxMeshMidPhase::eBVH33; } + virtual void createMidPhaseStructure(); + virtual void saveMidPhaseStructure(PxOutputStream& stream) const; + + Gu::RTreeTriangleData mData; + }; + + class BV4TriangleMeshBuilder : public TriangleMeshBuilder + { + public: + BV4TriangleMeshBuilder(const PxCookingParams& params); + virtual ~BV4TriangleMeshBuilder(); + + virtual PxMeshMidPhase::Enum getMidphaseID() const { return PxMeshMidPhase::eBVH34; } + virtual void createMidPhaseStructure(); + virtual void saveMidPhaseStructure(PxOutputStream& stream) const; + virtual void onMeshIndexFormatChange(); + + Gu::BV4TriangleData mData; + }; + + class BV32TriangleMeshBuilder + { + public: + static void createMidPhaseStructure(const PxCookingParams& params, Gu::TriangleMeshData& meshData, Gu::BV32Tree& bv32Tree); + static void saveMidPhaseStructure(Gu::BV32Tree* tree, PxOutputStream& stream); + }; + +} + +#endif diff --git a/PhysX_3.4/Source/PhysXCooking/src/windows/WindowsCookingDelayLoadHook.cpp b/PhysX_3.4/Source/PhysXCooking/src/windows/WindowsCookingDelayLoadHook.cpp new file mode 100644 index 00000000..9652bccb --- /dev/null +++ b/PhysX_3.4/Source/PhysXCooking/src/windows/WindowsCookingDelayLoadHook.cpp @@ -0,0 +1,82 @@ +// This code contains NVIDIA Confidential Information and is disclosed to you +// under a form of NVIDIA software license agreement provided separately to you. +// +// Notice +// NVIDIA Corporation and its licensors retain all intellectual property and +// proprietary rights in and to this software and related documentation and +// any modifications thereto. Any use, reproduction, disclosure, or +// distribution of this software and related documentation without an express +// license agreement from NVIDIA Corporation is strictly prohibited. +// +// ALL NVIDIA DESIGN SPECIFICATIONS, CODE ARE PROVIDED "AS IS.". NVIDIA MAKES +// NO WARRANTIES, EXPRESSED, IMPLIED, STATUTORY, OR OTHERWISE WITH RESPECT TO +// THE MATERIALS, AND EXPRESSLY DISCLAIMS ALL IMPLIED WARRANTIES OF NONINFRINGEMENT, +// MERCHANTABILITY, AND FITNESS FOR A PARTICULAR PURPOSE. +// +// Information and code furnished is believed to be accurate and reliable. +// However, NVIDIA Corporation assumes no responsibility for the consequences of use of such +// information or for any infringement of patents or other rights of third parties that may +// result from its use. No license is granted by implication or otherwise under any patent +// or patent rights of NVIDIA Corporation. Details are subject to change without notice. +// This code supersedes and replaces all information previously supplied. +// NVIDIA Corporation products are not authorized for use as critical +// components in life support devices or systems without express written approval of +// NVIDIA Corporation. +// +// Copyright (c) 2008-2016 NVIDIA Corporation. All rights reserved. +// Copyright (c) 2004-2008 AGEIA Technologies, Inc. All rights reserved. +// Copyright (c) 2001-2004 NovodeX AG. All rights reserved. + + +#include "windows/PxWindowsDelayLoadHook.h" +#include "windows/PsWindowsInclude.h" +#include "windows/CmWindowsLoadLibrary.h" + +// Prior to Visual Studio 2015 Update 3, these hooks were non-const. +#define DELAYIMP_INSECURE_WRITABLE_HOOKS +#include <delayimp.h> + +static const physx::PxDelayLoadHook* gDelayLoadHook = NULL; + +void physx::PxSetPhysXCookingDelayLoadHook(const physx::PxDelayLoadHook* hook) +{ + gDelayLoadHook = hook; +} + +using namespace physx; + +#pragma comment(lib, "delayimp") + +FARPROC WINAPI delayHook(unsigned dliNotify, PDelayLoadInfo pdli) +{ + switch (dliNotify) { + case dliStartProcessing : + break; + + case dliNotePreLoadLibrary : + { + return Cm::physXCommonDliNotePreLoadLibrary(pdli->szDll,gDelayLoadHook); + } + break; + + case dliNotePreGetProcAddress : + break; + + case dliFailLoadLib : + break; + + case dliFailGetProc : + break; + + case dliNoteEndProcessing : + break; + + default : + + return NULL; + } + + return NULL; +} + +PfnDliHook __pfnDliNotifyHook2 = delayHook; |