diff options
Diffstat (limited to 'openssl/src/ssl/mod.rs')
| -rw-r--r-- | openssl/src/ssl/mod.rs | 79 |
1 files changed, 42 insertions, 37 deletions
diff --git a/openssl/src/ssl/mod.rs b/openssl/src/ssl/mod.rs index 30821f4e..dc23b79d 100644 --- a/openssl/src/ssl/mod.rs +++ b/openssl/src/ssl/mod.rs @@ -306,9 +306,12 @@ fn wrap_ssl_result(res: c_int) -> Option<SslError> { /// An SSL context object pub struct SslContext { - ctx: ptr::Unique<ffi::SSL_CTX> + ctx: *mut ffi::SSL_CTX } +unsafe impl Send for SslContext {} +unsafe impl Sync for SslContext {} + // TODO: add useful info here impl fmt::Debug for SslContext { fn fmt(&self, fmt: &mut fmt::Formatter) -> fmt::Result { @@ -318,7 +321,7 @@ impl fmt::Debug for SslContext { impl Drop for SslContext { fn drop(&mut self) { - unsafe { ffi::SSL_CTX_free(*self.ctx) } + unsafe { ffi::SSL_CTX_free(self.ctx) } } } @@ -332,19 +335,18 @@ impl SslContext { return Err(SslError::get()); } - let ctx = unsafe { SslContext { ctx: ptr::Unique::new(ctx) } }; - Ok(ctx) + Ok(SslContext { ctx: ctx }) } /// Configures the certificate verification method for new connections. pub fn set_verify(&mut self, mode: SslVerifyMode, verify: Option<VerifyCallback>) { unsafe { - ffi::SSL_CTX_set_ex_data(*self.ctx, VERIFY_IDX, + ffi::SSL_CTX_set_ex_data(self.ctx, VERIFY_IDX, mem::transmute(verify)); let f: extern fn(c_int, *mut ffi::X509_STORE_CTX) -> c_int = raw_verify; - ffi::SSL_CTX_set_verify(*self.ctx, mode as c_int, Some(f)); + ffi::SSL_CTX_set_verify(self.ctx, mode as c_int, Some(f)); } } @@ -358,20 +360,20 @@ impl SslContext { where T: Any + 'static { let data = Box::new(data); unsafe { - ffi::SSL_CTX_set_ex_data(*self.ctx, VERIFY_IDX, + ffi::SSL_CTX_set_ex_data(self.ctx, VERIFY_IDX, mem::transmute(Some(verify))); - ffi::SSL_CTX_set_ex_data(*self.ctx, get_verify_data_idx::<T>(), + ffi::SSL_CTX_set_ex_data(self.ctx, get_verify_data_idx::<T>(), mem::transmute(data)); let f: extern fn(c_int, *mut ffi::X509_STORE_CTX) -> c_int = raw_verify_with_data::<T>; - ffi::SSL_CTX_set_verify(*self.ctx, mode as c_int, Some(f)); + ffi::SSL_CTX_set_verify(self.ctx, mode as c_int, Some(f)); } } /// Sets verification depth pub fn set_verify_depth(&mut self, depth: u32) { unsafe { - ffi::SSL_CTX_set_verify_depth(*self.ctx, depth as c_int); + ffi::SSL_CTX_set_verify_depth(self.ctx, depth as c_int); } } @@ -381,7 +383,7 @@ impl SslContext { let file = CString::new(file.as_os_str().to_str().expect("invalid utf8")).unwrap(); wrap_ssl_result( unsafe { - ffi::SSL_CTX_load_verify_locations(*self.ctx, file.as_ptr(), ptr::null()) + ffi::SSL_CTX_load_verify_locations(self.ctx, file.as_ptr(), ptr::null()) }) } @@ -391,7 +393,7 @@ impl SslContext { let file = CString::new(file.as_os_str().to_str().expect("invalid utf8")).unwrap(); wrap_ssl_result( unsafe { - ffi::SSL_CTX_use_certificate_file(*self.ctx, file.as_ptr(), file_type as c_int) + ffi::SSL_CTX_use_certificate_file(self.ctx, file.as_ptr(), file_type as c_int) }) } @@ -401,7 +403,7 @@ impl SslContext { let file = CString::new(file.as_os_str().to_str().expect("invalid utf8")).unwrap(); wrap_ssl_result( unsafe { - ffi::SSL_CTX_use_PrivateKey_file(*self.ctx, file.as_ptr(), file_type as c_int) + ffi::SSL_CTX_use_PrivateKey_file(self.ctx, file.as_ptr(), file_type as c_int) }) } @@ -409,21 +411,21 @@ impl SslContext { wrap_ssl_result( unsafe { let cipher_list = CString::new(cipher_list.as_bytes()).unwrap(); - ffi::SSL_CTX_set_cipher_list(*self.ctx, cipher_list.as_ptr()) + ffi::SSL_CTX_set_cipher_list(self.ctx, cipher_list.as_ptr()) }) } pub fn set_options(&mut self, option: SslContextOptions) -> SslContextOptions { let raw_bits = option.bits(); let ret = unsafe { - ffi::SSL_CTX_set_options(*self.ctx, raw_bits) + ffi::SSL_CTX_set_options(self.ctx, raw_bits) }; SslContextOptions::from_bits(ret).unwrap() } pub fn get_options(&mut self) -> SslContextOptions { let ret = unsafe { - ffi::SSL_CTX_get_options(*self.ctx) + ffi::SSL_CTX_get_options(self.ctx) }; SslContextOptions::from_bits(ret).unwrap() } @@ -431,7 +433,7 @@ impl SslContext { pub fn clear_options(&mut self, option: SslContextOptions) -> SslContextOptions { let raw_bits = option.bits(); let ret = unsafe { - ffi::SSL_CTX_clear_options(*self.ctx, raw_bits) + ffi::SSL_CTX_clear_options(self.ctx, raw_bits) }; SslContextOptions::from_bits(ret).unwrap() } @@ -456,15 +458,15 @@ impl SslContext { unsafe { // Attach the protocol list to the OpenSSL context structure, // so that we can refer to it within the callback. - ffi::SSL_CTX_set_ex_data(*self.ctx, get_npn_protos_idx(), + ffi::SSL_CTX_set_ex_data(self.ctx, get_npn_protos_idx(), mem::transmute(protocols)); // Now register the callback that performs the default protocol // matching based on the client-supported list of protocols that // has been saved. - ffi::SSL_CTX_set_next_proto_select_cb(*self.ctx, raw_next_proto_select_cb, ptr::null_mut()); + ffi::SSL_CTX_set_next_proto_select_cb(self.ctx, raw_next_proto_select_cb, ptr::null_mut()); // Also register the callback to advertise these protocols, if a server socket is // created with the context. - ffi::SSL_CTX_set_next_protos_advertised_cb(*self.ctx, raw_next_protos_advertise_cb, ptr::null_mut()); + ffi::SSL_CTX_set_next_protos_advertised_cb(self.ctx, raw_next_protos_advertise_cb, ptr::null_mut()); } } } @@ -490,9 +492,12 @@ impl<'ssl> DerefMut for MemBioRef<'ssl> { } pub struct Ssl { - ssl: ptr::Unique<ffi::SSL> + ssl: *mut ffi::SSL } +unsafe impl Send for Ssl {} +unsafe impl Sync for Ssl {} + // TODO: put useful information here impl fmt::Debug for Ssl { fn fmt(&self, fmt: &mut fmt::Formatter) -> fmt::Result { @@ -502,31 +507,31 @@ impl fmt::Debug for Ssl { impl Drop for Ssl { fn drop(&mut self) { - unsafe { ffi::SSL_free(*self.ssl) } + unsafe { ffi::SSL_free(self.ssl) } } } impl Ssl { pub fn new(ctx: &SslContext) -> Result<Ssl, SslError> { - let ssl = unsafe { ffi::SSL_new(*ctx.ctx) }; + let ssl = unsafe { ffi::SSL_new(ctx.ctx) }; if ssl == ptr::null_mut() { return Err(SslError::get()); } - let ssl = unsafe { Ssl { ssl: ptr::Unique::new(ssl) } }; + let ssl = Ssl { ssl: ssl }; let rbio = try!(MemBio::new()); let wbio = try!(MemBio::new()); - unsafe { ffi::SSL_set_bio(*ssl.ssl, rbio.unwrap(), wbio.unwrap()) } + unsafe { ffi::SSL_set_bio(ssl.ssl, rbio.unwrap(), wbio.unwrap()) } Ok(ssl) } fn get_rbio<'a>(&'a self) -> MemBioRef<'a> { - unsafe { self.wrap_bio(ffi::SSL_get_rbio(*self.ssl)) } + unsafe { self.wrap_bio(ffi::SSL_get_rbio(self.ssl)) } } fn get_wbio<'a>(&'a self) -> MemBioRef<'a> { - unsafe { self.wrap_bio(ffi::SSL_get_wbio(*self.ssl)) } + unsafe { self.wrap_bio(ffi::SSL_get_wbio(self.ssl)) } } fn wrap_bio<'a>(&'a self, bio: *mut ffi::BIO) -> MemBioRef<'a> { @@ -538,25 +543,25 @@ impl Ssl { } fn connect(&self) -> c_int { - unsafe { ffi::SSL_connect(*self.ssl) } + unsafe { ffi::SSL_connect(self.ssl) } } fn accept(&self) -> c_int { - unsafe { ffi::SSL_accept(*self.ssl) } + unsafe { ffi::SSL_accept(self.ssl) } } fn read(&self, buf: &mut [u8]) -> c_int { let len = cmp::min(c_int::max_value() as usize, buf.len()) as c_int; - unsafe { ffi::SSL_read(*self.ssl, buf.as_ptr() as *mut c_void, len) } + unsafe { ffi::SSL_read(self.ssl, buf.as_ptr() as *mut c_void, len) } } fn write(&self, buf: &[u8]) -> c_int { let len = cmp::min(c_int::max_value() as usize, buf.len()) as c_int; - unsafe { ffi::SSL_write(*self.ssl, buf.as_ptr() as *const c_void, len) } + unsafe { ffi::SSL_write(self.ssl, buf.as_ptr() as *const c_void, len) } } fn get_error(&self, ret: c_int) -> LibSslError { - let err = unsafe { ffi::SSL_get_error(*self.ssl, ret) }; + let err = unsafe { ffi::SSL_get_error(self.ssl, ret) }; match LibSslError::from_i32(err as i32) { Some(err) => err, None => unreachable!() @@ -571,7 +576,7 @@ impl Ssl { // SSL_ctrl(s,SSL_CTRL_SET_TLSEXT_HOSTNAME,TLSEXT_NAMETYPE_host_name,(char *)name) let hostname = CString::new(hostname.as_bytes()).unwrap(); - ffi::SSL_ctrl(*self.ssl, ffi::SSL_CTRL_SET_TLSEXT_HOSTNAME, + ffi::SSL_ctrl(self.ssl, ffi::SSL_CTRL_SET_TLSEXT_HOSTNAME, ffi::TLSEXT_NAMETYPE_host_name, hostname.as_ptr() as *mut c_void) }; @@ -586,7 +591,7 @@ impl Ssl { pub fn get_peer_certificate(&self) -> Option<X509> { unsafe { - let ptr = ffi::SSL_get_peer_certificate(*self.ssl); + let ptr = ffi::SSL_get_peer_certificate(self.ssl); if ptr.is_null() { None } else { @@ -608,7 +613,7 @@ impl Ssl { let mut len: c_uint = 0; // Get the negotiated protocol from the SSL instance. // `data` will point at a `c_uchar` array; `len` will contain the length of this array. - ffi::SSL_get0_next_proto_negotiated(*self.ssl, &mut data, &mut len); + ffi::SSL_get0_next_proto_negotiated(self.ssl, &mut data, &mut len); if data.is_null() { None @@ -744,7 +749,7 @@ impl<S: Read+Write> SslStream<S> { fn in_retry_wrapper<F>(&mut self, mut blk: F) -> Result<c_int, SslError> where F: FnMut(&Ssl) -> c_int { loop { - let ret = blk(&*self.ssl); + let ret = blk(&self.ssl); if ret > 0 { return Ok(ret); } @@ -775,7 +780,7 @@ impl<S: Read+Write> SslStream<S> { /// either None, indicating no compression is in use, or a string /// with the compression name. pub fn get_compression(&self) -> Option<String> { - let ptr = unsafe { ffi::SSL_get_current_compression(*self.ssl.ssl) }; + let ptr = unsafe { ffi::SSL_get_current_compression(self.ssl.ssl) }; if ptr == ptr::null() { return None; } |