aboutsummaryrefslogtreecommitdiff
path: root/openssl/src/ssl/mod.rs
diff options
context:
space:
mode:
authorSteven Fackler <[email protected]>2015-07-06 11:09:19 -0700
committerSteven Fackler <[email protected]>2015-07-06 11:09:19 -0700
commit114e8a5a58a8fb3c4cc37391fc2f5a7addd796fc (patch)
treed35618791cfc3bf1815b310639f74185a0d0464d /openssl/src/ssl/mod.rs
parentMerge branch 'release-v0.6.3' into release (diff)
parentRelease v0.6.4 (diff)
downloadrust-openssl-0.6.4.tar.xz
rust-openssl-0.6.4.zip
Merge branch 'release-v0.6.4' into releasev0.6.4
Diffstat (limited to 'openssl/src/ssl/mod.rs')
-rw-r--r--openssl/src/ssl/mod.rs691
1 files changed, 530 insertions, 161 deletions
diff --git a/openssl/src/ssl/mod.rs b/openssl/src/ssl/mod.rs
index a0f97b17..88ba9af4 100644
--- a/openssl/src/ssl/mod.rs
+++ b/openssl/src/ssl/mod.rs
@@ -13,9 +13,9 @@ use std::sync::{Once, ONCE_INIT, Arc, Mutex};
use std::ops::{Deref, DerefMut};
use std::cmp;
use std::any::Any;
-#[cfg(feature = "npn")]
+#[cfg(any(feature = "npn", feature = "alpn"))]
use libc::{c_uchar, c_uint};
-#[cfg(feature = "npn")]
+#[cfg(any(feature = "npn", feature = "alpn"))]
use std::slice;
use bio::{MemBio};
@@ -170,49 +170,37 @@ lazy_static! {
// Registers a destructor for the data which will be called
// when context is freed
fn get_verify_data_idx<T: Any + 'static>() -> c_int {
- extern fn free_data_box<T>(_parent: *mut c_void, ptr: *mut c_void,
- _ad: *mut ffi::CRYPTO_EX_DATA, _idx: c_int,
- _argl: c_long, _argp: *mut c_void) {
- if ptr != 0 as *mut _ {
- let _: Box<T> = unsafe { mem::transmute(ptr) };
- }
- }
-
*INDEXES.lock().unwrap().entry(TypeId::of::<T>()).or_insert_with(|| {
- unsafe {
- let f: ffi::CRYPTO_EX_free = free_data_box::<T>;
- let idx = ffi::SSL_CTX_get_ex_new_index(0, ptr::null(), None, None, Some(f));
- assert!(idx >= 0);
- idx
- }
+ get_new_idx::<T>()
})
}
-/// Creates a static index for the list of NPN protocols.
-/// Registers a destructor for the data which will be called
-/// when the context is freed.
#[cfg(feature = "npn")]
-fn get_npn_protos_idx() -> c_int {
- static mut NPN_PROTOS_IDX: c_int = -1;
- static mut INIT: Once = ONCE_INIT;
+lazy_static! {
+ static ref NPN_PROTOS_IDX: c_int = get_new_idx::<Vec<u8>>();
+}
+#[cfg(feature = "alpn")]
+lazy_static! {
+ static ref ALPN_PROTOS_IDX: c_int = get_new_idx::<Vec<u8>>();
+}
- extern fn free_data_box(_parent: *mut c_void, ptr: *mut c_void,
+/// Determine a new index to use for SSL CTX ex data.
+/// Registers a destruct for the data which will be called by openssl when the context is freed.
+fn get_new_idx<T>() -> c_int {
+ extern fn free_data_box<T>(_parent: *mut c_void, ptr: *mut c_void,
_ad: *mut ffi::CRYPTO_EX_DATA, _idx: c_int,
_argl: c_long, _argp: *mut c_void) {
if !ptr.is_null() {
- let _: Box<Vec<u8>> = unsafe { mem::transmute(ptr) };
+ let _: Box<T> = unsafe { mem::transmute(ptr) };
}
}
unsafe {
- INIT.call_once(|| {
- let f: ffi::CRYPTO_EX_free = free_data_box;
- let idx = ffi::SSL_CTX_get_ex_new_index(0, ptr::null(), None,
- None, Some(f));
- assert!(idx >= 0);
- NPN_PROTOS_IDX = idx;
- });
- NPN_PROTOS_IDX
+ let f: ffi::CRYPTO_EX_free = free_data_box::<T>;
+ let idx = ffi::SSL_CTX_get_ex_new_index(0, ptr::null(), None,
+ None, Some(f));
+ assert!(idx >= 0);
+ idx
}
}
@@ -264,6 +252,26 @@ extern fn raw_verify_with_data<T>(preverify_ok: c_int,
}
}
+#[cfg(any(feature = "npn", feature = "alpn"))]
+unsafe fn select_proto_using(ssl: *mut ffi::SSL,
+ out: *mut *mut c_uchar, outlen: *mut c_uchar,
+ inbuf: *const c_uchar, inlen: c_uint,
+ ex_data: c_int) -> c_int {
+
+ // First, get the list of protocols (that the client should support) saved in the context
+ // extra data.
+ let ssl_ctx = ffi::SSL_get_SSL_CTX(ssl);
+ let protocols = ffi::SSL_CTX_get_ex_data(ssl_ctx, ex_data);
+ let protocols: &Vec<u8> = mem::transmute(protocols);
+ // Prepare the client list parameters to be passed to the OpenSSL function...
+ let client = protocols.as_ptr();
+ let client_len = protocols.len() as c_uint;
+ // Finally, let OpenSSL find a protocol to be used, by matching the given server and
+ // client lists.
+ ffi::SSL_select_next_proto(out, outlen, inbuf, inlen, client, client_len);
+ ffi::SSL_TLSEXT_ERR_OK
+}
+
/// The function is given as the callback to `SSL_CTX_set_next_proto_select_cb`.
///
/// It chooses the protocol that the client wishes to use, out of the given list of protocols
@@ -276,20 +284,18 @@ extern fn raw_next_proto_select_cb(ssl: *mut ffi::SSL,
inbuf: *const c_uchar, inlen: c_uint,
_arg: *mut c_void) -> c_int {
unsafe {
- // First, get the list of protocols (that the client should support) saved in the context
- // extra data.
- let ssl_ctx = ffi::SSL_get_SSL_CTX(ssl);
- let protocols = ffi::SSL_CTX_get_ex_data(ssl_ctx, get_npn_protos_idx());
- let protocols: &Vec<u8> = mem::transmute(protocols);
- // Prepare the client list parameters to be passed to the OpenSSL function...
- let client = protocols.as_ptr();
- let client_len = protocols.len() as c_uint;
- // Finally, let OpenSSL find a protocol to be used, by matching the given server and
- // client lists.
- ffi::SSL_select_next_proto(out, outlen, inbuf, inlen, client, client_len);
+ select_proto_using(ssl, out, outlen, inbuf, inlen, *NPN_PROTOS_IDX)
}
+}
- ffi::SSL_TLSEXT_ERR_OK
+#[cfg(feature = "alpn")]
+extern fn raw_alpn_select_cb(ssl: *mut ffi::SSL,
+ out: *mut *mut c_uchar, outlen: *mut c_uchar,
+ inbuf: *const c_uchar, inlen: c_uint,
+ _arg: *mut c_void) -> c_int {
+ unsafe {
+ select_proto_using(ssl, out, outlen, inbuf, inlen, *ALPN_PROTOS_IDX)
+ }
}
/// The function is given as the callback to `SSL_CTX_set_next_protos_advertised_cb`.
@@ -306,7 +312,7 @@ extern fn raw_next_protos_advertise_cb(ssl: *mut ffi::SSL,
unsafe {
// First, get the list of (supported) protocols saved in the context extra data.
let ssl_ctx = ffi::SSL_get_SSL_CTX(ssl);
- let protocols = ffi::SSL_CTX_get_ex_data(ssl_ctx, get_npn_protos_idx());
+ let protocols = ffi::SSL_CTX_get_ex_data(ssl_ctx, *NPN_PROTOS_IDX);
if protocols.is_null() {
*out = b"".as_ptr();
*outlen = 0;
@@ -322,6 +328,24 @@ extern fn raw_next_protos_advertise_cb(ssl: *mut ffi::SSL,
ffi::SSL_TLSEXT_ERR_OK
}
+/// Convert a set of byte slices into a series of byte strings encoded for SSL. Encoding is a byte
+/// containing the length followed by the string.
+#[cfg(any(feature = "npn", feature = "alpn"))]
+fn ssl_encode_byte_strings(strings: &[&[u8]]) -> Vec<u8>
+{
+ let mut enc = Vec::new();
+ for string in strings {
+ let len = string.len() as u8;
+ if len as usize != string.len() {
+ // If the item does not fit, discard it
+ continue;
+ }
+ enc.push(len);
+ enc.extend(string[..len as usize].to_vec());
+ }
+ enc
+}
+
/// The signature of functions that can be used to manually verify certificates
pub type VerifyCallback = fn(preverify_ok: bool,
x509_ctx: &X509StoreContext) -> bool;
@@ -495,7 +519,7 @@ impl SslContext {
pub fn set_cipher_list(&mut self, cipher_list: &str) -> Result<(),SslError> {
wrap_ssl_result(
unsafe {
- let cipher_list = CString::new(cipher_list.as_bytes()).unwrap();
+ let cipher_list = CString::new(cipher_list).unwrap();
ffi::SSL_CTX_set_cipher_list(self.ctx, cipher_list.as_ptr())
})
}
@@ -531,19 +555,12 @@ impl SslContext {
pub fn set_npn_protocols(&mut self, protocols: &[&[u8]]) {
// Firstly, convert the list of protocols to a byte-array that can be passed to OpenSSL
// APIs -- a list of length-prefixed strings.
- let mut npn_protocols = Vec::new();
- for protocol in protocols {
- let len = protocol.len() as u8;
- npn_protocols.push(len);
- // If the length is greater than the max `u8`, this truncates the protocol name.
- npn_protocols.extend(protocol[..len as usize].to_vec());
- }
- let protocols: Box<Vec<u8>> = Box::new(npn_protocols);
+ let protocols: Box<Vec<u8>> = Box::new(ssl_encode_byte_strings(protocols));
unsafe {
// Attach the protocol list to the OpenSSL context structure,
// so that we can refer to it within the callback.
- ffi::SSL_CTX_set_ex_data(self.ctx, get_npn_protos_idx(),
+ ffi::SSL_CTX_set_ex_data(self.ctx, *NPN_PROTOS_IDX,
mem::transmute(protocols));
// Now register the callback that performs the default protocol
// matching based on the client-supported list of protocols that
@@ -554,6 +571,35 @@ impl SslContext {
ffi::SSL_CTX_set_next_protos_advertised_cb(self.ctx, raw_next_protos_advertise_cb, ptr::null_mut());
}
}
+
+ /// Set the protocols to be used during ALPN (application layer protocol negotiation).
+ /// If this is a server, these are the protocols we report to the client.
+ /// If this is a client, these are the protocols we try to match with those reported by the
+ /// server.
+ ///
+ /// Note that ordering of the protocols controls the priority with which they are chosen.
+ ///
+ /// This method needs the `alpn` feature.
+ #[cfg(feature = "alpn")]
+ pub fn set_alpn_protocols(&mut self, protocols: &[&[u8]]) {
+ let protocols: Box<Vec<u8>> = Box::new(ssl_encode_byte_strings(protocols));
+ unsafe {
+ // Set the context's internal protocol list for use if we are a server
+ ffi::SSL_CTX_set_alpn_protos(self.ctx, protocols.as_ptr(), protocols.len() as c_uint);
+
+ // Rather than use the argument to the callback to contain our data, store it in the
+ // ssl ctx's ex_data so that we can configure a function to free it later. In the
+ // future, it might make sense to pull this into our internal struct Ssl instead of
+ // leaning on openssl and using function pointers.
+ ffi::SSL_CTX_set_ex_data(self.ctx, *ALPN_PROTOS_IDX,
+ mem::transmute(protocols));
+
+ // Now register the callback that performs the default protocol
+ // matching based on the client-supported list of protocols that
+ // has been saved.
+ ffi::SSL_CTX_set_alpn_select_cb(self.ctx, raw_alpn_select_cb, ptr::null_mut());
+ }
+ }
}
#[allow(dead_code)]
@@ -603,11 +649,6 @@ impl Ssl {
return Err(SslError::get());
}
let ssl = Ssl { ssl: ssl };
-
- let rbio = try!(MemBio::new());
- let wbio = try!(MemBio::new());
-
- unsafe { ffi::SSL_set_bio(ssl.ssl, rbio.unwrap(), wbio.unwrap()) }
Ok(ssl)
}
@@ -655,16 +696,8 @@ impl Ssl {
/// Set the host name to be used with SNI (Server Name Indication).
pub fn set_hostname(&self, hostname: &str) -> Result<(), SslError> {
- let ret = unsafe {
- // This is defined as a macro:
- // #define SSL_set_tlsext_host_name(s,name) \
- // SSL_ctrl(s,SSL_CTRL_SET_TLSEXT_HOSTNAME,TLSEXT_NAMETYPE_host_name,(char *)name)
-
- let hostname = CString::new(hostname.as_bytes()).unwrap();
- ffi::SSL_ctrl(self.ssl, ffi::SSL_CTRL_SET_TLSEXT_HOSTNAME,
- ffi::TLSEXT_NAMETYPE_host_name,
- hostname.as_ptr() as *mut c_void)
- };
+ let cstr = CString::new(hostname).unwrap();
+ let ret = unsafe { ffi::SSL_set_tlsext_host_name(self.ssl, cstr.as_ptr()) };
// For this case, 0 indicates failure.
if ret == 0 {
@@ -708,6 +741,29 @@ impl Ssl {
}
}
+ /// Returns the protocol selected by performing ALPN, if any.
+ ///
+ /// The protocol's name is returned is an opaque sequence of bytes. It is up to the client
+ /// to interpret it.
+ ///
+ /// This method needs the `alpn` feature.
+ #[cfg(feature = "alpn")]
+ pub fn get_selected_alpn_protocol(&self) -> Option<&[u8]> {
+ unsafe {
+ let mut data: *const c_uchar = ptr::null();
+ let mut len: c_uint = 0;
+ // Get the negotiated protocol from the SSL instance.
+ // `data` will point at a `c_uchar` array; `len` will contain the length of this array.
+ ffi::SSL_get0_alpn_selected(self.ssl, &mut data, &mut len);
+
+ if data.is_null() {
+ None
+ } else {
+ Some(slice::from_raw_parts(data, len as usize))
+ }
+ }
+ }
+
/// pending() takes into account only bytes from the TLS/SSL record that is currently being processed (if any).
pub fn pending(&self) -> usize {
unsafe {
@@ -747,71 +803,395 @@ make_LibSslError! {
ErrorWantAccept = SSL_ERROR_WANT_ACCEPT
}
-/// A stream wrapper which handles SSL encryption for an underlying stream.
+struct IndirectStream<S> {
+ stream: S,
+ ssl: Arc<Ssl>,
+ // Max TLS record size is 16k
+ buf: Box<[u8; 16 * 1024]>,
+}
+
+impl<S: Clone> Clone for IndirectStream<S> {
+ fn clone(&self) -> IndirectStream<S> {
+ IndirectStream {
+ stream: self.stream.clone(),
+ ssl: self.ssl.clone(),
+ buf: Box::new(*self.buf)
+ }
+ }
+}
+
+impl IndirectStream<net::TcpStream> {
+ fn try_clone(&self) -> io::Result<IndirectStream<net::TcpStream>> {
+ Ok(IndirectStream {
+ stream: try!(self.stream.try_clone()),
+ ssl: self.ssl.clone(),
+ buf: Box::new(*self.buf)
+ })
+ }
+}
+
+impl<S: Read+Write> IndirectStream<S> {
+ fn new_base<T: IntoSsl>(ssl: T, stream: S) -> Result<IndirectStream<S>, SslError> {
+ let ssl = try!(ssl.into_ssl());
+
+ let rbio = try!(MemBio::new());
+ let wbio = try!(MemBio::new());
+
+ unsafe { ffi::SSL_set_bio(ssl.ssl, rbio.unwrap(), wbio.unwrap()) }
+
+ Ok(IndirectStream {
+ stream: stream,
+ ssl: Arc::new(ssl),
+ buf: Box::new([0; 16 * 1024]),
+ })
+ }
+
+ fn connect<T: IntoSsl>(ssl: T, stream: S) -> Result<IndirectStream<S>, SslError> {
+ let mut ssl = try!(IndirectStream::new_base(ssl, stream));
+ try!(ssl.in_retry_wrapper(|ssl| ssl.connect()));
+ Ok(ssl)
+ }
+
+ fn accept<T: IntoSsl>(ssl: T, stream: S) -> Result<IndirectStream<S>, SslError> {
+ let mut ssl = try!(IndirectStream::new_base(ssl, stream));
+ try!(ssl.in_retry_wrapper(|ssl| ssl.accept()));
+ Ok(ssl)
+ }
+
+ fn in_retry_wrapper<F>(&mut self, mut blk: F) -> Result<c_int, SslError>
+ where F: FnMut(&Ssl) -> c_int {
+ loop {
+ let ret = blk(&self.ssl);
+ if ret > 0 {
+ return Ok(ret);
+ }
+
+ let e = self.ssl.get_error(ret);
+ match e {
+ LibSslError::ErrorWantRead => {
+ try_ssl_stream!(self.flush());
+ let len = try_ssl_stream!(self.stream.read(&mut self.buf[..]));
+ if len == 0 {
+ self.ssl.get_rbio().set_eof(true);
+ } else {
+ try_ssl_stream!(self.ssl.get_rbio().write_all(&self.buf[..len]));
+ }
+ }
+ LibSslError::ErrorWantWrite => { try_ssl_stream!(self.flush()) }
+ LibSslError::ErrorZeroReturn => return Err(SslSessionClosed),
+ LibSslError::ErrorSsl => return Err(SslError::get()),
+ LibSslError::ErrorSyscall if ret == 0 => return Ok(0),
+ err => panic!("unexpected error {:?} with ret {}", err, ret),
+ }
+ }
+ }
+
+ fn write_through(&mut self) -> io::Result<()> {
+ io::copy(&mut *self.ssl.get_wbio(), &mut self.stream).map(|_| ())
+ }
+}
+
+impl<S: Read+Write> Read for IndirectStream<S> {
+ fn read(&mut self, buf: &mut [u8]) -> io::Result<usize> {
+ match self.in_retry_wrapper(|ssl| { ssl.read(buf) }) {
+ Ok(len) => Ok(len as usize),
+ Err(SslSessionClosed) => Ok(0),
+ Err(StreamError(e)) => Err(e),
+ Err(e @ OpenSslErrors(_)) => {
+ Err(io::Error::new(io::ErrorKind::Other, e))
+ }
+ }
+ }
+}
+
+impl<S: Read+Write> Write for IndirectStream<S> {
+ fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
+ let count = match self.in_retry_wrapper(|ssl| ssl.write(buf)) {
+ Ok(len) => len as usize,
+ Err(SslSessionClosed) => 0,
+ Err(StreamError(e)) => return Err(e),
+ Err(e @ OpenSslErrors(_)) => return Err(io::Error::new(io::ErrorKind::Other, e)),
+ };
+ try!(self.write_through());
+ Ok(count)
+ }
+
+ fn flush(&mut self) -> io::Result<()> {
+ try!(self.write_through());
+ self.stream.flush()
+ }
+}
+
#[derive(Clone)]
-pub struct SslStream<S> {
+struct DirectStream<S> {
stream: S,
ssl: Arc<Ssl>,
- buf: Vec<u8>
+}
+
+impl DirectStream<net::TcpStream> {
+ fn try_clone(&self) -> io::Result<DirectStream<net::TcpStream>> {
+ Ok(DirectStream {
+ stream: try!(self.stream.try_clone()),
+ ssl: self.ssl.clone(),
+ })
+ }
+}
+
+impl<S> DirectStream<S> {
+ fn new_base(ssl: Ssl, stream: S, sock: c_int) -> Result<DirectStream<S>, SslError> {
+ unsafe {
+ let bio = ffi::BIO_new_socket(sock, 0);
+ if bio == ptr::null_mut() {
+ return Err(SslError::get());
+ }
+ ffi::SSL_set_bio(ssl.ssl, bio, bio);
+ }
+
+ Ok(DirectStream {
+ stream: stream,
+ ssl: Arc::new(ssl),
+ })
+ }
+
+ fn connect(ssl: Ssl, stream: S, sock: c_int) -> Result<DirectStream<S>, SslError> {
+ let ssl = try!(DirectStream::new_base(ssl, stream, sock));
+ let ret = ssl.ssl.connect();
+ if ret > 0 {
+ Ok(ssl)
+ } else {
+ Err(ssl.make_error(ret))
+ }
+ }
+
+ fn accept(ssl: Ssl, stream: S, sock: c_int) -> Result<DirectStream<S>, SslError> {
+ let ssl = try!(DirectStream::new_base(ssl, stream, sock));
+ let ret = ssl.ssl.accept();
+ if ret > 0 {
+ Ok(ssl)
+ } else {
+ Err(ssl.make_error(ret))
+ }
+ }
+
+ fn make_error(&self, ret: c_int) -> SslError {
+ match self.ssl.get_error(ret) {
+ LibSslError::ErrorSsl => SslError::get(),
+ LibSslError::ErrorSyscall => {
+ let err = SslError::get();
+ let count = match err {
+ SslError::OpenSslErrors(ref v) => v.len(),
+ _ => unreachable!(),
+ };
+ if count == 0 {
+ if ret == 0 {
+ SslError::StreamError(io::Error::new(io::ErrorKind::ConnectionAborted,
+ "unexpected EOF observed"))
+ } else {
+ SslError::StreamError(io::Error::last_os_error())
+ }
+ } else {
+ err
+ }
+ }
+ err => panic!("unexpected error {:?} with ret {}", err, ret),
+ }
+ }
+}
+
+impl<S> Read for DirectStream<S> {
+ fn read(&mut self, buf: &mut [u8]) -> io::Result<usize> {
+ let ret = self.ssl.read(buf);
+ if ret >= 0 {
+ return Ok(ret as usize);
+ }
+
+ match self.make_error(ret) {
+ SslError::StreamError(e) => Err(e),
+ e => Err(io::Error::new(io::ErrorKind::Other, e)),
+ }
+ }
+}
+
+impl<S: Write> Write for DirectStream<S> {
+ fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
+ let ret = self.ssl.write(buf);
+ if ret > 0 {
+ return Ok(ret as usize);
+ }
+
+ match self.make_error(ret) {
+ SslError::StreamError(e) => Err(e),
+ e => Err(io::Error::new(io::ErrorKind::Other, e)),
+ }
+ }
+
+ fn flush(&mut self) -> io::Result<()> {
+ self.stream.flush()
+ }
+}
+
+#[derive(Clone)]
+enum StreamKind<S> {
+ Indirect(IndirectStream<S>),
+ Direct(DirectStream<S>),
+}
+
+impl<S> StreamKind<S> {
+ fn stream(&self) -> &S {
+ match *self {
+ StreamKind::Indirect(ref s) => &s.stream,
+ StreamKind::Direct(ref s) => &s.stream,
+ }
+ }
+
+ fn mut_stream(&mut self) -> &mut S {
+ match *self {
+ StreamKind::Indirect(ref mut s) => &mut s.stream,
+ StreamKind::Direct(ref mut s) => &mut s.stream,
+ }
+ }
+
+ fn ssl(&self) -> &Ssl {
+ match *self {
+ StreamKind::Indirect(ref s) => &s.ssl,
+ StreamKind::Direct(ref s) => &s.ssl,
+ }
+ }
+}
+
+/// A stream wrapper which handles SSL encryption for an underlying stream.
+#[derive(Clone)]
+pub struct SslStream<S> {
+ kind: StreamKind<S>,
}
impl SslStream<net::TcpStream> {
/// Create a new independently owned handle to the underlying socket.
pub fn try_clone(&self) -> io::Result<SslStream<net::TcpStream>> {
+ let kind = match self.kind {
+ StreamKind::Indirect(ref s) => StreamKind::Indirect(try!(s.try_clone())),
+ StreamKind::Direct(ref s) => StreamKind::Direct(try!(s.try_clone()))
+ };
Ok(SslStream {
- stream: try!(self.stream.try_clone()),
- ssl: self.ssl.clone(),
- buf: self.buf.clone(),
+ kind: kind
})
}
}
impl<S> fmt::Debug for SslStream<S> where S: fmt::Debug {
fn fmt(&self, fmt: &mut fmt::Formatter) -> fmt::Result {
- write!(fmt, "SslStream {{ stream: {:?}, ssl: {:?} }}", self.stream, self.ssl)
+ write!(fmt, "SslStream {{ stream: {:?}, ssl: {:?} }}", self.kind.stream(), self.kind.ssl())
+ }
+}
+
+#[cfg(unix)]
+impl<S: Read+Write+::std::os::unix::io::AsRawFd> SslStream<S> {
+ /// Creates an SSL/TLS client operating over the provided stream.
+ ///
+ /// Streams passed to this method must implement `AsRawFd` on Unixy
+ /// platforms and `AsRawSocket` on Windows. Use `connect_generic` for
+ /// streams that do not.
+ pub fn connect<T: IntoSsl>(ssl: T, stream: S) -> Result<SslStream<S>, SslError> {
+ let ssl = try!(ssl.into_ssl());
+ let fd = stream.as_raw_fd() as c_int;
+ let stream = try!(DirectStream::connect(ssl, stream, fd));
+ Ok(SslStream {
+ kind: StreamKind::Direct(stream)
+ })
+ }
+
+ /// Creates an SSL/TLS server operating over the provided stream.
+ ///
+ /// Streams passed to this method must implement `AsRawFd` on Unixy
+ /// platforms and `AsRawSocket` on Windows. Use `accept_generic` for
+ /// streams that do not.
+ pub fn accept<T: IntoSsl>(ssl: T, stream: S) -> Result<SslStream<S>, SslError> {
+ let ssl = try!(ssl.into_ssl());
+ let fd = stream.as_raw_fd() as c_int;
+ let stream = try!(DirectStream::accept(ssl, stream, fd));
+ Ok(SslStream {
+ kind: StreamKind::Direct(stream)
+ })
+ }
+}
+
+#[cfg(windows)]
+impl<S: Read+Write+::std::os::windows::io::AsRawSocket> SslStream<S> {
+ /// Creates an SSL/TLS client operating over the provided stream.
+ ///
+ /// Streams passed to this method must implement `AsRawFd` on Unixy
+ /// platforms and `AsRawSocket` on Windows. Use `connect_generic` for
+ /// streams that do not.
+ pub fn connect<T: IntoSsl>(ssl: T, stream: S) -> Result<SslStream<S>, SslError> {
+ let ssl = try!(ssl.into_ssl());
+ let fd = stream.as_raw_socket() as c_int;
+ let stream = try!(DirectStream::connect(ssl, stream, fd));
+ Ok(SslStream {
+ kind: StreamKind::Direct(stream)
+ })
+ }
+
+ /// Creates an SSL/TLS server operating over the provided stream.
+ ///
+ /// Streams passed to this method must implement `AsRawFd` on Unixy
+ /// platforms and `AsRawSocket` on Windows. Use `accept_generic` for
+ /// streams that do not.
+ pub fn accept<T: IntoSsl>(ssl: T, stream: S) -> Result<SslStream<S>, SslError> {
+ let ssl = try!(ssl.into_ssl());
+ let fd = stream.as_raw_socket() as c_int;
+ let stream = try!(DirectStream::accept(ssl, stream, fd));
+ Ok(SslStream {
+ kind: StreamKind::Direct(stream)
+ })
}
}
impl<S: Read+Write> SslStream<S> {
- fn new_base(ssl:Ssl, stream: S) -> SslStream<S> {
- SslStream {
- stream: stream,
- ssl: Arc::new(ssl),
- // Maximum TLS record size is 16k
- // We're just using this as a buffer, so there's no reason to pay
- // to memset it
- buf: {
- const CAP: usize = 16 * 1024;
- let mut v = Vec::with_capacity(CAP);
- unsafe { v.set_len(CAP); }
- v
- }
- }
+ /// Creates an SSL/TLS client operating over the provided stream.
+ ///
+ /// `SslStream`s returned by this method will be less efficient than ones
+ /// returned by `connect`, so this method should only be used for streams
+ /// that do not implement `AsRawFd` and `AsRawSocket`.
+ pub fn connect_generic<T: IntoSsl>(ssl: T, stream: S) -> Result<SslStream<S>, SslError> {
+ let stream = try!(IndirectStream::connect(ssl, stream));
+ Ok(SslStream {
+ kind: StreamKind::Indirect(stream)
+ })
}
+ /// Creates an SSL/TLS server operating over the provided stream.
+ ///
+ /// `SslStream`s returned by this method will be less efficient than ones
+ /// returned by `accept`, so this method should only be used for streams
+ /// that do not implement `AsRawFd` and `AsRawSocket`.
+ pub fn accept_generic<T: IntoSsl>(ssl: T, stream: S) -> Result<SslStream<S>, SslError> {
+ let stream = try!(IndirectStream::accept(ssl, stream));
+ Ok(SslStream {
+ kind: StreamKind::Indirect(stream)
+ })
+ }
+
+ /// # Deprecated
+ pub fn new_server(ssl: &SslContext, stream: S) -> Result<SslStream<S>, SslError> {
+ SslStream::accept_generic(ssl, stream)
+ }
+
+ /// # Deprecated
pub fn new_server_from(ssl: Ssl, stream: S) -> Result<SslStream<S>, SslError> {
- let mut ssl = SslStream::new_base(ssl, stream);
- ssl.in_retry_wrapper(|ssl| { ssl.accept() }).and(Ok(ssl))
+ SslStream::accept_generic(ssl, stream)
}
- /// Attempts to create a new SSL stream from a given `Ssl` instance.
+ /// # Deprecated
pub fn new_from(ssl: Ssl, stream: S) -> Result<SslStream<S>, SslError> {
- let mut ssl = SslStream::new_base(ssl, stream);
- ssl.in_retry_wrapper(|ssl| { ssl.connect() }).and(Ok(ssl))
+ SslStream::connect_generic(ssl, stream)
}
- /// Creates a new SSL stream
+ /// # Deprecated
pub fn new(ctx: &SslContext, stream: S) -> Result<SslStream<S>, SslError> {
- let ssl = try!(Ssl::new(ctx));
- SslStream::new_from(ssl, stream)
- }
-
- /// Creates a new SSL server stream
- pub fn new_server(ctx: &SslContext, stream: S) -> Result<SslStream<S>, SslError> {
- let ssl = try!(Ssl::new(ctx));
- SslStream::new_server_from(ssl, stream)
+ SslStream::connect_generic(ctx, stream)
}
+ /// # Deprecated
#[doc(hidden)]
pub fn get_inner(&mut self) -> &mut S {
self.get_mut()
@@ -819,12 +1199,12 @@ impl<S: Read+Write> SslStream<S> {
/// Returns a reference to the underlying stream.
pub fn get_ref(&self) -> &S {
- &self.stream
+ self.kind.stream()
}
/// Return the certificate of the peer
pub fn get_peer_certificate(&self) -> Option<X509> {
- self.ssl.get_peer_certificate()
+ self.kind.ssl().get_peer_certificate()
}
/// Returns a mutable reference to the underlying stream.
@@ -832,48 +1212,16 @@ impl<S: Read+Write> SslStream<S> {
/// ## Warning
///
/// It is inadvisable to read from or write to the underlying stream as it
- /// will most likely desynchronize the SSL session.
+ /// will most likely corrupt the SSL session.
pub fn get_mut(&mut self) -> &mut S {
- &mut self.stream
- }
-
- fn in_retry_wrapper<F>(&mut self, mut blk: F)
- -> Result<c_int, SslError> where F: FnMut(&Ssl) -> c_int {
- loop {
- let ret = blk(&self.ssl);
- if ret > 0 {
- return Ok(ret);
- }
-
- let e = self.ssl.get_error(ret);
- match e {
- LibSslError::ErrorWantRead => {
- try_ssl_stream!(self.flush());
- let len = try_ssl_stream!(self.stream.read(&mut self.buf[..]));
- if len == 0 {
- self.ssl.get_rbio().set_eof(true);
- } else {
- try_ssl_stream!(self.ssl.get_rbio().write_all(&self.buf[..len]));
- }
- }
- LibSslError::ErrorWantWrite => { try_ssl_stream!(self.flush()) }
- LibSslError::ErrorZeroReturn => return Err(SslSessionClosed),
- LibSslError::ErrorSsl => return Err(SslError::get()),
- LibSslError::ErrorSyscall if ret == 0 => return Ok(0),
- err => panic!("unexpected error {:?} with ret {}", err, ret),
- }
- }
- }
-
- fn write_through(&mut self) -> io::Result<()> {
- io::copy(&mut *self.ssl.get_wbio(), &mut self.stream).map(|_| ())
+ self.kind.mut_stream()
}
/// Get the compression currently in use. The result will be
/// either None, indicating no compression is in use, or a string
/// with the compression name.
pub fn get_compression(&self) -> Option<String> {
- let ptr = unsafe { ffi::SSL_get_current_compression(self.ssl.ssl) };
+ let ptr = unsafe { ffi::SSL_get_current_compression(self.kind.ssl().ssl) };
if ptr == ptr::null() {
return None;
}
@@ -894,43 +1242,64 @@ impl<S: Read+Write> SslStream<S> {
/// This method needs the `npn` feature.
#[cfg(feature = "npn")]
pub fn get_selected_npn_protocol(&self) -> Option<&[u8]> {
- self.ssl.get_selected_npn_protocol()
+ self.kind.ssl().get_selected_npn_protocol()
+ }
+
+ /// Returns the protocol selected by performing ALPN, if any.
+ ///
+ /// The protocol's name is returned is an opaque sequence of bytes. It is up to the client
+ /// to interpret it.
+ ///
+ /// This method needs the `alpn` feature.
+ #[cfg(feature = "alpn")]
+ pub fn get_selected_alpn_protocol(&self) -> Option<&[u8]> {
+ self.kind.ssl().get_selected_alpn_protocol()
}
/// pending() takes into account only bytes from the TLS/SSL record that is currently being processed (if any).
pub fn pending(&self) -> usize {
- self.ssl.pending()
+ self.kind.ssl().pending()
}
}
impl<S: Read+Write> Read for SslStream<S> {
fn read(&mut self, buf: &mut [u8]) -> io::Result<usize> {
- match self.in_retry_wrapper(|ssl| { ssl.read(buf) }) {
- Ok(len) => Ok(len as usize),
- Err(SslSessionClosed) => Ok(0),
- Err(StreamError(e)) => Err(e),
- Err(e @ OpenSslErrors(_)) => {
- Err(io::Error::new(io::ErrorKind::Other, e))
- }
+ match self.kind {
+ StreamKind::Indirect(ref mut s) => s.read(buf),
+ StreamKind::Direct(ref mut s) => s.read(buf),
}
}
}
impl<S: Read+Write> Write for SslStream<S> {
fn write(&mut self, buf: &[u8]) -> io::Result<usize> {
- let count = match self.in_retry_wrapper(|ssl| ssl.write(buf)) {
- Ok(len) => len as usize,
- Err(SslSessionClosed) => 0,
- Err(StreamError(e)) => return Err(e),
- Err(e @ OpenSslErrors(_)) => return Err(io::Error::new(io::ErrorKind::Other, e)),
- };
- try!(self.write_through());
- Ok(count)
+ match self.kind {
+ StreamKind::Indirect(ref mut s) => s.write(buf),
+ StreamKind::Direct(ref mut s) => s.write(buf),
+ }
}
fn flush(&mut self) -> io::Result<()> {
- try!(self.write_through());
- self.stream.flush()
+ match self.kind {
+ StreamKind::Indirect(ref mut s) => s.flush(),
+ StreamKind::Direct(ref mut s) => s.flush(),
+ }
+ }
+}
+
+pub trait IntoSsl {
+ fn into_ssl(self) -> Result<Ssl, SslError>;
+}
+
+impl IntoSsl for Ssl {
+ fn into_ssl(self) -> Result<Ssl, SslError> {
+ Ok(self)
+ }
+}
+
+impl<'a> IntoSsl for &'a SslContext {
+ fn into_ssl(self) -> Result<Ssl, SslError> {
+ Ssl::new(self)
}
}