use libc::{c_int, c_void, c_long}; use std::any::TypeId; use std::collections::HashMap; use std::ffi::{CStr, CString}; use std::fmt; use std::io; use std::io::prelude::*; use std::mem; use std::net; use std::path::Path; use std::ptr; use std::sync::{Once, ONCE_INIT, Arc, Mutex}; use std::ops::{Deref, DerefMut}; use std::cmp; use std::any::Any; #[cfg(feature = "npn")] use libc::{c_uchar, c_uint}; #[cfg(feature = "npn")] use std::slice; use bio::{MemBio}; use ffi; use ssl::error::{SslError, SslSessionClosed, StreamError, OpenSslErrors}; use x509::{X509StoreContext, X509FileType, X509}; use crypto::pkey::PKey; pub mod error; #[cfg(test)] mod tests; static mut VERIFY_IDX: c_int = -1; fn init() { static mut INIT: Once = ONCE_INIT; unsafe { INIT.call_once(|| { ffi::init(); let verify_idx = ffi::SSL_CTX_get_ex_new_index(0, ptr::null(), None, None, None); assert!(verify_idx >= 0); VERIFY_IDX = verify_idx; }); } } bitflags! { flags SslContextOptions: c_long { const SSL_OP_LEGACY_SERVER_CONNECT = 0x00000004, const SSL_OP_NETSCAPE_REUSE_CIPHER_CHANGE_BUG = 0x00000008, const SSL_OP_TLSEXT_PADDING = 0x00000010, const SSL_OP_MICROSOFT_BIG_SSLV3_BUFFER = 0x00000020, const SSL_OP_SAFARI_ECDHE_ECDSA_BUG = 0x00000040, const SSL_OP_SSLEAY_080_CLIENT_DH_BUG = 0x00000080, const SSL_OP_TLS_D5_BUG = 0x00000100, const SSL_OP_TLS_BLOCK_PADDING_BUG = 0x00000200, const SSL_OP_DONT_INSERT_EMPTY_FRAGMENTS = 0x00000800, const SSL_OP_ALL = 0x80000BFF, const SSL_OP_NO_QUERY_MTU = 0x00001000, const SSL_OP_COOKIE_EXCHANGE = 0x00002000, const SSL_OP_NO_TICKET = 0x00004000, const SSL_OP_CISCO_ANYCONNECT = 0x00008000, const SSL_OP_NO_SESSION_RESUMPTION_ON_RENEGOTIATION = 0x00010000, const SSL_OP_NO_COMPRESSION = 0x00020000, const SSL_OP_ALLOW_UNSAFE_LEGACY_RENEGOTIATION = 0x00040000, const SSL_OP_SINGLE_ECDH_USE = 0x00080000, const SSL_OP_SINGLE_DH_USE = 0x00100000, const SSL_OP_CIPHER_SERVER_PREFERENCE = 0x00400000, const SSL_OP_TLS_ROLLBACK_BUG = 0x00800000, const SSL_OP_NO_SSLV2 = 0x00000000, const SSL_OP_NO_SSLV3 = 0x02000000, const SSL_OP_NO_TLSV1 = 0x04000000, const SSL_OP_NO_TLSV1_2 = 0x08000000, const SSL_OP_NO_TLSV1_1 = 0x10000000, const SSL_OP_NO_DTLSV1 = 0x04000000, const SSL_OP_NO_DTLSV1_2 = 0x08000000 } } /// Determines the SSL method supported #[allow(non_camel_case_types)] #[derive(Copy, Clone, Debug, Hash, PartialEq, Eq)] pub enum SslMethod { #[cfg(feature = "sslv2")] /// Only support the SSLv2 protocol, requires the `sslv2` feature. Sslv2, /// Support the SSLv2, SSLv3 and TLSv1 protocols. Sslv23, /// Only support the SSLv3 protocol. Sslv3, /// Only support the TLSv1 protocol. Tlsv1, #[cfg(feature = "tlsv1_1")] /// Support TLSv1.1 protocol, requires the `tlsv1_1` feature. Tlsv1_1, #[cfg(feature = "tlsv1_2")] /// Support TLSv1.2 protocol, requires the `tlsv1_2` feature. Tlsv1_2, #[cfg(feature = "dtlsv1")] /// Support DTLSv1 protocol, requires the `dtlsv1` feature. Dtlsv1, #[cfg(feature = "dtlsv1_2")] /// Support DTLSv1.2 protocol, requires the `dtlsv1_2` feature. Dtlsv1_2, } impl SslMethod { unsafe fn to_raw(&self) -> *const ffi::SSL_METHOD { match *self { #[cfg(feature = "sslv2")] SslMethod::Sslv2 => ffi::SSLv2_method(), SslMethod::Sslv3 => ffi::SSLv3_method(), SslMethod::Tlsv1 => ffi::TLSv1_method(), SslMethod::Sslv23 => ffi::SSLv23_method(), #[cfg(feature = "tlsv1_1")] SslMethod::Tlsv1_1 => ffi::TLSv1_1_method(), #[cfg(feature = "tlsv1_2")] SslMethod::Tlsv1_2 => ffi::TLSv1_2_method(), #[cfg(feature = "dtlsv1")] SslMethod::Dtlsv1 => ffi::DTLSv1_method(), #[cfg(feature = "dtlsv1_2")] SslMethod::Dtlsv1_2 => ffi::DTLSv1_2_method(), } } #[cfg(feature = "dtlsv1")] pub fn is_dtlsv1(&self) -> bool { *self == SslMethod::Dtlsv1 } #[cfg(feature = "dtlsv1_2")] pub fn is_dtlsv1_2(&self) -> bool { *self == SslMethod::Dtlsv1_2 } pub fn is_dtls(&self) -> bool { self.is_dtlsv1() || self.is_dtlsv1_2() } #[cfg(not(feature = "dtlsv1"))] pub fn is_dtlsv1(&self) -> bool { false } #[cfg(not(feature = "dtlsv1_2"))] pub fn is_dtlsv1_2(&self) -> bool { false } } /// Determines the type of certificate verification used bitflags! { flags SslVerifyMode: i32 { /// Verify that the server's certificate is trusted const SSL_VERIFY_PEER = ffi::SSL_VERIFY_PEER, /// Do not verify the server's certificate const SSL_VERIFY_NONE = ffi::SSL_VERIFY_NONE, /// Terminate handshake if client did not return a certificate. /// Use together with SSL_VERIFY_PEER. const SSL_VERIFY_FAIL_IF_NO_PEER_CERT = ffi::SSL_VERIFY_FAIL_IF_NO_PEER_CERT, } } lazy_static! { static ref INDEXES: Mutex> = Mutex::new(HashMap::new()); } // Creates a static index for user data of type T // Registers a destructor for the data which will be called // when context is freed fn get_verify_data_idx() -> c_int { extern fn free_data_box(_parent: *mut c_void, ptr: *mut c_void, _ad: *mut ffi::CRYPTO_EX_DATA, _idx: c_int, _argl: c_long, _argp: *mut c_void) { if ptr != 0 as *mut _ { let _: Box = unsafe { mem::transmute(ptr) }; } } *INDEXES.lock().unwrap().entry(TypeId::of::()).or_insert_with(|| { unsafe { let f: ffi::CRYPTO_EX_free = free_data_box::; let idx = ffi::SSL_CTX_get_ex_new_index(0, ptr::null(), None, None, Some(f)); assert!(idx >= 0); idx } }) } /// Creates a static index for the list of NPN protocols. /// Registers a destructor for the data which will be called /// when the context is freed. #[cfg(feature = "npn")] fn get_npn_protos_idx() -> c_int { static mut NPN_PROTOS_IDX: c_int = -1; static mut INIT: Once = ONCE_INIT; extern fn free_data_box(_parent: *mut c_void, ptr: *mut c_void, _ad: *mut ffi::CRYPTO_EX_DATA, _idx: c_int, _argl: c_long, _argp: *mut c_void) { if !ptr.is_null() { let _: Box> = unsafe { mem::transmute(ptr) }; } } unsafe { INIT.call_once(|| { let f: ffi::CRYPTO_EX_free = free_data_box; let idx = ffi::SSL_CTX_get_ex_new_index(0, ptr::null(), None, None, Some(f)); assert!(idx >= 0); NPN_PROTOS_IDX = idx; }); NPN_PROTOS_IDX } } extern fn raw_verify(preverify_ok: c_int, x509_ctx: *mut ffi::X509_STORE_CTX) -> c_int { unsafe { let idx = ffi::SSL_get_ex_data_X509_STORE_CTX_idx(); let ssl = ffi::X509_STORE_CTX_get_ex_data(x509_ctx, idx); let ssl_ctx = ffi::SSL_get_SSL_CTX(ssl); let verify = ffi::SSL_CTX_get_ex_data(ssl_ctx, VERIFY_IDX); let verify: Option = mem::transmute(verify); let ctx = X509StoreContext::new(x509_ctx); match verify { None => preverify_ok, Some(verify) => verify(preverify_ok != 0, &ctx) as c_int } } } extern fn raw_verify_with_data(preverify_ok: c_int, x509_ctx: *mut ffi::X509_STORE_CTX) -> c_int where T: Any + 'static { unsafe { let idx = ffi::SSL_get_ex_data_X509_STORE_CTX_idx(); let ssl = ffi::X509_STORE_CTX_get_ex_data(x509_ctx, idx); let ssl_ctx = ffi::SSL_get_SSL_CTX(ssl); let verify = ffi::SSL_CTX_get_ex_data(ssl_ctx, VERIFY_IDX); let verify: Option> = mem::transmute(verify); let data = ffi::SSL_CTX_get_ex_data(ssl_ctx, get_verify_data_idx::()); let data: Box = mem::transmute(data); let ctx = X509StoreContext::new(x509_ctx); let res = match verify { None => preverify_ok, Some(verify) => verify(preverify_ok != 0, &ctx, &*data) as c_int }; // Since data might be required on the next verification // it is time to forget about it and avoid dropping // data will be freed once OpenSSL considers it is time // to free all context data mem::forget(data); res } } /// The function is given as the callback to `SSL_CTX_set_next_proto_select_cb`. /// /// It chooses the protocol that the client wishes to use, out of the given list of protocols /// supported by the server. It achieves this by delegating to the `SSL_select_next_proto` /// function. The list of protocols supported by the client is found in the extra data of the /// OpenSSL context. #[cfg(feature = "npn")] extern fn raw_next_proto_select_cb(ssl: *mut ffi::SSL, out: *mut *mut c_uchar, outlen: *mut c_uchar, inbuf: *const c_uchar, inlen: c_uint, _arg: *mut c_void) -> c_int { unsafe { // First, get the list of protocols (that the client should support) saved in the context // extra data. let ssl_ctx = ffi::SSL_get_SSL_CTX(ssl); let protocols = ffi::SSL_CTX_get_ex_data(ssl_ctx, get_npn_protos_idx()); let protocols: &Vec = mem::transmute(protocols); // Prepare the client list parameters to be passed to the OpenSSL function... let client = protocols.as_ptr(); let client_len = protocols.len() as c_uint; // Finally, let OpenSSL find a protocol to be used, by matching the given server and // client lists. ffi::SSL_select_next_proto(out, outlen, inbuf, inlen, client, client_len); } ffi::SSL_TLSEXT_ERR_OK } /// The function is given as the callback to `SSL_CTX_set_next_protos_advertised_cb`. /// /// It causes the parameter `out` to point at a `*const c_uchar` instance that /// represents the list of protocols that the server should advertise as those /// that it supports. /// The list of supported protocols is found in the extra data of the OpenSSL /// context. #[cfg(feature = "npn")] extern fn raw_next_protos_advertise_cb(ssl: *mut ffi::SSL, out: *mut *const c_uchar, outlen: *mut c_uint, _arg: *mut c_void) -> c_int { unsafe { // First, get the list of (supported) protocols saved in the context extra data. let ssl_ctx = ffi::SSL_get_SSL_CTX(ssl); let protocols = ffi::SSL_CTX_get_ex_data(ssl_ctx, get_npn_protos_idx()); if protocols.is_null() { *out = b"".as_ptr(); *outlen = 0; } else { // If the pointer is valid, put the pointer to the actual byte array into the // output parameter `out`, as well as its length into `outlen`. let protocols: &Vec = mem::transmute(protocols); *out = protocols.as_ptr(); *outlen = protocols.len() as c_uint; } } ffi::SSL_TLSEXT_ERR_OK } /// The signature of functions that can be used to manually verify certificates pub type VerifyCallback = fn(preverify_ok: bool, x509_ctx: &X509StoreContext) -> bool; /// The signature of functions that can be used to manually verify certificates /// when user-data should be carried for all verification process pub type VerifyCallbackData = fn(preverify_ok: bool, x509_ctx: &X509StoreContext, data: &T) -> bool; // FIXME: macro may be instead of inlining? #[inline] fn wrap_ssl_result(res: c_int) -> Result<(),SslError> { if res == 0 { Err(SslError::get()) } else { Ok(()) } } /// An SSL context object pub struct SslContext { ctx: *mut ffi::SSL_CTX } unsafe impl Send for SslContext {} unsafe impl Sync for SslContext {} // TODO: add useful info here impl fmt::Debug for SslContext { fn fmt(&self, fmt: &mut fmt::Formatter) -> fmt::Result { write!(fmt, "SslContext") } } impl Drop for SslContext { fn drop(&mut self) { unsafe { ffi::SSL_CTX_free(self.ctx) } } } impl SslContext { /// Creates a new SSL context. pub fn new(method: SslMethod) -> Result { init(); let ctx = unsafe { ffi::SSL_CTX_new(method.to_raw()) }; if ctx == ptr::null_mut() { return Err(SslError::get()); } let ctx = SslContext { ctx: ctx }; if method.is_dtls() { ctx.set_read_ahead(1); } Ok(ctx) } /// Configures the certificate verification method for new connections. pub fn set_verify(&mut self, mode: SslVerifyMode, verify: Option) { unsafe { ffi::SSL_CTX_set_ex_data(self.ctx, VERIFY_IDX, mem::transmute(verify)); let f: extern fn(c_int, *mut ffi::X509_STORE_CTX) -> c_int = raw_verify; ffi::SSL_CTX_set_verify(self.ctx, mode.bits as c_int, Some(f)); } } /// Configures the certificate verification method for new connections also /// carrying supplied data. // Note: no option because there is no point to set data without providing // a function handling it pub fn set_verify_with_data(&mut self, mode: SslVerifyMode, verify: VerifyCallbackData, data: T) where T: Any + 'static { let data = Box::new(data); unsafe { ffi::SSL_CTX_set_ex_data(self.ctx, VERIFY_IDX, mem::transmute(Some(verify))); ffi::SSL_CTX_set_ex_data(self.ctx, get_verify_data_idx::(), mem::transmute(data)); let f: extern fn(c_int, *mut ffi::X509_STORE_CTX) -> c_int = raw_verify_with_data::; ffi::SSL_CTX_set_verify(self.ctx, mode.bits as c_int, Some(f)); } } /// Sets verification depth pub fn set_verify_depth(&mut self, depth: u32) { unsafe { ffi::SSL_CTX_set_verify_depth(self.ctx, depth as c_int); } } pub fn set_read_ahead(&self, m: u32) { unsafe { ffi::SSL_CTX_set_read_ahead(self.ctx, m as c_long); } } #[allow(non_snake_case)] /// Specifies the file that contains trusted CA certificates. pub fn set_CA_file(&mut self, file: &Path) -> Result<(),SslError> { let file = CString::new(file.as_os_str().to_str().expect("invalid utf8")).unwrap(); wrap_ssl_result( unsafe { ffi::SSL_CTX_load_verify_locations(self.ctx, file.as_ptr(), ptr::null()) }) } /// Specifies the file that contains certificate pub fn set_certificate_file(&mut self, file: &Path, file_type: X509FileType) -> Result<(),SslError> { let file = CString::new(file.as_os_str().to_str().expect("invalid utf8")).unwrap(); wrap_ssl_result( unsafe { ffi::SSL_CTX_use_certificate_file(self.ctx, file.as_ptr(), file_type as c_int) }) } /// Specifies the certificate pub fn set_certificate(&mut self, cert: &X509) -> Result<(),SslError> { wrap_ssl_result( unsafe { ffi::SSL_CTX_use_certificate(self.ctx, cert.get_handle()) }) } /// Adds a certificate to the certificate chain presented together with the /// certificate specified using set_certificate() pub fn add_extra_chain_cert(&mut self, cert: &X509) -> Result<(),SslError> { wrap_ssl_result( unsafe { ffi::SSL_CTX_add_extra_chain_cert(self.ctx, cert.get_handle()) as c_int }) } /// Specifies the file that contains private key pub fn set_private_key_file(&mut self, file: &Path, file_type: X509FileType) -> Result<(),SslError> { let file = CString::new(file.as_os_str().to_str().expect("invalid utf8")).unwrap(); wrap_ssl_result( unsafe { ffi::SSL_CTX_use_PrivateKey_file(self.ctx, file.as_ptr(), file_type as c_int) }) } /// Specifies the private key pub fn set_private_key(&mut self, key: &PKey) -> Result<(),SslError> { wrap_ssl_result( unsafe { ffi::SSL_CTX_use_PrivateKey(self.ctx, key.get_handle()) }) } /// Check consistency of private key and certificate pub fn check_private_key(&mut self) -> Result<(),SslError> { wrap_ssl_result( unsafe { ffi::SSL_CTX_check_private_key(self.ctx) }) } pub fn set_cipher_list(&mut self, cipher_list: &str) -> Result<(),SslError> { wrap_ssl_result( unsafe { let cipher_list = CString::new(cipher_list.as_bytes()).unwrap(); ffi::SSL_CTX_set_cipher_list(self.ctx, cipher_list.as_ptr()) }) } pub fn set_options(&mut self, option: SslContextOptions) -> SslContextOptions { let raw_bits = option.bits(); let ret = unsafe { ffi::SSL_CTX_set_options(self.ctx, raw_bits) }; SslContextOptions::from_bits(ret).unwrap() } pub fn get_options(&mut self) -> SslContextOptions { let ret = unsafe { ffi::SSL_CTX_get_options(self.ctx) }; SslContextOptions::from_bits(ret).unwrap() } pub fn clear_options(&mut self, option: SslContextOptions) -> SslContextOptions { let raw_bits = option.bits(); let ret = unsafe { ffi::SSL_CTX_clear_options(self.ctx, raw_bits) }; SslContextOptions::from_bits(ret).unwrap() } /// Set the protocols to be used during Next Protocol Negotiation (the protocols /// supported by the application). /// /// This method needs the `npn` feature. #[cfg(feature = "npn")] pub fn set_npn_protocols(&mut self, protocols: &[&[u8]]) { // Firstly, convert the list of protocols to a byte-array that can be passed to OpenSSL // APIs -- a list of length-prefixed strings. let mut npn_protocols = Vec::new(); for protocol in protocols { let len = protocol.len() as u8; npn_protocols.push(len); // If the length is greater than the max `u8`, this truncates the protocol name. npn_protocols.extend(protocol[..len as usize].to_vec()); } let protocols: Box> = Box::new(npn_protocols); unsafe { // Attach the protocol list to the OpenSSL context structure, // so that we can refer to it within the callback. ffi::SSL_CTX_set_ex_data(self.ctx, get_npn_protos_idx(), mem::transmute(protocols)); // Now register the callback that performs the default protocol // matching based on the client-supported list of protocols that // has been saved. ffi::SSL_CTX_set_next_proto_select_cb(self.ctx, raw_next_proto_select_cb, ptr::null_mut()); // Also register the callback to advertise these protocols, if a server socket is // created with the context. ffi::SSL_CTX_set_next_protos_advertised_cb(self.ctx, raw_next_protos_advertise_cb, ptr::null_mut()); } } } #[allow(dead_code)] struct MemBioRef<'ssl> { ssl: &'ssl Ssl, bio: MemBio, } impl<'ssl> Deref for MemBioRef<'ssl> { type Target = MemBio; fn deref(&self) -> &MemBio { &self.bio } } impl<'ssl> DerefMut for MemBioRef<'ssl> { fn deref_mut(&mut self) -> &mut MemBio { &mut self.bio } } pub struct Ssl { ssl: *mut ffi::SSL } unsafe impl Send for Ssl {} unsafe impl Sync for Ssl {} // TODO: put useful information here impl fmt::Debug for Ssl { fn fmt(&self, fmt: &mut fmt::Formatter) -> fmt::Result { write!(fmt, "Ssl") } } impl Drop for Ssl { fn drop(&mut self) { unsafe { ffi::SSL_free(self.ssl) } } } impl Ssl { pub fn new(ctx: &SslContext) -> Result { let ssl = unsafe { ffi::SSL_new(ctx.ctx) }; if ssl == ptr::null_mut() { return Err(SslError::get()); } let ssl = Ssl { ssl: ssl }; let rbio = try!(MemBio::new()); let wbio = try!(MemBio::new()); unsafe { ffi::SSL_set_bio(ssl.ssl, rbio.unwrap(), wbio.unwrap()) } Ok(ssl) } fn get_rbio<'a>(&'a self) -> MemBioRef<'a> { unsafe { self.wrap_bio(ffi::SSL_get_rbio(self.ssl)) } } fn get_wbio<'a>(&'a self) -> MemBioRef<'a> { unsafe { self.wrap_bio(ffi::SSL_get_wbio(self.ssl)) } } fn wrap_bio<'a>(&'a self, bio: *mut ffi::BIO) -> MemBioRef<'a> { assert!(bio != ptr::null_mut()); MemBioRef { ssl: self, bio: MemBio::borrowed(bio) } } fn connect(&self) -> c_int { unsafe { ffi::SSL_connect(self.ssl) } } fn accept(&self) -> c_int { unsafe { ffi::SSL_accept(self.ssl) } } fn read(&self, buf: &mut [u8]) -> c_int { let len = cmp::min(c_int::max_value() as usize, buf.len()) as c_int; unsafe { ffi::SSL_read(self.ssl, buf.as_ptr() as *mut c_void, len) } } fn write(&self, buf: &[u8]) -> c_int { let len = cmp::min(c_int::max_value() as usize, buf.len()) as c_int; unsafe { ffi::SSL_write(self.ssl, buf.as_ptr() as *const c_void, len) } } fn get_error(&self, ret: c_int) -> LibSslError { let err = unsafe { ffi::SSL_get_error(self.ssl, ret) }; match LibSslError::from_i32(err as i32) { Some(err) => err, None => unreachable!() } } /// Set the host name to be used with SNI (Server Name Indication). pub fn set_hostname(&self, hostname: &str) -> Result<(), SslError> { let ret = unsafe { // This is defined as a macro: // #define SSL_set_tlsext_host_name(s,name) \ // SSL_ctrl(s,SSL_CTRL_SET_TLSEXT_HOSTNAME,TLSEXT_NAMETYPE_host_name,(char *)name) let hostname = CString::new(hostname.as_bytes()).unwrap(); ffi::SSL_ctrl(self.ssl, ffi::SSL_CTRL_SET_TLSEXT_HOSTNAME, ffi::TLSEXT_NAMETYPE_host_name, hostname.as_ptr() as *mut c_void) }; // For this case, 0 indicates failure. if ret == 0 { Err(SslError::get()) } else { Ok(()) } } pub fn get_peer_certificate(&self) -> Option { unsafe { let ptr = ffi::SSL_get_peer_certificate(self.ssl); if ptr.is_null() { None } else { Some(X509::new(ptr, true)) } } } /// Returns the protocol selected by performing Next Protocol Negotiation, if any. /// /// The protocol's name is returned is an opaque sequence of bytes. It is up to the client /// to interpret it. /// /// This method needs the `npn` feature. #[cfg(feature = "npn")] pub fn get_selected_npn_protocol(&self) -> Option<&[u8]> { unsafe { let mut data: *const c_uchar = ptr::null(); let mut len: c_uint = 0; // Get the negotiated protocol from the SSL instance. // `data` will point at a `c_uchar` array; `len` will contain the length of this array. ffi::SSL_get0_next_proto_negotiated(self.ssl, &mut data, &mut len); if data.is_null() { None } else { Some(slice::from_raw_parts(data, len as usize)) } } } } macro_rules! make_LibSslError { ($($variant:ident = $value:ident),+) => { #[derive(Debug)] #[repr(i32)] enum LibSslError { $($variant = ffi::$value),+ } impl LibSslError { fn from_i32(val: i32) -> Option { match val { $(ffi::$value => Some(LibSslError::$variant),)+ _ => None } } } } } make_LibSslError! { ErrorNone = SSL_ERROR_NONE, ErrorSsl = SSL_ERROR_SSL, ErrorWantRead = SSL_ERROR_WANT_READ, ErrorWantWrite = SSL_ERROR_WANT_WRITE, ErrorWantX509Lookup = SSL_ERROR_WANT_X509_LOOKUP, ErrorSyscall = SSL_ERROR_SYSCALL, ErrorZeroReturn = SSL_ERROR_ZERO_RETURN, ErrorWantConnect = SSL_ERROR_WANT_CONNECT, ErrorWantAccept = SSL_ERROR_WANT_ACCEPT } /// A stream wrapper which handles SSL encryption for an underlying stream. #[derive(Clone)] pub struct SslStream { stream: S, ssl: Arc, buf: Vec } impl SslStream { /// Create a new independently owned handle to the underlying socket. pub fn try_clone(&self) -> io::Result> { Ok(SslStream { stream: try!(self.stream.try_clone()), ssl: self.ssl.clone(), buf: self.buf.clone(), }) } } impl fmt::Debug for SslStream where S: fmt::Debug { fn fmt(&self, fmt: &mut fmt::Formatter) -> fmt::Result { write!(fmt, "SslStream {{ stream: {:?}, ssl: {:?} }}", self.stream, self.ssl) } } impl SslStream { fn new_base(ssl:Ssl, stream: S) -> SslStream { SslStream { stream: stream, ssl: Arc::new(ssl), // Maximum TLS record size is 16k // We're just using this as a buffer, so there's no reason to pay // to memset it buf: { const CAP: usize = 16 * 1024; let mut v = Vec::with_capacity(CAP); unsafe { v.set_len(CAP); } v } } } pub fn new_server_from(ssl: Ssl, stream: S) -> Result, SslError> { let mut ssl = SslStream::new_base(ssl, stream); ssl.in_retry_wrapper(|ssl| { ssl.accept() }).and(Ok(ssl)) } /// Attempts to create a new SSL stream from a given `Ssl` instance. pub fn new_from(ssl: Ssl, stream: S) -> Result, SslError> { let mut ssl = SslStream::new_base(ssl, stream); ssl.in_retry_wrapper(|ssl| { ssl.connect() }).and(Ok(ssl)) } /// Creates a new SSL stream pub fn new(ctx: &SslContext, stream: S) -> Result, SslError> { let ssl = try!(Ssl::new(ctx)); SslStream::new_from(ssl, stream) } /// Creates a new SSL server stream pub fn new_server(ctx: &SslContext, stream: S) -> Result, SslError> { let ssl = try!(Ssl::new(ctx)); SslStream::new_server_from(ssl, stream) } /// Returns a mutable reference to the underlying stream. /// /// ## Warning /// /// `read`ing or `write`ing directly to the underlying stream will most /// likely desynchronize the SSL session. #[deprecated="use get_mut instead"] pub fn get_inner(&mut self) -> &mut S { self.get_mut() } /// Returns a reference to the underlying stream. pub fn get_ref(&self) -> &S { &self.stream } /// Returns a mutable reference to the underlying stream. /// /// ## Warning /// /// It is inadvisable to read from or write to the underlying stream as it /// will most likely desynchronize the SSL session. pub fn get_mut(&mut self) -> &mut S { &mut self.stream } fn in_retry_wrapper(&mut self, mut blk: F) -> Result where F: FnMut(&Ssl) -> c_int { loop { let ret = blk(&self.ssl); if ret > 0 { return Ok(ret); } let e = self.ssl.get_error(ret); match e { LibSslError::ErrorWantRead => { try_ssl_stream!(self.flush()); let len = try_ssl_stream!(self.stream.read(&mut self.buf[..])); if len == 0 { return Ok(0); } try_ssl_stream!(self.ssl.get_rbio().write_all(&self.buf[..len])); } LibSslError::ErrorWantWrite => { try_ssl_stream!(self.flush()) } LibSslError::ErrorZeroReturn => return Err(SslSessionClosed), LibSslError::ErrorSsl => return Err(SslError::get()), err => panic!("unexpected error {:?}", err), } } } fn write_through(&mut self) -> io::Result<()> { io::copy(&mut *self.ssl.get_wbio(), &mut self.stream).map(|_| ()) } /// Get the compression currently in use. The result will be /// either None, indicating no compression is in use, or a string /// with the compression name. pub fn get_compression(&self) -> Option { let ptr = unsafe { ffi::SSL_get_current_compression(self.ssl.ssl) }; if ptr == ptr::null() { return None; } let meth = unsafe { ffi::SSL_COMP_get_name(ptr) }; let s = unsafe { String::from_utf8(CStr::from_ptr(meth).to_bytes().to_vec()).unwrap() }; Some(s) } /// Returns the protocol selected by performing Next Protocol Negotiation, if any. /// /// The protocol's name is returned is an opaque sequence of bytes. It is up to the client /// to interpret it. /// /// This method needs the `npn` feature. #[cfg(feature = "npn")] pub fn get_selected_npn_protocol(&self) -> Option<&[u8]> { self.ssl.get_selected_npn_protocol() } } impl Read for SslStream { fn read(&mut self, buf: &mut [u8]) -> io::Result { match self.in_retry_wrapper(|ssl| { ssl.read(buf) }) { Ok(len) => Ok(len as usize), Err(SslSessionClosed) => Ok(0), Err(StreamError(e)) => Err(e), Err(e @ OpenSslErrors(_)) => { Err(io::Error::new(io::ErrorKind::Other, e)) } } } } impl Write for SslStream { fn write(&mut self, buf: &[u8]) -> io::Result { match self.in_retry_wrapper(|ssl| ssl.write(buf)) { Ok(len) => Ok(len as usize), Err(SslSessionClosed) => Ok(0), Err(StreamError(e)) => return Err(e), Err(e @ OpenSslErrors(_)) => { Err(io::Error::new(io::ErrorKind::Other, e)) } } } fn flush(&mut self) -> io::Result<()> { try!(self.write_through()); self.stream.flush() } } /// A utility type to help in cases where the use of SSL is decided at runtime. #[derive(Debug)] pub enum MaybeSslStream where S: Read+Write { /// A connection using SSL Ssl(SslStream), /// A connection not using SSL Normal(S), } impl Read for MaybeSslStream where S: Read+Write { fn read(&mut self, buf: &mut [u8]) -> io::Result { match *self { MaybeSslStream::Ssl(ref mut s) => s.read(buf), MaybeSslStream::Normal(ref mut s) => s.read(buf), } } } impl Write for MaybeSslStream where S: Read+Write { fn write(&mut self, buf: &[u8]) -> io::Result { match *self { MaybeSslStream::Ssl(ref mut s) => s.write(buf), MaybeSslStream::Normal(ref mut s) => s.write(buf), } } fn flush(&mut self) -> io::Result<()> { match *self { MaybeSslStream::Ssl(ref mut s) => s.flush(), MaybeSslStream::Normal(ref mut s) => s.flush(), } } } impl MaybeSslStream where S: Read+Write { /// Returns a reference to the underlying stream. pub fn get_ref(&self) -> &S { match *self { MaybeSslStream::Ssl(ref s) => s.get_ref(), MaybeSslStream::Normal(ref s) => s, } } /// Returns a mutable reference to the underlying stream. /// /// ## Warning /// /// It is inadvisable to read from or write to the underlying stream. pub fn get_mut(&mut self) -> &mut S { match *self { MaybeSslStream::Ssl(ref mut s) => s.get_mut(), MaybeSslStream::Normal(ref mut s) => s, } } }